Nyitólap  >  Tudástár  >  Orvosi szótár
Bezárás(X) Elküldöm egy ismerősömnek

Orvosi szótár

További címzett megadása

 

A találatok száma meghaladja az ezret, kérem szűkítse a keresést!

Orvosi szótár címszavak

A
1. adenin; alanin 2. Indexként használva alveoláris gázra utal. 3. az abszorbencia szimbóluma 4. A polinukleotidokban az denozinnak, vagy az adenilsavnak a jelzése, a polipeptidekben az alanint jelöli, a multiszubsztrát enzim által katalizált reakciókban az első szubsztrátot jelzi.
A
abszorbencia
a
1. Ante, area, asszimmetrikus, auris fogalmak rövítése 2. atto szimbóluma (10-18) 3. Indexként használva a szisztémás artériás vérre utal.
A -
anion
a-, an-
(gör) Nem, nélkül jelentésű; fosztóképző. Megegyezik a latin in-, un-nal.
A-mód
A diagnosztikai ultrahangban egy dimenziós megjelenítése a visszavert hanghullámoknak, amelyben a visszhang amplitúdója (A) a vertikális tengelyen, míg a visszaverődés ideje (mélység) a horizontális tengelyen képződik le. Vagyis az echo információk a felületek sorrendjét mutatják egy vonal mentén, amerre a hangot irányítjuk.
A.S.
auris sinistra, bal fül
AA, aa
aminosav; aminoacil
AASH
(ang) adrenal androgen-stimulating hormone = mellékvese eredetű androgén stimuláló hormon
Ab
(ang) antibody = antitest
ab-, abs-
1. (lat) -tól, -től, eltérő 2. Név elé tett képző a CGS elektromágneses rendszerben az elektromos egységek előtt, megkülönböztetve ezeket a CGS elektrosztatikus rendszer egységeitől (ahol a prefixum stat), valamint a metrikus, vagy SI rendszer egységeitől (ahol nincsen prefixum).
abamper
Elektromágneses egység, amelyben az áram 10 abszolút amperrel azonos; olyan áram, amely 2gx10-5 newton erőt fejt ki egységnyi mágneses póluson 1 cm-es sugarú vezeték körének központjában.
abapicalis
apextől távol eső
abarognosis
Súlyérzékelés, illetve a különböző súlyú tárgyak közötti különbségtétel képességének hiánya. Ha a primer érzékek megtartottak, az abarognosis-t az ellenoldali parietalis lebenyben lévő laesio okozza. (gör: a-, fosztóképző + baros, súly, + gnosis, ismeret)
abasia
ld. járásképtelenség (gör: a-, fosztóképző + basis, lépés)
Találatok Magyarázat
abasia atactica járásnehézség a lábak ataxiája következtében
abasia choreica a lábak choreiform mozgása miatti járási nehézség
abasia spastica Az izmok spasticus kontrakciója következtében a járás megkísérlése nehezített.
abasia trepidans lábszár remegése miatt nehezített járás
abasia astasia hisztériás járási és állási képtelenség; ld. astasia abasia
abasicus
abasiában szenvedő, abasiával kapcsolatos.
abaxialis
1. Tengelyen kívül fekvő, vonatkozhat a testre, vagy annak bármely részére. 2. egy rész tengelyének végpontjával ellentétes irányban lévő
abdomen
A törzs azon része, amely a thorax (mellkas) és a pelvis (medence) között található. Az abdomen több anatómus szerint magában foglalja a pelvist is (abdominopelvis). Maga az abdomen a cavum abdominis nagyobb részét jelenti, és önkényesen kilenc régióra osztható. Ld. abdominalis régiók. Szinonima: venter (Latin abdomen, etimológiája bizonytalan).
Találatok Magyarázat
akut abdomen Súlyos intraabdominalis állapot kialakulása (pl. appendicitis), amelyet jellemez a fájdalom, az érzékenység, az izomrigiditás, és amely esetén sürgősségi műtét végzendő. Szinonima: sebészi has, akut has.
abdomen carinatus Olyan csónak alakú has, amely a középvonalban kiemelkedik és oldalra lejt.
navicularis abdomen szinonima: scaphoid, sajka alakú
protuberant abdomen Szokatlan, vagy erős mértékű konvexitás, amelyet hatalmas mennyiségben felgyűlt subcutan zsírszövet, az izomtónus gyengesége, vagy az intraabdominalis tartalom megnövekedése okoz.
scaphoid abdomen Olyan has, amelyben az elülső hasfal besüppedt és inkább konkáv kontúrt mutat. Szinonima: navicularis abdomen
abdominalis
hasi, hasra vonatkozó
abdomino-, abdomin-
has-, hasi (lat. abdomen, abdominis)
abdominocentesis
has paracentesise, szúrcsapolása
abdominocyesis
1. szinonima: abdominalis terhesség 2. szinonima: szekunder abdominalis terhesség (abdomino+gör: cyesis, terhesség)
abdominocysticus
szinonima: abdominovesicalis (abdomino+gör: cystis, hólyag)
abdominogenitalis
hasat és a genitalis szerveket illető
abdominohysterectomia
szinonima: abdominalis hysterectomia, hasi behatolással végzett méhkivétel
abdominohysterotomia
szinonima: abdominalis hysterotomia, a méh hasi metszéssel történő megnyitása
abdominopelvicus
hasat és medencét illető, főként a has- és medenceüregre vonatkozó
abdominoperinealis
mind a hasüregre, mind a gátra vonatkozó
abdominoplastica
Műtét, amelyet a hasfalon esztétikai ok miatt végeznek (abdomino + gör: plastos, alakított)
abdominoscrotalis
hasat és herezacskót illető
abdominoszkópia
szinonima: peritoneoszkópia, laparoszkópia (abdomino +gör: skopeo= megvizsgálni)
abdominothoracicus
mind a hasra, mind a mellkasra vonatkozó
abdominovaginalis
mind a hasra, mind a hüvelyre vonatkozó
abdominovesicalis
mind a hasra, mind pedig a húgyhólyagra vonatkozó, vagy a hasra és az epehólyagra vonatkozó, szinonima: abdominocysticus
abducens
test, vagy valamely testrész középvonalától lateralis irányba elmozdító (lat: eltávolító)
Találatok Magyarázat
abducens oculi szinonima: musculus rectus lateralis szemizom (ld. függelék)
nervus abducens szinonima: VI. agyideg (ld. függelék)
abductio
1. a test valamely részének elmozdítása kifelé a medián síktól, de ez érvényes a lábra, a kézre, az ujjakra is. 2. a szem monocularis rotatioja a halánték irányába. 3. Ezen mozgás(ok) eredménye; ellentéte az adductio. (lat: távolítás)
abductor
Annak az izomnak az elnevezése, amely a test, vagy valamely testrész középvonalától oldalra, a kéz esetében a középső ujj által képzett tengelytől lateral felé történő, vagy a lábon a második lábujj alkotta tengelytől eltávolító mozgást végez.
Abell-Kendall módszer
ld.: módszer címszó
aberráns
1. normálistól eltérő lefutású, alakú, vagy szokatlan helyen lévő vezetékek, erek, vagy idegek jelzője 2. botanikában, vagy zoológiában: megszokottól különböző, atípusos individuum, vagy species 3. szinonima: ektópiás (lat: aberrans)
aberratio
1. normál lefolyástól, vagy jellegtől való eltérés 2. fejlődés eltérő lefolyása Ld.: kromoszóma
Találatok Magyarázat
aberratio chromatica Egy kép fókuszában, vagy nagyságában lévő különbség, amely úgy jön létre, hogy a fehér fényt összetevő különböző hullámhosszak refrakciójában különbségek adódnak. Szinonima: chromatismus
kromoszóma aberratio a normális számtól, vagy morfológiától való eltérés a kromoszómákban, ill. az ebből eredő phenotypiás eltérés
coma aberratio Kép torzulása, amelyet az optikai rendszerbe belépő, az optikai tengellyel nem párhuzamos fényköteg okoz. (gör: komé, haj, lombozat)
aberratio dioptrica szinonima: aberratio sphaerica, szférikus aberráció
disztorziós aberratio Valamely kép lencsén keresztüli torz megjelenése, melynek oka a tárgy perifériás részének a centrálisétól különböző nagyítása.
lateralis aberratio Szférikus aberrációban a centrális sugarak paraxialis fókusza közötti távolság az optikai tengelyen.
longitudinalis aberratio Szférikus aberrációban az a távolság, amely a paraxialis fókusz és a perifériás sugarak között található az optikai tengelyen.
meridionalis aberratio Olyan eltérés, amely a lencse egyszerű meridiánjának síkjától keletkezik
monochromaticus aberratio Az optikai képben azért keletkezik hiba, mert a lencse anyaga nem felel meg a követelménynek. Fő típusai: szférikus aberratio, coma aberratio, meridionalis aberratio, disztorziós aberratio, valamint ferde sugárkéve astigmatizmusa
aberratio optica A beérkező fénysugarak nem képesek tökéletes képet alkotni, miután valamely optikai rendszeren áthaladtak.
aberratio sphaerica Monochrom aberratio, amely szférikus felületen megtörve keletkezik, mivel a tengelyben és a szélen futó sugarak a tengely mentén különböző pontokban fókuszálódnak. Szinonima: aberratio dioptrica
abetalipoproteinaemia
Ritka, autoszomális recesszív öröklődésű kórkép, amelynél a plazma azon alacsony denzitású lipoproteinjei (LDL) hiányzanak, amelyek elektroforetikusan béta globulinokkal együtt vándorolnak. A vérben acanthocytákkal találkozunk, a retinában degeneratio pigmentosa retinae-t látunk. A zsírfelszívódás jelentős mértékű csökkenése miatt malabsorptio, steatorrhoea jelentkezik, valamint neuromuscularis eltérések, ataxia, mentalis retardatio is észlelhetők. (gör: a- fosztóképző,+ a + lipoprotein + aemia, vér)
ABG (air bone gap)
ld. vérgázok
abioticus
1. élettel összeegyeztethetetlen 2. élettelen
abiotrophia
A sejtek életképességének idő előtti elvesztésével járó folyamat. (gör: a- fosztóképző+ bios, élet + trophé, táplálás)
abl
Egy oncogén, amelyet az egér leukaemia Abelson törzsében találtak, és a Philadelphia kromoszóma translocatiojában is szerepel a krónikus granulocytás leukaemiában.
ablaktatio
1. az emlő tejelválasztásának (gyógyszerrel történő) megelőzése, ill. felfüggesztése 2. csecsemő elválasztása
ablatio
A test valamely részének eltávolítása, leválása, vagy működésének kikapcsolása műtéti eljárás, betegség, vagy károsító anyag révén.
Találatok Magyarázat
ablatio placentae méhlepényleválás
ablatio retinae ideghártya leválása
elektród katéter ablatio Az arrhythmiák megszüntetésének egy speciális módszere; a ritmuszavar kiváltó helyén magas energiájú elektrosokkot adnak le intravascularis katéteren át.
ablepharia
szemhéj veleszületett hiánya
ablepsia
vakság
abneuralis
1. idegtől távoli 2. specifikusan olyan elektromos áramot jelez, amely az izomrostokon át a beidegzés helyétől távol halad (lat: ab-, távol+gör: neuron, ideg)
abnormalitás
1. normálistól való eltérés 2. anomália, deformitás, malformatio, károsodás vagy diszfunkció
aboralis
A szájtól távol eső irányt jelöli; ellentétes az oralissal. (lat: ab, -tól, os, oro száj)
abortifaciens
1. abortust előidéző hatás, ill. hatóanyag 2. szinonima: abortívum (lat: abortus+ facio, csinálni)
abortív
1. nem teljes; valami nem jut el a tökéletességig, a kifejletig (pl. egy betegség gyógyulással végződik, mielőtt még teljesen kialakult volna) 2. szinonima: abortifaciens, abortust előidéző (lat: abortivus)
abortus
1. Vetélés, terhesség megszakadása/megszakítása a magzat életképessé válása (gestatio 28. hete) előtt. Az abortus lehet spontán, természetes okból eredő, vagy indukált (művi=arteficialis, esetleg terápiás). 2. életképtelen terméke a szülésnek 3. valamely folyamatnak, vagy tevékenységnek a természetes befejezés előtti megszakítása
Találatok Magyarázat
abortus arteficialis művi vetélés, terhesség-megszakítás
abortus completus befejezett vetélés; szinonima: abortus perfectus
abortus criminalis törvénytelenül végzett terhesség-megszakítás
abortus habitualis Egymást követően fellépő 3, vagy több spontán abortus esetén nevezzük az abortus-t habitualisnak, avagy szokványos vetélésnek.
abortus imminens fenyegető vetélés
abortus incipiens kezdődő vetélés
abortus incompletus Befejezetlen vetélés, amely során fogamzás termékének egy része távozik a méhből, de egy része (általában a placenta) bennmarad.
abortus infectiosus fertőző vetélés
abortus perfectus ld. abortus completus
abortus septicus Fertőző vetélés, amelyet láz, endometritis és parametritis komplikál.
abortus spontaneus spontán, nem mesterségesen megindított vetélés
abortus therapeuticus A terápiás vetélés során az abortust az anya fizikai, vagy mentális egészségének megmentése, vagy megőrzése érdekében indítják meg, vagy azért, hogy megakadályozzák a fejlődési rendellenességben szenvedő, vagy nemi erőszak következtében fogant gyerek megszületését.
elektív abortus orvosi indoklás nélkül, de legálisan végzett abortus
indukált abortus Szándékosan gyógyszerrel, vagy mechanikus eszközzel előidézett abortus.
missed abortus A magzat elhal, de a méhben marad több mint 4 héten át.
ABP
(ang: androgen binding protein) androgént kötő fehérje
ABR
(ang: auditory brainstem response) hallási agytörzsi válasz
abrachia
karok veleszületett hiánya ld. amelia (gör: a- fosztóképző + brachion, kar)
abrachiocephalia
fej és kar veleszületett hiánya (gör: a- fosztóképző+ brachion, kar + kephale, fej)
abrasio
1. excoriatio, horzsolás, lekaparás, körülírt felületen rendszerint mechanikus ok miatt kialakult bőr, vagy nyálkahártya folytonossági hiány 2. méh műszeres kiürítése 3. fogászatban: fogak kóros kopása, mely helytelen fogkefélési módszer, vagy egyéb külső behatás, esetleg fogcsikorgatás következtében jön létre; szinonima: grinding, őrölés
abrasív
1. abrasiot okozó 2. bármely anyag, amely abrasiot képes előidézni 3. fogászatban: olyan anyag, amelyet eltávolításra, dörzsölés, fúrás, vagy csiszolás céljára használnak
abreaction
freudi pszichoanalízisben: emocionális kisülés, vagy katarzis, amely a múltban elnyomott kellemetlen tapasztalatok felidézésével történik
abruptio placentae
normális helyzetű méhlepény idő előtti leválása
abscessus
1. tályog; purulens exsudatum körülírt gyüleme, amely akut, vagy krónikus lokalizált fertőzéses gyulladás terméke; gyakran szövetpusztulással és a gyulladás egyéb jeleivel, pl. oedemával jár együtt 2. elfolyósodó necrosis következtében kialakult üreg a szolid szövetekben (lat: abscessus, eltávozás)
Találatok Magyarázat
abscessus alveolaris Az állkapocs processus alveolarisában elhelyezkedő tályog, mely leginkább a közelben lévő devitalizált fog fertőzésének tovaterjedéséből ered. Szinonima: abscessus dentalis, abscessus dentoalveolaris
abscessus dentoalveolaris szinonima: abscessus alveolaris
abscessus fecalis a. szinonima: abscessusstercoralis
abscessus frigidus hidegtályog. A gyulladás egyes jelei, így a meleg (calor) hiányoznak, rendszerint gümőkór talaján jön létre. Szinoníma: tuberculoticus a.
abscessus gingivalis gingiva lágy szövetére kiterjedő tályog
abscessus hypostaticus A genny áttörve a tályogfalat a gravitációs erőnek megfelelően a szövetrésekben tovaterjed, ily módon újabb abscessus keletkezik. Szinomima: abscessus migrans, perforáló abscessus
abscessus metastaticus Secunder abscessus, amely a primer góctól távolabb található; a pyogén baktérium nyirokutakon, vagy véren át való terjedése során jön létre.
abscessus migrans vándortályog ld. abscessus hypostaticus
abscessus miliaris apró, kölesnyi gennygyülemek egyike, amely nagy területen, esetleg az egész szervezetben disszeminált
abscessus periappendicularis Rendszerint akut appendicitises infekció terjedésének következménye, gyakran az appendix perforatioját követve alakul ki a jobb fossa iliacában.
abscessus periarticularis ízület menti abscessus, mely nem feltétlenül hatol az ízületi üregbe
abscessus peritonsillaris tonsilla fertőzés kiterjedése a kapszulán áttörve, mely általában a tonsilla mögött képez tályogot
abscessus phlegmonosus Körülírt gennyedés, amelyet igen intenzív környezeti gyulladás kísér, induratiot és az érintett terület duzzadását okozza.
abscessus residualis Ez egy korábbi abscessus helyén ismét megjelenő abscessus, mivel mikroba, vagy genny maradt vissza az eredeti tályogból.
abscessus stellatus Csillag alakú necroticus terület, amelyet histiocyták vesznek körül, lymphogranuloma venereumban látjuk a duzzadt inguinalis nyirokcsomón belül.
abscessus stercoralis genny és faeces gyüleme
abscessus tuberculoticus tuberculosis bacillus okozta abscessus; szinonima: hidegtályog ld. abscessus frigidus
amoebás abscessus elfolyósodó necrosis a májban, vagy más szervben, amely amoebiasis során alakulhat ki
collar-button abscessus inggomb-tályog. Két tályogüreg van, amelyeket szűk csatorna kapcsol össze, rendszerint a felette lévő fascia rupturájának következménye.
cryptaabscessus Lieberkühn-cryptában kialakuló, colitis ulcerosára jellemző abscessus
Dubois abscessus Thymusban kialakult apró cysták, amelyek polymorphonuclearis leukocytákat tartalmaznak, szarusodó hámmal béleltek. Congenitalis syphilisben írták le, de syphilis nélkül is megtalálhatók. Szinonima: Dubois betegség
hematogén abscessus Eredete pyaemia, septicaemia, vagy bacteraemia.
psoasabscessus általában tuberculoticus abscessus, amely tuberculoticus spondylitisből ered, túlterjed az iliopsoas izomzaton egészen az inguinalis régióba
szatellita abscessus olyan másodlagos tályog, amely az elsődlegessel összeköttetésben áll.
száraz abscessus a genny felszívódása után megmaradó üreget jelzi
abscopalis
Az irradiatio hatását jelzi egy, a besugárzástól távol fekvő, nem besugárzott szövetre (ab + gör: skopos, céltábla + al)
absence
Rohamokban fellépő, rendszerint gyermekkorban jelentkező tudatzavar, amelyhez izomgörcs, vagy a fejizmok rángása társulhat, gyakran hyperventillatio váltja ki. Egyszerű formájakor rövid ideig (10-30 sec-ig) ködössé való tudat együtt jár az EEG-n hirtelen kezdődő 3/sec tüskék megjelenésével. (lat: absentia) Szinonima: petit mal
Absidia
gomba genus, amely a természetben gyakori; thermophil speciesei túlélik a komposztban a 450C-ot és emberen zygomycosist okozhatnak.
absolutus
(röv.: abs.) teljes, feltétlen, más anyagot nem tartalmazó
abszorbeál
1. abszorpció révén felvesz 2. átmenő fény intenzitását csökkenti (lat: absorbeo, pp: -sorptus , felszívni)
abszorbencia (A,
A) A spektrofotometriában használatos fogalom, mely egy közegbe hatoló sugárzás intenzitásának (I0) és a közegen áthaladt sugárzás (I) hányadosának (I0/ I) tízes alapú logaritmusával fejezhető ki. Szinonima: extinkció, optikai denzitás (OD)
abszorbens
1. felszívó képesség; telítő képesség; egy anyag/közeg képessége arra, hogy felvegyen/elnyeljen gázt, folyadékot, fény-, vagy hősugarat 2. bármely anyag, amely ilyen tulajdonsággal, képességgel rendelkezik 3. altatógépeknél: olyan anyag, leginkább lúg, amely a széndioxidot képes a recirkuláló rendszerből kivonni, amelybe a beteg kilégzik
abszorpció
1. gázoknak, folyadékoknak, fénynek, vagy hőnek a felvétele, elnyelése 2. radiológia: a sugárzási energia felvétele a szövetek, vagy azon közeg részéről, amelyen a sugárzás áthalad 3. orvosi fizika: radioaktivitás, egységnyi időre jutó elbomló radioaktív részecskék száma (SI mértékegysége: Bq, becquerel) (lat: absorptio, nyelés)
absztinencia
önmegtartóztatás; bizonyos ételektől magát távol tartja, vagy nem fogyaszt szeszes italokat, nem használ illegális drogokat, vagy nem él nemi életet (lat: abstineo, visszatartani magát)
absztrakció
1. elvonatkoztatás; egy koncepció bizonyos aspektusainak meghatározott gondolatmenet alapján történő kiemelése; lényeges dolgok elkülönítése a lényegtelentől 2. volatilis (illékony) alkotórészek desztillációval való kivonása egy anyagból 3. nyers drogból kivonat készítése 4. fogak rossz záródása (malocclusio), vagy a foggal kapcsolódó struktúrák alacsonyabban helyezkednek el, mint a normális occlusiós sík (lat: abstraho pp. tractus, kivonni)
abulia
1. akarathiány; az akaratlagos cselekedetek kivitelezésének, vagy a döntéshozatalnak a képtelensége, vagy sérülése 2. a beszéd, a mozgás, a gondolat és az érzelmi reakciók csökkenése, kétoldali frontális betegség következtében (gör: a-fosztóképző + boulé, akarat)
abusus
1. visszaélés; helytelen, mértéktelen, túlzott használat, 2. testi, vagy pszichés károsodást okozó, offenzív bánásmód gyerekkel szemben, vagy szexuális magatartásban
Találatok Magyarázat
drogabusus Rendszeres, orvosi előírás nélkül történő, társadalmilag nem elfogadott használata, önkezű adagolása valamely szernek a hangulat, a magatartás, a tudatállapot megváltoztatása céljából. Az alkalmazott gyógyszer feleslegesen és szükségtelenül hat a szervezet működésére (pl. hashajtóval történő visszaélés). Az adott gyógyszerrel, kábítószerrel, vagy alkohollal történő tartós visszaélés szociális, foglalkozásbeli, pszichés, vagy fizikális problémákat okoz.
AC
váltóáram (ang: alternating current)
Ac
1. aktínium 2. acetil-
ac.
akut, heveny (lat: acutus)
AC/A
alkalmazkodási convergencia/akkomodáció hányados (ang: accomodative covergence-accomodation ratio)
acalculia
számolási képtelenség; az aphasia egyik alakja, a beteg nem képes a legegyszerűbb matematikai problémákat megoldani, gyakran a dementia első jele
acanth(o)-
tüske, tövis-, fog (gör: akantha, tövis)
acanthaesthesia
paraesthesia egy formája, amelyben a beteg tűszurkálásokat érez (gör: akantha, tövis+ aisthésis, érzés)
acanthocyta
vörösvérsejt, amelyet tüskés plazma kinövések jellemeznek (gör: acantho+kystos, sejt)
acanthocytosis
Ritka állapot, amelyben az erythrocyták többsége acanthocyta; abetalipoproteinaemiában jellegzetes.
acanthoid
tüskés alakú
acantholysis
Pemphigus vulgarisban és Darier-kórban az egyes epidermális keratinocyták elválása szomszédjaiktól. (gör: acantho+lysis, lazulás)
acanthoma
tumor, amely az epithelium elszarusodó sejtjeiből ered, ld. keratoacanthoma (gör: acantho+ -oma, tumor)
acanthorrhexis
epidermis tüskés sejtjei között az intercelluláris hidak kontakt dermatitisben észlelt szétszakadása; ld. spongiosis (gör: acantho + rhexis, szakadás)
acanthosis
epidermis stratum spinosumának megvastagodása (gör: acanth- + -osis, állapot)
Találatok Magyarázat
acanthosis nigricans Bársonyos, szemölcsös benignus növedék és hyperpigmentatio, mely az axillák bőrén, a nyakon, az anogenitalis területen és a lágyékban észlelhető. Felnőtteken belszervi malignitás, endokrin betegség, vagy elhízás gyakran kíséri. Gyerekeken benignus, juvenilis típusát találhatjuk. (lat: niger, fekete)
acapnia
szén-dioxid hiány a vérben, gyakran tévesen hypocapnia helyett használják (gör: a- fosztóképző + kapnos, füst)
acardia
congenitalis szívhiány; ez az állapot gyakran monozygota ikrekben mutatkozik, vagy sziámi ikrek kisebb tagjában, ha a nagyobbik testvér kisajátítja a placentaris vérellátást (gör: a- fosztóképző + kardia, szív)
acariasis
atkás bőrfertőzés ld. rühesség, scabies, szinonima: acaridiasis
acaricid
atkákat, ill. kullancsokat pusztító hatóanyag (lat: acarus, atka + caedo, ölök)
Acaridae
Az atkák rendjének egyik családja (készletatkafélék); rendkívül apró (<0,5 mm), szárított gyümölcsökben, gabonában, lisztben található atkák tartoznak ide. Gyakran súlyos dermatitist okoznak a fertőzött élelmiszerrel érintkezőkön, akik irántuk hiperszenzitizálódtak.
acaridiasis
szinonima: acariasis
acarodermatitis
bőrgyulladás, vagy kiütés, amelyet atka okozott (gör: akari, atka + derma-,(dermat) bőr)
acarophobia
beteges félelem apró parazitáktól, rühességtől, vagy viszketéstől (gör: akari, atka + phobos, félelem)
Acarus
atka; atkák nemzetsége az Acaridae családból (gör: akari, atka)
Találatok Magyarázat
Acarus siro (Sarcoptes scabiei) emberi rühatka, scabies (rühesség) kórokozója
acaryocyta
ld. akaryocyta
acatalasia
veleszületett kataláz enzimhiány
accelerans
serkentő szinonima: accelerator
accelerator
ld. akcelerátor
accentuator
Olyan anyag (pl. anilin), amelynek jelenlétében egyes hisztológiai elemek festődése kifejezettebbé válik. (lat: accentus, hangsúly)
acceptor
ld. akceptor
accessoricus
1. kiegészítő, járulékos 2. anat: izmok, idegek, mirigyek stb. jelölése, amelyek segédfunkciót végeznek, vagy számfölöttiek a meglévő, hasonló célú, de nagyobb fontosságú szervhez képest (lat: accessorium, tovább mozogni) szinonima: accessorius ld. nervus accessorius (XI. agyideg)
accidentalis
nem várt, de gyakran megjósolható esemény, amely károsodást okoz, pl. a közlekedésben, az ipari tevékenységben, a háztartásban, de ilyen váratlan esemény bekövetkezhet betegség lefolyása kapcsán is (lat: accido, történni)
accretio
1. összenövés, letapadás 2. fogászat: idegen anyag (plakk, vagy kő) fogak felületére vagy üregekbe történő lerakódása (lat: ad- hozzá + crescere, nőni)
Találatok Magyarázat
accretio cordis felrakódás a pericardiumon, mely révén a szívburok hozzánő a környező extracardialis struktúrákhoz (pl. mellkasfalhoz, mellhártyához)
accuracy
Valamely mérés pontossági fokát fejezi ki, vagyis a mért érték mennyire közelíti meg a valódi értéket. A laboratóriumi accuracy teszt annyit jelent, hogy a meghatározott referencia teszt eredményével hasonlítjuk össze a saját mérésünk eredményét.
acellularis
1. sejtmentes 2. egysejtű lényekre alkalmazzuk, amelyek nem válnak többsejtűekké és egyetlen sejtegységgel teljesek (gör: a- fosztóképző +lat: cellula, kis kamra)
acentricus
1. centrum nélküli 2. cytogenetika: olyan kromoszóma fragmentum, amelyben nincsen centroméra (gör: a- fosztóképző + centron, központ)
acephalia
fej congenitalis hiánya (gör: a- fosztóképző + cephale, fej)
acephalocardia
fej és szív hiánya parazita ikerben (gör: a- fosztóképző +cephale, fej + cardia, szív)
acephalocheiria, acephalochiria
fej és kezek congenitalis hiánya (gör: a- fosztóképző +cephale, fej + cheir, kéz)
acephalogastria
fej, és gyomor congenitalis hiánya parazita
acephalopodia
fej és a lábak congenitalis hiánya (gör: a- fosztóképző + cephale, fej, + pous, láb)
acephalostomia
congenitalis hiánya a fej nagyobb részének, de egy szájszerű nyílás található (gör: a- fosztóképző + cephale, fej + stoma, száj)
acephalosus
fej nélküli
acephalothoracia
congenitalis fej és thorax hiány (gör: a- fosztóképző + cephale, fej + thorax, mellkas)
acephalus
fej nélküli magzat (gör: a- fosztóképző + cephale, fej)
acet-, aceto-
két szénatomos ecetsav gyököt jelöli
acetabulectomia
az acetabulum műtét során történő eltávolítása (gör: acetabulum + ektomé, kimetszés)
acetabuloplastica
műtéti eljárás, amelynek célja az acetabulum közel normálissá történő helyreállítása (acetabulum + gör: plastos, alakított)
acetabulum
csésze alakú ízvápa a medencecsont külső felszínén, amellyel a femur feje ízesül (lat: csésze, lapos ecetes csésze)
acetát
CH3COO- az ecetsav sója, vagy észtere
Találatok Magyarázat
acetát thiokináz szinonima: acetil-KoA ligáz
acetát-KoA ligáz
szinonima: acetil-KoA ligáz
acetecetsav
CH3COCH2COOH ketontestek egyike, amelyek túlzott mértékben képződve a vizeletben is megjelennek éhezés, diabeteses ketoacidosis esetén;
acetil- (Ac)
CH3CO- ecetsav molekulából egy hidroxil-csoport eltávolítása után keletkező egy vegyértékű gyök
acetil-KoA
(acetil-koenzim A) nagy energiatartalmú ecetsav észter, mely a Krebs-ciklus és a zsírsavszintézis közti terméke
acetil-KoA
A koenzim A-nak és az ecetsavnak kondenzációs terméke; képlete: KoAS-COCH3. Az acetil-KoA intermedier a két szénatomot tartalmazó fragmentumok szállításában, részt vesz a Krebs-ciklusban és a zsírsavak szintézisében.
Találatok Magyarázat
acetil-KoA acetiltranszferáz Az acetil-KoA egy acetiltransferáz, amely acetoacetil-KoA-t képez két molekula acetil-KoA-ból, miközben egy KoA felszabadul. A katalizált reakció kulcslépés a ketogenezisben és a szterol szintézisben. Szinonima: acetoacetil-KoA thioláz, acetil-KoA thioláz.
acetil-KoA ligáz Az acetil-KoA olyan ligáz, amely az acetát és a KoA, valamint az ATP közötti reakciót katalizálja, a reakció végén AMP, pirofoszfát és acetil-KoA keletkezik. Kulcslépés az acetát aktivációja. Szinonima: acetát thiokináz, acetát-KoA ligáz, acetil aktiváló enzim, acetil-KoA szintetáz.
acetil-KoA szintetáz szinonima: acetil-KoA ligáz
acetil-KoA thioláz szinonima: acetil-KoA acetiltranszferáz
acetil-kolin
(Ach) (2-acetoxietil) trimetil ammónium ion; a központi és vegetatív idegrendszer kolinerg szinapsisaiban lévő, valamint a neuromuscularis junctioknál felszabaduló fontos ingerületátvivő anyag
acetil-szalicilsav
(acidum acetylsalicilicum) nem-szteroid gyulladás gátló vegyület
acetiláció
acetil származék képzése
acetiláz
bármely enzim, amely acetilációt, vagy dezacetilációt katalizál (pl. glutamátból acetil-KoA jelenlétében N-acetil-glutamátot képez, vagy ennek fordítottja megy végbe. Az acetiláz-t gyakran acetil-transzferáznak is nevezik.
acetiltranszferáz
bármely olyan enzim elnevezése, amely acetil csoportot visz át egyik vegyületről egy másikra. Ld.: kolin acetiltranszferáz; szinonima: transzacetiláz
acetoacetát
acetecetsav ionja, vagy sója; ketontest, amelyet a ketogenezis kapcsán termel a szervezet
acetoacetil-KoA
Az acetoacetil-KoA a zsírsavak oxidációjában szereplő intermedier termék, amely két molekula acetil-KoA-ból keletkezhet. Az acetoacetil-KoA-nak szerepe van a ketontestek képzésében, ill. nagy jelentőségű az acetil-KoA-val történő kondenzációja, amikor -hidroxi---metilglutaril-KoA képződik.
Találatok Magyarázat
acetoacetil-KoA- thioláz szinonima: acetil-KoA acetiltranszferáz
aceton
CH3COCH3 Az aceton színtelen, illékony, gyúlékony folyadék, mely a legegyszerűbb szerkezetű ketontest, csekély mennyiségben a vizeletben is megtalálható. Diabetesesek vérében és vizeletében nagyobb mennyisége is kimutatható, gyakran a vizeletnek és a lélegzetnek éteres szagát adva. Oldószerként használják gyógyszereknél.
acetonaemia
acetonnak, és egyéb ketontesteknek relatíve nagy koncentrációban való jelenléte a vérben (aceton + gör: haima, vér)
acetonuria
nagy mennyiségű aceton kiválasztása a vizeletben (aceton + gör: ouron, vizelet)
AcG, acg
akcelerátor globulin
ACH, Ach
ld. acetil-kolin
achalasia
1. leggyakrabban: cardiaspasmus, alsó nyelőcső sphincter relaxációs elégtelensége az autonóm beidegzés zavara miatt 2. egyéb visceralis nyílások sphincter izomzatának ellazulási képtelensége (pylorus, cardia stb.) (gör: a- fosztóképző + chalasis, elernyedés)
acheilia
congenitalis ajak hiány
acheiria
fejlődési rendellenesség következtében kialakuló kéz hiány
acheiropodia
kezek és lábak congenitalis hiánya, autoszomális recesszív örökletességet mutató elváltozás (gör: a- fosztóképző + cheir, kéz + podos, láb)
Achilles-ín
felületes lábszárhajlító izmok közös ina; szinonima: tendo calcaneus
achillobursitis
Achilles-ín bursájában fellépő gyulladás
achillodynia
Az achillodynia a calcaneus közeli bursa és a calcaneus ina közti területen kialakuló gyulladás (achillobursitis) okozta fájdalom. (Achilles, (ín) +gör: odyné, fájdalom)
achillorrhaphia
a calcaneus inának suturája (Achilles (ín) + gör: rhaphé, varrni)
achillotenotomia
szinonima: achillotomia (Achilles (ín) + gör: tenon, ín+ tomé, bevágás)
achillotomia
calcaneus inának műtéti metszése, szétválasztása; szinonima: achillotenotomia. (Achilles .íní + tomé, vágni)
achlorhydria
sósavszekréció hiánya a gyomorban, pl. anaemia perniciosában (gör: a- fosztóképző + lat: (acidum) chlorhydricum, sósav)
achlorophillosus
klorofilmentes (pl. gombák)
acholia
epeszekréció hiánya, vagy epeelfolyás zavara (gör: a- fosztóképző + cholé, epe)
acholiás
epe nélküli, mint a halvány színű széklet
acholuria
vizeletben az epepigment hiánya sárgaság egyes eseteiben (gör: a- fosztóképző+cholé, epe+ ouron, vizelet
achondrogenesis
Az achondrogenesis öröklött csontfejlődési rendellenesség miatt kialakuló törpeség, amely esetében a négy végtag és a törzs rövidebb, normális, vagy megnagyobbodott koponya mellett. (gör: a- fosztóképző + chondros, porc +genesis, eredet)
achondroplasia
Az achondroplasia a chondrodystrophia egyik típusa, amelyben nem szabályosan zajlik a porc csontosodása. Főleg a hosszú csöves csontokon észlelhető; a végtagokban az epiphysealis növekedés retardált és korán megszűnik, ennek következménye a törpeség, amely már a születéskor is látható, a végtagok rövidek, a törzs normális. (gör: a- fosztóképző+ chondros, porc + plasis, mintázás) Szinonima: chondrodystrophia fetalis
achromacyta
szinonima: achromocyta
achromaticus
1. színtelen 2. nehezen festődő 3. fényt chromaticus aberratio mentesen törő (gör: a- fosztóképző + chroma, szín)
achromatismus
1. színtelenség 2. chromaticus aberratio megszüntetése üvegek kombinálásával, amelyeknek különböző a törési indexük és a fényszórásuk
achromatocyta
szinonima: achromocyta
achromatophil
szövettani, vagy mikrobiológiai festési módszerekkel nem festődő sejt, vagy szövet; szinonima: achromophil (gör: a- fosztóképző+ chroma, szín + philos, szeret)
achromatopsia
Az achromatopsia teljes színvakság, súlyos congenitalis színfelismerési rendellenesség, amely gyakran társul nystagmussal és csökkent látásélességgel. Szinonima: monochromatismus (gör: a- fosztóképző + chroma, szín+ opsis, látás)
achromatosis
színtelenség (pl. szivárványhártya, bőr achromatosis-a)
achromaturia
igen halvány, színtelen vizelet ürítése (gör: a- fosztóképző+ chroma, szín + ouron, vizelet)
achromia
1. természetes pigmentáció hiánya, vagy elvesztése (bőr, iris, vörösvértestek esetében) ld. depigmentatio 2. sejtek, vagy szövetek festékfelvevő kapacitásának hiánya (gör: a- fosztóképző + chroma, szín)
achromocyta
hypochrom, félhold alakú erythrocyta; valószínűleg a vörösvérsejt arteficiálisan létrejött rupturája során jön létre; szinonima: achromacyta, achromatocyta (gör: a- fosztóképző + chroma, szín + kytos, üreges (sejt))
achromophil
szinonima: achromatophil
achylia
gyomornedvnek, vagy más emésztőnedvnek a hiánya (gör: a- fosztóképző + chylos, nedv)
acidaemia
hidrogénion koncentrációjának emelkedése a vérben, más szóval a normális pH esése még akkor is, ha a bikarbonát koncentráció is eltolódik. (acid + gör: haima, vér)
Találatok Magyarázat
aminoacidaemia aminosavak vérben való felszaporodása miatt kialakuló acidaemia
aciditás
1. savasság, savanyúság 2. valamely folyadék savtartalma
acidophil
1. savkedvelő 2. olyan sejt, vagy szöveti elem, amely savanyú festékkel (pl. eosinnal) festődik; pl. hypophysis elülső lebenyében lévő acidophil sejtek 3. mikroorganizmus, amely erősen savi vegyhatású miliőben növekedésre képes (acid-, sav + gör: philos, szeret)
acidosis
savbőség, alkáli tartalom csökkenés a testfolyadékokban; gyakran savanyú metabolitok felhalmozódása mutatható ki (acid+ gör: -osis, állapot)
Találatok Magyarázat
diabeteses ketoacidosis diabetes mellitusban kialakuló pH és bikarbonát koncentráció csökkenés, a szervezetben ketontestek halmozódnak fel
kompenzált acidosis a testfolyadékok pH-ja normális; a kompenzáció részben respiratorikus, részben renalis mechanizmusok révén következnek be
laktátacidosis jobbra forgató tejsav felszaporodása okozta acidosis
metabolikus acidosis csökken a pH és a testnedvek bikarbonát tartaléka, mert vagy sav (tejsav, aminosav stb.) halmozódik fel, vagy a szervezet fix bázis tartaléka vész el (pl. hasmenésben, vagy vesebetegségben)
renalis tubularis acidosis klinikai szindróma, amelyet a vese csökkent vizelet savanyító képessége jellemez, a plazmában alacsony a bikarbonát szint, magas a hidrogén-, és klorid-ion koncentráció, gyakori eltérés a hypokalaemia, nephrocalcinosis, osteomalacia
respiratorikus acidosis hypoventillatio miatt kialakuló széndioxid retenció okozta acidosis; kompenzált formájában a vesék bikarbonát visszatartásával ellensúlyozzák a létrejött acidosis-t
acidum (acid.)
sav; olyan vegyület, amely poláris oldószerben hidrogén iont ad le (pl. vízben). A savak sót képeznek, amennyiben az ionizálható hidrogénjüket elektropozitív elemmel, vagy gyökkel helyettesítjük. (lat: acidus, savanyú)
Találatok Magyarázat
acidum (acid.) aceticum ecetsav
acidum (acid.) acetylsalicilicum acetilszalicilsav
acidum (acid.) boracicum bórsav
acidum (acid.) carbonicum anhydricum szénsav
acidum (acid.) citricum citromsav
acidum (acid.) formicum hangyasav
acidum (acid.) hydrochloricum sósav
acidum (acid.) lacticum tejsav
acidum (acid.) nitricum salétromsav
acidum (acid.) nitrosum salétromosssav
acidum (acid.) oleinicum olajsav
acidum (acid.) palmitinicum palmitinsav
acidum (acid.) phosphoricum foszforsav
acidum (acid.) salicylicum szalicilsav
acidum (acid.) succinicum borostyánkősav
acidum (acid.) sulfuricum kénsav
acidum (acid.) tartaricum borkősav
acidum (acid.) trichloraceticum triklórecetsav
aciduria
1. savanyú vizelet kiválasztása 2. Az aciduria abnormális mennyiségben történő ürítése valamely savnak a vizeletben. Az egyes savféléket prefix-szel jelölhetjük: aminoaciduria, ketoaciduria. (acid, sav +gör: ouron, vizelet)
acil-
szerves gyök, amely szerves savból ered a karboxil-csoport hidroxil-csoportjának eltávolítása után
acil-KoA
(RCH2CO-SKoA) A karboxilsav és a koenzim A kondenzációs terméke; fontos intermedier anyagcseretermék a zsírok oxidációjában és szintézisében.
acilamidáz
szinonima: amidáz
aciltranszferáz
(EC osztály 2.3) acil-csoport acil-KoA-ról egy másik akceptorra való szállítását katalizáló enzim szinonima: transzaciláz
acini
acinus szó többes száma
aciniformis
szinonima: acinosus (lat: acinus, szőlőfürt + form, alak)
acinitis
acinus gyulladása
acinosus
acinusra emlékeztető, szőlőfürtszerű struktúra; szinonima: aciniform
acinus
(gen., plur.: acini) 1. mirigyek végkamrája, szőlőfürtre emlékeztető, piciny szekretoros egységei (lat: szőlőfürt) 2. májacinus máj legkisebb funkcionális egysége, a máj parenchymát, valamint az azt ellátó portalis véna és hepaticus artéria végágakat tartalmazza 3. tüdőacinus a tüdő legkisebb működési egysége, amelybe a bronchiolus respiratoricus és annak elágazódásai, valamint az ehhez kapcsolódó alvelousok tartoznak; szinonima: pulmonaris lobulus (tüdő lebenyke)
aclasis
normális és patológiás szövet közötti átmenet állapota (gör: a- fosztóképző, klasis eltörni)
acmaesthesia
1. tűszúrás iránti érzékenység 2. éles ponttal szembeni bőr érzékenység (gör: acmé, pont + aisthésis, érzés)
acne
pilosebaceus egység gyakori, rendszerint pubertáskorban kezdődő gyulladásos betegsége, amelyet comedo, papula, pustula, abscessus, ill. extrém esetben sipoly képződése jellemezhet. (gör: acme, a kiütés pontja)
Találatok Magyarázat
acne conglobata súlyos cysticus acne, tályogok, kommunikáló sinusok, fistulák, vastag csomós, torzító hegek kialakulása jellemzi; főként a háton, elülső mellkasfalon, glutealis tájékon figyelhető meg, rendszerint az arcot megkíméli
acne cosmetica enyhe gyulladásossal járó acne, mely rendszerint nőknél, az arc két oldalán, zsíros krémek gyakori alkalmazása nyomán jön létre
acne cystica súlyos acne, amelyben follicularis cysták a domináns elváltozások, amelyek megrepednek és hegesednek
acne erythematosa szinonima: acne rosacea
acne fulminans akutan kialakuló, súlyos, kifekélyesedő, majd hegesedő nodulocysticus acne tizenéven fiúkon; társulhat lázzal, polyarthralgiával, fogyással, anaemiával, és leukocytosissal (lat: fulmen, villám)
acne indurata mélyen ülő acne nagy papulákkal és pustulákkal, valamint hypertrophiás heggel
acne keratosa rendszerint a hajfolliculusokat érintő gyulladásos papulákból álló eruptiok, amelyeket szarucsap zár
acne medicamentosa gyógyszer okozta, vagy gyógyszer által súlyosbított acne (pl. szteroid, ACTH, androgén, INH, lítium, egyes antiepileptikumok, B6 és B12 vitaminok)
acne papulosa acne vulgaris, amelyben papularis elváltozás uralkodik
acne punctata fekete comedokkal járó acne
acne pustulosa acne vulgaris, amelyen pustularis elváltozás uralkodik
acne rosacea fokozott faggyúmirigy aktivitás és kapilláristágulatok miatt az orron kialakuló, bőrfelszín egyenetlenséget okozó elváltozás; szinonima: rosacea
acne varioliformis himlőszerű pyogen infectio, amely a folliculusokat támadja meg, főként a homlokon és a halántékon mutatkozik, heggel gyógyul
acne vulgaris Főleg az arcon, a hát felső részén és a mellkason megjelenő gyulladásos eruptiok, melyek comedokból, cystákból, papulákból és pustulákból állnak. Leginkább a serdülőkorban mutatkozik a faggyúszekréció androgén stimulációjának következtében, a folliculusokat szarucsap zárja el, az elváltozásból kimutatható a Propionibacterium acnes.
chloracne klór okozta acne
colloid acne szinonima: colloid milium
jód acne az arc, a törzs, a végtagok follicularis eruptioja, amelyet jód injekciója, vagy oralis bejutása erre hypersensitiv egyéneken idéz elő; ld. iododerma
pomádé acne homlokon és halántékon alakul ki fekete férfiakon, akik ismételten hajkrémet használnak
szteroid acne acne vulgarishoz hasonlító folliculitis, amelyet lokalis, vagy oralis szteroid adása okoz; a comedok ritkák
tropikus acne az acne súlyos formája, az egész törzsön, vállakon, felkaron, glutealisan és a felső combon mutatkozik, kialakulásának feltétele a forró, nedves klíma
acneiformis
acnéra hasonlító, pattanásszerű
aconuresis
akaratlan vizeletürítés
acorea
congenitalis pupilla hiány a szemben (gör: a- fosztóképző + koré, pupilla)
acquisitus
szerzett, nem öröklött betegség, vagy abnormalitás (lat: acquiro , szerezni)
acr(o)-
összetett szavakban előtag 1. csúcs, vég 2. végső, legfelső (gör: akron-, csúcs)
acra
1. perifériás, v. kiálló testrész (végtag, áll, orr stb.) 2. valaminek a legszélsőbb része (gör: akron, végtag)
acralis
perifériás testrészre vonatkozó
Acrania
Chordata törzs egyik csoportja, amelynek tagjai gerinchúrral, kopoltyú hasadékkal, és ideghúrral rendelkeznek, de gerincoszlopuk, bordájuk, vagy koponyájuk nincs. Az Acrania-khoz tartoznak pl. Amphioxus fajok, a zsákállatok és a makkos férgek (gör: a- fosztóképző + kranion, koponya)
acrania
koponya teljes, vagy részleges hiánya, anencephaliával társulhat (gör: a- fosztóképző + kranion, koponya)
acroaesthesia
egy, vagy több végtag hyperaesthesiája (acro- + aisthesis, érzés)
acroagnosis
valamely végtag érzékelésének hiánya, vagy csökkenése; az acrognosis kiesése
acroanaesthesia
egy, vagy több végtag érzéstelensége (gör: acro- + an- fosztóképző + aisthesis érzés) szinonima: acroagnosis
acroataxia
végtagok distalis részét (vagyis a kezeket, lábfejet, ujjakat)érintő ataxia ld: proximoataxia (gör: acro- + ataxia)
acroblast
fejlődő spermatida egyik, számos Golgi-elemből álló komponense, mely a proakroszomális granulumokat tartalmazza (gör: acro- + blastos, csíra)
acrobrachycephalia
craniosynostosis rendellenességeinek egyik típusa, amelynél a koronavarrat idő előtti záródása észlelhető (gör: acro- + brachys, rövid + kephalé, fej)
acrocentricus
Az acrocentricus kromoszóma esetében a centromera a kromoszóma végének közelében található. (gör: acro- + kentron, központ)
acrocephalia
rendellenes, csúcsos fejforma (gör: acro- + kephalé, fej) szinonima: oxycephalia
acrocephalosyndactylia
Az acrocephalosyndactylia congenitalis abnormalitások olyan csoportja, amelyet a hegyes koponya és az ujjak összenövése, illetve a közöttük lévő úszóhártya jellemez. (gör: acrocephalia + syn, össze + daktylos, ujj)
acrochordon
bőrön lévő kis függelék (gör: acro- + chordé, zsinór)
acrocyanosis
Az acrocyanosis kiálló testrészek (pl. ujjak, orr) szederjessége, hűvössége rendszerint oxigénhiány, alacsony külső hőmérséklet, keringési zavar stb. következtében. Egyes esetei a Raynaud jelenséggel kapcsolatosak. (gör: acro- + kyanos, kék, -osis, állapot)
acrodermatitis
végtagok, vagy egyéb acralis testrészek bőrének gyulladása (gör: acro- + derma, bőr, + -itis, gyulladás)
Találatok Magyarázat
acrodermatitis chronica atrophicans Lyme-kór késői bőrtünete, amely elsősorban a kezeken, lábakon, könyökön és térden mutatkozik indurált erythemás plakkok formájában, amelyek később atrophiássá válnak.
acrodermatitis continua szinonima: pustulosis palmaris et plantaris
acrodermatitis enteropathica gyomor-, bélrendszeri betegségekhez társuló, a száj, az analis régió, valamint a végtagok bőrén található psoriasiform bőrelváltozások
acrodermatosis
bármely bőrelváltozás, amely a végtagok distalis részére terjed
acrodynia
1. acralis testrészeken érzett fájdalom 2. higanymérgezés okozta tünetcsoport: gyerekeken jellemzi a végtagok, mellkas, és orr erythemája, polyneuritis, száj kifekélyesedése és egyéb gasztrointesztinális tünetek; felnőtteken anorexia, photophobia, izzadás és tachycardia észlelhető; szinonima: dermatopolyneuritis, rózsaszín betegség (pink disease), Swift-kór (gör: acro- + odyné, fájdalom)
acrognosis
végtagok normális érzékelése (gör: acro- + gnósis, ismeret)
acrohyperhydrosis
kéz és láb fokozott verejtékezése
acrokeratosis
szaruréteg nodularis túlnövekedése kéz- és lábujjakon, ritkábban fülön és orron (gör: acro- + keras, szaru, -osis, állapot)
acromegalia
Az acromegalia olyan betegség, amelyet a fej, az arc, a kezek, és a lábfej fokozódó megnagyobbodása jellemez, mivel a növekedési hormon (somatotropin) túlzott mértékben termelődik. Szervek megnagyobbodása (organomegalia) és anyagcserezavarok is mutatkoznak, így pl. diabetes mellitus alakulhat ki. (gör: acro- + megas, nagy)
acromelalgia
Az acromelalgia az alsó, ritkábban a felső végtagok rohamszerűen jelentkező, kipirosodással járó fájdalma. Szinonima: erythromelalgia (gör: acro- + melos, láb)
acromelicus
láb terminális részét illető (gör: acro- + melos, láb)
acromesomelia
törpeség egyik, autoszomális recesszív öröklődésű formája, amelyben a végtagok legdistalisabb szegmentuma érintett (gör: acro- + melos, láb, + -ia, állapot)
acrometagenesis
végtagok abnormális növekedése, amely deformitást okoz (gör: acro- + meta, mögöttes, + genesis, eredet)
acromi(o)-
acromionnal kapcsolatos
acromicria
kéz, v. láb abnormálisan kis méretével járó eltérés
acromioclavicularis
acromionnal és claviculával kapcsolatos; az ízesülést és a szalagokat jelzi a clavicula és a scapula között szinonima: scapuloclavicularis
acromiocoracoidealis
szinonima: coracoacromialis
acromiohumeralis
acromionnal és humerussal kapcsolatos
acromion
vállcsúcs; a scapula csúcsának laterális vége, amely kiszélesedett, lelapult processusként a fossa gleoidalis fölé nyúlik; az acromion ízesül a claviculával és tapadást biztosít a musculus deltoideus és trapezius részére szinonima: processus acromialis (gör: akromion, akron, csúcs, + ómos, váll)
acromioscapularis
mind az acromionnal, mind a scapulával kapcsolatos
acromiothoracicus
szinonima: thoracoacromialis
acromyotonia
csak a végtagokat érintő myotonia, amely a kéz és láb specifikus deformitását idézi elő szinonima: acromyotonus (gör: acro- + mys , izom + tonos, tenzió)
acromyotonus
ld. acromyotonia
acroparaesthesia
1. egy, vagy több végtag paraesthesiája 2. éjszaka jelentkező paraesthesia a kezeken, főleg középkorú nőkön észlelhető; régebben a thoracalis kimenetben lévő elváltozásnak tulajdonították, ma viszont úgy tartjuk, hogy a csukló csatorna (carpal tunnel) szindróma része (acro- +paraesthesia)
acropetalis
csúcs felé erősödő
acrophobia
kóros iszonyodás, félelem a magaslatoktól (gör: acro- + phobos, félelem)
acroposthitis
fitymagyulladás
acropustulosis
pustulosus kiütések a kezeken, lábakon, gyakran a psoriasis egyik megjelenési formája
Találatok Magyarázat
infantilis acropustulosis recurrens papulopustulosus és varros viszkető kiütés, főleg fekete gyerekeken látható
acroscleroderma
ld: acrosclerosis (gör: acro- + skleros, kemény + derma, bőr)
acrosclerosis
Az acrosclerosis az ujjak bőrének megvastagodása és keményedése, a lágy szövetek atrophiájával, a distalis ujjpercek osteoporosisával. Körülhatárolt alakja a Raynaud jelenségnek, amelyben progressiv systemás sclerosis mutatkozhat. Ld.: CREST-szindróma szinonima: acroscleroderma, sclerodactylia
acrosin
Az acrosin spermiumokban található szerin proteáz, mely a petesejt zona pellucidáját oldja fel a megtermékenyítés során; specificitását tekintve a tripszinhez hasonlít.
acrosoma
spermidák Golgi-apparátusának módosulásából létrejövő, sapka alakú sejtorganellum, amely a spermium magjának elülső kétharmadát burkolja. Ezen sapkán belül olyan enzimek működnek, amelyek a spermium petesejtbe való hatolását segítik elő. (gör: acro- + soma, test)
acrotismus
pulzus tapinthatatlansága, vagy hiánya (gör: a- fosztóképző + krotos, pulzáló)
ACTH
Az agyalapi mirigy elülső lebenyében termelődő adrenocorticotrop hormon rövidítése, mely szerepet játszik egyes mellékvesekéreg hormonok elválasztásának szabályozásában. Szinonima: corticotropin
Találatok Magyarázat
big ACTH ACTH bizonyos daganatok által termelt nagy molekulájú alakja, amely immunohisztokémiailag nem különbözik a kis ACTH-tól, de nem gyakorolja az ACTH-ra jellemző biológiai hatást
little ACTH a konvencionális, biológiai hatással rendelkező ACTH molekulát jelölhetjük így, összehasonlítva a big ACTH-val
actin
Az actin egyike azon fehérjéknek, amelyek az actomyosin komplexet alkotják, és az izmok működésében, a sejtmozgásban elengedhetetlen szerepet játszanak; fibrosus (F-actin) és globularis alakja (G-actin) van.
actin(o)-
sugár-; összetételekben: sugárzási, sugárszerű ld.: radio- (gör: aktis, sugár, fény)
actiniformis
sugár alakú (gör: aktis (aktin), sugár)
actinium
(Ac) 89-es rendszámú elem, amelynek atomsúlya 227,05. Nincsen stabil izotópja, a természetben csak az uránium és a thorium bomlástermékeként létezik. (gör: aktis, sugár)
actinodermatitis
sugárzás okozta bőrgyulladás, pl. rtg-sugárzás ld: photodermatitis
Actinomycetaceae
Gram-pozitív, nem saválló, spórátlan, fakultatív anaerob baktériumok családja (actinomycetales rend), amelyek elágazódó, gombafonalra emlékeztető nyúlványokat képeznek. Ez a család az alábbi nemzetségeket foglalja magába: Actinomyces, Arachnia, Bacterionema, Bifidobacterium, Rothia genus.
Actinomycetales
A baktériumok egyik rendje, melyhez penészgombaszerű, pálcika, bot, vagy szalag alakú, elágazódásra hajlamos speciesek tartoznak. Ide sorolhatóak a Mycobacteriaceae, az Actinomycetaceae, a Streptomycetaceae és a Nocardiaceae családok.
actinomycoma
Az actinomyceták okozta granulomatosus szövetszaporulat. Ld. mycetoma (gör: actino- + mykés, gomba +oma, tumor)
actinomycosis
Elsődlegesen szarvasmarhák és emberek betegsége, amelyet az Actinomyces bovis okoz marhákban és az Actinomyces israelii valamint az Actinomyces propionica emberben. Mindezek az actinomyceták a száj és pharynx normális baktérium flóráját képezik, de képesek krónikus destruktív tályogokat, granulomákat előidézni, amelyekből viszkózus genny folyik, benne pici, sárgás szemcsékkel (kén granulumok) Emberben az actinomycosis leggyakrabban a cervicofacialis területen (actinomycosis cervicofacialis), hasban (actinomycosis abdominalis), ill. mellkasban keletkezik (actinomycosis pulmonalis). (gör: actino- + mykés, gomba + osis, állapot)
actinomycoticus
actinomycosissal kapcsolatos
actinotherapia
1. sugaras gyógykezelés 2. dermatológia: ultraibolya fény terápia
actomyosin
Protein komplex, amely actinból és myosinból áll; ez az izomrostok alapvető kontraktilis anyaga.
acuitas
1. élesség, világosság, félreérthetetlenség 2. súlyosság (lat: acuo pp acutus, élez)
aculeatus
pontozott, éles csúcsokkal fedett (lat: aculeatus, pontozott)
acuminatus
pontozott, hegyes, éles (lat: acomino pp atus élesít)
acusticus
hallásra vonatkozó, hallást érintő (gör: akoustikos, hallásra vonatkozó)
Találatok Magyarázat
nervus acusticus hallóideg, VIII.agyideg
acyanopsia
kék szín észlelésének hiánya
acyanoticus
cyanosis hiányával jellemezhető
acystia
congenitalis húgyhólyag hiány (gör: a- fosztóképző + kystis, hólyag)
ad libitum
(ad lib.) szabadon, amint kívánatos, tetszés szerint
ad manus medici (ad m. m.)
az orvos kezébe
ad sat.
lat: ad saturatum, telítődésig
ad us
. int. lat: ad usum internum, belső alkalmazásra
ad us. ext.
lat: ad usum externum, külső alkalmazásra
ad us. propr.
lat: ad usum proprium, saját használatra
ad-
1. hozzá, felé 2. Prefixum, amely összetételekben növekedést, hozzákapcsolódást jelent. (lat: ad- hoz, felé)
adactylia
congenitalis ujj hiány (kézen, vagy lábon) (gör: a-, fosztóképző + daktylos, ujj)
adamantinocarcinoma
fogzománchám rákos megbetegedése
adamantinoma
zománchám jóindulatú szövetszaporulata
adamantoblast
fogzománcsejt
ádámcsutka
szinonima: prominentia laryngea
adaptáció
1. Egy species tagjainak túlélési előnye, mivel a fenotípusuk fokozott lehetőséget ad számukra a környezethez való alkalmazkodásra. 2. Egy szervnek, szövetnek, vagy ezek működésének kedvező változása, alkalmazkodása az új környezettel való találkozás nyomán. 3. retina alkalmazkodása a fény intenzitásához 4. Bizonyos receptorok megváltozott tulajdonsága, amellyel az állandó intenzitású ismételt ingerre módosítják a választ. 5. Egy helyreállító anyag pontos fedése, illeszkedése a hozzá kapcsolódó fog, csont stb. alakjának megfelelően. 6. Dinamikus folyamat, amelyben a gondolatok, érzések, és a magatartás folytonosan változnak az adott egyénben a változó környezetnek megfelelően. 7. homeosztatikus válasz (lat: adapto, alkalmazkodni)
Találatok Magyarázat
maladaptáció hiányos, vagy nem megfelelő adaptáció
photopicus adaptáció A látás fokozott megvilágításhoz történő alkalmazkodása, amely során a retina fény iránti érzékenysége mérséklődik. ? retinalis adaptáció megvilágításhoz történő alkalmazkodása az ideghártyának
scotopicus adaptáció A látás alkalmazkodása a csökkent világításhoz, amely során a retina érzékenysége fokozódik.
adapter
1. egy apparátus két elemét összekötő rész 2. elektromos áram átalakító
adaptométer
szerkezet, amely alkalmas a retina sötéthez való adaptációjának meghatározására, a minimális fényküszöböt ki tudja mérni
adde
(lat; röv: add.) adj hozzá; addantur adassék hozzá; addendus hozzáadandó; addendo hozzáadással
addendum
kiegészítés, adalék
addíció
1. összegzés 2. kémiai reakció, mely két vegyület egyesülésével jár
addict
szenvedélybeteg, kóros drogfüggőségben szenvedő egyén
addictio
Gyógyszerhez, vagy kábítószerhez való pszichés és fizikai függőséggel járó állapot, amely már kicsúszott az akarat ellenőrzése alól. (lat: addico, addictus, beleegyezés) ld. abusus, dependentia
Addis-szám
12 óra alatt gyűjtött vizeletben található alakos elemek (vörösvérsejtek, fehérvérsejtek stb.) száma
Addison-kór
bronzkór; mellékvesekéreg alulműködésével járó krónikus betegség
Addison-krízis
mellékvesekéreg pusztulása miatt hirtelen kialakuló súlyos mellékvesekéreg elégtelenség
additív
1. járulékos, hozzáadott, kiegészítő 2. táplálék mesterségesen hozzáadott, járulékos, de a szervezet számára hasznos alkotórésze 3. genetikai, epidemiológiai, élettani, statisztikai, farmakológiai stb. vizsgálatokban: két, vagy több tényező összegzett, kombinált hatása megfelel az egyenkénti hatások összegének vö: szinergizmus
adducens
(középvonal felé) közelítő
adductio
1. a test valamely részének a középvonal felé történő elmozdulása 2. a szem monocularis rotatioja az orr irányába 3. ilyen irányú elmozdulásból adódó helyzet vö: abductio (lat: adduco pp. ductus, közelíteni)
adductor
Olyan izom, amely valamely testrészt a medián sík felé, vagy kéz esetén a középső ujj, lábon a második lábujj tengelyállásának irányába mozgatja.
aden-, adeno-
összetett alakban mirigyet jelöl szinonima: glandularis (gör: aden, adenos, mirigy)
adendriticus
dendrit mentes (gör: a-, fosztóképző + dendron, fa)
adenectomia
1. valamely mirigy sebészi kimetszése 2. garatmandula műtéti eltávolítása (gör: aden- + ektomé, excisio, kivágás)
adenectopia
valamely mirigy szabályos anatómiai helyzettől eltérő elhelyezkedése (gör: aden- + ek, ki + topos, hely)
adeniformis
mirigyszerű szinonima: adenoid
adenil
adeninnek ionja, vagy gyöke
adenil-cikláz
a ciklusos AMP (cAMP) ATP-ből való keletkezését katalizáló enzim
adenilát
adenilsav (AMP) sója, vagy észtere
Találatok Magyarázat
adenilát cikláz ATP-re ható, plazma membránhoz kötött enzim, amely pirofoszfát lehasításával 3"-5"-ciklikus AMP-t állít elő. Szinonima: 3"-5"-ciklikus AMP szintetáz
adenilát kináz Egy foszfotranszferáz, amely az ADP molekulájának reverzibilis foszforilálását végzi el MgADP révén MgATP-vé és AMP-vé (AMP+ATP↔ 2 ADP). Szinonima: adenilsav kináz, myokináz
adenine (A, Ade)
purinvegyület, amely RNS-ben és DNS-ben, de különböző szabad nukleotidokban is megtalálható
Találatok Magyarázat
adenine (A, Ade) dezoxiribonukleotid szinonima: dezoxiadenilsav
adenine (A, Ade) nukleotid szinonima: adenilsav
adenitis
valamely mirigy gyulladása (gör: aden- + -itis, gyulladás)
adenoacanthoma
Malignus neoplasma, amely ált. jól differenciált glandularis epithelsejtekből (adenocarcinoma) áll, helyenként elszarusodó (vagy epidermoid) neoplasiás gócokkal.
adenoblast
proliferáló embrionális sejt mirigyes parenchymát kialakítására alkalmas potenciállal (gör: adeno + blastos, csíra)
adenocarcinoma
mirigyes, vagy mirigyszerű epithel sejtekből felépített malignus daganat
Találatok Magyarázat
acinus sejtes adenocarcinoma racemosus mirigy szekréciós sejtjeiből keletkezőadenocarcinoma; főleg nyálmirigyből ered
adenocarcinoma papillare Bolyhozott felszínű adenocarcinoma, amelyben a vascularis kötőszövetből álló ujjszerű nyúlványok daganatos epitheliummal fedetten növekednek.
adenocellulitis
mirigy, vagy nyirokcsomó környező szövetekre terjedő gyulladása
adenochondroma
szinonima: pulmonaris hamartoma (gör: adeno- + chondros, porc + -oma, tumor)
adenocystoma
adenoma, amelyben a neoplasiás glandularis epithelium cystát képez
adenocyta
mirigyek szekretoros sejtje (gör: adeno- + kystos, üreg, sejt)
adenodynia
valamely mirigy fájdalma; szinonima: adenalgia
adenofibroma
benignus daganat, amely mirigyszövetből és fibrosus állományból áll
adenofibromyoma
benignus daganat, amely mirigyszövetből, fibrocytákból, valamint simaizom sejtekből áll szinonima: adenomatoid tumor
adenofibrosis
szinonima: adenosis
adenogen
mirigyszövet eredetű
adenographia
valamely mirigy röntgenvizsgálata
adenohypophysealis
adenohypophysissel kapcsolatos
adenohypophysectomia
adenohypophysis műtéti eltávolítása
adenohypophysis
Az adenohypophysis a hypophysis elülső lebenye, amelyet anatómiailag distalis, közti és infundibularis (nyél) részre osztunk. Ld. hypophysis; szinonima: lobus anterior hypophyseos
adenohypophysitis
Gyulladásos reakció, amely a hypophysis elülső lebenyére ráterjed, gyakori terhesség mellett.
Találatok Magyarázat
adenoid 1. mirigyszerű, mirigyes küllemű szinonima: adeniformis, lymphoid 2. tonsilla pharyngea, garatmandula (gör: adeno- + eidos, megjelenés)
adenoidectomia
tonsilla pharyngea műtéti eltávolítása (gör: adenoid + ektomé, kimetszés)
adenoiditis
tonsilla pharyngea gyulladása
adenolipoma
Benignus tumor, amelyet glandularis és zsírszövet képez. (gör: aden-, mirigy + lipos, zsír + -oma, tumor)
adenolipomatosis
olyan állapot, amelyben multiplex adenolipoma fejlődik
adenoma
Mirigyhám sejtekből származó benignus daganat, amely rendszerint jól körülhatárolt, a környezetet inkább nyomja, de nem infiltrálja. (gör: adeno + -oma, daganat)
Találatok Magyarázat
acidophil adenoma Az adenohypophysis daganata, amelyben a sejtek citoplazmája savanyú festékeket vesz fel. Gyakori a növekedési hormont termelő sejtek részvétele. Szinonima: eosinophyl adenoma
ACTH-termelő adenoma Hypophysis daganat, amely ACTH-t előállító, ált. basophil festődésű sejtekből áll; Cushing-kór, vagy Nelson-szindróma okozója lehet.
apocrin adenoma szinonima: papillaris hidradenoma
basophil adenoma Az adenohypophysis daganata, amelynek sejtjei bázikus festékeket vesznek fel, gyakran ACTH-t termelnek.
bronchusadenoma benignus, a bronchus nyálkahártya mirigyeiből, vagy azok ductusából kiinduló polipoid daganat
chromophil adenoma minden adenoma, amelynek sejtjei könnyen festődnek
chromophob adenoma Az adenohypophysis daganata, amelynek sejtjei sem savas, sem bázikus festéket nem vesznek fel.
eosinophil adenoma szinonima: acidophil adenoma
adenoma fibrosum kötőszöveti rostos elemeket tartalmazó benignus daganat szinonima: fibroadenoma
növekedési hormont termelő adenoma Olyan adenoma, amely a gigantismus, vagy az acromegalia klinikai képét idézi elő, bár az ezt alkotó sejtek harmada nem tartalmaz semmilyen granulát, acidophil és chromophob sejtek keveréke. Egyes esetekben mind növekedési hormont, mind prolaktint elválasztanak a tumorsejtek. Gyakori köztük az acidophil, vagy eosinophil adenoma.
hepaticus adenoma A máj benignus tumora, mely rendszerint olyan nőknél figyelhető meg, akik hosszan szedtek oralis fogamzásgátlót.
Hürtle sejtes adenoma A thyreoidea daganatok ritkább képviselője; sejtjeiben bőségesen látható eosinophil citoplazma, számos mitochondrium. Gyakran malignus, metastasist képez, ritkán vesz fel jódot.
papillaris cysticus adenoma Olyan adenoma, amelyben az acinusok lumenei gyakran folyadékot tartalmaznak és a neoplasiás epithel sejtek szabálytalan, ujjszerű kitüremkedéseket képeznek.
prolaktin termelő adenoma Olyan hypophysistumor, amelyben prolaktin termelő sejtek találhatók. Klinikai tünetek között nőknél secunder amenorrhoea és galactorrhoea szerepelnek (Forbes-Albright szindróma), illetve férfiakon impotencia jelentkezhet. Szinonima: prolactinoma
adenoma sebaceum faggyúmirigyek benignus daganata, túlsúlyban érett faggyútermelő sejtekkel
villosus adenoma Szoliter, sessilis (nyél nélküli), gyakran nagy daganat a colon mucosájából kiindulva. Nyáktermelő epithelsejtekből áll, amelyek igen finom érnyúlványokat fednek. Malignus elfajulás igen gyakori. Szinonima: papillaris adenoma
adenomatoid
adenomára hasonlító
adenomatosis
multiplex glandularis növedékekkel jellemezhető elváltozás
Találatok Magyarázat
pulmonalis adenomatosis daganatos betegség, amelyben az alveolusokat és a distalis bronchusokat nyáktermelő hengerhám sejtek töltik ki. Jellemző tünetek: bőséges, rendkívül tapadós nyák, hidegrázás, láz, köhögés, dyspnoe és pleuralis fájdalom.
adenomatosus
adenomával kapcsolatos, vagy glandularis hyperplasiára jellemző
adenomegalia
valamely mirigy megnagyobbodása
adenomyoma
Benignus izomdaganat (rendszerint simaizom eredetű), amelyben mirigyes elemek is találhatók. Leggyakrabban a méhben és az uterus szalagjaiban alakul ki. (gör: aden-, mirigy + mys, izom + -oma, daganat)
adenomyosarcoma
Malignus izomdaganat, amelyben mirigyes elemek is találhatók.
adenomyosis
adenomatosus szövet diffúz ectopiás implantatioja simaizomba (gör: aden- , mirigy + myo, izom + -osis, állapot)
adenopathia
nyirokcsomó, v. mirigy duzzanata, kóros megnagyobbodása (gör: adeno- + pathos, szenvedés)
adenosalpingitis
szinonima: salpingitis isthmica nodosa
adenosarcoma
mesodermalis és glandularis epitheliumból kiinduló malignus neoplasma
adenosis
generalizált mirigybetegség ritkán használt terminusa
Találatok Magyarázat
microglandularis adenosis Az emlőben kis tubulusok szabálytalan halmaza van jelen az adiposus, vagy fibrosus szövetben; emlékeztet tubularis carcinomára, de nincs a stromában fibroblastos proliferatio.
adenosis sclerotisans Az emlőben kialakuló nodularis benignus elváltozás, mely gyakran fiatal nőkön mutatkozik. Hyperplasticus, torz lobulusokba rendezett acinaris szövet észlelhető megnövekedett kollagén stromával. Az elváltozás néha mikroszkóposan is nehezen különíthető el a carcinomától. A prostatában is kialakulhat benignus nodulsaris adenosis, amelyben acinaris szövet látható felszaporodott stroma mellett. A basalis sejtréteg jellegzetes simaizom metaplasiát mutat. Szinonima: adenofibrosis
adenotomia
mirigy műtéti bemetszése (gör: adeno- + tomé, vágás)
adenotonsillectomia
tonsillák, ill. adenoidok műtéti eltávolítása
Adenoviridae
DNS vírusok családja, adenovírusként ismertek, a fertőzött emlős- és madársejtek magjában fejlődnek.
adenovírus
Az Adenoviridae család valamely tagja. Több mint negyven típusárólismert, hogy emberre fertőző, akut felső légúti fertőzést, conjunctivitist, gastroenteritist, haemorrhagiás cystitist, valamint az újszülöttek súlyos fertőzését okozzák. Szinonima: Adeno-pharingeo-conjunctivalis vagy A-P-C vírus (gör: aden-, mirigy + virus)
adenozin (Ado)
Az adenin és D-ribóz kondenzációjából keletkező purinvázas nukleozid, mely szerepet játszik a sejtek energiaforgalmában (adenozin (Ado) trifoszfát), intracellularis jelátvitelben (cAMP), nukleinsavak felépítésében.
Találatok Magyarázat
adenozin (Ado) difoszfát ld. adenozin 5"-difoszfát
adenozin (Ado) monofoszfát (AMP) adenozin 5"-monofoszfát ld. adenilsav
adenozin (Ado) foszfát specifikusan adenozin 3"-, vagy 5"- foszfát Az adenozin és foszforsav kondenzációs terméke; nukleinsavak hidrolízise során keletkező nukleotid. Szinonima: adenin nukleotid
adenozin (Ado) 5"-foszfoszulfát (APS) PAPS (aktív szulfát) képződésében intermedier termék
adenozin (Ado) trifoszfát szinonima: adenozin 5"-trifoszfát
adenozin 3"-5"-ciklikus monofoszfát (cAMP)
ATP-ből keletkezik adenilát cikláz hatására és 5"-AMP-vé bomlik foszfodiészteráz által. Intracellularis jelátvitel szabályozásában fontos second messenger molekula, mely különböző protein kinázok aktivátora. Szinonima: ciklikus AMP
adenozin 5"-difoszfát (ADP)
Az adenozin és pirofoszforsav kondenzációs terméke; az ATP-ből hidrolízissel keletkezik a terminális foszfát csoport lehasadásával.
adenozin 5"-trifoszfát (ATP)
Az adenozin trifoszforsavval 5" helyen történő észterifikációja nyomán keletkező molekula. Közvetlen prekurzora az adenin nukleotidoknak a nukleinsavakban, ill. a sejtek elsődleges energia szolgáltatója. Szinonima: adenozin 5"-pirofoszfát
adenozin trifoszfatáz (ATP-áz)
Az adenozin trifoszfatáz (ATP-áz) katalizálja a terminális foszfát csoport lehasadását az adenozin 5"-trifoszfátról; az izomban (myosinban) lévő nagy koncentrációban jelen lévő enzim, de máshol is kimutatható.
adeps,
gen.adipis, pl. adipes 1. zsír, vagy adiposus szövet 2. olvasztott sertészsír, amelyet kenőcsök előállítására használnak Ld. még adeps, lanae
Találatok Magyarázat
adeps, lanae birka (Ovis aries, Bovidae család) gyapjújából eltávolított olajos anyag, melyet lágyítóként krémek és kenőcsök alapanyagául használnak fel.
adermia
congenitalis bőrhiány (gör: a- fosztóképző +derma, bőr)
adermogenesis
bőr regenerációjának elégtelensége, vagy hiánya; bőrfejlődési rendellenesség (gör: a- fosztóképző + derma, bőr, + genesis, eredet)
adhaesio
1. két rész felületének egyesítése, vagy összetapadása, főleg a sebszélek esetén 2. kóros összenövés; pl. serosa felületek összetapadása gyulladás következtében 3. molekulák egymással való kapcsolódása (pl. antigén-antitest komplex kialakulása) 4. érintkező testek felülete közötti molekuláris vonzás (lat: adhaesio, tapadás)
Találatok Magyarázat
primaer adhaesio szinonima: elsődleges sebgyógyulás
secundaer adhaesio szinonima: másodlagos sebgyógyulás
adhaesiotomia
adhaesiok sebészi úton történő oldása, szétválasztása
adhaesivus
1. adhaesióval kapcsolatos, vagy adhaesióra jellemző 2. bármely olyan anyag, amely valamely másik felületettel érintkezve a felületek között tapadást hoz létre 3. rögzítő anyag, pl. tapasz
adiadochokinesis
Képtelenség gyors, egymást követő, váltakozó mozgás kivitelezésére; a cerebellaris diszfunkció jele. vö: diadochokinesia (gör: a- fosztóképző + diadochos, egymásra következő + kinesis, mozgás)
adiaphoresis
szinonima: anhydrosis (gör: a- fosztóképző + diaphoresis, verejtékezés)
adiaphoria
Képtelenség arra, hogy egy ingersorozat után hasonló stimulusra reagáljon a szervezet. (gör: a- fosztóképző + dia, át + phoros, hordoz)
adip-, adipo-
zsír-; megfelel a görög lipo-nak (lat: adeps, lágy állati eredetű zsír)
adipes
ld. adeps
adipis
ld. adeps
adipo-
ld. adip-
adipocellularis
zsírsejtekre, esetleg zsírszövetre, vagy olyan kötőszövetre vonatkozó, amelyben sok a zsírsejt
adipoceratosus
adipocere-re vonatkozó szinonima: lipoceratosus
adipocere
Hullaviasz; zsírszerű anyag, amely levegőmentes, állandó hőmérsékletű, nedves helyen holttestekben lezajló átalakulás során képződik; oldhatatlan zsírsavak és szappanok keverékéből áll. (lat: adipo + cera, viasz)
adipocyta
szinonima: zsírsejt
adipogenesis
szinonima: lipogenesis
adipoid
szinonima: lipoid (gör: adipo- + eidos, hasonló)
adipokinetikus
Olyan anyag, vagy faktor, amely a zsírszövetekben lerakódott és tárolt lipidek mobilizációját okozza. (gör: adipo- + kinesis, mozgás)
adipokinin
A hypophysis elülső lebenyének egyik hormonja, amely a zsírraktárak mobilizációját idézi elő. Szinonima: adipokineticus hormon
adiponecrosis
zsírszövet elhalása
adiposis
Az adiposis nagy mértékű lokális, vagy generalizált zsírlerakódás a szervezetben. Szinonima: lipomatosis, liposis, steatosis (gör: adipo- + -osis, állapot)
Találatok Magyarázat
adipositas kövérség, elhízás, lokálisan, vagy generalizáltan kialakuló, kóros zsírfelhalmozódás; szinonima: obesitas
adiposis cardiaca szinonima: szív elzsírosodása
adiposis universalis egész szervezetet érintő kóros zsírfelszaporodás
adiposuria
zsír ürítése a vizeletben szinonima: lipuria (gör: adipo- + ouron, vizelet)
adiposus
kövér, zsíros
adipsia
szomjúság érzés kiesése, hiánya
aditus pl. aditus
nyílás, bemenet; szinonima: apertura (lat: access, bemenni)
Találatok Magyarázat
aditus pl. aditus laryngis gégebemenet
adiuretin
ld. antidiuretikus hormon (ADH)
adjuváns
1. Olyan anyag, amelyet a gyógyszer formulázásához adva meghatározható módon befolyásolja az aktív hatóanyag hatását. 2. Immunológia: az antigén immunogenitását fokozó vehiculum. Ilyen immunogenitást növelő adjuváns lehet pl. ásványi anyagok szuszpenziója (alumínium sók, alumínium-hidroxid, vagy -foszfát), amelyben az antigén adszorbeálódik, vagy víz-olaj emulzió, amelyben az antigén emulziót képez (Freud-féle inkomplett adjuváns), továbbá víz-olaj emulzió elölt mycobacteriumokkal együtt (Freud-féle komplett adjuváns). (lat: adjuvo, segít)
adnervalis
szinonima: adneuralis
adneuralis
1. ideghez közeli, ideg irányában 2. elektromos áram, amely az izomszöveten át az ideg belépési pontja felé halad szinonima: adnervalis
adnexa
sing. adnexum
Találatok Magyarázat
adnexa uteri méhfüggelékek; petevezeték, petefészek közös elnevezése
adnexectomia
méhfüggelékek (adnexa uteri) műtét során való eltávolítása; szinonima: adnectomia
adnexitis
A méhfüggelékek gyulladása, mely rendszerint ascendáló fertőzés következménye.
adnexopexia
méhfüggelékek rögzítése műtét során
adnextumor
méhfüggelékek gyulladásos duzzanata, vagy daganatos megbetegedése
adnexum
(plur. adnexa) valamely szervhez tartozó mellékstruktúra, függelék; szinonima: annexum (lat: kapcsolt részek)
adolescent
(ang.) 1. adolescentiára vonatkozó 2. serdülő
adolescentia
Az élet azon periódusa (14-20 év), amely a pubertással (másodlagos nemi jelleg kialakulásával) kezdődik, és a fizikális fejlődés teljes befejeződéséig tart. Szinonima: serdülőkor
ADP
adenozin-5"difoszfát
ADR
(adverse drug reaction) gyógyszer mellékhatás
adren(o)-
mellékvesével kapcsolatos (lat: ad-, -hoz, közel + renes, vesék)
adren-
ld. adreno-
adrenalectomia
mellékvese eltávolítás (gör: adren- + ektomé, eltávolítás)
adrenalin
szinonima: epinephrin
adrenalis
1. veséhez közeli 2. mellékveséből származó, mellékvesével kapcsolatos (lat: ad, -hoz, + ren, vese)
Találatok Magyarázat
adrenalitis mellékvese gyulladása; szinonima: adrenitis
adrenalopathia
bármilyen mellékvesét érintő kóros állapot (gör: adren- + pathos szenvedés)
adrenarche
hónalj- és szeméremszőrzet növekedése pubertás során
adrenectomia
mellékvese műtéti eltávolítása; szinomima: adrenalectomia
adrenerg
1. Az autonóm idegrendszer olyan idegsejtjei, vagy idegrostjai, amelyekben norepinephrin a neurotranszmitter. vö: kolinerg 2. Olyan gyógyszerre vonatkozik, amely az adrenalinhoz hasonló hatású, ill. azon a receptoron hat, amelyhez az epinephrin is kötődik. Ld. receptor címszónál: adrenerg-receptor (gör: adren- + ergon, munka)
adrenerg bénítók
Olyan hatóanyagok, amelyek szelektíven gátolják a szimpatikus adrenerg idegek aktivitását (sympatholyticum) és blokkoló hatást fejtenek ki az epinephrinre, norepinephrinre és más adrenerg aminokra (adrenolyticum). Két különböző osztályuk létezik: az α- és α--adrenerg receptor blokkolók.
Találatok Magyarázat
α-adrenerg receptor blokkolók Olyan hatóanyagok, amely kompetitív módon gátolják az α-adrenoceptorokat. A hypertensio kezelésében kerülnek felhasználásra.
β-adrenerg receptor blokkolók A gyógyszerek azon csoportja, amelyek a -adrenerg agonistákkal kompetitív módon versengenek a rendelkezésre álló receptor helyek iránt. Egyes vegyületek mind a e1- és -2-receptorokat blokkolják (pl. propranolol), míg mások csak a -1- (pl. metoprolol), vagy csak a -2-receptorokat gátolják. A --receptor blokkolók elsősorban különböző cardiovascularis betegségekben alkalmazandók, ahol a g-adrenerg blokád kívánatos. A -1-receptor (kardioszelektív) blokkolók előnye a non-szelektív vegyületekkel szemben a kedvezőbb mellékhatás profil (↓ bronchokonstrikció). Szinonima: béta-blokkolók
adrenerg neuronblokkolók Olyan gyógyszerek, amelyek gátolják a norepinephrin kiáramlást a szimpatikus idegvégződésekben.
adrenitis
ld. adrenalitis
adrenoceptor
Olyan receptor, amelynek endogén ligandja az epinephrin, ill. a norepinephrin. Szinomima: adrenerg receptor
adrenocorticalis
mellékvesekéreghez tartozó
adrenocorticomimeticus
mellékvesekéreg hatásait utánzó (gör: adreno- + cortex, kéreg + mimetikos, utánzó)
adrenocorticotrop hormon
ld. ACTH
adrenogen
mellékvese eredetű (gör: adreno + -gen, képző)
adrenogenitalis szindróma
A mellékvesekéreg veleszületett vagy szerzett androgén túltermelésével járó kórkép, amely virilisatiot okoz.
adrenoleukodystrophia
Gyermekkorban jelentkező, öröklődő (X kromoszómához kötött, recesszív) anyagcserezavar, mely mellékvese sorvadással és kiterjedt demyelinisatioval jár; mentalis retardatiot, vakságot okoz a corticospinalis pályák károsodása mellett.
adrenolyticus
Az epinephrin, norepinephrin és egyéb sympathomimeticumok antagonistáit, ill. ezek hatását jelzi. (gör: adreno- + lysis, oldás)
adrenomegalia
mellékvese megnagyobbodás (gör: adreno + megas, nagy)
adrenomimetikus
1. epinephrinhez, norepinephrinhez hasonló hatású 2. (helytelenül) szinonimaként: sympathomimeticus; vö: adrenerg, cholinomimeticus (gör: adreno + mimetikos, utánzó)
adrenomyeloneuropathia
Felnőtt férfiak betegsége, akiknél mellékvese elégtelenség, hypogonadismus, progresszív myelopathia, perifériás neuropathia és sphincter zavarok állnak fenn. Valószínűleg az adrenoleukodystrophia egyik változata. (gör: adreno- + myelos, velő + neuron, ideg + pathos, szenvedés)
adrenopathia
szinonima: adrenalopathia
adrenotropin
szinonima: adrenocorticotrop hormon (ACTH), corticotropin
adst. feb.
lat: adstante febre, ha láz van jelen
adszorbens
1. szilárd anyag, mely a felületén folyadék, vagy gáz megkötésére képes 2. antigén vagy antitest az immunadszorpció folyamatában 3. toxinok megkötésére képes anyag, amely hasmenések, ill. mérgezések kezelésében fontos (pl. orvosi szén, kaolin, talkum, pektin)
adszorpció
Valamely szilárd anyag a felületén folyadékot, gázt, vagy oldatban, ill. szuszpenzióban lévő anyagot köt meg. vö: abszorpción (lat: ad-, -hoz + sorbeo, felszív)
Találatok Magyarázat
immun adszorpció 1. antitest eltávolítása specifikus antigén alkalmazásával 2. antigén eltávolítása specifikus antiszérummal
adsztringens
Összehúzószer, mely nyálkahártyákon, ill. sebek felszínén fehérjék koagulációjával vékony védőhártyát hoz létre (pl. csersav, bizmut-, alumínium-, ólom-, és cinksók). Felhasználhatók hámregeneráció elősegítésére, idült gyulladások és sebek lokális kezelésére, vérzéscsillapításra, ill. egyes adsztringens-ek obstipálószerként is.
adterminalis
bármely struktúra vége felé irányuló
adulteratio
1. Bármilyen hatóanyagot megváltoztat, vagy hozzáad önkényesen olyan kiegészítést, amely eredetileg nem tartozott hozzá, és ezzel csökkenti a hatóanyag terápiás értékét. 2. hatóanyag meghamisítása, aktív anyag felhígítása
adultus
felnőtt; testileg és lelkileg érett (lat: felnőtt)
adventitia
Legkülső, kötőszöveti réteg, mely ereket, vagy bármely más, olyan szervet borít, amelyet nem fed serosa. Szinonima: membrana adventitia, tunica externa (vasorum) (lat: adventictius, távolról, kívűlről érkezni)
adventitius
A külső fedő réteggel kapcsolatos valamely szervben, vagy ereknél. Szinonima: adventitialisae- Azokat a szavakat, amelyek ae-vel kezdődnek, és nem találhatók itt, keresse az e-vel kezdődőknél!
aegrotus
beteg (lat.)
aequalis (aequ.)
egyenlő
aer-, aero-
levegő-, gáz-, légi, gázszerű (gör: aer, levegő)
aeraemia
levegő jelenléte a vérben
aerob
1. Olyan szervezet, amely csak oxigén jelenlétében képes élni és szaporodni. 2. Olyan szervezet, amely az oxigént végső elektron akceptorként használja a légzési láncban. (gör: aero + bios, élet)
Találatok Magyarázat
obligát aerob Olyan szervezet, amely nem képes élni és növekedni oxigénmentes környezetben.
fakultatív aerob Olyan szervezet, amely képes fermentációra áttérve oxigénmentes környezetben élni, de szaporodásának üteme lassul, vagy esetleg meg is szűnik.
aerobiosis
élet oxigén tartalmú atmoszférában (gör: aero- + biosis, életmód)
aerodinamika
gázok mozgását tanulmányozó tudományág (gör: aero- + dynamis, erő)
aerodontalgia
fogfájdalom akár az atmoszférikus nyomás növekedése, akár csökkenése esetén (gör: aero- + dens, fog, -algos, fájdalom
aeroembolia
légembólia
aerogen
1. légúti (infectio) 2. gáztermelő
aerokele
természetes üreg levegőtartalmú kitágulása, kiboltosulása (gör: aero- + kele, tumor)
aerokolpos
hüvely kitágulása gáz következtében (gör: aero + kolpos, üreg)
aerootitis media
Légnyomásváltozás okozta akut, v. krónikus középfülgyulladás, amelyben a dobüregi nyomás csökkenése áll be a környezeti nyomással szemben. Ez általában szekunder jelenség, a tuba elzáródásának következményeként jön létre. Gyakran repüléskor, magasból történő leereszkedés nyomán alakul ki. Szinonima: barootitis media (gör: aero- + ous, fül,+ itis, gyulladás)
aeropathia
légnyomásváltozás okozta kóros állapot
aerophagia
(abnormális) levegőnyelés (gör: aero- + phago, enni)
aerophil
1. levegőt, ill. oxigént kedvelő 2. aerob szervezetre vonatkozó jelző (gör: aero- + philos, szeret)
aerophobia
kóros félelem a friss levegőtől, vagy enyhe széltől (aero- + phobos, félelem)
aeropiesotherapia
betegek komprimált, vagy ritkított levegővel történő kezelése (gör: aero- + piesis, nyomás + therapeia, orvosi kezelés)
aeroplethysmograph
noninvazív légzési vizsgálatra alkalmas készülék
aerosinusitis
Az orrmelléküregek gyulladása, amelyet a sinus és a külső környezet közötti nyomáskülönbség okoz, pl. repülés esetén, nagy magasságba való emelkedéskor, ill. leereszkedéskor. Szekunder módon a sinus nyílásának elzáródása következtében is kialakulhat. Szinonima: barosinusitis
aeroszol
1. Folyadékot, vagy szilárd anyagot tartalmazó, levegőben, vagy más gázban diszpergált rendszer, amelyet terápiás, féregölő, vagy más célból állítanak elő. 2. Olyan terápiásan, illetve kémiailag aktív hatóanyagot tartalmazó készítmény, amelyet nyomás alatt csomagolnak; a felhasználáskor képződő gyógyszerfelhő helyi adásra, inhalációra, vagy testüregbe való bevezetés céljára alkalmazható. E gyógyszerforma előnye a gyorsan kialakuló hatás; hátrányát jelentik viszont a nagy egyéni, felszívódásban megfigyelhető különbségek.
Találatok Magyarázat
aerotherapia gyógykezelés levegő felhasználásával
aerothorax
ld. pneumothorax
aerotonometer
vérben oldott gázok nyomásának mérésére alkalmas készülék
Aesculapius
Az i.e. VII. századtól az orvostudomány isteneként tisztelt görög orvos. Leánya, Hügieia az egészség megszemélyesítője a görög mitológiában. Szent állata a kígyó, mely napjainkban is a gyógyszerészet jelképe. (lat: Aesculapius, gör: Asklépios)
Aesculus hippocastanum
vadgesztenye; hatóanyagait venotonikumként alkalmazzák
aesthesia
érzés
aether
ld. éter
Találatok Magyarázat
aether ad narcosim altatáshoz használt éter
afebrilis
láztalan, szinonima: apyreticus
affekció
1. érzelem, érzékenység, felindulás 2. kóros testi, vagy pszichés állapot; hajlam (lat: affectio, befolyás)
affektív
1. érzékeny 2. érzelmileg színezett; érzelmi; indulati
Találatok Magyarázat
bipoláris affektív zavarok hangulat és affektivitás visszatérő hullámzása (↑: mania; ↓: depressio)
affektivitás
érzelmi jelenségek összessége (pl. emóció, érzések, indulatok)
affektus
1. érzelem, indulat 2. érzelmek külső megjelenése (lat: affectus, az elme állapota)
afferens
odavezető; centrum felé irányuló (artéria, véna, nyirokér, ideg stb.); (lat: afferens, hozzá vezető) vö: efferens, elvezető; szinonima: centripetalis
affinitás
1. kémiai kötés kialakítására való hajlam 2. valamely szövet szelektív festése egy bizonyos festékkel 3. Fab antitest fragmentum és az antigén determináns csoportja közötti kötés erőssége (lat: affinis, szomszédos)
affixus
rögzített
afibrillaris
Olyan biológiai struktúrát jelez, amelyben nincsenek fibrillumok.
afibrinogenaemia
fibrinogén hiány a plazmában; ld. hypofibrinogenaemia
Találatok Magyarázat
congenitalis afibrinogenaemia véralvadás ritkán előforduló zavara, melynél nem, vagy alig lehet fibrinogént a plazmában kimutatni.
afterimage
látási válasz tartós fennmaradása a kiváltó stimulus megszünte után
afterload
1. Az afterload az az izom összehúzódása során jelentkező erő, mely szemben az izom megrövidülése során munkát végez. 2. Szívizom esetében: az afterload az az erő, amely a relaxációt követő inger nyomán kialakuló szívizomrost összehúzódásnak áll ellen. Nagysága arányos az aortabillentyű nyílásakor mért systolés vérnyomással, ill. a legnagyobb systolés falfeszüléssel. Szinonima: utóterhelés
Ag
1. ezüst vegyjele (argentum) 2. antigén
agalactia
tejelválasztás hiánya szülés után az emlőben (gör: a-, fosztóképző + gala, tej) szinonima: agalactosis
agalactorrhoea
hiányzik a tejelválasztás, vagy tejfolyás (gör: a-, fosztóképző + gala, tej + rhoia, folyás)
agalactosis
szinonima: agalactia
agaméta
ivartalanul szaporodó (pl. hasadással, bimbózással stb.) élőlény sejtje (gör: agamos, nem házas)
agammaglobulinaemia
A szérum globulin gamma frakciója hiányzik, vagy igen alacsony a gamma-globulin szint; fertőzésekkel szembeni csökkent ellenállóképességgel járó állapot. Gyakran pontatlanul az immunglobulinok hiányára utalnak e szóval. Ld.: hypogammaglobulinaemia
aganglionosis
ganglion mentesség állapota (pl. congenitalis megacolon esetén a plexus myentericusból hiányzanak a ganglionok) (gör: a-, fosztóképző + ganglion + osis, állapot)
agar
Tengeri algákból kivont poliszacharid, amelyet szilárdító anyagként használnak tenyésztési táptalajokban. (bengál szó)
Találatok Magyarázat
eosin-metilénkék agar Táptalaj, amely peptont, laktózt, szukrózt, valamint eosint és metilénkéket tartalmaz. Alkalmas arra, hogy elkülönítse a laktózt fermentáló és nem fermentáló Gram-negatív baktériumokat.
MavConkey agar Táptalaj, amely peptont, laktózt, epesókat, neutrálvöröst és kristályibolyát tartalmaz. Alkalmas arra, hogy azonosítsa a Gram-negatív bacillusokat, és laktóz fermentációs tulajdonságukkal jellemezze őket. A fermentáló baktériumok telepei vörösek, a nem fermentálóké színtelenek.
Sabouraud-féle dextrózagar Enyhén savas kémhatású (pH=5,6) dextróz-pepton táptalaj, amelyen a patogén gombák jól növekednek.
Thayer-Martin agar Hasonló, mint a Mueller-Hinton agar, de 5% hemolizált birkavért és antibiotikumokat is tartalmaz. A Neisseria gonorrhoeae és a Neisseria meningitidis primer izolálására és transzportálására használják.
agastria
gyomor congenitalis hiánya (gör: a-, fosztóképző + gaster, has)
agenesis
kialakulás hiánya, tökéletlen fejlődés (gör: a-, fosztóképző+ genesis, produkció)
agenitalismus
genitaliák veleszületett hiánya
agenosomia
A genitalia kóros fejlődése, vagy hiánya fetusban. Rendszerint a hasi zsigerek nem teljesen zárt hasfalon keresztüli előesésével együtt észlelhető. (gör: a-, fosztóképző + genos, nem + soma, test)
ágens
1. Aktív szubsztancia, vagy erő, amely képes valamely hatást kiváltani. A felsorolásban nem részletezett ágenseket ld. specifikus elnevezésüknél. 2. Valamely betegséggel kapcsolatban álló tényező (pl. mikroorganizmus, kémiai anyag jelenléte vagy hiánya, sugárzás stb.), amely lényeges a betegség megjelenéséhez. (lat: ago pres. part. agens, véghezvisz)
Találatok Magyarázat
delta-ágens szinonima: hepatitis D-vírus
Eaton-ágens szinonima: Mycoplasma pneumoniae
fizikai ágensek Akusztikus, elektromos, mechanikus, termikus, vagy fényenergiai stb. hatások, amelyek az élő szervezetre, szövetekre hatva megváltoztatják az élettani folyamatokat, és esetleg ezzel kapcsolatban terápiás hatást fejtenek ki.
Pittsburgh-pneumonia ágens szinonima: Legionella micdadei
ageusia
ízérzés elvesztése (gör: a-, fosztóképző + geusis, íz)
agglutináns
agglutinatiot okozó anyag (lat: ad-, -hoz + gluten, ragasztó)
agglutinatio
1. Az a folyamat, amelyben szuszpendált baktériumok, sejtek, vagy egyéb antigének csapódnak ki immunsavó (agglutinin) hatására. A precipitációhoz hasonlóan történik, de a részecskék az agglutinatio esetén nagyobbak, és nem oldatot, hanem szuszpenziót képeznek. A különböző vércsoportok specifikus reakcióit ld.vércsoportok címszónál. 2. sebfelülethez történő adhesio (lat: ad-, -hoz + gluten, enyv)
Találatok Magyarázat
bacteriogén agglutinatio erythrocyták összecsapzódása baktériumok, vagy valamely baktérium termékének (bakterioagglutinin) hatására
hideg agglutinatio vörösvérsejtek agglutinatio-ja a vér testhőmérséklet alatti hőmérsékletre való lehűtése után saját (ld. autoagglutinatio), vagy bármely más szérum hatására. Normál személy vérében is látjuk néha, de kóros jelenségként Mycoplasma pneumoniában, mononucleosis infectiosában, egyes protozoon fertőzésekben, vagy lymphoproliferatív kórképekben észlelhető.
agglutinin
Olyan antitest vagy egyéb anyag, amely összecsapzódást, agglutinatiot képes baktériumok, vagy egyéb sejtek esetén előidézni.
Találatok Magyarázat
csoport agglutinin Immunspecifikus agglutinin, amely egy közös, ún. csoport antigénre specifikus. Szinonima: keresztreaktív agglutinin
H-agglutinin 1. Olyan agglutinin, amely termolabilis antigén hatására képződik, illetve ezzel reagál. Ilyen antigének általában csillószőrös mikroorganizmusok csillóiban találhatók. 2. ld.vércsoportok címszónál
hideg agglutinin Olyan antitest, amely 37 C0 alatti hőmérsékleten fokozottan okoz agglutinatiot.
inkomplett agglutinin Olyan antitest, amely kötődik az erythrocytákhoz, de nem hoz létre agglutinatiot, ha sóoldatban szuszpendáljuk a vörösvérsejteket. Amennyiben viszont a szuszpendálás szérumban, vagy más proteinoldatban (pl. albumin oldatban) történt, létrejön az agglutinatio.
keresztreaktív agglutinin szinonima: csoport agglutinin
komplett agglutinin Olyan antitest, amely az erythrocytákat agglutinálja, ha azok sóoldatban, vagy proteinoldatban vannak szuszpendálva.
major agglutinin Olyan agglutinin, amely a legnagyobb mennyiségben van jelen az antiszérumban, és a domináns antigén stimulálja termelését.
minor agglutinin Az antiszérumban a major agglutininnál kisebb koncentrációban jelenlévő agglutinin. Szinonima: partialis agglutinin
O-agglutinin 1. Olyan agglutinin, amelynek képződését valamely mikroorganizmus sejttestében jelenlévő, relatíve termostabil antigén stimulálja. 2. ld.vércsoportok
partialis agglutinin szinonima: minor agglutinin
agglutinogen
agglutinatiot okozó ellenanyag (agglutinin) termelését kiváltó antigén (agglutinin + gör: gen, képződés)
agglutinophil
könnyen agglutinálódó (agglutinatio + gör: phileo, szeret)
aggravatio
kórkép tüneteinek szándékos eltúlzása, felerősítése
aggregatio
1. független, hasonló egységek csoportot alkotó összessége 2. masszaképződés, összetömörülés
Találatok Magyarázat
familiaris aggregatio Egy család több tagjában előforduló sajátosság, amelyet véletlen egybeeséssel, vagy genetikai tényezőkkel lehet magyarázni, de ez utóbbi szerepe nem bizonyított.
aggregatum
1. Individuális egységek összessége, amelyek csoportot formálnak. 2. részecskék (pl. atomok, ionok, molekulák) halmaza
aggregatus
csoportos, összetett
aggresszív
1. agressziót jelző 2. vetélkedő erőt, támadást mutató magatartási jellemző (pl. patogén mikroorganizmus, vagy betegség)
agit. ante us.
(lat.) agita ante usum, használat előtt felrázandó
agitatio
motoros nyugtalanság
aglossia
congenitalis nyelv hiány
aglossostomia
congenitalis nyelv hiány a száj fejlődési rendellenessége mellett (gör: a-, fosztóképző + glossa, nyelv + stoma, száj)
aglutitio
szinonima: dysphagia
aglycosuria
vizelet nem tartalmaz glükózt
agnathia
Az alsó állkapocs congenitalis hiánya, rendszerint a fülek egymáshoz való közeledésével társul. Ld. otocephalia, synotia (gör: a-, fosztóképző + gnathos, áll)
agnogen
szinonima: idiopathicus (gör: a-, fosztóképző + gnosis, tudás, genesis, eredet)
agnosia
A felismerés, a megértés, bizonyos érzékszervi stimulusok érzékelésének nehezítettsége, amelynek nem primer receptorialis károsodás az oka. (gör: a-, fosztóképző + gnosis, tudás)
Találatok Magyarázat
hallási agnosia A hangok, a szavak, a zene felfogásának képtelensége, amelyet temporalis lebenyben lévő elváltozások okoznak.
színagnosia A megfelelő szín megnevezése szenved zavart. A domináns occipitalis és temporalis lebeny elváltozása okozza.
ujjagnosia Az egyes ujjak megnevezésének képtelensége; sem a saját, sem mások ujjait nem ismeri meg. Leginkább a domináns félteke gyrus angularisának, vagy közeli területének elváltozása okozza.
tactilis agnosia A tárgyak tapintással történő felismerésének hiánya ép proprioceptív érzékelés mellett. Az ellenoldali parietalis lebeny károsodása okozza. Szinonima: astereognosis
visualis agnosia A tárgyak látás útján történő felismerésének hiánya, amelyet általában kétoldali parieto-occipitalis elváltozás okoz.
agomphosis, agomphiasis
szinonima: anodontia (gör: a-, fosztóképző + gomphos, ék)
agonadalis
gonadok hiányát jelző
agonia
haldoklás
agonista
1. egy izom kontrakciós állapotban; a szemben lévő, opponáló izom az antagonista 2. Olyan gyógyszer, amely a receptorhoz kötődve képes hatást kiváltani. Az agonista hatása az affinitással és intrinsic aktivitással jellemezhető. (gör: agon, verseng)
agoraphobia
Szellemi zavar, irracionális félelem az otthoni családi környezet elhagyásától, a szabadban való időtöltéstől, közlekedési eszközök használatától stb.; gyakori a pánikroham. (gör: agora, vásártér + phobos, félelem)
agrammatismus
Az aphasia egyik alakja, amelyre jellemző érthetetlen és helytelen szavak használata; a beteg képtelen nyelvtanilag helyes mondatot formálni. Oka a domináns temporalis lebeny elváltozása.
agranulocyta
non-granularis, szemcséket nem tartalmazó leukocyta (gör: a-, fosztóképző + lat: granulum +gör: kystos, sejt)
agranulocytosis
Akut állapot, amelyet igen kifejezett leukopenia jellemez. Fertőzéses fekélyek alakulnak ki a torokban, a béltraktusban és egyéb nyálkahártya területeken, valamint a bőrön. Gyakran gyógyszerek hatására alakul ki agranulocytosis.
agranuloplasticus
non-granularis leukocyták képzését serkentő (gör: a-, fosztóképző + granulum + plastikos, alakító)
agraphia
Írásképtelenség, amelyet nem mozgásszervi eltérés, hanem a központi idegrendszer károsodása okoz. Gyakran aphasiával és alexiával társul. Szinonima: logagraphia (gör: a-, fosztóképző + grapho, írni)
agresszió
1. erőszakos, támadó, verbális, vagy fizikai akció egy másik személy ellen 2. düh, ellenségesség, harag motoros kifejeződése (lat: aggressio, támadás)
agyria
gyrusok veleszületett hiánya az agykéregben; szinonima: lyssencephalia (gör: a-, fosztóképző + gyros, kör)
AIDS aquired immunodeficiency syndrome (szerzett immunhiányos szindróma)
Az immunrendszer megbetegedése, amelyet opportunista kórokozók okozta fertőzések jellemeznek, beleértve a candidiasist, Pneumocystis carinii pneumoniát, oralis szőrös leukoplakiát, herpes zostert, Kaposi sarcomát, toxoplasmosist, isosporiasist, cryptococcosist, non-Hodgkin lymphomát és tuberculosist. A szindrómát a humán immundeficiencia vírus (HIV-1, HIV-2) okozza, amely testnedvekkel kerül át másokba (különösen veszélyes: vér, ondó) szexuális kapcsolat útján, vagy fertőzött injekciós tűvel (iv. kábítószer fogyasztók), véletlen szúrással, ha a tű fertőzött, vagy a fertőzött vérrel, vérkészítménnyel adott transzfúzió révén. Az immundeficienciának fontos jele a T4-helper/inducer lymphocyták számának jelentős csökkenése, amelynek kialakulását a vírus e sejtek iránti specifikus tropizmusa magyarázza.
ailurophobia
macskáktól való kóros félelem (gör: allouros, macska + phobos, félelem)
akaryocyta
nucleus nélküli sejt (pl. erythrocyta) Szinonima: acaryocyta, akaryota (gör: a-, fosztóképző + karyon, mag + kystos, sejt)
akathisia
Az akathisia jellemzője, hogy a beteg nem képes ülő helyzetben maradni motoros nyugtalansága és az izomremegés érzete miatt. Antipszichotikumok és neuroleptikumok mellékhatásaként léphet fel. (gör: a-, fosztóképző + kathisis, ülés)
akcelerátor
1. bármi, amely a hatást vagy a működés sebességét növeli 2. élettan: egy ideg, izom, vagy anyag, amely a mozgást, vagy választ gyorsítja 3. katalitikus hatóanyag (katalizátor), amelyet egy kémia reakció gyorsítására alkalmazunk 4. fizika: Olyan készülék, amely töltéssel bíró részecskéket (pl. protont) nagy sebességre gyorsít fel, hogy a céltárgyban nukleáris reakciót idézzen elő; gyakran radioterápia céljára alkalmazzák. (lat: accelero, gyorsít)
Találatok Magyarázat
lineáris akcelerátor Olyan készülék, amely nagy sebességet és energiát közöl elektromosan töltött, elemi részecskékkel. Gyakran használják radioaktív izotópok előállítására, vagy sugárterápiás célokra.
proszérum prothrombin converzió akcelerátor (PPCA) szinonima: faktor VIII
prothrombin akcelerátor szinonima: faktor V
szérum akcelerátor szinonima: faktor VII
szérum prothrombin konverzió akcelerátor (SPCA) szinonima: faktor VII
akceptor
Olyan vegyület, amely vegyi csoportot képes felvenni (pl. amin-, metil-csoportot stb.) egy másik vegyületről (donor). (lat: accipio pp. -ceptus, elfogadni)
akeratosis
epidermis szarurétegének hiánya, vagy elégtelensége
akinaesthesia
mozgás, vagy testhelyzet érzékelésének hiánya (gör: a-, fosztóképző + kinésis, mozgás + aisthesis, érzés)
akinesia
akaratlagos mozgás hiánya; szinonima: akinesis (gör: a-, fosztóképző + kinésis, mozgás)
akinesis
szinonima: akinesia
akinetikus
akinesiával kapcsolatos, vagy akinesiában szenvedő
akklimatizáció
élettani adaptáció a környezeti tényezők (hőmérséklet, klíma viszonyok, magasság stb.) változásaihoz
akkomodáció
1. adaptáció, vagy alkalmazkodás folyamata 2. szemlencse alakjának alkalmazkodása a különböző fókusztávolságokhoz 3. Szenzoromotoros teória, amely szerint a felismerési elvárások úgy változnak, hogy azok a tapasztalattal egybecsengjenek. (lat: accomodo pp -atus, adaptálódni)
Találatok Magyarázat
akkomodáció amplitúdója különbség a szem refraktivitása között nyugalomban és teljes akkomodációkor
hisztológiai akkomodáció sejtek méretének alkalmazkodása megváltozott fizikai viszonyokhoz; pl. emelkedett nyomás hatására köbhámsejtek lelapulása
negatív akkomodáció Az akkomodáció csökkenése, amikor közellátásból távollátásba váltunk át.
pozitív akkomodáció A szem fokozott törése, amikor távolnézésből áttérünk a közeli tárgy nézésére
akridin orange
(C.I. 46005) 10-azaantracén Bázikus fluoreszcens festék, a nukleinsavak metakromatikus festésére alkalmazzák. Felhasználják a méhnyak kenet festésére, ahol kóros, malignus sejtek kimutatását szolgálja.
aktinidák
Azok a ritka, radioaktív elemek, amelyeknek rendszáma 89 és 103 közötti; a periodikus táblázat lanthanidáinak felelnek meg. (actinium: első eleme a sorozatnak)
aktiváció
1. (radio)aktívvá tétel 2. Valamely atom, vagy molekula energiatartalmának megnövelése a hőmérséklet emelésével, fotonok abszorpciójával stb. 3. Az agy fénnyel, hanggal, elektromossággal, vagy kémiai vegyülettel történő izgatása azzal a céllal, hogy az EEG-n abnormális aktivitást váltson ki. 4. perifériás idegrostok stimulálása az akciós potenciál megjelenéséig 5. sejtosztódás stimulálása
aktivátor
1. Olyan anyag, amely egy másik anyagot aktivál, vagy gyorsítja, katalizálja a reakció folyamatát. 2. Olyan szerkezet, amely egy anyagot radioaktívvá képes tenni. 3. Kivehető típusa a myofunctionalis orthodontialis applikátornak, amely az erő passzív áttevőjeként hat a vele kapcsolatban lévő fogakra, processus alveolarisra, az aktivált izmok működése révén.
Találatok Magyarázat
plazminogén aktivátor proteáz, amely a plazminogént plazminná alakítja egy Arg-Val kötés hasítása révén
szöveti plazminogén aktivátor (TPA) Thrombolyticus szerin proteáz, amely fokozza a plazminogén-plazmin átalakulást. A rekombináns módszerrel előállított proteint thrombolyticumként alkalmazzák pl. koszorúsér elzáródásánál, pulmonalis emboliánál stb.
aktivitás
1. általánosságban: (fokozott) tevékenység, hatóképesség 2. electroencephalographia: neurogén elektromos tevékenység jelenléte 3. fizikokémia: Olyan ideális koncentráció, amelynél a tömeghatás törvénye tökéletesen érvényesül; az aktivitás valódi koncentrációhoz viszonyított aránya az aktivitási koefficiens (á), amelynek értéke végtelen hígításban 1,00. 4. enzimek által egy megadott idő alatt és adott feltételek között átalakított szubsztrátum/keletkező termék mennyisége
Találatok Magyarázat
fizikai aktivitás bármely, vázizmok által végrehajtott mozgás
inzulinszerű aktivitás (insulin-like activity; ILA) Plazmában lévő olyan anyagok összessége, amelyek inzulinhoz hasonló biológiai hatásokat képesek kiváltani különböző vizsgálatokban. Olykor a szérum inzulin koncentrációjaként értékelik. Mindig magasabb az értéke, mint az immunkémiai módszerrel mért inzulin koncentrációnak.
kiváltott (triggerelt) aktivitás Spontán generált szívütés, vagy ennek sorozata, amely olyan akciós potenciálból ered, amely depolarizáció után keletkezik, miután szívizom membránpotenciálja elérte az aktivációs küszöböt.
optikai aktivitás egy anyag képessége a polarizált fény síkjának elforgatására valamely oldatban
plazma renin aktivitás (PRA) A plazma renin szintjének meghatározása azzal a céllal, hogy a keletkezett angiotensin I, vagy II mennyiségére indirekt módon következtetni tudjunk.
specifikus aktivitás egy adott, egységnyi tömegű radioaktív anyag időegységre jutó atommag bomlásainak számával arányos mennyiség
akupresszúra
nyomás alkalmazása az akupunktúrás helyeken terápiás célból
akupunktúra
Ősi ázsiai gyógyítási rendszer, melynél hosszú, finom tűkkel meghatározott pontokon végzett szúrásokkal érnek el terápiás hatást, anaesthesiát, analgesiát. Ellenjavallt az akupunktúra alkalmazása lázas állapotokban, fertőzéses eredetű kórképekben. (lat: acus, tű + punctura)
akusztika
hangtan; hangokkal és azok észlelésével foglalkozó tudomány (gör: akoustikos, hallásra vonatkozó)
akut
1. heveny; rövid ideig tartó, nem krónikus egészségi hatás 2. expozícióra vonatkoztatva: rövid, intenzív (lat: acutus, éles)
Al
alumínium
ALA
-aminolevulinsav vö: Ala
Ala
ld. alanin
ala,
gen. és pl. alae szárny
alalia
mutismus, némaság, beszédre való képtelenség ld.: aphonia (gör: a-, fosztóképző + lalia, beszéd)
alanil
alanin acil gyöke
alanin (A, Ala)
2-amino-propionsav, α-amino-propionsav; nem esszenciális aminosavak egyike
alanin aminotranszferáz (ALT)
Ez az enzim az L-alaninon lévő aminocsoportot viszi át 2-glutarátra, vagy fordítva az L-glutamátról piruvátra. Az alanin aminotranszferáz (ALT) enzim szérum koncentrációja emelkedett májbetegségekben, és myocardium infarctusban. Szinonima: glutamát-piruvát transzamináz (GPT)
ALARA
as low as reasonably achievable rövidítése, mely radioterápiában a besugárzás dózisának megválasztásának elvére vonatkozik. Lényege, hogy mindig a lehető legalacsonyabb, de még az adott terápiás, vagy diagnosztikai cél eléréséhez szükséges dózis alkalmazása javasolt.
alaris
1. szárnnyal kapcsolatos, szárnyas, szárnyszerű 2. szinoníma: axillaris 3. szárnyakkal kapcsolatos olyan struktúrákban, mint az orr (orrszárny), os sphenoidale, sacrum, stb.
alba
fehér (lat: albus fehér nőnemű alakja)
albicans pl. albicantia
1. fehér 2. szinonima: corpus albicans
albiduria
színtelen, fehér, alacsony fajsúlyú vizelet ürítése; szinonima: albinuria (lat: albidus, fehéres + gör: ouron, vizelet)
albinismus
Veleszületett, rendszerint autoszomális recesszív eltérések csoportja, amely arról ismerhető fel, hogy a bőrben, a szőrzetben, a szemben, vagy csupán a szemben pigmenthiány észlelhető, mivel a melanin képződése abnormális.
Találatok Magyarázat
albinismus ocularis X-kromoszómához kapcsolt öröklődésű pigmenthiány főleg az irisben, a choroideában és a retina pigment epitheliumában, süketséggel társultan.
albino
albinismusban szenvedő egyén
albinuria
szinonima: albiduria
albugineus
fehéres ld. tunica albuginea (lat: albugineus, fehér folt)
albumin
A plazma alapvető fehérjéje, mely a plazmán kívül serosus testfolyadékokban is jelen van. A zsírsavak transzportjában és a vér ozmotikus nyomásának szabályozásában fontos szerepet játszik. Az albumin vízben jól oldódik, erős sav, hő hatására viszont kicsapódik. Szinonima: szérum albumin (lat: albumen, tojás fehérjéje)
Találatok Magyarázat
bovin szérum albumin (BSA) Az albumin forrása, gyakran alkalmazott anyag biológiai tanulmányokban.
131 I humán szérum albumin Diagnosztikai célra, a vértérfogat és a perctérfogat meghatározására használt steril, pufferezett isotoniás oldat, amelyet olyan módon készítenek, hogy legalább 10 mg 131I izotóppal jelzett, max. 1 mCi radioaktivitású normál humán szérumot tartalmazzon ml-enként.
125 I szérum albumin Diagnosztikai célra, a vértérfogat és a perctérfogat meghatározására használt steril, pufferezett isotoniás oldat, amely legalább 10 mg 125I izotóppal jelzett, max. 1 mCi radioaktivitású normál humán szérumot tartalmaz ml-enként.
humán szérum albumin A humán szérum albumin steril készítménye; a plazma proteinjeit frakcionálva állítják elő egészséges emberek véréből. Transzfúziós célra, hypoproteinaemia okozta oedema kezelésére használják.
ovalbumin tojásfehérjében lévő albumin
albuminoid
1. albuminra emlékeztető 2. proteinek egyszerű, neutrális oldószerekben oldhatatlan típusa, mely a szaru- és porcszövetekben, valamint a szemlencsében van jelen (pl. keratin, elasztin, kollagén). Szinonima: scleroprotein
albuminuria
Albumin jelenléte a vizeletben, mely rendszerint betegségre utal, de lehet átmeneti diszfunkció jele is. Ld. proteinuria (albumin+gör: ouron, vizelet)
aldehid
Olyan vegyület (pl. acetaldehid), amely -CH=O gyököt tartalmaz; redukálható alkohollá (-CH2OH), oxidálható karboxilcsoporttá (-COOH).
aldopentóz
Monoszacharid (pl. ribóz), amelyben lévő 5 szénatom egyike aldehid-csoportot tartalmaz.
aldosteronismus
Olyan kórkép, amely az aldoszteron túlzott szekrécióval jár. Szinonima: hyperaldosteronismus
Találatok Magyarázat
idiopathiás aldosteronismus szinonima: primaer aldosteronismus
primaer aldosteronismus A mellékvesekéreg túlzott mértékű aldoszteron szekréciója által kiváltott kórkép. Jellemzi a fejfájás, nocturia, polyuria, fáradtság, hypertensio, fokozott káliumvesztés, hypokalaemiás alkalosis, hypervolaemia és alacsony plazma renin aktivitás. Társulhat kisméretű benignus adrenocorticalis adenomákkal. Szinonima: Conn-szindróma, idiopathiás aldosteronismus
secundaer aldosteronismus Az aldosteronismus-t nem a mellékvesekéreg megbetegedése váltja ki, hanem extraadrenaliseredetű az eltérés. A secundaer aldosteronismus megjelenhet szívelégtelenségben, nephrosis-szindrómában, májcirrhosisban és hypoproteinaemiában.
aldoszteron
A mellékvesekéreg által termelt mineralokortikoid hormon, amelynek fő hatása a nátrium visszaszívás fokozása, valamint a kálium és hidrogén ürítés elősegítése a distalis vese tubulusokban.
aldóz
aldehid-csoportot (-CH=O) tartalmazó monoszacharid
aleukaemia
1. leukocyták hiánya a vérben 2. leukaemia olyan változata, amelynél a perifériás kenetben a fehérvérsejt szám normális, vagy a normális értéknél alacsonyabb (gör: a-, fosztóképző + leukos, fehér + haima, vér)
aleukaemoid
aleukaemiára emlékeztető (tünetek)
aleukia
A leukocyták hiánya, vagy feltűnően csekély száma a keringő vérben. Gyakran az aleukaemiás myelosist nevezik így. (gör: a-, fosztóképző + leukos, fehér)
aleukocytosis
fehérvérsejtek igen alacsony száma, vagy hiánya a keringő vérben
alexia
Az írott, vagy nyomtatott szavak, mondatok megértésének hiánya, amelyet cerebralis elváltozás okoz. De nevezik opticus alexia-nak, sensoros alexia-nak, vagy visualis alexia-nak, megkülönböztetésül a motoros alexia-tól (anarthria), amikor a megtartott megértés mellett hiányzik a hangos felolvasás képessége. Szinonima: szóvakság, visualis aphasia (gör: a-, fosztóképző + lexis, szó)
alexithymia
érzelmek felismerésének, leírásának csökkent képessége (gör: a-, fosztóképző + lexis, szó + thymia érzés)
alga
eukaryota, fotoszintetizáló, nem virágzó növényi szervezet (lat: alga, hínár)
alge-, algesi-, algio-, algo-
fájdalom; lat: dolor (gör: algos, fájdalom)
algesi-
ld.: alge-
algesia
szinonima: algesthaesia (gör: algesis, fájdalom érzése)
algesiometer
Olyan eszköz, amely a fájdalmas inger iránti érzékenységet méri. Szinonima: algesimeter, algometer, odynometer (gör: algésis, fájdalom érzése + metron, mérés)
algesthaesia
1. fájdalom felismerése 2. fájdalom iránti túlérzékenység (gör: algos, fájdalom + aisthesis, érzés)
algeticus
1. fájdalmas, fájdalommal kapcsolatos, fájdalom előidézője 2. fájdalom iránti túlérzékenységgel kapcsolatos
algio-
ld. alge-
algo-
ld. alge
algogen
fájdalmat produkáló (gör: algesis, fájdalomérzés + gen, produkció)
algolagnia
A szexuális perverzió egyik alakja, amelyben fájdalom kiváltása, vagy fájdalom tapasztalása fokozza az élvezetet, és a szexuális élvezet nemegyszer függetlenné válik az aktustól. Ide tartozik a szadizmus (aktív algolagnia) és a mazochizmus (passzív algolagnia). Szinonima: algophilia (gör: algo- + phileo, szeretni)
algophobia
abnormális félelem, vagy érzékenység a fájdalom iránt (gör: algo + phobos, félelem)
algor
hidegség
algoritmus
1. Számítási folyamat egyes lépéseinek leírása matematikai feladatok megoldására. 2. Az algoritmus a klinikai orvostudományban a kezelés menetét lépésről lépésre leíró protokoll az egészségi problémák megoldására, melynél minden újabb lépés az előző kimenetétől függ. 3. A komputeres tomográfiában használt képletek, amelyek alapján a röntgen transzmissziós adatokból a végső képetmegalkotják. (lat: algorismus al-Khwarizmi, arab tudós neve után + gör: arithmos, szám)
algovascularis
vérerek lumenének fájdalom hatására bekövetkező változásai (gör: algos, fájdalom)
alienatio
Olyan állapot, amelyben hiányzik a másokkal való szorosabb személyes kapcsolat, gyakran deperszonalizációval, elidegenedéssel jár. (lat: alieno pp. -atus, idegenít)
alienia
lép veleszületett hiánya (gör: a-, fosztóképző + lat: lien, lép)
alienus
idegen
alifás
nyílt szénláncú (szerves vegyület)
aliformis
szárny alakú (lat: ala, szárny + forma, alak)
alignment
1. láb, vagy csont longitudinális helyzete 2. fogászat: fogak rendeződése a támasztó struktúrákhoz, valamint az opponáló fogazathoz (ang: alignment, vonalba állítás, kiegyenesítés)
alimentaris
étellel, vagy táplálkozással kapcsolatos (lat: alimentarius, alimentum, táplálkozás)
alimentatio
táplálkozás, táplálás
Találatok Magyarázat
alimentatio arteficialis mesterséges táplálás
alimentatio enteralis tápcsatornán keresztül végzett mesterséges táplálás
alimentatio parenteralis tápcsatorna megkerülésével, érrendszeren keresztül, infúziós oldattal végzett táplálás
alimentum
táplálék
aliquant
maradék nélkül nem osztható
aliquot
maradék nélkül osztható (lat: néhány)
alizarin
(C.I. 58000) 1,2-dihidroxiantrakinon, buzérvörös Vörös festék, amely a festőbuzér gyökerében van jelen. Vízben gyengén oldódik. Régóta festékként használják; újabban szintetikusan állítják elő antracénből, és kék, narancs, valamint vörös festékek előállítására alkalmazzák. Mint indikátor sárga színű pH 5,5 alatt; pH 6,8 fölött vörössé válik.
alkalaemia
H-ion koncentráció csökkenése a vérben; másként szólva a pH emelkedése függetlenül a bikarbonát-ion szintjétől. (alkali + gör: -haima, vér)
alkáli
1. erősen bázikus anyag, amely oldatban hidroxil-ionokat ad le (pl. nátrium-hidroxid, kálium-hidroxid) 2. szinonima: bázis 3. szinonima: alkáli fém (arab: al, határozott névelő + qaliy, szóda)
alkalikus
bázikus reakciót adó, lúgos
Találatok Magyarázat
alkalikus foszfatáz (ALP) Májban, csontokban, placentában és bélhámban nagy koncentrációban jelen lévő foszfatáz enzim, amelynek kórosan magas szintje elsősorban csont-, májbetegségekben, gyulladásos bélbetegségekben, ill. malignus tumoroknál fordul elő.
alkalinuria
lúgos vizelet ürítése (alkalikus + gör: ouron, vizelet)
alkálitartalék
vér bikarbonát tartalma
alkaloid
Eredeti jelentése szerint több száz növényi termék közül alkaloid-nak tekinthető bármelyik, amely bázikus reakciót ad. Jelenleg azon növények által szintetizált, nitrogén tartalmú, heterociklusos, gyakran komplex struktúrákat nevezünk alkaloid-nak, amelyek specifikus farmakológiai aktivitással rendelkeznek. Nevük legtöbbször -in-re végződik (morphin, atropin, colchicin). Orvosi célokra inkább sóikat használjuk, mivel könnyebben oldódnak vízben.
alkalosis
1. H+-ion vesztéssel jellemezhető eltérés 2. bázis túlsúly a testnedvekben (metabolicus alkalosis), de okozhatja fokozott CO2 vesztés is, pl. hyperventillatio esetében (respiratoricus alkalosis)
Találatok Magyarázat
kompenzált alkalosis esetében változás történt a bikarbonát koncentrációban, de a testnedvek pH-ja a normális határok között mozog. A respiratoricus alkalosis azzal kompenzálható, hogy fokozott mennyiségben képződik sav, vagy a vesék nagyobb mértékben választják ki a bikarbonátot; a metabolicus alkalosis-t ritkán kompenzálja a szervezet hypoventillatioval.
metabolicus alkalosis Ez esetben az artériás vér bikarbonát koncentrációja emelkedik, okozója nagy mennyiségű alkalikus anyag felvétele, vagy jelentős, vizelettel, v. hányással történő savveszteség lehet. A base excess és a standard bikarbonát koncentráció emelkedett. ? respiratoricus alkalosis Akkor alakul ki, ha hyperventillatioval abnormális mennyiségű CO2 veszteség jön létre, mely a H+-ion koncentráció csökkenésével jár egyidejűleg.
alkalotikus
alkalosishoz kapcsolódó
alkaluria
szinonima: alkalinuria
alkán
telített, aciklikus szénhidrogének általános megnevezése (pl. propán, bután)
alkapton
szinonima: homogentizinsav (alkáli + gör: kapto, sóváran felszívni)
alkaptonuria
Homogentizinsav kiválasztása a vizeletben, amelynek oka a tirozin anyagcsere zavara, a homogentizinsav oxidáz veleszületett hiánya. A vizelet színe állás közben sötétté válik. Szabálytalan időközönként visszatér, majd elmúlik. Késői szövődményei közé tartozik az ochronosis és arthritis (alkapton + gör: ouron, vizelet).
alkén
Aciklikus szénhidrogén, amely egy, vagy több kettős kötéssel rendelkezik (pl. etilén, propilén). Szinonima: olefin
alkenil
alkén gyök
alkil
1. szénhidrogén gyök, általános képlete CnH2n+1 2. olyan vegyület, amelyben fém kötődik az alkilgyökhöz (pl. ólom-tetraetil).
alkiláció
Hidrogén atom alkilgyökkel történő szubsztitúciója (pl. aromás vegyületnél oldallánc bevitele)
alkohol
1. Szerves vegyületek egy csoportja, amelyben egy, v. több szénhez kapcsolódó hidrogént OH-csoport vált fel. Az alkohol savval történő reakciója nyomán észter képződik. A legfontosabb alkohol-ok közé tartoznak az oldószerként, ill. hűtőfolyadékokban használt metanol és etanol. 2. etil-alkohol CH3CH2OH Szénhidrátból fermentációval, szintetikusan etilénből, vagy acetilénből állítható elő. Az orvostudomány szempontjából addiktológiai szempontból nagy jelentőségű. Külsőleg a bőr kipirosítására (rubefaciens), és fertőtlenítésre alkalmazzák. Belsőleg analgetikumként, szedatívumként és antipiretikumként került régebben felhasználásra. Szinonima: etanol, ethyl 3. CH3CH2OH és víz azeotróp keveréke (95°-os alkohol) 4. alcohol absolutus vízmentes etil-alkohol (arab: al, névelő + kohl, finom, tapinthatatlan por)
Találatok Magyarázat
dihidrikus alkohol két OH-csoportot tartalmazó alkohol (pl. etilénglikol)
monohidrikus alkohol olyan alkohol, amelynek molekulája egy OH-csoportot tartalmaz
primer alkohol egyértékű OH-gyök jellemzi (R-CH2OH)
szekunder alkohol bivalens csoportot tartalmaz (R-CH(OH)-R")
tercier alkohol metanol szénatomján három szubsztituenssel rendelkezik (R-CR"(OH)-R")
trihidrikus alkohol három OH-csoportot tartalmaz (pl. glicerol)
alkohol-dehidrogenáz
Oxidoreduktáz, amely reverzibilisen az alkoholt aldehiddé, vagy ketonná alakítja át NAD+-ot használva H-akceptorként (pl. ethanol + NAD+ ↔ acetaldehid + NADH+H+).
alkoholista
alkohol abususban szenvedő; alkoholtól függő személy
alkoholízis
kémiai kötés hasítása alkohol hozzáadásával a hasítási pont eléréséig. (alkohol + gör: lysis, oldás)
alkoholizmus
Krónikus alkoholfüggőség, vagy -abusus, amelyet tartós, túlzott mértékű alkoholfogyasztás jellemez; az egyén fizikai és pszichés egészségi állapotának és szociális helyzetének romlásával jár. Az alkohol mértéktelen fogyasztása hozzászokást eredményez, amely miatt még több alkoholt kíván, hogy a kívánt hatást elérje.
Találatok Magyarázat
akut alkoholizmus Az értelmi működés időleges romlása, az izmok koordinálatlansága és paresise jellemzi; mindezt gyorsan, nagy mennyiségben elfogyasztott alkoholos italok okozzák. Szinonima: alkohol intoxikáció
krónikus alkoholizmus Olyan főleg az idegrendszert és a gastrointestinalis traktust érintő kóros állapot, amely rendszeres, toxikus mennyiségben fogyasztott alkoholos italok hatására alakul ki.
alkoholos
alkohollal kapcsolatos, alkoholt tartalmazó, alkohol által produkált
ALL
akut lymphoid leukaemia
allachaesthesia
Olyan állapot, amelyben a tactilis ingerek máshol keltenek érzést, nem az applikáció helyén (gör: allaché, máshol + aisthésis érzés).
allanto-, allant-
Allantois, allantoid, kolbász (gör: allas, allantos, kolbász)
allantochorion
Extraembrionalis hártya, amely az allantoisnak és a chorionnak az összeolvadásából származik.
allantoid
1. kolbász alakú 2. allantoishoz hasonló (allantoin + gör: eidos, megjelenés)
allantoin
purinanyagcsere végtermék kétéltűekben, hüllőkben és emlősökben (vö: húgysav)
allantoinuria
allantoin vizelettel történő kiválasztása (legtöbb emlősben normális, emberben kóros jelenség) (allantoin + gör: ouron, vizelet)
allantois
Magzati burok, amely a hátsó bélből, vagy - emberben csökevényes formában - peteburokból alakul ki. Emlősöknél részt vesz a köldökzsinór és a méhlepény kialakításában. (allanto- + gör: eidos, megjelenés)
allél
Két, vagy több különböző génsorozat bármelyike, amely ugyanazon locust foglalja el egy adott kromoszómán. Mivel az autoszomális kromoszómák párosak, a normális szomatikus sejtben minden autoszomális gén kétszer fordul elő. Ha ugyanaz az allél foglalja el az adott locus mindkét helyét, akkor az adott sejt homozigóta jelleget mutat erre az allélra. Ha az allélok különbözők, a sejt heterozigóta jellegű mindkét allélra. (gör: allélon, reciprok)
allelotaxis
Egy szerv kialakulása számos embrionális struktúrából és szövetből (gör: allelon, kölcsönösen + taxis, rendező).
allergén
megváltozott reaktivitást kiváltó anyag, antigén neve (allergy + gör: gen, létrehozó)
Találatok Magyarázat
hypoallergén olyan anyag, mely nagy valószínűséggel nem vált ki allergiás reakciót az egyénnél.
allergia
1. hiperszenzitivitás, a reaktivitás jelentős fokozódása, amelyet egy meghatározott antigén (allergén) expozíciója vált ki. A legközelebbi, ismételt antigén expozíció esetén gyakran kóros következményekkel jár. Ld. még allergiás reakció, anaphylaxis 2. Szerzett hiperszenzitivitás bizonyos gyógyszerekkel, vagy biológiai anyagokkal szemben (gör: allos, más + ergon, munka).
Találatok Magyarázat
azonnali allergia (I. típusú allergiás reakció) A szenzitizált egyénen a reakció az allergénnel történő kontaktus után már percekkel fellép, egy órán belül eléri a csúcsát, majd gyorsan szűnik. Ld. anaphylaxis; vö: késői típusú allergia
fizikai allergia Túlzott mértékű válasz olyan környezeti tényezőkkel szemben, mint hideg, vagy meleg.
késői típusú allergia (IV. típusú allergiás reakció) Az allergiás reakció a szenzitizált egyénen csak az allergénnel történt érintkezés után órákkal kezdődik, csúcsát 36-48 óra múlva éri el, majd lassan szűnik meg. Sejt közvetítette válasszal áll kapcsolatban. Vö: I. típusú, azonnali allergiás reakció
kontakt allergia szinonima: allergiás kontakt dermatitis
látens allergia Olyan allergia, amelynek nincsen tünete és csak bizonyos, specifikus antigénnel végzett immunológiai tesztekkel lehet kimutatni.
polivalens allergia allergiás válasz szimultán számos specifikus allergénnel szemben
allergiás
allergén által stimulált válaszra vonatkozó
allergic salute
Az orr jellemző törlése, dörzsölése a kéz felfelé és oldalirányú mozgatásával, mely gyerekek allergiás rhinitisében látható.
allergológus
Olyan orvos, aki az allergiák kezelésére specializálta magát.
allo-
1. más; normáltól, vagy megszokottól különböző 2. Kémiai prefixum, amelyet aminosavak esetében használunk akkor, ha az oldallánc aszimmetrikus szénatomot tartalmaz (pl. alloizoleucinok, vagy allotreoninek). (gör: allos, más)
alloantigén
Olyan antigén, amely egy adott species néhány, de nem minden tagjában észlelhető. Gyakran isoantigén név is ilyen értelemben használatos.
alloantitest
Olyan antitest, amely specifikus az alloantigénre. Néha isoantitestnek is mondják.
allocheiria
Ld. allochiria
allochiria, allocheiria
Az allachaesthesia egyik alakja, amelyben az egyik lábat (végtagot) ért stimulus az ellenoldalon vált ki érzetet. Szinonima: Bamberger-jel (allo- + gör: cheir, kéz)
allocortex
O. Vogt alkotta szakkifejezés, amely az agykéreg bizonyos régióit jelenti, főleg az olfactorius cortexet (szaglókéreg) és a hippocampust, amelyekben kevesebb sejtréteg található, mint az isocortexben. (allo- + lat: cortex, kéreg)
allodiploid
Ld.: alloploid
allodynia
Olyan állapot, amelyben rendesen nem fájdalmas inger fájdalmat vált ki. (allo- + gör: odyné, fájdalom)
alloerotismus
szexuális vonzalom másik ember iránt; vö: autoerotismus, szinonima: heteroerotismus (allo- + gör: eros, szerelem)
allograft
Olyan transzplantátum, amelynek átültetése genetikailag nem azonos, de ugyanazon fajhoz tartozó egyének között történik. Szinonima: allogén graft, homológ graft.
allokeratoplasztika
A homályos cornea szövetének kicserélése átlátszó protézissel, amely rendszerint műanyagból készül.
allolalia
Bármely beszédzavar, melyet agyi károsodás okoz. (allo- + gör: lalia, beszéd)
allomér
kémiai összetételében különböző, de ugyanolyan alakban kristályosodó (allo- + gör: meros, rész)
allomorfizmus
1. A sejtek alakjának változása mechanikus ok következtében (pl. lelapulás), vagy progresszív metaplasiába való átmenet (pl. epeút sejtek májsejtekké alakulása). 2. Hasonló vegyi összetétel eltérő kristályos alak mellett (allo- + gör: morphé, alak).
allopathia
Olyan terápiás rendszer, amelyben egy betegség olyan alapon kerül kezelésre, amely a betegséggel antagonista módon hat. Vö: homeopathia; szinonima: heteropathia (allo- + gör: pathos, szenvedés)
alloplast
1. Egy vegyileg közömbös fémből, vagy műanyagból készült graft. 2. Egy relatíve inert idegen test, amelyet a szövetekben implantátumként használnak. (allo- + gör: plastos, alakított)
alloplasztika
szövethiány allotranszplantációval történő pótlása
alloploid
Hibrid egyedre, vagy sejtre vonatkozó fogalom, mely alatt olyan egyedet, vagy sejtet értünk, amely a kromoszómáknak két, vagy több különböző felmenőktől származó sorozatával rendelkezik. (allo- + -ploid)
alloploidia
alloploid állapot
allopolyploid
Olyan alloploid, amely három, vagy több haploid kromoszóma sorozattal rendelkezik.
allopolyploidia
allopolyploid állapot
allopsychés
A külső környezettel kapcsolatos mentális folyamatot jelzi.
alloritmia
A szív ritmusában mutatkozó szabálytalanság, amely időnként ismétlődik.
allosoma
A kromoszómák egyike, amely különbözik megjelenésében, vagy viselkedésében az autosomáktól, és néha egyenlőtlenül oszlik meg a csírasejtek között. Szinonima: heterokromoszóma (allo- + gör: soma, test)
allosztéria
Valamely enzim aktivitásának, vagy egy ligand proteinhez való kapcsolódásának befolyásolása, mely a fehérje konformációs változása nyomán jön létre, amint egy szubsztrátum vagy más effektor molekula a fehérje valamely kötőhelyéhez kapcsolódik (alloszterikus hely).
alloszterikus
allosztériára jellemző
allotípus
1. Immunglobulinokra jellemző, genetikailag meghatározott különbség antigén-tulajdonságaik tekintetében, mely ugyanazon faj különböző egyedei között mutatható ki. Ld. antitest (allo- + gör: typos, modell) 2. Fehérjék genetikailag meghatározott polimorfizmusa adott fajon belül; az egyes allotípusok kémiai tulajdonságaikat tekintve eltérőek lehetnek, azonban biológiai funkciók vonatkozásában hasonló feladattal rendelkeznek.
allotop
valamely allotípus antigén determinánsa
allotranszplantáció
allograft transzplantációja; szinonima: homotranszplantáció
allotrop
valamely elem egyik előfordulási alakja (gör: allo- + tropos, fordulat)
allotropicus
1. allotropizmussal kapcsolatos 2. személyiségi jegyek tipizálása, mások reakcióinak összehasonlításával
allotropizmus, allotropia
Bizonyos elemek előfordulása több alakban, amelyek jelentős mértékben különböznek fizikai tulajdonságaikat tekintve (pl. szén vonatkozásában: grafit és gyémánt) (allo- + gör: tropos, fordulat)
alloxán
(2,4,5,6-pirimidinetetron) Húgysav oxidációs terméke, mely kísérleti állatokban hypoglycaemiát idéz elő inzulin felszabadításával; ezt későbbiekben hyperglycaemia követi, melynek oka a Langerhans-szigetek károsodása (alloxán diabetes).
alloxantin
Két molekula alloxán kondenzációs terméke, mely redukálószer jelenlétében képződik; szintén diabetogén hatású.
alloxuraemia
purin bázisok jelenléte a vérben (alloxán + gör: haima, vér)
alloxuria
purin vegyületek jelenléte a vizeletben (alloxán + gör: ouron, vizelet)
alogia
1. szinonima: aphasia 2. mentális elégtelenség, dementia következtében kialakult beszédképtelenség (gör: a-, fosztóképző + logos, beszéd)
alopecia
haj elvesztése; szinonima: kopaszság (gör: alopekia, róka rühesség nevű betegség)
Találatok Magyarázat
alopecia adnata szempillák fejletlensége ld. alopecia congenitalis, szinonima: madarosis (szemhéj gyulladás a szempillák pusztulásával)
androgén alopecia A hajzat fokozatos csökkenése jellemzi a pubertás után bekövetkező androgén szekréció hatására, mely fokozott familiaris hajlam mellett már korai felnőtt korban kialakulhat. Leggyakoribb formájánál a frontalis és kétoldali háromszögletű halánték hajvonal visszavonul, valamint kopasz terület figyelhető meg a fejtetőn, amely aztán progrediálhat teljes alopecia-ig.
alopecia areata Ismeretlen eredetű állapot, amelyben körülírt, nem hegesedő, rendszerint aszimmetrikus területeken a fejtető kopasszá válik, de kihullhat a szemöldök, és a szakállas arcon is tar foltok keletkezhetnek. Szinonima: alopecia circumscripta
alopecia capitis totalis szinonima: alopecia totalis
alopecia cicatrisata E betegségben a haj follikulusai irreverzibilisen tönkrementek hegesedés következtében olyan alapbetegség szövődményeként, mint trauma, égés, lupus erythematosus, lichen planopapillaris, scleroderma, folliculitis decalvans, vagy más, ismeretlen ok következtében. Szinonima: hegesedő alopecia (lat: cicatrix, heg)
alopecia circumscripta szinonima: alopecia areata
alopecia congenitalis Már születéskor a hajzat teljes hiánya észlelhető, pszichomotoros epilepsziával társul.
női típusú alopecia Diffúz, részleges hajhiány a koponyatető centripetalis területén, miközben frontalisan és temporalisan a hajvonal megtartott. A leggyakoribb androgén típusú alopecia nőkön.
alopecia hereditaria szinonima: androgén alopecia
lipoedematosus alopecia A hajhullás viszketéssel, érzékenységgel jár, főként fekete nők fején észlelhető. A fejbőr megvastagodott és puha, a subcutan zsírszövet felszaporodott, a haj elszórtan nő és rövid.
férfi típusú alopecia Az androgén alopecia leggyakoribb formája; férfiakon látni, amint visszavonul a frontalis és kétoldali háromszögletű halánték hajvonal, és kopasz terület alakul ki a fejtetőn, amely aztán teljes alopecia-ig fokozódhat.
alopecia marginalis A haj vonalban történő hullása, melyet leginkább feketéknél látunk. Gyakran átmeneti és a haj húzgálása a feltehető ok, bár hosszan tartó hajhúzás tartós kopaszságot is okozhat.
alopecia medicamentosa Diffúz hajhullás, amelyet különböző gyógyszerek szedése okozhat.
alopecia pityrodes Hajhullás jelentkezik a fejen, a testen is a szőrzet hullása észlehető, melyet a bőr korpaszerű hámlása kísér.
nyomási alopecia A haj kihullása körülírt területen, főként a hajas fejbőr hátsó részén, akkor, ha hosszú műtét alatt ez a terület tartósan nyomásnak volt kitéve, vagy a beteg gyógyszer túladagolás következtében hosszan feküdt rajta.
alopecia symptomatica Különböző szisztémás, vagy lokális betegség jeleként, esetleg tartós lázas betegség következtében alakul ki a hajhullás.
alopecia totalis A haj teljes kihullása igen rövid időn belül, vagy alopecia areata progressziója nyomán alakul ki. Vö: alopecia universalis; szinonima: alopecia capitis totalis
alopecia universalis a haj és szőrzet teljes kihullása; vö: alopecia totalis
alpha
(α) 1. Első betűje a görög ábécének, számos tudományág osztályozásának első tagja. 2. Bunsen-féle szolubilitási koefficiens jele 3. kém: A szorosan összetartozó vegyületekből álló sorozat első tagját jelzi. A karboxil-csoporthoz legközelebb álló tag jelzése, aromás szubsztituens egy alifás láncon, vagy a kémiai kötés irányát fejezi ki, ha az a nézőtől távolra esik. 4. az alpha részecske rövidítése 5. kém: Az optikai rotáció szögének, ill. a disszociáció fokának szimbólumát is jelenti. Prefixum alpha: ld. a specifikus kifejezéseknél.
alternáció
váltakozás
alternans
1. alternáló, váltakozó 2. pulsus alternans: minden második ütés erősebb
alumínium (Al)
Ezüstös fehér fém, amelynek alacsony a fajsúlya. Atomszáma 13, atomsúlya 26.981539. Számos sóját és vegyületét alkalmazzák a medicinában és a fogászatban. (lat: alumen, timsó)
alumínium-acetát
dezinficiensként, desiccansként használatos a bőrgyógyászatban ekzema, ill. krónikus fekélyek kezelésére
alumínium-foszfát
AlPO4; fogászatban kalcium-szulfáttal és nátrium-szilikáttal együtt használatos cementképző
alumínium-hidroxid
Al(OH)3 adstringens hatású; antacidumként szintén használatos
alumínium-hidroxiklorid
antiperspirans
alumínium-klorid hexahidrát
AlCl3·6H2O antiseptikum
alumínium-szalicilát
bázis; pharingitis kezelésében alkalmazzák
alumínium-szilikát
szinonima: kaolin
alumínium-szubacetát
Al(CH3CO2)2OH; adstringens és antisepticus hatása miatt alkalmazzák (pl. Burow-oldatban); szinonima: alumínium-diacetát.
aluminosis
A pneumoconiosis egyik formája, amelynek oka alumínium részecskék belégzése.
alveoalgia
A foghúzás posztoperatív szövődménye, az üregben széteső véralvadék focalis osteomyelitist idéz elő, amely nagy fájdalommal jár. Szinonima: alveolalgia (alveolus + gör: algos, fájdalom)
alveolalgia
szinonima: alveoalgia
alveolaris
alveolussal kapcsolatos; alveolushoz tartozó
alveolectomia
A dentoalveolaris processus egy részének műtéti eltávolítása, amikor a fogat rendszerint azért húzzák ki, hogy a fogpótlást könnyebbé tegyék.
alveolingualis
szinonima: alveololingualis
alveolitis
1. alveolusok gyulladása 2. fogmeder gyulladása
Találatok Magyarázat
akut pulmonalis alveolitis A tüdő alveolusaiban zajló heveny gyulladás exsudatioval, a gázcsere károsodása mellett. A tüdő bevérzését, vagy necrosisát is előidézheti. Goodpasture-szindrómában glomerulonephritis mellett fordul elő.
extrinsic allergiás alveolitis Szerves porszennyezés iránti túlérzékenység okozta pneumoconiosis, amelyet a foglalkozás ártalom specifikál. Akut alakjában légzési tüneteket okoz, a pornak kitett személyen láz fejlődhet ki az allergénnel történő expositio után néhány órával. Krónikus formájában a diffúz fibrosis jeleit látjuk a tüdőben, de ennek kialakulása néhány évet vesz igénybe.
alveolo-
Az alveolust, alveolaris nyúlványt jelzi. (lat: alveolus, edény)
alveoloclasia
alveolus pusztulása, károsodása (alveolo + gör: klasis, tönkremenetel)
alveolodentalis
alveolusra és fogra együttesen vonatkozó
alveololabialis
Az alsó, vagy felső állkapocs processus alveolarisának labialis, vagy vestibularis felszínére vonatkozik.
alveololingualis
Az alsó, vagy felső állkapocs processus alveolarisának belső, lingualis felszínére használt jelző.
alveolopalatalis
A felső állkapocs processus alveolarisának szájpadhoz közeli felszínére vonatkozik.
alveoloplastica
Az alveolus gerincének műtéti kiképezése, hogy a műfogsort rá lehessen illeszteni. A kihúzott fogak üregeinek szélét tompítva, majd megfelelő suturával lehet a helyes műfogsori alapot elkészíteni. (alveolo + gör: plasso, alakít)
alveolotomia
Műtéti nyílás a fog alveolusba, hogy a periapicalis, vagy más intraossealis tályogból a genny ürülését elősegítsék.
alveolus
(pl. alveoli) kis sejt, üreg, vagy vájat 1. szinonima: alveolus pulmonis, tüdő léghólyagocska: vékonyfalú terminális tágulat a bronchiolus respiraticuson, a ductis alveolarison, illetve az alveolaris tasakon, ezen át következik be a gázcsere az alveolaris levegő és a pulmonalis kapilláris között. 2. Alveolaris, vagy fürtös mirigy végső elágazása, ahol a szekréciós struktúrák találhatók. 3. gyomorfalban méhsejtszerű bemélyedés 4. szinonima: alveolus dentalis, fogmeder (lat: alveus kicsinyítő laveolus, üreg)
Találatok Magyarázat
alveus (pl. alvei) csatorna, vályú
alymphocytosis
lymphocyták hiánya, vagy számuk jelentős csökkenése
alymphoplasia
nyirokszövetek aplasiája, vagy hypoplasiája
Alzheimer-kór
Progresszív mentális hanyatlással járó kórkép, amely memóriazavarokkal, csökkent számolási képességgel, visuo-spatialis orientatio zavarával, confusioval, desorientatioval jár. Általában az 5. évtized után (presenilis forma), vagy még később, 70-80 éves korban (senilis forma) kezdődik, és 5-10 éven belül halálhoz vezet. Patológiailag az agy közepes, vagy súlyos fokú atrophiája jellemzi a folyamatot, különösen a frontalis, occipitalis és a temporalis regiókban. Hisztológiai elváltozások között intracellularis neurofibrillumok, senilis plakkok felhalmozódása figyelhető meg, döntően a cerebralis cortexben, az amygdalában, és a hippocampusban. Az Alzheimer-kór a senilis dementiák kialakulásának kb. 60-70%-ért felelős; a 65 év felettiek 5-10%-át, míg a 80 év feletti populáció kb. 20%-át érinti. A kialakult változások pontos oka nem ismert, azonban a kórkép etiológiájában feltehetőleg szerepet játszanak genetikai és környezeti tényezők, neurokémiai változások (csökkent kolinerg transzmisszió a károsodott területeken), autoimmun folyamatok, de akár vírusfertőzés szerepét sem zárják ki. A napjainkban alkalmazott kezelés a létrejött neurokémiai változások helyreállítására korlátozódik (koliészteráz-bénítók, nootrop szerek), de folynak kísérletek az idegrendszeri regenáció serkentésére (NGF; nerve growth factor), ill. idegszövet transzplantációjára vonatkozólag is, azonban utóbbiaknak mindmáig csupán elméleti jelentősége van.
Am
amerícium
am
(ammeter) ampermérő, árammérő rövidítése
amakrin
1. Olyan sejt, vagy struktúra, amelyben nincs hosszú, fibrosus nyúlvány. 2. Ilyen sejtnek, vagy struktúrának jelzője. (gör: a-, fosztóképző + makros, hosszú + is, rost)
amakrin sejt
Cajal által leírt, retinában található idegsejt típus, mely rövid elágazódó dendritekkel, axonnal azonban feltehetőleg nem rendelkezik.
amalgám
Olyan öntvény, amelyben valamely elem, vagy fém higannyal ötvöződik. A fogászatban főként két típusát alkalmazzák, az ezüst-ón amalgámot, amely kis mennyiségben még tartalmaz rezet, cinket és még esetleg más fémeket is, míg a másik több rezet tartalmaz (12-30 súly%-ig). Ezeket fogtömésre és festékkészítésre használják. (gör: malagma, lágy massza)
amantadin hidroklorid
Antiviralis szer, melyet influenza ellen alkalmaznak, de Parkinson-kór kezelésében szintén használatos, mivel a dopamin felszabadulását fokozza, ill. visszavételét gátolja a substantia nigra dopaminerg neuronjainak idegvégződésein.
amarus
(lat.) keserű
amasia
szinonima: amastia
amastia
emlőhiány; szinonima: amasia (gör: a-, fosztóképző + mastos, emlő)
amatoxin
Amanita phalloides toxinja, biciklikus octapeptid
amaurosis
vakság, a szemek kóros eltérése nélkül; oka általában valamilyen agyi elváltozás (gör: amauros, sötét + osis, állapot)
Találatok Magyarázat
amaurosis fugax Átmeneti, néhány percig tartó vakság, amelynek oka lehet az arteria carotis elégtelensége, az arteria retinalis embolusa, vagy a centrifugalis erő (pl. repülés során).
amauroticus
amaurosissal kapcsolatos, vagy abban szenvedő
ambageusia
ízérzés elvesztése a nyelv mindkét oldalán (lat: ambo, mindkettő + gör: a-, fosztóképző + geusis, ízérzés)
ambi-
körül, minden oldalról, kettős; megfelelője a görög amphi- (lat: körül)
ambidexter
mindkét kezet egyforma ügyességgel használó
ambidextria
mindkét kéznek ugyanolyan ügyességgel történő használata
ambiguus
1. kétértelmű 2. anat: vándorló; kétirányú 3. neuroanat: nucleus ambiguus, amelyből kiinduló visceralis efferens rostok a n. vagusban és n. glossopharyngeusban futnak. (lat: ambiguus, vándorol)
ambilateralis
mindkét oldalra vonatkozó, kétoldali (ambi + lat: latus, oldal)
ambiszexuális
1. Olyan szexuális jellegzetességnek jelölése, amelyek mindkét nemben fellelhetőek. 2. szleng: biszexuálisok jelölésére
ambivalencia
Egy adott személlyel, dologgal, vagy eszmével szemben érzett kettős érzés, vagy érzelem. Szeretet és gyűlölet egyszerre történő érzése ugyanazon személy iránt. (ambi- + lat: valentia, erő)
ambivalens
ambivalenciára vonatkozó, vagy azzal jellemzett
ambly-
tompaság, homály, halványság (gör: amblys, halvány, tompa)
amblyaphia
tapintási érzék csökkenése (ambly- + gör: haphé, érint)
amblygeusia
ízérzés csökkenése (ambly- + gör: geusis, ízérzés)
amblyopia
Látásgyengeség valamely szemen, amelynek oka nem ismert, lencsével nem korrigálható. (gör: amblyopia, látás homályossága)
Találatok Magyarázat
szuppressziós amblyopia Az egyik szem centrális látása gátolt, ha a kép a két szemben oly mértékben különbözik, hogy képtelen egybeolvadni. Ezt okozhatja (1) rossz képalakítás (sensoros amblyopia), (2) a két szem törőviszonyainak nagy mértékű eltérése (anisometrop amblyopia) , vagy (3) a két szem másfelé tekint (strabismus). A legtöbb szuppressziós amblyopia megfelelő kezeléssel megszüntethető 6 éves kor előtt.
amblyoscop
Reflektáló stereoscop, amellyel értékelni, illetve stimulálni lehet a binocularis látást. (gör: amblyopia + skopeo, tekinteni)
amboceptor
Komplement kötő antitest, jelenleg főleg a birkák vörösvérsejtjei ellen termelt antitesteket értjük alatta, amelyeket hemolitikus komplement fixációs tesztekben használunk. (ambo + lat: capio, venni)
ambuláns
Olyan beteg, aki nem ágyhoz kötött, fennjáró. (lat: ambulans, sétáló)
Találatok Magyarázat
ambuláns sebészet Operatív beavatkozások olyan betegeken, akiknél a felvétel napján történik a beavatkozás, és a hazabocsájtás is.
amelia
congenitalis végtaghiány (gör: a-, fosztóképző + melos, végtag)
ameloblast
A zománcszerv belső rétegének hengerhámsejtje a fejlődő fogcsírában, amelynek szerepe jelentős a fogzománc kialakításában. (ang: amel, zománc + gör: blastos, csíra)
ameloblastoma
Benignus odontogen epithelialis daganat, mely lassan növekszik, radiolucens tumorként. Leggyakrabban a mandibula hátsó területen mutatkozik; nem megfelelő excisio esetén hajlamos a kiújulásra. (ameloblast + gör: oma, tumor)
amelodentinalis
szinonima: dentinoenamelis
amelogenesis
A fogzománc lerakódása és fejlődése. Szinonima: enamelogenesis
Találatok Magyarázat
amelogenesis imperfecta Örökletes, ectodermalis fejlődési zavar, amelynél a fogzománc képződése zavart szenved. Szinomima: enamelogenesis imperfecta
amenorrhoea
menstruáció hiánya, vagy elmaradása (gör: a-, fosztóképző + mén, hónap + rhoia, folyás)
Találatok Magyarázat
amenorrhoea lactationis A menstruáció fiziológiás elmaradása szoptatás alatt. Szinonima: postpartum amenorrhoea
primer amenorrhoea menstruáció teljes hiánya
szekunder amenorrhoea A menses pubertásban megjelent, de később kimaradt (pl. súlyos testsúlyvesztés, krónikus betegség, endokrin zavar következtében).
amentia
1. Szinonima: mentalis retardatio 2. Szinonima: dementia (lat: bolondság)
amerícium (Am)
Uránium neutronnal való bombázásakor, vagy a plutónium 241,242 és 243 -bomlásakor kapott elem. Atomszáma 95, atomsúlya 243,06. A 241Am (felezési idő 432,2 év) csontbetegségek diagnosztikájában használható. A 243Am felezési ideje 7370 év.
ametria
uterus congenitalis hiánya (gör: a-, fosztóképző+ metra, méh)
ametropia
Bármilyen fénytörési zavar, amelynek következtében a beteg nem képes a retinára fókuszálni. (gör: a-, fosztóképző + metron, mérték + ops, szem)
ametropiás
Ametropiával kapcsolatos, vagy olyan személy, aki ametropiában szenved.
amfórás
Üreges hang jelzése, amelyet percussio, vagy auscultatio révén hallunk a thorax fölött, ha a tüdőben üreg, vagy pneumothorax alakult ki. (gör: amphora, edény)
amfoter
Két ellentétes jellemzővel rendelkező, pl. olyan tulajdonságú vegyület, amely savként és bázisként is viselkedik. (gör: amphoteroi, mindkettő)
amid
Olyan kémiai anyag, amely formálisan az ammóniából származik, annak egy, vagy több H atomját acil-csoporttal behelyettesítve R-CO-NH2 általános képletet nyerjük; Egy H atom helyettesítése primer amid, két hidrogéné szekunder amid és három esetén pedig tertier amid képződéséhez vezet. Fordítva:_amid vegyület karboxilsavból a karboxil -OH csoportjának NH2-vel történő szubsztitúciójával is előállítható.
amidáz
Olyan enzim, amely a monokarboxil-amidok hidrolízisét katalizálja szabad savvá és NH3-vá. Szinonima: acil-amidáz
amidin
monovalens gyök; -C(NH)-NH2
amido-
prefixum, jelzi az amid gyök jelenlétét (R-CO-NH, vagy R-SO2-NH, stb.)
amidohydrolases
(EC osztály 3.5.1 és 3.5.2.) az amidokban és a ciklikus amidokban C-N kötéseket hidrolizáló enzimek Pl. asparaginase, barbiturase, urease, amidase. Szinonima: amidases, deamidases, deamidizing enzymes
amidoxil
amidoxim gyök, mely a terminalis H atom (NOH-n lévő hidrogén) leválasztása után keletkezik.
amidoxim
amidok oxim származékai; általános képletük: R-C(NH2)-NOH
amil
Pentánból (C5H12) egy hidrogén eltávolításával keletkezett kémiai gyök, melynek több izomerje ismert. Szinonima: pentil
amiláz
Az amilolitíkus enzimek egyik típusa, amely hasítja a keményítőt, a glikogént és olyan vegyületeket, amelyek 1,4-α-glukánokkal kapcsolatosak. Szinonima: diasztáz
amilopektin
Elágazó szénláncú poliglükóz (glikán) a keményítőben, amelyben mind 1,4, mind 1,6 kötések előfordulnak. Vö: amilóz
amilóz
Nem elágazó szénláncú poliglükóz (glikán) a keményítőben, amely hasonlít a cellulózra, α(1-4) kötéseket tartalmaz. Vö: amilopektin
amimia
1. A non-verbális kommunikációban az egyén nem képes gesztusokat, jeleket használni. 2. Asymbolia; nem képes a gesztusok, jelek, szimbólumok, pantomim értelmét felfogni. (gör: a-, fosztóképző + mimos, mimika)
amin
Olyan anyag, amely formálisan az ammóniából származik egy, vagy több H atom szénhidrogénnel, vagy más gyökkel történő helyettesítésével. Egy H helyettesítése adja a primer amin-t (pl. NH2CH3), két H atom esetén szekunder amin keletkezik (pl. NH(CH3)2), míg három H szubsztitúciója nyomán tercier amin jön létre (pl. N(CH3)3). Lehetséges négy H atomot is szubsztituálni, ekkor keletkezik a quaterner amin (pl. +N(CH3)4), amely pozitív töltéssel rendelkezik. Az amin-ok sókat alkotnak különböző savakkal.
Találatok Magyarázat
amin oxidáz Flavin tartalmú oxidoreduktáz enzim, amely az aminokat O2 és víz jelenlétében aldehidekké, vagy ketonokká oxidálja, miközben NH3 és H2O2 válik szabaddá.
sympathomimeticus amin Olyan hatóanyag, amely hasonló választ provokál, mint az adrenerg idegi aktivitás (pl. epinephrin, ephedrin, isoproterenol). Szinonima: adrenomimeticus amin
vazoaktív amin Olyan anyag, mint a hisztamin, vagy szerotonin, melyek amino-csoportot tartalmaznak, és farmakológiailag a vérerekre gyakorolt hatásukkal jellemezhetők, változtatják az erek kaliberét és permeabilitását.
amino-
Prefixum, mely azt jelzi, hogy a vegyület amino-gyököt (-NH2) tartalmaz.
aminoacidaemia
aminosavak nagy mennyiségű jelenléte a vérben (aminoacid + gör: haima, vér)
aminoaciduria
aminosavak vizelettel történő kiválasztása, különösen nagy mennyiségben (aminoacid + gör: ouron, vizelet)
aminoacil
Aminosavból képződő gyök, ha a -COOH csoportból eltávolítjuk a hidroxil-csoportot.
aminoaciláz
Olyan enzim, amely széles skálájú N-acil aminosav hidrolízisét katalizálja a megfelelő aminosavakká.
aminolízis
Halogén atom amino-gyökkel történő szubsztitúcióját katalizálja alkil, vagy aril molekulában.
aminopeptidáz
Peptid lebontásban résztvevő enzimek, az aminosavat a peptid lánc amino-végéről hasítják le (vagyis exopeptidázok); a bélszekrétumban találhatók.
aminosav
Organikus sav, amelyben a szénatomhoz kapcsolódó egyik H atomot NH2-csoport helyettesíti. Rendszerint amino-karboxilsavat jelent. Ld. α-aminosav
Találatok Magyarázat
aminosav dehidrogenáz Olyan enzimek, amelyek az aminosavakat oxidatív dezamináció során oxo- (keto-)savakká alakítják át.
esszenciális aminosav α-aminosavak, amelyeket a szervezetnek a táplálékból kell beszereznie akár aminosav, akár fehérje alakjában, mivel nem képes szintetizálni az emberi szervezet ezeket.
non-esszenciális aminosav Azok az aminosavak, amelyeket maga a szervezet is képes előállítani, tehát nem feltétlenül szükséges, hogy az étkezés tartalmazza.
aminosav oxidáz Oxidáló flavoenzimek, amelyek O2, vagy víz révén specifikusan vagy a D-, vagy az L-aminosavakat a megfelelő 2-ketosavakká, NH3-vá és H2O2-vé alakítják. Vö: aminosav dehidrogenáz
α-aminosav Olyan aminosav, amelynek általános képlete: R-CHNH2-COOH (vagyis az NH2 α helyzetben található a -COOH csoport mellett). A proteinek hidrolízisének termékei az L-α-aminosavak.
aminotranszferáz
Ezek az enzimek amino-csoportot szállítanak át (rendszerint) 2-ketosavra. Szinonima: transzamináz
aminuria
aminok vizeletben történő kiválasztása (amin + gör: ouron, vizelet)
amitózis
A sejtmag és a sejt direkt osztódása anélkül, hogy a normál sejtoszlás alatt észlelt bonyolult folyamat lezajlana. (gör:a-, fosztóképző + mitosis)
ammeter (am)
Olyan készülék, amely az elektromos áramerősséget amperben méri.
ammonaemia, ammoniaemia
Az ammóniának, vagy vegyületeinek fokozott jelenléte a vérben. Tünetei: alacsony testhőmérséklet, gyenge pulzus, gasztroenterális tünetek és coma. (ammónia + gör: haima, vér)
ammónia-liáz
Olyan enzimek, amelyek az ammóniát vagy egy amino-csoportot nem hidrolitikus úton, a C-N kötés hasításával távolítanak el otthagyva egy kettős kötést.
ammonio-
Összetételben ammónium csoport jelenlétére utal.
ammónium
NH4+-ion, amely az NH3 és H+ kapcsolódásából származik; ammónium vegyületek képzésekor úgy viselkedik, mint egy univalens fémion.
ammoniuria
vizelettel nagy mennyiségű ammónia kiválasztása (ammónia + gör: ouron, vizelet)
ammonolízis
Kémiai kötés hasítása ammónia bevitelével a hasítási pontnál (ammónia + gör: lysis, oldás)
amnesia
Memóriazavar, a hosszú távú (long term) memóriában raktározott információk kiesése. Ilyen esetben a beteg képtelen a múlt tapasztalataira visszaemlékezni. (gör: amnesia, feledékenység)
Találatok Magyarázat
anterográd amnesia Egy traumára, vagy betegségre történő emlékezés esik ki, amely magát az amnesiát előidézte.
lacunaris amnesia Egy izolált eseményre vonatkozik csupán az amnesia.
retrográd amnesia Olyan eseményre vonatkozik, amely a kiváltó trauma, vagy betegség előtt történt.
tranziens globális amnesia Olyan jelent és közelmúltat érintő, átmeneti, rövid ideig tartó emlékezet zavar, amelyet középkorú, vagy idős betegen látunk. Ezen epizód alatt a beteg bár emlékezet kiesésben szenved, de egyébként teljesen éber és tájékozott, képes igen magas intellektuális aktivitásra és a neurológiai vizsgálat is normális viszonyokat fed fel.
traumás amnesia A memória elvesztése, vagy zavara az agyat ért sérülés kapcsán jelentkezik, amely megfelelhet a fejet érő sérülésnek, túlzott alkoholfogyasztásnak, vagy éppenséggel az alkohol megvonásnak, ill. valamely pszichoaktív szer kihagyásának. Ilyen típusú memória kieséssel találkozunk hisztériában és más disszociatív rendellenességekben is.
amnesiás
amnesiában szenvedő személy
amnesiogen
amnesiát előidéző (környezeti hatás, gyógyszer stb.)
amnesticus
1. amnesiára vonatkozó 2. Olyan anyag, amely amnesiát idéz elő. 3. Olyan elváltozás, amelynek a memória funkció károsodása az egyik jellegzetessége.
amnio-
amnionra vonatkozó előtag kifejezésekben (gör: amnion)
amniocentesis
transabdominalis folyadékleszívás az amnionzsákból diagnosztikai céllal (amnio + gör: kentésis, csapolás)
amniochorialis
mind az amnionnal, mind a chorionnal kapcsolatos
amniogenesis
az amnion kialakulása (amnio + gör: genesis, kialakulás)
amnioma
Lapos, kiterjedt daganat a bőrben, amelyet antenatalis amnion letapadása okoz. (amnio + gör: oma, tumor)
amnion
A legbelső embrionalis hártya, amely az embriót az uterusban burkolja, és az amnionfolyadékot tartalmazza; trophoblast sejtekből származik. Egy belső, ectodermalis eredetű embrionalis rétegből és egy külső szomatikus mesodermalis összetevőből áll. A terhesség végső fázisában az amnion kiterjed, és kapcsolatba kerül, majd részben összeolvad a chorion ereinek belső falával. (gör: magzatburok, amnios, bárány)
Találatok Magyarázat
amnion nodosum Amnionban lévő csomócskák, amelyeket szarusodó epithelium alkot; squamosus metaplasiának felel meg.
amnionitis
Gyulladás az amnionzsák fertőzésének következtében, amely idő előtti magzatburok repedést idézhet elő (gyakran a magzat fertőzése társul a kórképhez). (amnion + gör: itis, gyulladás)
amniorrhexis
amnionzsák ruptura (amnio + gör: rhexis, ruptura)
amniorrhoea
amnionfolyadék csorgása (amnio + gör: rhoia, folyás)
amnioscop
endoszkóp az amnionfolyadék vizsgálatára intakt amnionzsákban
amnioscopia
amnionfolyadék vizsgálata az amnionzsák legalsó pontján endoszkópot alkalmazva a nyakcsatornán keresztül (amnio + gör: skopeo, megtekinteni)
amnioticus
amnionra vonatkozó
amniotom
magzatburok bemetszésére szolgáló eszköz (amnio + gör: tomé, vágás)
amniotomia
A magzatburok mesterséges repesztése, amely a szülés megindítását célozza.
amoeba
(pl. amebae) protoplazma nyúlványokkal mozgó egysejtű élőlény, protozoon. Sok faja emberi kórokozó.
amoebiasis
Entamoeba histolytica, vagy esetleg más amoebával történt fertőzés okozta kórkép (amoeba + gör: iasis, állapot)
amoebicid
amoebákat pusztító
amoebiform
amoeba alakját felvevő (amoeba + lat: forma, alak)
amoebocyta
1. gerinctelenek közé tartozó vándorló sejt 2. in vitro leukocyta szövetkultúra 3. leukocyták régies, elavult neve (amoeba + gör: kystos, sejt)
amoeboid
1. jellegzetességében amoebára emlékeztető 2. Szabálytalan körvonalú, perifériás nyúlványokkal rendelkező sejt. Lemeztenyészeten a telepek alakjára utal. (amoeba + gör: eidos, megjelenés)
amoeboma
Nodularis, tumorszerű proliferatív gyulladás, amely krónikus amoebiasisban fordulhat elő, főleg a colon falában. Szinonima: amoebás granuloma (amoeba + gör: oma, tumor)
amoeburia
amoebák jelenléte a vizeletben (amoeba + gör: ouron, vizelet)
amorph
1. Olyan allél, amelynek a fenotípusban nincsen felismerhető produktuma, létezéséről tehát csak molekuláris bizonyítékok alapján tudunk. 2. alaktalan, torz (gör: a-, fosztóképző + morphé, alakít)
amorphia, amorphismus
amorf állapot, amorfként létezni (gör: a-, fosztóképző + morphé, alakít)
amorphus
1. meghatározott alak nélküli, torz, differenciálatlan 2. nem kristályos
Ampere (A)
Az elektromos áram gyakorlati egysége. Az abszolút, gyakorlati Ampere (A) eredeti meghatározása szerint 1/10-e az elektromágneses egységnek (ld. abampere és coulomb). A jelenlegi meghatározása a következő: 1. Az az áram, amely 1 másodperc alatt átfolyva 1,118 mg ezüstöt von ki az ezüst-nitrát oldatból. 2. Tudományos (SI) definíciója: Az Ampere (A) az áram mennyiség, amely két párhuzamos végtelen hosszúságú vezetékben, amelyeknek elhanyagolható a keresztmetszete és vákuumban 1 méter távolságra helyezkednek el egymástól, közöttük 2x10-7 N/m nagyságú erőt képez.
amph-
ld. amphi-, ampho-
amphi-
mindkét oldali, körülvevő, kettős, megfelel a lat. ambi-nak (gör: amphi, amphi-, mindkét oldalt, körül)
amphiarthrodialis
symphysissel kapcsolatos (1) (amphiarthrosis)
amphiaster
Kettős csillag alakzat, amelyet a két asztroszféra és az őket összekötő osztódási orsó képez mitózis alatt. (gör: amphi- + astér, csillag)
amphicentricus
mindkét szélén lévő középpontba összefutó, pl. rete mirabile (az erek szétágazódnak, majd ismét egyesülnek ugyanazon érbe). (amphi- + gör: kentron, centrum)
ampho-
minkét oldali, körülvevő, kettős (gör: ampho, mindkettő)
amphocyta
szinomima: amphophil
amphophil
1. mind savi, mind bázikus festékek iránt affinitással rendelkező 2. Olyan sejt, amelyik könnyen felveszi a savanyú és a bázikus festéket egyaránt. (ampho + gör: philos, szeret)
amplificatio
1. erősítés, nagyobbítás 2. inger (pl. hallási, látási inger) erősségének növelése az érzékelés megkönnyítésére
Találatok Magyarázat
genetikai amplificatio Olyan eljárás, amellyel a megfelelő genetikai anyag mennyiségét növelik meg, főleg a plazmid DNS arányát a bakteriális DNS-ben. (lat: amplificatio, nagyobbítás)
amplifier (erősítő)
1. Olyan eszköz, amely a mikroszkóp nagyítását növelni képes. 2. Elektronikus szerkezet, amely a bemeneti jeleket fokozza, erősíti.
Találatok Magyarázat
image amplifier (képerősítő) Olyan szerkezet, amely a fluoroscopos (Rtg) kép alacsony fényintenzitását olyan mértékben erősíteni képes, hogy világos környezetben is a szem számára jól láthatóvá teszi. Rendesen fénysokszorozóból áll, amelyet televíziós képernyővel kötnek össze.
ampulla
(gen. ampullae) 1. valamely csatorna, vagy cső zsákszerű kidomborodása 2. üvegtartály injekciós oldatok számára (lat: ampulla, kétfülű korsó)
Találatok Magyarázat
ampulla recti analis csatorna feletti tág szakasza a rectumnak
ampulla labyrinthi A három félkör alakú ívjárat mindegyikének egyik végén található körkörös tágulat, melyekben a neuroepithelialis crista ampullaris található.
ampulla tubae uterinae A petevezeték széles része, közel annak csillós (fimbriás) végéhez. Komplexen ráncolt mucosája csillószőrös hengerhámmal fedett, közöttük szekretoros sejtek találhatók.
ampullaris
ampullával kapcsolatos
ampullitis
Bármely ampulla gyulladása, de főleg a vas deferens tágult részének, vagy a Vater-ampullának a gyulladásos folyamatát jelöli. (ampulla + gör: itis, gyulladás)
amputált
Olyan személy, akinek valamely végtagját, vagy annak egy részét csonkolták.
amputatio
1. Egy végtagnak, vagy végtag egy részének, az emlőnek, vagy más testrésznek műtéti úton történő eltávolítása, csonkolása. 2. A fogászatban a fog gyökerének, vagy a pulpának, vagy a ganglionnak az eltávolítását jelenti. Módosító melléknévvel szokás jelölni, a fog mely részéről van szó (pulpa amputatio, gyökér amputatio). (lat: amputatio, nyesni)
Találatok Magyarázat
Chopart-féle amputatio középső tarsalis vonalban, vagyis a tarsonavicularis és a calcaneo-cuboid ízületek között végzett amputatio; szinonima: mediotarsalis amputatio
kineplasztikus amputatio Olyan amputációs módszer egy végtagon, amelyben az izmok és inak a csonkban úgy egyesülnek, hogy képesek bizonyos mozgásokat végezni, illetve mozgásokat közvetíteni speciálisan konstruált protézishez.
circularis amputatio A bőrön kör alakú metszést végeznek, az izmokat hasonló módon felette metszik át, végül pedig a csontot még magasabban vágják át.
congenitalis amputatio In utero történt amputatio, amelyet általában amnionszalag okozta nyomás magyaráz. Szinonima: intrauterin amputatio, spontán amputatio
double flap amputatio A lebenyt a végtag mindkét oldalán lévő lágy részekből alakítják ki.
Dupuytren-féle amputatio a kar vállízületben történő amputatio-ja
flap amputatio Az izom és a bőrszöveti lebeny a csontot teljesen fedi.
flapless amputatio Ebben az esetben nincsen csonkot fedő szövet.
Gritti-Stokes féle amputatio A femur supracondylaris amputatio-ja; a patellát megtartják, és a csont végére teszik, de eltávolítják róla az ízületi porcot, hogy a csonttal egyesülni tudjon.
Hey-féle amputatio tarsometatarsalis ízületben végzett amputatio
interpelviabdominalis amputatio szinonima: hemipelvectomia
intrauterin amputatio szinonima: congenitalis amputatio
Krukenberg-féle amputatio Kineplasztikus amputatio egyik formája, melynél a csonkolás a kéztőben, az alkar distalis végén történik, amellyel villa alakú csonkot képeznek ki. Ez főként a vakok esetén hasznos, mivel a csonkban fennmarad a propriocepció.
Larrey-féle amputatio vállízületben történő csonkolás
Lisfranc-féle amputatio A lábon a tarso-metatarsalis ízületben végzik a csonkolást, a talpat megfelelő lebennyel megtartják.
mediotarsalis amputatio szinonima: Chopart-féle amputatio
ovális amputatio A lebeny ovalis metszés révén készül izomból és bőrből.
periosteoplasticus amputatio szinonima: subperiostalis amputatio
Pirogoff-féle amputatio A lábon a tibiának és a fibulának alsó ízületi felszínét átfűrészelik és a végeket a calcaneus egy részével fedik, amelyet átvágnak felülről lefelé és előre.
spontán amputatio 1. szinonima: congenitalis amputatio 2. kórfolyamat eredményként létrejött, nem pedig külső trauma okozta amputatio
Stokes-féle amputatio A Gritti-Stokes amputatio módosított változata, amelynél a femur átvágásának vonala proximalisabban helyezkedik el.
subperiostealis amputatio A periosteumot a csontról amputáció helyétől distalisan lefejtik, majd később visszahelyezik, ily módon egy periostalis lebeny alakul ki a metszés végén. Szinonima: periosteoplasticus amputatio
Syme-féle amputatio A láb amputatio-ja a bokaízület szintjén történik, a bokákat lefűrészelik, a lebenyt pedig a sarok lágy részeiből állítják elő.
Teale-féle amputatio 1. Az alkar alsó felében, vagy a combon hosszú posterior derékszögű és rövid anterior lebennyel végzett csonkolás. 2. A láb amputálása hosszú anterior derékszögű és rövid posterior lebennyel.
traumás amputatio Az amputatio-t baleseti, vagy egyéb, nem sebészi behatás okozza; lehet komplett és inkomplett típusú.
Tripier-féle amputatio A Chopart-féle amputatio módosítása, amelyben a calcaneus egy részét is eltávolítják.
amusia
Az aphasia egyik alakja, amely esetén a páciens nem képes zenét felismerni, vagy zenét szerezni. (gör: a-, fosztóképző + mousa, zene)
amyelia
A gerincvelő congenitalis hiánya, mely anencephaliával együtt fordul elő. (gör: a-, fosztóképző + myelos, velő)
amyeloid
A csontvelő hiányát jelzi, vagy azt, hogy maga a csontvelő nem vesz részt a vérképzésben. (gör: a-, fosztóképző + myelos, velő)
amygdala
(gen. amygdalae) A tonsilla cerebellit, valamint a lymphaticus tonsillákat jelenti (pl. pharyngealis, palatinalis, lingualis, laryngealis és tubalis). (gör: amygdalé, mandula)
amygdaloid
mandulára, illetve tonsillára emlékeztető (amygdala + gör: eidos, megjelenés)
amyl-
1. Ld. amylo- 2. pentil-, ld. amil
amylaceosus
keményítőszerű
amylasuria
Az amiláz exkréciója a vizeletben; különösen nagy mennyiségben jelenik meg pancreatitisben. Szinonima: diastasuria
amylin
keményítő szemcsék oldhatatlan része
amylo-
keményítő, poliszacharid eredetű, vagy jellegű (gör: amylon, őröletlen keményítő)
amylogenesis
keményítő bioszintézis (amylo + gör: genesis, képzés)
amyloid
1. Kémiailag különböző proteinek csoportja, amely mikroszkópos vizsgálattal homogénként mutatkozik. Összetételében lineáris, nem elágazó aggregált fibrillák lemezekké rendeződnek elektronmikroszkóp alatt. Jóddal sötétbarnásra festődnek, a polarizált fényben jellegzetes zöld színben látszanak, kongóvörössel metakromáziásan festődnek, míg metilibolyával rózsás vörös, vagy kristályibolyával bíbor vörös és thioflavin T festéssel sárgás fluoreszcenciát mutatnak. Jellegzetesen kóros depositumként (amyloidosis) láthatók, különösen a reticulo-endothelialis szövetekkel kapcsolatban. Kémiai természetét tekintve proteinből álló fibrillumok, amelyek az alapbetegségnek megfelelő fehérjékből származnak. 2. keményítő tartalomra emlékeztető (amilo + gör: eidos, emlékeztető)
amyloidosis
1. betegség, amelyet a különböző szervekben és szövetekben felhalmozódó amyloid jellemez. 2. amyloid protein depozíciójának folyamata (amyloid + gör: osis, állapot)
Találatok Magyarázat
időskori amyloidosis Kongóvörössel festődő proteinek lerakódása, főleg az idegrendszerben, a myocardiumban és a pancreasban találjuk. Alzheimer-betegségben is hasonló a lelet. Kezelhetetlen esetben szívelégtelenséget eredményez a szívizomban való amyloid lerakódás.
focalis amyloidosis szinonima: nodularis amyloidosis
light-chain related amyloidosis (könnyű lánc amyloidosis) A primer amyloidosis egyik alakja, amelyben a fibrillaris depozitumok az immunglobulinok könnyű láncából származnak. B-lymphocytás és plazmasejtes dyscrasiáknál látjuk.
macularis amyloidosis Az amyloidosis bőrre lokalizált formája. Szimmetrikus, barna, viszkető hálózatos maculák jellemzik, főleg a hát felső részén. Mikroszkópos vizsgálattal az amyloid subepidermalis globulusokban deponálódott.
nodularis amyloidosis Lokalizált alak, amelyben az amyloid csomókban, a bőrben, vagy a nyálkahártyában (pl. larynxban) lerakódva mutatkozik. Szinonima: amyloid tumor, focalis amyloidosis
primer amyloidosis Kialakulásában semmiféle kiváltó társbetegség nem játszik szerepet. Az amyloid depositumok az artériák falát beszűrik, valamint a nyelv mesenchymalis szöveteiben, a tüdőben, a béltraktusban, a bőrben, a vázizomzatban és a myocardiumban is megtalálhatók. Gyakran nem mutatható ki a szokásos kongóvörös festéssel, idegentestszerű gyulladásos reakciót provokálhat.
renalis amyloidosis Az amyloid a vesében rakódik le, főleg a glomerulusok kapillárisainak falában, következményes albuminuriával és nephrosis-szindrómával. Szinonima: amyloid nephrosis
szekunder amyloidosis Krónikus gyulladásos betegségekhez társulva mutatkozik. Gyakrabban megtámadott szervek a máj, a lép, a vesék. A mellékvesék érintettsége ritkábban észlelhető.
senilis amyloidosis Idős embereken gyakori forma, rendszerint enyhe és a szívre korlátozódik. Ld. időskori amyloidosis
amylolysis
keményítő oldható származékokra történő bontása (amylo + gör: lysis, oldás)
amylorrhoea
Emésztetlen keményítő megjelenése a székletben, amely a tápcsatornában lévő emésztőenzim, amiláz hiányára enged következtetni. (amilo + gör: rhoia, folyás)
amylosuria
keményítő megjelenése a vizeletben; szinonima: amyluria
amyluria
szinonima: amylosuria
amyoaesthesia, amyoaesthesis
izomérzés kiesése (gör: a-, fosztóképző + mys, izom + aisthésis, felfogás)
amyostasia
álló testhelyzet megtartásának nehézsége izomremegés, vagy inkoordináció miatt (gör: a-, fosztóképző + mys, izom + stasis állás)
amyostaticus
izomremegés jelenléte
amyosthenia
izomgyengeség (gör: a-, fosztóképző + mys, izom + sthenos, erő)
amyotaxia
izomataxia, az izomműködés idegrendszeri eredetű zavara (gör: a-, fosztóképző + mys, izom + taxis, rend)
amyotonia
Az izomtónus generalizált hiánya, mely rendszerint laza izomzattal és az ízületekben fokozott mozgathatósággal társul.
Találatok Magyarázat
amyotonia congenita 1. Atoniás pseudoparalysis, amely veleszületett, de nem örökletes eredetű. Különösen gyerekeken észleljük; jellemző, hogy az izomtónus csak a gerincvelői idegek által innervált izmokból hiányzik. Szinonima: myotonia congenita, Oppenheim-szindróma 2. Congenitalis neuromuscularis eltérések összefoglaló, általános elnevezése, amelyek fiatalokban általános myotoniát okoznak és benignus lefolyásúak.
amyotrophia
izomsorvadás, vagy atrophia (gör: a-, fosztóképző + mys, izom + trophé, táplálás)
Találatok Magyarázat
diabéteszes amyotrophia A diabeteses neuropathia egyik típusa, amely elsősorban idős betegeket érint. Klinikailag jellegzetes tünetek közé tartoznak: egyoldali, vagy mindkét oldali combfájdalom, gyengeség és atrophia. A diabéteszes polyradiculopathiának egyik alakja; gyakran tévesen femoralis neuropathiának is nevezik.
neuralgiás amyotrophia Idegrendszeri zavar, amelynek oka ismeretlen. Hirtelen kezdet és erős fájdalom jellemzi, főleg a vállban, gyakran éjjel hevesebbé válik a fájdalom, majd mindezt izomgyengeség és sorvadás követi a felső végtagban, különösen a vállövben. Észleltek sporadikus és familiáris megjelenést, az előző gyakoribb. Néha megelőző események deríthetők fel az anamnézisben, mint pl. légúti fertőzés, kórházi bennfekvés, vakcináció, nem specifikus trauma. A betegséget gyakran a plexus brachialis elváltozásának tulajdonítják, mivel az idegek, amelyekre kiterjed, a felső truncusból erednek, de aktuálisan multiplex proximalis mononeuropathiaként is mutatkozhat.
amyotrophiás lateralsclerosis (ALS)
Motoneruron-betegség, progresszív, fatálisan végződő, neurodegeneratív kórkép, a mozgató neuronok károsodása következtében alakul ki, amelyek az akaratlagos mozgásokat irányítják. Jellemző az izomgyengeség, izomsorvadás, működéskiesések, a beteg egy idő után képtelen lesz önmagát ellátni.
amyxorrhoea
normál nyákszekréció hiánya (gör: a-, fosztóképző + myxa, nyák + rhoia, folyás)
an-
ld. a-
ana-
Prefixum, melynek jelentése: ismét, újra, vissza; nem összetévesztendő az an- fosztóképzővel. (gör: ana, fel)
anabiosis
Az anabiosis az életjelenségek megszűnésével járó, de még reverzibilis állapot. (gör: újraéledés)
anabolikus
anabolizmussal kapcsolatos, vagy azt elősegítő
anabolit
Bármilyen anyag, amely anabolikus folyamat kapcsán keletkezett.
anabolizmus
1. Komplex vegyületek, makromolekulák felépítése a szervezetben kisebb alkotóelemekből (pl. proteinszintézis aminosavakból). Rendszerint energia igényes folyamat. 2. szintetizáló anyagcsere reakciók összessége (gör: anabolé, felemelni)
anaciditás
Savasság hiánya; főleg a gyomornedv sósav hiányát jelöli.
anaclasis
1. fény, vagy hang visszaverődése 2. szem törőközegeinek fénytörése (gör: hátra hajlás, reflexió)
anaclisis
Támaszkodás valamire, vagy függés valakitől. A pszichoanalízisben a csecsemő függése anyjától, vagy az anyahelyettestől. Ld. anacliticus depressio (gör: ana-, valami irányába + klino, támaszkodni)
anacrot
Az artériás pulzushullám felszálló szárának felütésére vonatkozik; az anadicrot rövidített alakja. Két ütés a felszálló szár alatt; szinonima: anadicrot
anacrotismus
pulzushullámra jellemző; ld. anacrot pulzus. Szinonima: anadicrotismus (gör: ana, fel + krotos, ütés)
anacusis
hangpercepció teljes kiesése; siketség
anadenia
mellékvesefunkciók teljes hiánya
anadicrot
szinonima: anacrot
anadicrotismus
szinonima: anacrotismus (gör: ana, fel, di-krotos, kettős ütés)
anadipsia
kórosan fokozott szomjúság; ld. polydipsia
anadrenalismus
mellékvesefunkciók teljes hiánya
anaemia
Minden olyan állapot, amelyben a vörösvérsejtek száma köbmilliméterenként, valamint a 100 ml-re számított hemoglobin érték és a 100 ml-re számított hematokrit érték a normálisnál alacsonyabb. Klinikailag az oxigén szállítására szolgáló anyag koncentrációja csökken, szembe állítva a totális mennyiség csökkenésével, amelyet oligocythaemiának, oligochromaemiának és oligaemiának nevezünk. Az anaemia klinikai képe: sápadtság a bőrön és a nyálkahártyákon, légszomj, szív palpitatioja, lágy szisztolés zörej, letargia és fáradékonyság. (gör: anaimia, vérszegénység)
Találatok Magyarázat
achresticus anaemia A krónikus progresszív macrocytás anaemia egyik alakja, amely fatális kimenetelű is lehet. A vérképben és a csontvelőben az elváltozások az anaemia perniciosára emlékeztetnek, de a B12-vitamin adása legfeljebb átmeneti hatást fejt ki, vagy teljesen hatástalan. Glossitis, gasztrointesztinális panaszok, központi idegrendszeri tünetek és láz, szemben az anaemia perniciosával, itt nem észlelhetők, valamint a beteg nem vérzékeny, nincs hemolízise. (gör: a-, fosztóképző + chrésis, használás)
Addison-féle anaemia szinonima: anaemia perniciosa
aplasticus anaemia Olyan anaemia, amelyet az erythrocyták és a hemoglobin képzésének nagyfokú elégtelensége jelez, rendszerint együtt jár granulocytopeniával és a thrombocytopeniával; a csontvelő hypoplasticus, vagy aplasiás.
autoimmun hemolitikus anaemia 1. hideg hemagglutinin okozta hemolitikus anaemia 2. Meleg típusú antitest okozta, szerzett hemolitikus anaemia; az antitest a beteg saját vörösvérsejtjeivel reagál, az antigén specificitás főként az Rh-komplexben található meg. Idiopathiás, vagy szekunder (daganat által provokált, autoimmun vagy egyéb) eredetű lehet.
congenitalis anaemia szinonima: erythroblastosis fetalis
congenitalis Heinz-testes hemolitikus anaemia A congenitalis hemolitikus anaemia egyik csoportja, amelyet egy instabil hemoglobin variáns öröklött jelenléte okoz. Az egyik hemoglobin lánc aminosavszekvenciájában történt változás következtében a hemoglobin nem hajlik a megfelelő konfigurációba, az alfa hélix struktúrája megváltozik, vagy befolyásolja a hemnek a globinnal történő kapcsolódását. Az így denaturálódott hemoglobin Heinz-testként a sejtmembránhoz csapzódik, a membránt károsítja, és végül idő előtti sejtpusztulást idéz elő.
congenitalis hemolitikus anaemia A vörösvérsejtek fokozott hemolízise jellemzi örökletes defektus következtében, a herediter spherocytosishoz hasonlóan.
congenitalis hypoplasticus anaemia A csontvelő congenitalis hypoplasiája okozza, amelyben durván elégtelen a vörösvérsejtképzés, elégtelenek a vörösvérsejt prekurzorok, ugyanakkor a többi csontvelői elem normális. Az anaemia progresszív és súlyos, ugyanakkor a leukocyták és a thrombocyták száma vagy normális, vagy csupán enyhe mértékben csökkent. A transzfúzióval bevitt vörösvérsejtek élettartama normális. Szinonima: veleszületett non-regeneratív familiaris hypoplasticus, vagy tiszta vörös vérsejt (pure red cell) anaemia. Erythrogenesis imperfecta. Diamond-Blackfan szindróma.
Cooley-féle anaemia szinonima: thalassaemia major
drepanocyticus anaemia szinonima: sickle cell anaemia
hemolitikus anaemia Minden olyan anaemia, amely fokozott vörösvérsejt szétesés következtében alakul ki.
hyperchrom anaemia Olyan vérszegénység, amelyben a hemoglobin aránya az erythrocyta volumenéhez képest magasabb, vagyis az átlag corpuscularis hemoglobin koncentráció magasabb a normálisnál.
hypochrom anaemia Olyan vérszegénység, amelyben a hemoglobin aránya csökkent az erythrocyta térfogathoz képest; vagyis az átlag corpuscularis hemoglobin koncentráció alacsonyabb a normálisnál.
hypoplasticus anaemia Progresszív, non-regeneratív anaemia, amelynek oka a nem megfelelően működő, deprimált csontvelő. Ha a folyamat tartós, aplasticus anaemia alakul ki a következményeként.
macrocytás anaemia Minden olyan anaemia, amelyben a keringő vörösvérsejtek a normálisnál nagyobbak, vagyis az átlag corpuscularis térfogatuk a 94 m3-t meghaladja (normál nagyságrend 82-92 >m3). Ide tartoznak az anaemia perniciosa, sprue és coeliakia okozta anaemia, terhességi macrocytás anaemia, diphylobothriasis stb. anaemiák.
megaloblastos anaemia A megaloblastos erythroblastok nagy számmal fordulnak elő, a normoblastok száma alacsony, a csontvelőben pedig hyperplasticus erythroid sejteket találunk (anaemia perniciosához hasonlóan)
metaplasticus anaemia Anaemia perniciosa, amelyben a vérsejtek különböző elemei változatosak (pl. multisegmentált, szokatlanul nagy neutrophilok macropolycytákm, éretlen myeloid sejtek, bizarr vérlemezkék).
microangiopathiás hemolitikus anaemia Hemolízis, amelynek oka a kis vérerek (ált. gyulladásos eredetű) szűkülete. Ez az áthaladó vörösvérsejtek széttöredezéséhez, alakváltozásához vezet.
microcytás anaemia Minden olyan anaemia, amelyben az átlag vörösvérsejt corpuscularis volumen 80 nm3, vagy kisebb (normál nagyságrend 82-92 >m3).
myelopathiás anaemia szinonima: leukoerythroblastosis
neonatalis anaemia szinonima: erythroblastosis fetalis
normochrom anaemia Olyan anaemia, amelyben az erythrocytákban a hemoglobin koncentrációja normális (átlag corpuscularis hemoglobin koncentráció 32-36%)
normocytás anaemia Olyan típusú vérszegénység, amelyben az erythrocyták normális méretűek, vagyis az átlag corpuscularis volumenük 82-92 m3.
anaemia perniciosa Krónikus, progresszív, idős felnőtteken megjelenő betegség, akiknél kimutatható a B12-vitamin felszívódásának hiánya, amelynek oka rendszerint a gyomor nyálkahártya atrophiája és az intrinsic faktor hiánya. Klinikai tünetei: zsibbadás és paraesthesia a végtagokon, gyengeség, glossitis, kisebb terhelésre is fellépő dyspnoe, bőr és nyálkahártyák sápadtsága, étvágytalanság, hasmenés, fogyás, láz. Laboratóriumi eltérések: jelentősen alacsonyabb vörösvérsejt szám, alacsonyabb hemoglobin szint, a vörösvérsejtek között sok ovális, macrocytás alak. A gyomorban achlorhydria. A csontvelőben dominánsan megaloblastok, kevés normoblast, a perifériás vérképben alacsonyabb leukocytaszám, relatív lymphocytosissal, sok hypersegmentált neutrophil sejt. A periférián a vörösvérsejtek B12-vitamin tartalma alacsony. B12-vitamin injekció jellegzetes reticulocyta-krízist idéz elő, a tünetek megszűnnek, feltételezve, hogy az anaemia perniciosa nem szövődött más betegséggel is. Szinonima: Addison-féle anaemia
refrakter anaemia Progresszív, semmiféle kezelésre nem javuló anaemia; csak transzfúzió segít.
sarlósejtes anaemia Autoszomális domináns öröklődésű. Jellemzi a vörösvérsejtek félhold, vagy sarló alakja, a fokozott hemolízis. Oka, hogy a hemoglobin k-láncában a hatodik helyen a glutaminsavat valin helyettesíti. A homozigóták 85-95% HbS mellett súlyos anaemiában szenvednek, míg a heterozigóták hemoglobinjának 40-45%-a HbS, a többi normál HbA. Az alacsony oxigén tenzió az abnormális n-láncok polimerizálódását okozza, ezzel a vörösvérsejtek alakját félholddá torzítja. A homozigótákon krízisek alakulnak ki, amelyekben lezajló microvascularis elzáródások csontinfarktusokat, alszárfekélyeket, lép atrophiát, bakteriális fertőzésekre való fokozott hajlamot (főként Streptococcus pneumoniára) idéznek elő. Majdnem kizárólag feketéken fordul elő a betegség. Szinonima: drepanocyticus anaemia, sickle cell anaemia
sideroblastos anaemia refrakter anaemia a csontvelőben sideroblastokkal
spherocytás anaemia szinonima: herediter spherocytosis
terhelés kiváltotta anaemia Erőltetett tréning által előidézett hemoglobin koncentrációesés addig a szintig, amely megközelíti a klinikai anaemia mértékét. Általában a tréning korai fázisában látni; kapcsolatban lehet a plazmatérfogat jelentős mértékű kiterjedésével, amelyet nem követ még a hemoglobin koncentráció emelkedése.
vashiányos anaemia Hypochrom microcytás anaemia, melyre az alacsony szérum vastartalom, megnövekedett szérum vaskötő kapacitás és csökkent szérum ferritinszint jellemző.
anaemiás
anaemia tüneteit mutató
anaerob
Olyan mikroorganizmus, amely oxigén jelenléte nélkül képes élni és növekedni. (gör: an-, fosztóképző + aér, levegő + bios, élet)
Találatok Magyarázat
fakultatív anaerob Olyan anaerob, amely levegő jelenlétében, vagy akár csökkent oxigén tenzió mellett is képes élni és növekedni.
obligát anaerob Olyan mikroorganizmus, amely csakis a szabad oxigén hiányában képes élni.
anaerobiosis
oxigénmentes atmoszférában való létezés (gör: an-, fosztóképző +aér, levegő + biosis, életmód)
anaerogén
gázt nem termelő (gör: an-, fosztóképző +aér, levegő, gen, termelő)
anaesthekinesia
kombinált szenzoros és motoros bénulás (gör: an-, fosztóképző + aisthesis érzés + kinesis, mozgás)
anaesthesia
1. gyógyszeres úton kiváltott, vagy idegi működési zavar okozta érzéskiesés 2. aneszteziológiának, mint klinikai diszciplínának szélesebb értelmű elnevezése (gör: anaisthesia, érzés nélkül)
Találatok Magyarázat
akupunktúra révén kiváltott anaesthesia Tűk percutan behelyezése és esetleg stimulálása a test kritikus pontjaiban, mely a megfelelő területen érzéstelenítést okoz.
balanced anaesthesia Az általános anaesthesia azon a koncepción alapuló technikája, hogy ha néhány idegi depresszáns kis mennyiségű keverékét alkalmazzuk, akkor azok farmakológiai előnyei összegeződnek, hátrányaik megjelenése nélkül.
basalis anaesthesia Egy, vagy több szedatívum parenteralis adása, amelyben olyan állapot érendő el, hogy a beteg tudata kellőképpen csökkenjen röviddel az általános altatás megkezdése előtt.
caudalis anaesthesia Regionális anaesthesia, mely során a lokál anaesthesiás oldatot az epiduralis térbe fecskendezzük a hiatus sacralison át.
disszociált anaesthesia Az érzések bizonyos típusának elvesztése, más érzéskvalitások megmaradása mellett. Leginkább az idegi blokád idején észlelhető, amikor a fájdalom és hő-érzés elvész, de megmarad a tapintási érzés.
disszociatív anaesthesia Az általános anaesthesia egyik alakja, amelynél nem szükségszerű a tudat elvesztése. Catalepsiával, catatoniával és amnesiával írható le, különösen, ha fenil-ciklohexilamin vegyületek idézik elő, beleértve a ketamint is.
anaesthesia dolorosa anaesthesiás területen megjelenő súlyos, spontán fájdalom
endotrachealis anaesthesia Inhalációs technika, amelyben az inhalációs gázokat endotrachealis tubuson át juttatjuk a tüdőbe.
epiduralis anaesthesia Regionális anaesthesia, amelyben a lokál anaesthesiás oldatot a periduralis térbe adjuk.
félig nyitott rendszerű anaesthesia Inhalációs anaesthesia, amelyben a belégzésre kerülő gázoknak egy része az altatógép segítségével jut a beteg szervezetébe, másik része pedig a légtérből származik.
félig zárt rendszerű anaesthesia Az inhalációs anaesthesia olyan technikája, amelyben a kilélegzett gáz jelentős részét - kivéve a széndioxidot, amelyet abszorbeáltatnak - visszalélegeztetik.
generális anaesthesia Alkalmazása esetén elvész a fájdalom érzése, de emellett öntudatlanság is kialakul. Inhalációs, vagy intravénás altató hatású anyaggal lehet elérni.
idegblokád anaesthesia Olyan vezetéses anaesthesia, amelyben az érzéstelenítő oldatot az ideg köré, a gyök köré, vagy a plexus köré fecskendezzük.
infiltrációs anaesthesia A helyi érzéstelenítő oldatot egyenesen oda fecskendezzük, ahol a fájdalom jelentkezik, illetve, ahol a műtét történik.
inhalációs anaesthesia anaesthesiás gázok, vagy gőzök belélegeztetésével létrehozott anaesthesia
insufflatiós anaesthesia Az inhaláció fenntartása oly módon, hogy az anaesthesiás gázt, vagy párát egyenesen a légutakba juttatjuk a spontán légzést mutató betegen.
intranasalis anaesthesia 1. Insufflatiós anaesthesia, mely során az altatószert az orrba, vagy a nasopharynxba juttatjuk. 2. A nasalis légutat infiltráljuk topikális, vagy lokális infiltrációval az orr nyálkahártyán.
intraoralis anaesthesia 1. Insufflatiós anaesthesia, amelyben az inhalációs gázt a szájon át belélegzett levegőhöz juttatjuk. 2. A szájüreg regionális anaesthesia-ja, melynél a lokális érzéstelenítő oldatot topikálisan tesszük a mucosára, vagy lokálisan infiltrálunk, vagy idegi blokádot végzünk.
intravénás anaesthesia Általános anaesthesia, mely során az anaestheticumotvénás beadással juttatjuk a keringésbe.
intravénás regionális anaesthesia Az intravénásan bedott helyi érzéstelenítőt lokális occlusiós tourniquet alá adjuk be egy olyan végtagba, amelyet nyomással, vagy gravitációval előzetesen vértelenítettünk. Szinonima: Bier-féle módszer
körlégzési rendszerrel történő anaesthesia Olyan inhalációs altatás, amelyben a légzési körbe széndioxid abszorbenst tesznek, és ezzel a kilélegzett levegőt és benne az altató gázokat zárt, vagy részben zárt térből visszalélegeztetik.
lokális anaesthesia Általános kifejezés, amellyel a topikális, infiltrációs, mező blokád, vagy ideg blokád anaesthesiát értjük, de nem tartozik bele a spinalis és az epiduralis anaesthesia.
nyílt rendszerű anaesthesia Az inhalációs anaesthesia egyik technikája, amelyben megfelelő szelep a kilélegzett levegőt eltávolítja a keringetésből.
open drop anaesthesia Inhalációs anaesthesia, melyre jellemző, hogy a folyékony altatószert cseppenként adagoljuk a géz maszkon át, amely az orrot és a szájat fedi.
patient-controlled anaesthesia (PCA) A fájdalomcsillapítás ellenőrzésének módszere, mely pumpát alkalmaz a konstans intravénás, ritkábban az epiduralis hígított fájdalomcsillapító beáramlásának szabályozására, amely révén előre meghatározott időközönként a beadott fájdalomcsillapítót a beteg maga ellenőrizheti, ha a fájdalomcsillapítás mértékét nem tartja kielégítőnek.
perineuralis anaesthesia A helyi érzéstelenítőt az ideg köré fecskendezzük.
rectalis anaesthesia Általános anaesthesia, mely során a rectumba instillálnak olyan oldatot, amely anaestheticus hatású.
regionális anaesthesia Helyi érzéstelenítő oldattal körülírt területen érzéskiesést idéznek elő. Generikus kifejezés, magában foglalja a vezetéses, idegi blokádos, spinalis, epiduralis, mező blokádos, infiltrációs és topikális anaesthesia-t.
retrobulbaris anaesthesia Helyi érzéstelenítő oldat szem mögé adott injekciója, amely módszerrel szemészeti beavatkozások előtt érnek el lokális anaesthesiát.
sebészeti anaesthesia 1. műtét miatt előidézett anaesthesia, megkülönböztetve a nőgyógyászatitól, diagnosztikaitól és terápiás célú anaesthesia-tól 2. érzéstelenítés izomrelaxációval együtt műtét elvégzése céljából
spinalis anaesthesia A helyi érzéstelenítő oldatot a spinalis subarachnoidalis térbe fecskendezik.
splanchnicus anaesthesia A fájdalomérzés megszűnése a zsigeri peritoneumon , amelyet a nervus splanchnicus közvetít. Szinonima: visceralis anaesthesia
stocking anaesthesia (zokni anaesthesia) Az alsó végtag distalis területének érzéstelensége, amikor csupán a lábfejre és a lábujjakra szorítkozik az anaesthesia.
szegmentális anaesthesia Az érzéstelenítés egy, vagy több gerincvelőbe futó ideggyököt érint.
tactilis anaesthesia tapintási érzés elvesztése, vagy károsodása
thermalis anaesthesia hőérzés elvesztése
topicalis anaesthesia Felületes érzéskiesés a conjunctivában, a nyálkahártyákon, és a bőrön, amelyet a helyi érzéstelenítő oldat, kenőcs, vagy gél lokális alkalmazása idéz elő.
traumás anaesthesia idegsérülést követő érzéstelenség
unilateralis anaesthesia szinonima: hemianaesthesia
vezetéses anaesthesia Regionális anaesthesia, melynél a lokális érzéstelenítő oldatot az idegek fölé injektálják, gátolva az idegi vezetést. Ide soroljuk a spinalis, epiduralis érzéstelenítést, az idegi blokkot, de nem tartozik ide a lokális, vagy a topikális anaesthesia.
visceralis anaesthesia szinonima: splanchnicus anaesthesia
zárt rendszerű anaesthesia Inhalációs altatás, a kilélegzett gázok teljes visszalélegeztetésével, kivéve a széndioxidot, amelyet elnyeletnek. Az anaesthesiás körbe gázként csak oxigént vezetnek, amelynek mennyiségét a beteg metabolikus szükséglete szerint állapítják meg. Ezen túl egyéb gázok már csak minimális mennyiségben kerülnek bevezetésre (pl. nitrogén oxid).
anaestheticum
1. Olyan vegyület, amely az idegi működéseket deprimálja, a fájdalomnak, vagy más ingereknek az érzékelését akadályozza. 2. altatószerek összefoglaló elnevezése 3. Érzésvesztéssel jellemzett, vagy olyan anyag, amely képes érzéskiesést előidézni. 4. anaesthesiához kapcsolódó
Találatok Magyarázat
általános anaestheticum Olyan vegyület, amelynek hatására érzéskiesés jön létre, és a beteg öntudatlanná válik.
inhalációs anaestheticum Gáz, vagy folyadék halmazállapotú vegyület, amely elegendő páranyomást ad, hogy belélegezve általános anaesthesiát okozzon.
intravénás anaestheticum Olyan vegyület, amely vénásan befecskendezve anaesthesiát hoz létre.
primer anaestheticum Olyan vegyület, amely az érzéstelenítésben alapvető hatású, amikor keveréket alkalmazunk.
szekunder anaestheticum Olyan vegyület, amely - bár szerepe az anaesthesiában nem alapvető - de részt vesz az anaesthesiás hatás kiváltásában.
anafázis
A mitózis, vagy meiózis azon stádiuma, amelyben a kromoszómák az egyenlítői síkból a sejt pólusai felé mozognak. Mitózisban a lánykromoszómák teljes sorozata (emberen 46) mozog mindkét pólus felé; a meiózis első oszlásakor pedig minden homológ pár egyik tagja (emberen 23) beleértve a két kromatidot, amelyek a centromérában egyesültek. A második oszlás alkalmával a centroméra is oszlik, és a két kromatid külön-külön mozog el a két pólus felé (gör: ana, fel + phasis, megjelenés)
anagén
A haj ciklus növekedési fázisa; az emberi haj esetén ez mintegy 3-6 év. (gör: ana, fel + gen, képező)
analbuminaemia
albumin hiánya a szérumban (gör: an-, fosztóképző + albumin + haima, vér)
analepticum
1. erősítő, stimuláló szer 2. Központi idegrendszeri stimuláns, főként olyan gyógyszer, amely a deprimált központi idegrendszeri működést helyreállítja. (gör: analeptikos, helyreállító)
analgesia
Neurológiai, vagy farmakológiai állapot, amelyben fájdalmas ingerek annyira mérséklődnek, hogy bár az illető képes felfogni, tovább már nem okoznak fájdalmat. Vö: anaesthesia (gör: érzéketlenség)
Találatok Magyarázat
analgesia algera szinonima: analgesia dolorosa
inhalációs analgesia központi idegrendszert deprimáló gáz belélegeztetésével létrehozott analgesia
patient-controlled analgesia (PCA) A fájdalom kezelésének az a módja, amelyben a konstans iv. infúzión, vagy ritkábban, az epidurális kanülön keresztül híg narcotikus oldat jut a beteg szervezetébe, és az adagolóval a beteg maga szabályozza a fájdalomcsillapító mennyiségét előre meghatározott időközönként a meghatározott dózistartományon belül, ha a fájdalomcsillapítás nem mutatkozik elegendőnek.
spinal analgesia ld. spinal anaesthesia
analgesicum
Olyan vegyület, amely képes analgetikus hatást előidézni oly módon, hogy a fájdalmat a nociceptív ingerek érzékelésének megváltoztatásával csillapítja, de eközben nem okoz anaesthesiát, vagy eszméletvesztést.
analgesimeter
fájdalmas ingerek erősségének mérésére alkalmas készülék kísérleti körülmények között
analis
anussal kapcsolatos
analitás
Arra a pszichés állapotra utal, amely a lelki szerveződések Freud szerinti analis periódusára jellemző a pszichoszexuális fejlődés folyamán.
analitikus
1. kémiai analízissel foglalkozó személy 2. pszichoanalitikus személy 3. analízissel kapcsolatos
analizátor
1. Olyan eszköz, amellyel analízist lehet végezni. 2. A polariszkóp prizmája, amellyel a polarizált fény tanulmányozható. 3. Olyan eszköz, amely elektronikusan meghatározza az elektroencefalogram adott csatornáján a frekvenciát és az amplitúdót.
analízis
1. Olyan eljárás, amely során valamely ismeretlen szerkezetű kémiai vegyület, vagy keverék egyszerűbb alakokká való bontása nyomán annak összetételét vizsgálják. 2. Valamely egésznek a vizsgálata annak vonatkozásában, hogy milyen alkotórészekből áll. 3. Ld. pszichoanalízis (gör: feltörés)
Találatok Magyarázat
aktivitás analízis Olyan eljárás, amellyel egy adott egyén, vagy populáció életét jellemző aktivitásnak, mozgási jellegnek és szervezettségnek a vizsgálatával foglalkozik.
vérgáz analízis Az oxigén és a széndioxid direkt, elektróddal történő mérése a vérben.
Fourier analízis Matematikai analitikai módszer, mely a periodikus különböző frekvenciaváltozások összegének változásait közelíti. Ezt alkalmazzák a komputeres tomográfiában és a mágneses rezonancia képalkotásban, továbbá mindenféle jel elemzésében, amelynek frekvencia tartalmát kívánják megismerni.
savszekréció analízis A gyomornedv pH-jának és savelválasztásának mérése. A basalis savelválasztás (BAO, basal acid output) meghatározható az éjszakai szekréció gyűjtésével, vagy az egy órás szekréciós vizsgálat módszerével. A maximális savválasz (MAO, maximal acid output) hisztamin, vagy gasztrin stimulálás utáni szekréciós választ jelenti. A titrálás lúggal történik.
Northern blot analízis A Southern blot analízis-hez hasonló vizsgálat; főleg arra használják, hogy szeparálják és azonosítsák az RNS fragmentumokat. Általában úgy járnak el, hogy az RNS fragmentumokat az agaróz gélről nitrocellulóz szűrőpapírra viszik át, majd megfelelő módszerrel itt azonosítják (northern blot aszó szerint északi folt technikas szót azért fabrikálták, hogy a régebben ismert Southern blot technika elnevezéstől megkülönböztessék).
occlusio analízis A szemben lévő fogak occlusios felületi viszonyát és ennek a környező struktúrákkal való kapcsolatát tanulmányozza a harapás folyamán.
pedigré analízis A pedigré örökletességének jellegét igyekszik formális vizsgálattal kideríteni, tisztázandó az öröklődés módját, valamint azt, hogy az adott fenotípus megjelenése milyen életkorban következik be, és milyen variációi lehetnek.
qualitatív analízis A mennyiségi analízis-sel szemben az anyag összetételét alkotó elemek minőségét vizsgálja.
quantitatív analízis Egy adott anyagot alkotó elemek minőségén túl azok mennyiségét határozza meg.
regresszió analízis Statisztikai módszer a legjobb matematikai modell megtalálására, hogy az egyik változó függvényében leírjuk a másikat.
szegregáció analízis A feltehető öröklési rend vizsgálatára alkalmazzák a genetikában a különböző és az egymást kölcsönösen kizáró fenotípusok alapján (pl. mendeli, autoszomális domináns, epistaticus, korfüggő öröklésmenet stb.).
Southern blot analízis A DNS szekvenciák szeparálására és azonosítására szolgáló eljárás. A DNS fragmentumokat elektroforézissel különválasztják agaróz gélen, átviszik (blottolják) nitrocellulóz, vagy nylon membránra, majd hibridizálják a jelzett komplementer nukleinsav próbákkal.
variancia analízis (ANOVA) Statisztikai technika, mely a kategorikusan független változók hozzájárulását értékeli és izolálja az állandó függő változó átlag értékének változásában.
Western blot analízis Olyan eljárás, amelyben elektroforézissel fehérjéket szeparálnak poliakrilamid gélen, majd ezt átviszik (blottolják) nitrocellulóz, vagy nylon membránra, specifikus antitestekkel azonosítják a foltokat, miután az antitesteket a reakció előtt, vagy utána megjelölik (izotóppal, fluorescens jelzéssel stb.). Ld. immunoblot; szinonima: western blotting (Southern blottól megkülönböztetendő látták el ezzel a névvel).
zoo blot analízis Southern blot analízis-t alkalmazva vizsgálják a nukleinsav próbának azon képességet, hogy tudja- e hibridizálni egy másik faj DNS fragmentumát.
anallergiás
nem allergiás
analóg
1. Két szerv egyike, vagy különböző fajokból az egyik részszerv, legyen az állati, vagy növényi, amelyek struktúrájukat tekintve különböznek, de funkciójuk igen erősen hasonlít. 2. Olyan vegyi anyag, amely struktúrájában egy másikhoz hasonlít, de nem feltétlenül izomerje. Az analóg-ok gyakran alkalmazhatók enzimreakciók blokkolására, mivel kapcsolódnak az enzimhez. (gör: analogos, arányos)
analphalipoproteinaemia
Familiáris HDL (high density lipoprotein) hiány; a lipid metabolizmus örökletes betegsége, melynél a plazmából majdnem teljes mértékben hiányzik a HDL, ennek következtében a koleszterin-észterek a habos (foam) sejtekben tárolódnak, a mandulák megnagyobbodtak és a pharynx, valamint a rectum mucosa narancs vagy sárgásszürke színűek. Hepatosplenomegalia, nyirokcsomó-megnagyobbodás, corneahomály, perifériás neuropathia jellemzi. A betegség öröklődése autoszomális recesszív. (gör: an-, fosztóképző + alpha + lipoprotein + emia, vér)
anamnesis
1. emlékezés aktusa 2. a beteg orvosi és fejlődési története, kórelőzménye (gör: anamnesis, visszaemlékezés)
anamnesticus
1. memória segítése; szinonima: mnemonicus 2. a beteg kórelőzményére vonatkozó
anaphia
tapintási érzék hiánya (gör: an-, fosztóképző + haphé, tapintás)
anaphrodisiacum
1. szexuális vágy elnyomása 2. Olyan szer, amely csökkenti, vagy elnyomja a szexuális vágyat. (gör: an-, fosztóképző + aphrodisia, szexuális élvezet)
anaphylacticus
anaphylaxiára vonatkozó, idegen fehérjével, vagy más anyaggal szemben túlzott érzékenységet mutató
anaphylactogen
Olyan anyag (antigén), amely egy személyt anaphylaxiára tesz hajlamossá, vagy szenzitizált személyen anaphylaxiás reakciót idéz elő.
anaphylactogen
Anaphylaxiát létrehozó; olyan anyagokra (antigénekre) vonatkozik, amelyek anaphylaxiát váltanak ki.
anaphylactogenesis
anaphylaxia kiváltása
anaphylactoid
anaphylaxisra emlékeztető (gör: anaphylaxis + eidos, emlékeztető)
anaphylatoxin
1. Olyan anyagot jelez, amely az anaphylaxiás sokk közvetlen okozója és feltehetően onnan származik, hogy in vivo a specifikus antitest a szenzitizáló anyaggal kapcsolódik. 2. Egy kis fragmentum (C3a), amely a komplement 3. komponenséből (C3) lehasadt, és amely lokális duzzanatot és pírt okoz intracutan injekcióval adva. (anaphylaxis + toxin)
anaphylaxis
Az immunológiai (allergiás) reakció közvetlen, átmeneti alakja, amelyet simaizomkontrakció, valamint a kapilláristágulat jellemez, mivel farmakológiailag aktív anyagok szabadulnak fel (hisztamin, bradikinin, szerotonin és slow reactive substance of anaphylaxis iaz anaphylaxia lassan reagáló anyaga, egy leukotriéna). Klasszikusan az antigén kötődik a hízósejten fixálódott antitestekkel (főként IgE). A reakció nagy mennyiségű szérum aggregátummal kiváltható (pl. antigén-antitest komplexum), amely valószínűleg képes a komplement rendszert aktiválni, és anaphylatoxin képzésére késztetni. (gör: ana-, elfelé + phylaxis, védelem)
Találatok Magyarázat
aktív anaphylaxis Az antigénnel történő oltás után bekövetkező anaphylaxis olyan személyen, akit előzőleg szenzitizáltak az adott antigénnel szemben.
antiszérum anaphylaxis szinonima: passzív anaphylaxis
generalizált anaphylaxis Közvetlen válasz, amely az allergén beadását követi, és amelyben a simaizmok és a kapillárisok az egész szervezetben mindenütt részt vesznek. Ld. anaphylaxiás sokk
lokális anaphylaxis Azonnali átmeneti válasz, amely az antigén intracutan injekcióját követi érzékenyített személyen, és csupán arra a területre határolódik, amelyen az inoculáció történt. Ld: bőrteszt
passzív anaphylaxis Az antigén beadása utáni reakció olyan állatban, amelyet előzetesen vénásan érzékenyítettek specifikus antiszérummal, amelyet egy másik állatból nyertek ki. A két oltás között látens periódusnak kell eltelnie, szemben az aktív anaphylaxis-val. Szinonima: antiszérum anaphylaxis
anaphylotoxin
szinonima: anaphylatoxin
anaplasia
A strukturális differenciálódás elvesztése, amelyet leggyakrabban, de nem mindig malignus daganatokban látunk. Szinonima: dedifferentiatio (gör: ana, ismét + plasis, olvadás)
anaplasticus
1. anaplasiára vonatkozó 2. anaplasiára jellemző 3. struktúra mentesen növekvő
anapophysis
A csigolyákon kiegészítő kinövés, amelyet főleg a thoracalis és lumbalis csigolyákon látunk. (gör: ana, hátra + apophysis, sarjadás)
anapticus
anaphiára vonatkozó
anaritmia
Az aphasiának azon típusa, amelyben a beteg képtelen számolni, vagy számokat használni. (gör: an, -fosztóképző + arithmos, szám)
anarthria
a beszéd artikulációjának elvesztése; ld: aphasia, alexia, dysarthria (gör: anarthros, ízület nélküli)
anasarca
generalizált vizenyővel beszűrődött kötőszövet (gör: ana-, át + sarx, hús)
anastigmat
1. Lencsék, amelyekben az astigmatizmus korrigált 2. Lencsék, amelyeket mind astigmatizmusra, mind térgörbületre korrigáltak.
anastomosis
1. Természetes direkt, vagy indirekt összenyílás két ér, vagy más csövet alkotó struktúra között. 2. Két anatómiai struktúra között műtéti úton létrehozott összeköttetés (pl. ér, üreges szerv esetén). 3. Műtét, trauma, vagy betegség által létrehozott nyílás két, vagy több, normális körülmények mellett különálló tér, vagy szerv között. (gör: anastomoo, szájjal ellátni)
Találatok Magyarázat
arteriovenosus anastomosis Az erek között létrejött összeköttetés kapcsán a vér az artériából a véna felé áramlik, anélkül, hogy a kapillárisokon áthaladna.
cavopulmonaris anastomosis Módszer a cyanoticus szívbetegségek palliatív kezelésére, melynek lényege, hogy a jobb arteria pulmonalist a vena cava superiorba vezetik.
conjoined anastomosis Két véreret egymással egyesítve side-to-side (oldal az oldalhoz), ellipszis alakú anastomosist készítenek, amivel egy nagyobb nyílás képezhető az ezt követő end-to-end (vég a véghez) anastomosis céljára.
cruciatus anastomosis Négyirányú, a femur felső részének mögöttes területén elhelyezkedő anastomosis az art. femoralis profunda, az art. glutealis inferior és medialis, valamint az art. femoralis circumflexa lateralis között.
intestinalis anastomosis szinonima: enteroenterostomia
isoperistalticus anastomosis a béltartalom útját a normális irányba vezető anastomosis
postcostalis anastomosis Longitudinális anastomosis az intersegmentalis arteriákból, amely az arteria vertebralishoz vezet.
precostalis anastomosis Az intersegmentalis arteriák longitudinális anastomosisa az embrióban, amelyből a thyrocervicalis és a costocervicalis törzs ered.
Riolan-féle anastomosis Circulus arteriosus Riolani; a colon széli artériájának az a része, amely az art. colica középső és bal ágát kapcsolja össze.
Roux-en-Y anastomosis A jejunumkacs distalis végének anastomosisa a gyomorral, az epeutakkal vagy más struktúrával oly módon, hogy a proximalis véget a jejunumba oldalt vezetik az első anastomosistól megfelelő távolságban, így a bél Y alakot formál.
termino-terminalis anastomosis Olyan műtét, amelyben egy artéria centrális végét összekötik a megfelelő véna perifériás végével, az artéria perifériás végét pedig a véna centrális végével.
anatómia
1. egy szervezet morfológiai szerkezete 2. különböző szervezetek felépítésének, vagy morfológiájának tudománya (gör: ana-, szét + tomé, vágás)
Találatok Magyarázat
fogászati anatómia A makroszkópos morfológia e része a fogak alakjával, helyzetével és egymáshoz viszonyával foglalkozik.
funkcionális anatómia A működés szempontjából foglalkozik az egyes szervek anatómiájával.
klinikai anatómia anatómiai ismeretek klinikai alkalmazása a diagnózis és a terápia céljára
makroszkópos anatómia Az általános anatómia mindazon területei, ahol mikroszkóp használatára nem kerül sor (pl. holttest boncolása).
mikroszkópos anatómia Az anatómia azon ága, amely a sejtek, szövetek és szervek struktúráját vizsgálja fénymikroszkóppal. Ld. hisztológia
összehasonlító anatómia állati struktúrák összehasonlító anatómiája, különös tekintettel a homológ szervekre és részekre
röntgen anatómia A test felépítésének rtg-felvételekkel és egyéb képalkotó eljárásokkal történő tanulmányozása.
sebészeti anatómia Alkalmazott anatómia, amely a sebészi diagnózis és kezelés szempontjait veszi figyelembe.
tájanatómia Az anatómiai tanulmány régiókon történő végzése (pl. láb, vagy inguinalis régió), mely a különböző szisztémás struktúrák egymáshoz való viszonyát (pl. izmok, idegek, és artériák) hangsúlyozza adott területen belül. Szinonima: topográfiai anatómia
topográfiai anatómia szinonima: tájanatómia
anatómiai
1. anatómiával kapcsolatos 2. szinonima: strukturális 3. Egy kifejezetten morfológiai vonást jelez, szemben az élettanival, vagy sebészivel (pl. anatómiai nyak a humeruson, anatómiai holt tér stb.).
anatómus
az anatómia tudományának szakembere
anatricrotismus
A pulzust hármas ütés jellemzi a szfigmográfiás regisztrátum felszálló szárán. (gör: ana, fel + tri, háromszoros + krotos, ütés)
ancipitalis
kétfejű, kétoldalú (lat: anceps, kétfejű)
anconad
könyök felé (gör: ankon, könyök)
anconeus
1. könyökkel kapcsolatos 2. anconeus izommal kapcsolatos
anconitis
könyökízület gyulladása
ancylo-
ld. ankylo-
ancylostomiasis
Horogférgesség, amelyet az Ancylostoma duodenale okoz. Jellemző tünetek: eosinophilia, anaemia, fogyás, dyspepsia, valamint gyerekeken fellépve súlyos krónikus fertőzés képét adja a szellemi és fizikai fejlődés elmaradásával.
Találatok Magyarázat
cutaneus ancylostomiasis cutan larva migrans okozta bőrférgesség; szinonima: swimmer"s itch (úszók viszketése)
ancyroid
Horgony karomhoz hasonlító alakú; az agy oldalkamráinak szarvát jelzi, valamint a scapula processus coracoideusát. (gör: ankyra, horgony, + eidos emlékeztető)
andro-
masculin, férfias (gör: anér, andros, férfi)
androblastoma
1. Heretumor, amely mikroszkópos képében a magzati testisre emlékeztet, váltakozó mértékben tartalmaz tubularis és stromalis elemeket. A tubulusokban Sertoli-sejtek is találhatók, amelyek feminizációt okozhatnak. 2. Szinonima: arrhenoblastoma (gör: andro, férfi + blastos, csíra + oma, daganat)
androgén
Olyan hatóanyagra, hormonra (pl. androszteron, tesztoszteron) vonatkozó generikus elnevezés, amely stimulálja a másodlagos nemi szerveket, előidézi a férfias szexuális jelleg kialakulását, vagy a kasztrálást követő változásokat megakadályozza. Természetes androgén steroidok az androsztán származékai.
androgynia 1.
szinonima: pseudohermaphroditismus femininus 2. Mind férfias, mind nőies vonásokkal rendelkező személyre jellemző, aki magatartásában és viselkedésében is a sztereotip, kulturálisan rögzült és szentesített férfias és nőies szexuális szerepet játssza. (andro- + gör: gyné, nő)
andromorph
férfias alakú és jellegzetességű (andro- + gör: morphé, alak)
androphobia
Beteges félelem a férfiaktól, vagy a férfi szexualitástól, elkerülve olyan helyzeteket, amikor férfiak is jelen lehetnek. (andro- + gör: phobos, félelem)
androsztán
androgén szteroidok alapvegyülete
androsztándiol
5α-androsztán-3>,17,-diol; szteroid metabolit, amelynek 5- izomerje ismert.
androsztándion
5α-androsztán,3,17dion; olyan szteroid metabolit, amelyből az 5> izomerek ugyancsak ismertek.
androszten
Androsztán, amely tartalmaz egy telítetlen (azaz -CH=CH-) kötést a molekulájában.
androsztendiol
5-androszten-3 , 17,diol; szteroid metabolit, amely az androsztándioltól a C5 és C6 közötti kettős kötésben különbözik.
androsztendion
4-androszten-3,17 dion; a tesztoszteronnal összehasonlítva gyengébb biológiai hatású androgén szteroid. A here, az ovarium és a mellékvesekéreg választja el.
androszteron
cis-androszteron, 3α-hidroxi-5α-androsztán-17-on; szteroid metabolit, amely férfiak vizeletében található. Gyenge androgén hatással rendelkezik; a herékben progeszteronból szintetizálódik.
anemophobia
beteges félelem a széltől
anencephalia
Congenitalis agyi fejlődési zavar, melyre jellemző, hogy a cervicalis boltozat csontjai hiányzanak, a cerebralis hemisphaeriumok csökevényesek, vagy hiányzanak, ugyanez lehet érvényes a cerebellumre, az agytörzsre és a basalis ganglionokra. (gör: an-, fosztóképző + enkephalos, agy)
anephricus
vesehiányos (gör: a-, fosztóképző + nephros, vese)
anergasia
pszichés aktivitás hiánya, mint organikus agyi betegség következménye (gör: an-, fosztóképző + ergasia, munka)
anergasticus
anergasiára vonatkozó, azzal kapcsolatos
anergia
1. Olyan állapot, amelyben az illető képtelen érzékenységi reakcióra, ha antigén inger (immunogén, allergén) éri. 2. energiahiány (gör: an-, fosztóképző + ergon, munka)
anergicus
anergiával kapcsolatos
anerythroplasia
Olyan állapot, amelyben nem képződik vörösvérsejt. (gör: an-, fosztóképző + erythro(cyte) + plasia, mintázás)
anerythroplasticus
anerythroplasiára jellemző, azzal kapcsolatos
aneszteziológia
Orvosi specialitás, amely az anaesthesiának és kapcsolt területeinek a farmakológiai, fiziológiai és klinikai alapjaival foglalkozik. Ide tartozik a resuscitatio, az intenzív respiratorikus ápolás, az akut és krónikus fájdalom kezelése is. (anaesthesia + gör: logos, tanulmány)
aneszteziológus
1. orvos, aki az aneszteziológiában és kapcsolt területeiben specialista 2. Olyan orvosi diplomával rendelkező személy, aki vizsgát tett és legálisan is minősítést nyert abban, hogy altatási és érzéstelenítési technikákat alkalmazzon.
anetoderma
Atrophoderma, amelyben a bőr zacskós és ráncos lesz (gör: anetos, relaxált + derma, bőr)
aneuploid
Abnormális kromoszóma számmal rendelkező sejt vagy egyed, amelyben a kromoszómák száma nem pontosan többszöröse a haploidnak, szemben azzal, amikor a komplett haploid sorozat többszöröse van jelen (diploid, triploid stb.) (gör: an-, fosztóképző + euploid)
aneuploidia
aneuploid állapotban lévő
aneurysma
Egy artéria, vagy szívüreg körülírt tágulata, melynek oka lehet veleszületett, vagy szerzett fali gyengeség. (gör: aneurysma, tágulat)
Találatok Magyarázat
álaneurysma 1. Pulzáló, tokosodott haematoma, amely a repedt ér lumenével kommunikál. 2. Kamrai pseudoaneurysma: szívruptura után a pericardium rekeszében lévő vér, amelynek külső falát a pericardium alkotja. 3. Olyan aneurysma, amelynek falát az adventitia és a periarterialis fibrosus szövet és haematoma képezi.
arterioscleroticus aneurysma Az aneurysmák leggyakoribb típusa, az aorta abdominalisban és más nagy artériában találjuk, főleg időseken.
arteriovenosus aneurysma 1. kitágult arteriovenosus shunt 2. gyakran congenitalis közlekedés egy artéria és véna között
berry (bogyó-) aneurysma Kis saccularis aneurysma az arteria cerebrin, amely bogyóra emlékeztet. Az ilyen típusú aneurysma rupturálva subarachnoidalis vérzést okozhat.
aneurysma cirsoideus Erek tágulata congenitalis malformatio következtében, melyek arteriovenosus shuntökkel járnak.
aneurysma dissecans Az artéria belső falán támadt hasadás (dissectio) esetén a vér az intima alá kerül, de ez történhet akkor is, ha az arteria interstitiumában támad vérzés. Leggyakrabban az aortán fordul elő.
aneurysma fusiformis megnyúlt, orsószerű artéria tágulat
mycoticus aneurysma Az érfalban bakteriális szaporodás, vagy szeptikus embolus eredményeként létrejött falgyengülés.
összetett aneurysma Amelyben az egyes artériák burkolata megrepedt, míg a többi verőér esetében intakt maradt.
aneurysma saccularis zsákszerű tágulat az artéria egyik oldalán
supraclinoidealis aneurysma Intracranialis aneurysma, amely éppen az os sphenoidale processus clinoideus anteriora felett található.
syphilises aneurysma Olyan aneurysma, amely az aorta thoracica területén található, és a tercier syphilis okozta aortitis luetica következtében alakult ki.
varicosus aneurysma Vért tartalmazó zsák, amely mind artériával, mind pedig vénával kommunikál.
aneurysmectomia
aneurysma excisioja (aneurysma + gör: ektomé, excisio)
aneurysmographia
Aneurysma kimutatása, rendszerint rtg-vizsgálattal és kontrasztanyag befecskendezésével. (aneurysma + gör: grapho, írni)
aneurysmoplastica
Aneurysma helyreállítása a zsák megnyitása és a fal elvarrása révén. Ld. aneurysmorrhaphia; szinonima: endoaneurysmoplastica, endoaneurysmorrhaphia. (aneurysma + gör: plastos, alakított)
aneurysmorrhaphia
Az aneurysma zsák lezárása varrattal oly módon, hogy a normál lumen nagyság helyreálljon. (aneurysma + gör: rhaphé, szutura)
aneurysmotomia
bemetszés az aneurysma zsákba (aneurysma + gör: tomé, bemetszés)
angi-
ld. angio-
angiectasia, angiectasis
nyirok-, vagy vérerek kitágulása (angio + gör: ektasis, szétfeszít)
angiectopia
valamely ér abnormális elhelyezkedése (angio + gör: ektopos, helyén kívül)
angina
1. Súlyos, gyakran szorító jellegű fájdalom, rendszerint az angina pectorist jelenti. 2. Elavult kifejezés torokfájásra, bármi is okozta. (lat: torokfájás)
Találatok Magyarázat
angina abdominalis Intermittens hasi fájdalom, gyakran étkezés után meghatározott időben mutatkozik, oka a mesenterialis keringés elégtelensége, amely általában arterioscleroticus eredetű, de hátterében lehet más artéria betegség is. Szinonima: intestinalis angina
crescendo angina az angina pectoris egyre gyakoribb és intenzívebb, hosszabb ideig tartó jelentkezése
angina cruris láb claudicatio intermittense
intestinalis angina szinonima: abdominalis angina
angina inversa szinonima: Prinzmetal-angina
angina Ludovici Odontogén eredetű cellulitis, kétoldalt bevonva a submaxillaris, sublingualis és submentalis területeket. Fájdalmas duzzadást okoz a szájalapon, a nyelvet megemeli, dysphagiával, dysphoniával jár és előfordul, hogy a légutakat is komprimálja.
angina pectoris Súlyos, szorító fájdalom a mellkasban, a precordiumtól a (főleg) bal vállba, ill. karba sugárzik. Oka a szív ischaemiája, amelyet koszorúsér betegség okoz. Szinonima: stenocardia
Prinzmetal-angina Az angina pectoris egyik alakja, melyre jellemző, hogy a fájdalom nyugalomban jelentkezik, hosszabb időtartamú, rendszerint súlyosabb fokú. Az érintett EKG elvezetésekben a szokásos ST-depressio helyett elevatiok jelennek meg, ill. nincsen a szemközti oldalon reciprok ST-elváltozás. Szinonima: angina inversa
instabil angina 1. Olyan angina pectoris, amelyben a coronaria eredetű mellkasi fájdalom egyre kisebb mértékű terhelésre, illetve más kiváltó tényezőre jelentkezik, mint ami korábban a kiváltásához kellett. Gyakran szívinfarctus előhírnöke, ha nem történik meg a kezelése; inkább a koszorúserek spazmusával, mint a fokozott myocardialis oxigén igénnyel magyarázható. 2. Olyan angina, amely 30-60 napon belül nem állapodik meg reprodukálható, állandó jellegben.
Vincent-angina A száj lágyszöveteinek fekélyes fertőzéses folyamata, mely érinti a tonsillákat és a pharynxot. Rendszerint fusiformis baktériumok és spirocheták mutathatók ki. Necrotizáló ulcerativ gingivitis csatlakozik hozzá, és súlyosabb, kezeletlen esetben nomává progrediálhat. Ritkán fulladás, vagy sepsis okozza a halálos kimenetelt.
walk-through angina Folytonos aktivitás közepette, mint például sétálás, az angina pectoris fájdalma csökkenhet, illetve megszűnhet (anginás fájdalom átsétálása).
anginiformis
anginaszerű
angio-, angi-
Vér-, vagy nyirokerek prefixumban. A latin vas-, vaso-, vasculo-nak felel meg. (gör: angeion, edény, vagy üreg a testben + eion, kicsiny)
angioblast
1. érképzésben résztvevő sejt 2. Primordialis mesenchymalis szövet, amelyből embrionális vérsejtek és vascularis endothelium differenciálódhat. (angio- + gör: blastos, csíra)
angioblastoma
szinonima: haemangioblastoma
angiocardiográfia
Kontrasztanyagos röntgen képalkotó eljárás a szív és nagy erek ábrázolására, valamint az áramlási irányok meghatározására. (angio- + gör: kardia, szív + grapho, írni)
Találatok Magyarázat
terheléses angiocardiográfia Az angiocardiográfia közben a beteg terhelésen vesz részt, pl. futószalagon, vagy kerékpáron.
radionuclid angiocardiográfia Gyorsan, bólusban befecskendezett radiopharmacon keringését stacioner szcintillációs kamera segítségével követik.
angiocardiopathia
Olyan betegség, amely mind a szívet, mind az ereket érintő elváltozásokat hoz létre. (angio- + gör: kardia, szív + pathos, betegség)
angiodysplasia
Degeneratív, vagy congenitalis strukturális abnormalitás a normális eloszlású érrendszerben.
angiodystrophia
Defektív képződés és növekedés, amelyben jelentős vascularis elváltozások is kimutathatók. (angio- + gör: dys, rossz + trophé, táplálás)
angioendotheliomatosis
vérerekben lévő endothel sejtek proliferatioja
angiofibroma
rostos érdaganat
angiofibrosis
vérerek falának fibrosisa
angioglioma
kevert glioma és angioma
angiográfia
Az erek radiográfiája, miután sugárelnyelő kontrasztanyagot adunk be percutan bevezetett sugárelnyelő katéteren keresztül. Ld.: arteriográfia, venográfia. (angio- + gör: grapho, írni)
Találatok Magyarázat
coronaria angiográfia A myocardium keringésének leképezése kontrasztanyag beadásával, rendszerint minden coronaria artéria szelektív katéterezésével; régebben viszont az aorta gyöknél adták be a kontrasztanyagot tartalmazó injekciót.
digitalis subtractiós angiográfia (DSA) Komputer asszisztált angiográfia, mely lehetővé teszi az érstruktúrák vizsgálatát a felette lévő csont és lágyszöveti denzitások nélkül. A képet a kontrasztanyag beadása előtt és után készített felvételek alapján kivonják, különválasztják és eltávolítják egymásból, így pusztán a kontrasztanyag által létrehozott árnyék marad a rtg-felvételen. A kontrasztanyagot vénásan, vagy intraarteriálisan a szokásosnál jóval alacsonyabb mennyiségben lehet beadni.
angiogram
angiográfiával végzett röntgenfelvétel (angio- + gör: gramma, irás)
angioid
vérerekre hasonlító, elágazó jellegű (angio- + eidos, emlékeztető)
Találatok Magyarázat
angioid sáv Törések a Bruch-membránban a szemfenéken peripapillárisan, mely néha összetéveszthető a chorioidea ereivel.
angiokeratoma
Felületes kapilláris teleangiectasiák, amelyek fölött szemölcsszerű hyperkeratosis alakul ki acanthosissal. (angio + gör: keras, szaru + oma, tumor)
angiokeratosis
többszörös angiokeratoma megjelenése
angiokinesis
szinonima: vasomotio (angio + gör: kinesis, mozgás)
angiokineticus
szinonima: vasomotoros (angio + gör: kinesis, mozgás)
angiolith
arteriolith, vagy phlebolith (angio + gör: lithos, kő
angiolithicus
angiolithhez kapcsolódó
angiolízis
A véredények elzáródása, mint amivel például újszülötteken találkozunk a köldökzsinór lekötése után. (angio + gör: lysis, tönkremenés)
angiológia
vérerekkel és nyirokerekkel foglalkozó tudományág (angio + gör: logos, tanulmány)
angiolupoid
Sarcoidszerű eruptio a bőrben, amelyben a granulomatosus teleangiectasiás papulák az orron és az arcon oszlanak el. (angio + lat: lupus, farkas + gör: eidos, emlékeztető)
angioma
Vérerek (haemangioma), vagy a nyirokerek (lymphangioma) proliferációja nyomán kialakuló duzzanat, vagy daganat értágulattal, vagy anélkül. (angio + gör: oma, tumor)
Találatok Magyarázat
cavernosus angioma Érmalformáció, amelynek összetételében sinusoidalis erek vesznek részt, de nincsen tápláló nagy artériája.
cherry angioma szinonima: senilis haemangioma (cseresznye angioma)
angioma serpiginosum Gyűrű alakú piros foltok jelenléte a bőrön, különösen lányokon, hajlamos perifériás terjedésre, mivel a felületes kapillárisok kitágulnak. Szinonima: esszenciális teleangiectasia
spider angioma Teleangiectaticus arteriola a bőrben, sugár alakú kapilláris ágakkal, mely póklábra hasonlít. Jellegzetes, de nem pathognomicus májbetegségre. Látható terhességben, szülést követően gyakran visszafejlődik. Ritkán egészséges egyénen is megjelenik. Szinonima: spider naevus, spider teleangiectasia, csillagnaevus, póknaevus.
teleangiectaticus angioma tágult ereket tartalmazó angioma
angiomatoid
éreredetű daganatra emlékeztető
angiomatosis
multiplex angiomával jellemezhető állapot
Találatok Magyarázat
bacillaris angiomatosis Immundeficiens betegen olyan fertőzés, amelyet az újonnan felfedezett Rickettsia specieshez tartozó Rochalimaea henselae okoz, amelyet láz, granulomás bőrcsomók és esetenként peliosis hepatis jellemez. A bőrbiopsia vascularis proliferatiot és az érfal neutrophil sejtekkel való beszűrődését jelzi, valamint Warthin-Starry ezüstfestéssel mikroorganizmusok csoportját mutatja.
angiomatosus
angiomára emlékeztető, vagy angiomával kapcsolatos
angiomyolipoma
A vese gyakori, jóindulatú daganata: erek, simaizomsejtek és zsírsejtek alkotják.
angioneurectomia
1. valamely terület ereinek és idegeinek kimetszése 2. ductus spermaticus egy szakaszának kimetszése sterilizálás céljából (angio + gör: neuron, ideg + ektomé, kimetszés)
angiooedema
Visszatérő, nagy, körülírt területeken mutatkozó subcutan oedema, amely hirtelen kezdődik, általában 24 óra alatt visszafejlődik. Főként fiatal nőkön találjuk, gyakori az allergiás hajlam gyógyszerre, vagy ételre. Szinonima: angioneuroticus oedema
angiopathia
Minden olyan betegség, amely a vérerekkel, vagy nyirokerekkel kapcsolatos. (angio + gör: pathos, szenvedés)
Találatok Magyarázat
cerebralis amyloid angiopathia A kis agyi erek olyan patológiai állapota, amelyet az érfalban amyloid depositum jellemez, amelynek következtében infarctus, vagy bevérzés következhet be. Alzheimer-kórban is találkozunk vele.
angiophacomatosis
Angiomatosus phacomatosis; a von Hippel-Lindau betegség és a Sturge-Weber-szindróma tartozik ide.
angioplastica
Vérerek rekonstrukciója, illetve rekanalizációja. Ide soroljuk a ballonnal történő dilatációt, az intima mechanikus lehántását, a fibrinolyticumok erélyes érbe injekciózását, vagy stent behelyezését. (angio- + gör: plastos, alakított)
Találatok Magyarázat
percutan transluminalis angioplastica (PTA) Műtét, amellyel a szűkült érlument felfújt és visszahúzott ballonnal tágítunk ki, amelyet angiográfiás katéter csúcsára helyezve viszünk a kívánt érszegmensbe. Az elnevezés magában foglalja az intravascularis stent elhelyezését is.
angiopoesis
vérerek és nyirokerek képződése; szinonima: vasoformatio (angio- +gör: poesis, készítés)
angiopoeticus
angiopoesissel kapcsolatos
angiorrhaphia
Valamely ér varrattal történő helyreállítása, főleg a vérerekkel kapcsolatban használjuk. (angio- + gör: rhaphé, varrás)
angiorrhexis
vérerek rupturájának megjelölésére használt összefoglaló elnevezés
angiosarcoma
Ritka malignus neoplasma, leginkább az emlőben és a bőrben mutatkozik; valószínűleg a vérerek endothel sejtjeiből származik. Mikroszkóposan szorosan egymás mellett lévő kerek vagy orsó alakú sejtekből áll, egy részük kis lument formál.
angiosclerosis
érfal megkeményedése, meszesedése
angioscopia
1. Intravénás injekció után kontrasztanyag érben történő keringését a kapillárisokon át mikroszkóposan tanulmányozzuk. 2. A vérerek belsejének vizualizációja, főleg a pulmonalis artériák esetén, száloptikás katétert alkalmazva, egy perifériás artérián át behatolva fés ha nyitott a foramen ovaleé (angio- + skopeo, megtekinteni)
angioscotoma
Szalag alakú látótér defektus, amelyet olyan retinalis ér idéz elő, amely fotoreceptorok felett fut. (angio- + gör: skotoma, szédülés)
angioscotometria
angioscotoma mérése, illetve kivetítése
angiospasmus
szinonima: vasospasmus
angiospasticus
szinonima: vasospasticus
angiostenosis
egy, vagy több ér szűkülete (angio- + gör: stenosis, szűkület)
angiotenzin
Vasoconstrictor hatású peptidek családja, amelyek a reninnek az angiotenzinogénre gyakorolt enzimatikus hatásából keletkeznek.
Találatok Magyarázat
angiotenzin amid Szintetikus anyag, mely erősen hasonlít a természetben található angiotenzin II-re. Hatásos érszűkítő, alkalmazható bizonyos sokk típusokban és keringési kollapszusban.
angiotenzin I Decapeptid, mely a tetradecapeptid angiotenzinogénből keletkezik 4 aminosav eltávolítása után, a reakciót a renin katalizálja; egy dipeptid (hisztidil-leucin) további lehasításával jön létre az angiotenzin II, a fiziológiásan aktív forma.
angiotenzin II Vazoaktív octapeptid, mely az angiotenzin konvertáló enzim hatására alakul ki angiotenzin I-ből; az érfalban lévő simaizomzat összehúzódását és fokozott aldoszteron szekréciót idéz elő.
angiotenzin III Vazoaktív heptapeptid, mely a simaizomzatra gyakorolt hatását tekintve kevésbé hatékony, mint az angiotenzin II, viszont az aldoszteron szekrécióra kifejtett hatása azzal megegyező mértékű.
angiotenzin prekurzor szinonima: angiotenzinogén
angiotenzin-konvertáló enzim (ACE)
Hidroláz, mely az angiotenzin I-nek dipeptid hisztidil-leucin lehasítása nyomán vazoaktív angiotenzin II-vé történő átalakulásáért felel. Az angiotenzin-konvertáló enzim (ACE)-gátló vegyületek hypertonia és pangásos szívelégtelenség kezelésében hatékonyak.
angiotenzin-konvertáló enzim inhibitor (ACEI)
Gyógyszerek azon csoportja, melyet magasvérnyomás betegség kezelésében alkalmaznak; hatásukat a perifériás érellenállás csökkentése révén fejtik ki, gátolják az angiotenzin I - angiotenzin II átalakulást.
angiotenzinogenáz
szinonima: renin
angiotomia
ér műtéti bemetszése (angio- + tomé, vágás)
angiotonia
szinonima: vasotonia
angiotrophicus
ritkán használt kifejezés, helyette vasotrophicus fordul elő (angio- + gör: trophé, táplálás)
angitis
vérerek gyulladása (arteritis, phlebitis) vagy a nyirokerek gyulladása (lymphangitis); szinonima: vasculitis (angio- + gör: -itis, gyulladás)
angolkór
ld. rachitis
angularis
szögletes
Találatok Magyarázat
cheilitis angularis ld. angulus infectiosus
angulatio
szögképződés; egy szervben abnormális szög, vagy hajlás kialakulása
angulus
(gen. és pl. anguli) Szög; két vonalnak, vagy síknak a találkozási pontja; a térnek vonalak és síkok által történő megosztása kapcsán előálló alakzata. Az alább nem sorolt szögeket a speciális nevükön lehet megtalálni, pl: axioincisalis, distobuccalis, labiogingivalis, linguogingivalis, mesiogingivalis, proximobuccalis stb. (lat: angulus, szög)
Találatok Magyarázat
angulus acromialis az acromion posterior és lateralis széle között előálló szög
angulus cardiophrenicus A szív és a rekesz közötti szög, amely a szív vetületi képének (rendszerint a mellkas röntgen-felvételen) bármelyik oldalsó vetületén mérhető. A jobboldali cardiophrenicus szög normálisan megkülönböztethetetlen a cardiohepaticustól, legalább is a röntgen-felvétel alapján.
angulus costae A borda testének hirtelen görbülete hátul, amint a borda nyaka és feje felfelé irányul.
angulus infectiosus A szájzug gyulladása, ill. fissura kialakulása táplálkozási hiánybetegségek, atopiás dermatitis, Candida albicans infectio talaján. Szinonima: perlèche, cheilitis angularis
angulus iridocornealis az iris és a cornea közötti hegyes szög a szem elülső csarnokának szélén
angulus mandibulae a mandibula testének alsó széle és a ramus mandibulae hátsó éle közötti szög
angulus pelvivertebralis A medence - amelyet a felső medencei nyílás síkja által határozunk meg - és a törzs, vagy a gerincoszlop általános tengelye között mért szög.
angulus sterni A sternum teste és a manubrium sterni közötti szög a manubriosternalis junctionál; ennél a szögnél ízesül a második borda és innen számoljuk a bordákat. Mögötte található az aorta arcusa, a trachea bifurcatioja és a T4/T5 intervertebralis discus.
angulus sternoclavicularis a claviculának a sternummal történő ízesülése által alkotott szög
angulus subpubicus A szeméremcsont rami inferiores közötti szög. Nőkön ez a szög közelíti a teljesen kiterjesztett hüvelyk és mutatóujj közötti szöget (900), férfiakon a teljesen széttárt mutató és középső ujj közötti szöget (600).
anhedonia
Valamely cselekedet megvalósításakor az élvezet hiánya, noha ez rendszerint élvezettel járna. (gör: an-, fosztóképző + hedoné, élvezet)
anhidrid
Olyan oxid, amely vízzel történő kapcsolódása során savat képez; fordítva: olyan vegyület, mely savból keletkezik víz elvonása után.
anhidro-
Kémiai prefixum, jelzi a víz eltávolítását. Vö: pyro- (gör: an-, fosztóképző + hydro, víz)
anhidrosis
verejtékmirigyek hiánya; szinonima: adiaphoresis (gör: an-, fosztóképző + hidros, verejték)
anhidrotikus
1. anhidrosissal jellemezhető, vagy azzal kapcsolatos 2. Jelzi a verejtékmirigyek hiányát, vagy számának csökkenését; jellegzetes congenitalis ectodermalis defectus és anhidrotikus ectodermalis dysplasia.
anictericus
sárgaság nélküli
Találatok Magyarázat
hepatitis anictericus Májgyulladás sárgaság nélkül (pl. vírus hepatitisek enyhe formájánál); a zajló folyamatra a hepatomegalia, lymphadenomegalia, ritkán splenomegalia, hányinger, hányás, étvágytalanság, hőemelkedés, hasi fájdalom, ill. hepatitisre jellemző labor eltérések és vírus szerológiai vizsgálatok alapján következtetünk.
anilid
N-acil-anilin, pl. acetanilid
anilin
(C6H5NH2) Olajos, színtelen, vagy barnás folyadék, amely aromás illatú és fanyar ízű, számos szintetikus festék alapvegyülete. Az anilin igen toxikus ezért ipari mérgezést okozhat. (arab: an-nil, indigó)
anilinctio, anilinctus
szinonima: anilingus
anilingus
szexuális izgatás az anus csókolásával, vagy nyalásával; szinonima: anilinctio, anilinctus (lat: anus + lingo, nyalni)
anilismus
Krónikus anilin-mérgezés, mely gyomor és szívgyengeséggel jár, valamint szédüléssel, izomgyengeséggel, ritmuszavarokkal és cyanosissal.
anima
1. lélek; ld. animus 2. Jung-féle pszichológiában a belső én, szemben a personával; női archetípus a férfiban. Vö: animus (lat: lélegzet, lélek)
animal
Állat; élő szervezet, amelynek membrános sejtfalai vannak, oxigént és szerves táplálékot fogyaszt, akaratlagos mozgásra képes, mindez a növényektől és az ásványoktól megkülönbözteti. (lat.)
animatio
1. élő állapot 2. élénkség, magas kedv (lat: animo pp atus, elevenít, anima, lélegzet, lélek)
Találatok Magyarázat
animatio suspensa Tetszhalál; átmeneti állapot, amely a halálra emlékeztet, a légzés kimaradásával. Az állatok téli álmára, hibernációjára emlékeztető forma, vagy a baktériumok endospóra képzése tartozik ide.
animus
1. energizált lélek 2. Törekvés arra, hogy valamit csináljunk; diszpozíció. 3. pszichiátriában: az aktív ellenségeskedés, vagy gyűlölet szelleme 4. Ideális kép, amely felé valaki törekszik. 5. Jung-féle pszichológiában: férfi archetípusa a nőben. Vö: anima (lat: animus, lélegzet, az emberben a racionális lélek, akarat)
anion (A - )
Negatív töltést hordozó ion, mely a pozitív töltésű kation felé vándorol. Sókban a savi gyökök anion (A - )-ok.
Találatok Magyarázat
anion (A - )csere Az a folyamat, amely során valamely folyadékban lévő anion egy másik anionnal kicserélődik, amely előzőleg szilárd, pozitívan töltött fázisban volt kötött állapotban. Ez utóbbi az anion cserélő. Anioncsere létrejöhet kromatográfiásan, anion szeparálás révén és gyógyszeresen (pl. Cl- anion eltávolítása a gyomornedvből vagy epesav a bélből).
anion gap A plazmában mért kationok és anionok koncentrációinak összegei közötti különbség, mely a következő képlet alapján számítható: (Na+ + K+) - (Cl- + HCO3-)= < 20 mmol/l. Az anion (A - ) értéke emelkedett pl. diabeteses vagy laktát-acidosisban; normális vagy alacsony tartományban mozog bikarbonát-vesztő metabolikus acidosisban.
aniridia
iris hiánya (gör: an-, fosztóképző + irid +ia)
aniseikonia
Olyan szem eltérés, amelyben egy tárgy képe az egyik szemben nagyságban, vagy alakban különbözik ugyanazon tárgy másik szemben létrejött képétől. (gör: anisos, egyenlőtlen + eikon, kép)
aniso-
egyenlőtlen (gör: anosis, egyenlőtlen
anisoaccomodatio
két szemben az akkomodációs képesség különbözősége (aniso + lat: accomodo, alkalmazkodni)
anisochromaticus
nem egyforma egyik színre vonatkozólag
anisocoria
Olyan állapot, amelyben a két pupilla nem egyforma átmérőjű. (gör: aniso + koré, pupilla)
anisocytosis
Azon sejtek nagyságában jelentős különbség van, amelyek normális körülmények között közel egyenlők, különösen a vörösvérsejtekre vonatkozóan. (aniso + gör: kytos, sejt, osis, állapot)
anisodactylia
A megfelelő ujjak nem egyforma hosszúságúak a két oldalon. (aniso + gör: daktylon, ujj)
anisogamia
Két gaméta fúziója, amelyeknek nem egyforma a nagyságuk, vagy alakjuk. (aniso + gör: gamos, házasság)
anisognathia
nem egyforma állkapcsú, a felső szélesebb, mint az alsó (aniso + gör: gnathos, állkapocs)
anisokaryosis
sejtmagok nagyságának szokásosnál nagyobb változatossága (aniso + gör: karyon, mag)
anisomastia
eltérő nagyságú emlők (aniso + gör: mastos, emlő)
anisomelia
a két páros végtag közötti nagyságbeli eltérés (aniso + gör: melos, láb)
anisometropia
két szem közötti eltérés fénytörési képességükben (aniso + gör: metron, mérték, ops, látás)
anisometropiás 1.
anisometropiára vonatkozó 2. Olyan személy, akinek két szeme között eltérés mutatkozik a fénytörési képességben.
anisopiesis
egyenlőtlen artériás vérnyomás a test két oldalán (aniso + gör: piesis, nyomás)
anisosphygmia
A test két oldalán lévő azonos artériákban a pulzus volumene, ideje, ereje különböző; pl. a két art. radialisban, vagy femoralisban. (aniso + gör: sphygmos, pulzus)
anisosthenia
Két izom, vagy izomcsoport egyenlőtlen erejű, amelyek párosak, vagy éppen antagonisták. (aniso + gör: sthenos, erő)
anisotoniás
nem azonos a tensio, vagy az ozmotikus nyomás (aniso + gör: tonus, nyomás)
ankirin
Egy erythrocyta membrán protein, mely a spektrinhez kapcsolódik. Az ankirin hiánya herediter spherocytosis egyik típusának kialakulásához vezet. Szinonima: anchorin, syndein. (gör: ankyra, anchor + -in)
ankylo-
meghajlott, görbült, merev, összeolvadt, összenövés (gör: ankylops, görbült; ankylosis, ízület merevsége)
ankylocolpos
szinonima: atresia vaginalis (ankylo- + gör: kolpos, hüvely)
ankylodactylia
két vagy több ujj közötti adhesio; ld. syndactylia
ankyloglossia
A nyelv részleges, vagy teljes összenövése a szájüreg alapjával, a frenulum linguae rendkívüli rövidsége. Szinonima: tongue-tie (kötött nyelv) (ankylo + gör: glossa, nyelv)
ankylopoeticus
ankylosist kialakító
ankyloproctia
imperforatio ani, vagy strictura ani
ankylosis
Egy ízület merevedése, vagy fixálódása valamilyen betegség következtében. Az ízület körül fibrosus és csontos kapcsolat alakul ki. (gör: ankylosis, ízület megmerevedése)
Találatok Magyarázat
arteficialis ankylosis szinonima: arthrodesis
csontos ankylosis szinonima: synostosis
dentalis ankylosis A fog merev fixálódása a környező alveolusba, mivel a ligamentuma elcsontosodott; gátolja a fogáttörést és az orthodontiás beavatkozásokat.
extracapsularis ankylosis Az ízület megmerevedése a környező szövetek zsugorodása, vagy heterotop ossificatioja folytán.
álankylosis szinonima: fibrosus ankylosis
fibrosus ankylosis Az ízület elmerevedése az ízületet képező csontok körüli fibrosus kötegek jelenléte következtében.
valódi ankylosis szinonima: synostosis
ankyloticus
ankylosissal jellemezhető, vagy ankylosishoz kapcsolódó
anlage
(pl. anlagen) 1. Szinonima: primordium 2. A pszichoanalízisben: genetikus prediszpozíció a személyi jellem egy bizonyos jellegzetességéhez (német: terv, vázlat)
annex
szinonima: adnex (függelék, toldalék)
anochlesia
1. szinonima: catalepsia 2. (lelki nyugalom) (gör: an- + ochlesis, zavar)
anochromasia
1. Olyan szöveti elemekre, sejtekre jellemző, melyek a hagyományos festési eljárásokkal nem festődnek. 2. Hemoglobin felhalmozódása az erythrocyták széli részein, amely következtében a középső területeik halványabbak. (gör: ano- + chroma, szín)
anococcygealis
mind az anusszal, mind az os coccygeum-mal kapcsolatos
anód
1. A galván elem pozitív pólusa, vagy a vele kapcsolatban lévő elektródé. Olyan pozitív töltésű elektród, amely felé negatív töltésű anionok vándorolnak. 2. Wolframból készített része a röntgen-csőnek, amelyből a rtg-sugarak (elektronok) a katódsugarak bombázásának következtében kilépnek. (gör: anodos, felfelé)
anoderm
Az analis csatorna hámja közvetlenül a linea dentata alatt, mely mintegy 1,5 cm-rel túlterjed az anus szélén. Ezen a bőrrészleten nincsen szőr, sem faggyú-, sem verejtékmirigy. Különösen sebezhető dörzsöléssel szemben (pl. durva toalett papír), de érzékeny a kémiai izgató szerek iránt (nem megfelelő szappan), számos nociceptiv receptort (fájdalom, viszketés) és tapintási idegvégződést tartalmaz. Innervációját a nervus pudendus inferiorból (rectalis) kapja.
anodontia
Congenitalis foghiány, vagyis fejlődési rendellenesség és nem kihúzásnak, vagy impactationak a következménye. Szinonima: agomphosis, agomphiasis (gör: an-, fosztóképző + odous, fog)
anodynia
fájdalommentesség (gör: an-, fosztóképző + odyn, fájdalom)
anogenitalis
mind az analis, mind a genitalis régióval kapcsolatos
anomalad
valamely malformáció a következményes strukturális elváltozásokkal együtt (ld: anomália)
anomália 1.
átlagtól, illetve a normálistól való eltérés 2. Bármi, ami strukturálisan szokatlan, szabálytalan, szemben az általános szabállyal. 3. congenitalis defectusok, rendellenességek (gör: anomalia, szabálytalanság)
Találatok Magyarázat
Alder-féle anomália 1. Durva azurophil granulatiok észlelhetők a leukocytákban, ilyenkor gargoylismust és Morquio-betegséget is gyakran látunk.
Ebstein-féle anomália 1. A szív tricuspidalis billentyűje lefelé húzódott a jobb kamrába congenitalis eltérés következtében.
Hegglin-féle anomália 1. A neutrophilok és eosinophilok basophil alakzatokat, Döhle- és Amado-testeket tartalmaznak, továbbá e betegségben a vérlemezkék érése nem megfelelő és thrombocytopenia is jellemző.
anomaloscop
színlátás vizsgálatára használatos műszer
anomia
szinonima: nominalis aphasia (gör: a-, fosztóképző + noma, név)
anonychia, anonychosis
körömhiány (gör: an-, fosztóképző + onyx, köröm)
anonymus
1. névtelen 2. A mellkasban futó nagy erekre gondolták ki e nevet (pl. art. et vena anonyma; ma truncus brachiocephalicusnak és a megfelelő vénának hívják), valamint a medencecsontot is így nevezték. (gör: an-, fosztóképző + onyma, név)
anophtalmia
a szem valamennyi szövetének congenitalis hiánya (gör: an-, fosztóképző + ophtalmos, szem)
anoplasztika
anus plasztikai sebészete (lat: anus + gör: plastos, alakított)
anorchia
szinonima: anorchismus
anorchismus
A herék hiánya, amely lehet congenitalis, vagy szerzett. Szinonima: anorchia (gör: an-, fosztóképző + orchis, here)
anorectalis
mind az anusszal, mind a rectummal kapcsolatos
anorecticum
étvágycsökkentő gyógyszer
anorexia
csökkent étvágy, étellel szembeni aversio
Találatok Magyarázat
anorexia nervosa Személyiségi zavar, túlzott félelem az elhízástól, mely az ételektől való elforduláshoz vezet. Fiatal nőkön mutatkozik, és gyakran életet veszélyeztető súlyveszteséget okoz. A testkép zavarával, hiperaktivitással és amenorrhoeával jár.
anorexiás
anorexiával kapcsolatos, anorexiában szenvedő, különösen anorexia nervosa esetében (gör: an-, fosztóképző + orexis, étvágy)
anorexigen
Olyan gyógyszer, "diéta tabletta", vagy eljárás, esemény, amely anorexiához vezet.
anorgasmia
Orgazmus, kéjérzés hiánya, melynek oka lehet biogén (szekunder fizikális eltérés miatt, vagy gyógyszer által előidézett), pszichogén (szekunder pszichológiai tényezők által, vagy szituáció miatt) vagy a kettő kombinációja. (gör: an-, fosztóképző+ orgasm + ia)
anorthographia
szinonima: agraphia (gör: an-, fosztóképző + orthos, egyenes + grapho, írni)
anoscop
rövid speculum (vizsgálótükör) az analis csatorna és a rectum vizsgálatára
anosigmoidoscopia
az anus, a rectum és a sigmabél endoscopos vizsgálata
anosmia
A szaglás érzésének elvesztése, mely lehet a nervus olfactorius elváltozásának, az orrüreg betegségének következménye, de kialakulhat minden magyarázható ok nélkül is. (gör: an-, fosztóképző + osmé, szaglás)
anosognosia
A betegség meglétéhez nemtörődöm módon viszonyul a páciens, tagadja hemiparesisét; legtöbbször olyan betegen látjuk, akinél nem domináns oldalon, a parietalis kérgi területen alakul ki elváltozás. (gör: an-, fosztóképző + nosos, betegség, gnosis, ismeret)
anospinalis
anussal és gerincvelővel kapcsolatos
anosteoplasia
a csontok kialakulásának zavara (gör: an-, fosztóképző + osteon, csont + plass, formálás)
anostosis
ossificatio elégtelensége (gör: an-, fosztóképző + osteon, csont)
anotia
fülkagylók veleszületett, egy- vagy kétoldali hiánya (gör: an-, fosztóképző + ous, fül)
anovesicalis
anusra és húgyhólyagra vonatkozó
anovulatio
peteérés felfüggesztése, vagy hiánya
anoxaemia
Az artériás vérből hiányzik az oxigén. Régebben a mérsékelt oxigénhiányt is ezzel jelölték, ma ilyenkor a hypoxaemia kifejezést használjuk. (gör: an-, fosztóképző + oxygen + haima, vér)
anoxia
A belélegzett levegőben, az artériás vérben, vagy a szövetekben az oxigén teljes, vagy majdnem teljes hiánya. Elkülönítendő a hypoxiától. (gör: an-, fosztóképző + oxygen)
Találatok Magyarázat
anaemiás anoxia vagy anaemiás hypoxia Az artériás vérben az oxigén parciális nyomása normális, azonban az oxigén szállítására szolgáló hemoglobin szintje csökkent.
anoxiás anoxia Enyhébb foka a hypoxiás hypoxia, amelyben az artériás vérben az oxigén parciális nyomása alacsonyabb a normális értéknél.
hisztotoxikus anoxia A szöveti légzési enzimrendszernek, a citokróm-oxidáznak cianidokkal történő gátlása nyomán figyelhető meg. Ilyen esetben a szövetek nem képesek az egyébként jelen lévő oxigént hasznosítani, ezért az oxigén tenzió a vérben és a kapillárisokban a szokásosnál is magasabb.
stagnáló vagy ischaemiás anoxia A csökkent szöveti vérátáramlás miatt nem jut a sejtekhez elegendő mennyiségben oxigén.
ansa
(gen. ansae) Bármilyen anatómiai struktúra, amelyet kacs, vagy ív jellemez. (lat: ansa, kacs, fogó)
Találatok Magyarázat
ansa cervicalis A plexus cervicalisban lévő kacs, amely az első három cervicalis idegből kapja rostjait. A C1 és C2-ből származó kacshoz még a nervus hypoglossus is csatlakozik rövidtávon, majd elhagyja, mint a felső gyökere az ansa cervicalisnak. A C2 és C3-ból erednek az ansa cervicalis alsó gyökerei. Gyakrabban a gyökerek összeolvadnak és az ansa cervicalist képezik, amely ágakra oszlik, beidegezve a nyelv alatti izmokat.
ansa peduncularis Komplex rostköteg, amely a lobus temporalis capsula interna medialis széle körül kanyarog, összekötve a lobus temporalist, az amygdalát és az olfactorius kérget a thalamus mediodorsalis nucleusával. A thalamusba a pedunculus thalamicus inferior részeként lép be, amelyben azon rostok nagyobb része található, amelyek a mediodorsalis nucleust az orbitofrontalis kéreggel kapcsolják össze.
ansa subclavia Idegköteg, amelynek rostjai a cervicalis ganglionokat a ganglion stellatummal kötik össze, és közben kacsot képeznek az arteria subclavia körül.
anserinus
lúdszerű
Találatok Magyarázat
pes anserinus lúdtalp
ansiformis
kacsszerű (lat: ansa, kacs + forma, alak)
ant-
ld.: anti-
antacid
1. savat neutralizáló 2. Bármilyen hatóanyag, amely az aciditst mérsékelni képes, mint a gyomornedvét, vagy más szekrétumét.
antagonista
Olyan struktúrák, hatóanyagok, betegségek vagy élettani folyamatok, amelyek neutralizálják, vagy gátolják egy másik hatását. Vö: szinergista
Találatok Magyarázat
aldoszteron antagonista Olyan anyag, amely ennek a mellékvesekéreg hormonnak a hatását képes antagonizálni a vese tubulusain. Ilyen hatóanyag a spironolakton, amely a primer aldoszteronizmus okozta hypertensiót képes rendezni, vagy a szekunder aldoszteronizmus okozta nátrium retenciót képes visszaszorítani.
fólsav antagonista Módosított pterinek (pl. aminopterin, amethopterin), amelyek a daganatok növekedéséhez szükséges fólsav hatását kivédik, ezzel fólsav hiány tüneteit idézik elő; kemoterápia során alkalmazzák e vegyületeket.
opioid antagonista Olyan hatóanyag, mint a naloxon és a naltrexon, amelyek jelentős affinitással rendelkeznek az opioid-receptorok iránt, hozzájuk kapcsolódnak, de nem aktiválják ezeket. Gátolják a kívülről adott opioidok hatását, mint amilyen a morfin, a heroin, a meperidin és a metadon, de egyben az endogén endorfinok és enkefalinok hatását is.
antagonizmus
1. struktúrák közötti kölcsönös szembenállást jelent a hatásukban, hatóanyag tartalmukban, betegségben, vagy élettani folyamatban. 2. Két, vagy több tényező együttes hatása kisebb, mint e tényezők egyikének a hatása önmagában. Szinonima: mutual resistence (kölcsönös ellenállás) (gör: anti, ellen; agonizomai, harcolni)
antalgia
antalgiás tartás: fájdalomkerülő, kényszertartás, gerinc-, ízületi-, izomfájdalmak esetén.
ante cibum
(pl. ante cibos) étkezés előtt (lat.)
ante finem
vég előtt, befejezés előtt
ante-
előtt (időre, helyre és rendre is vonatkozik); ld.: pre-, pro (lat: ante-, előtt)
antebrachialis
alkarra vonatkozó
antebrachium
alkar
antecubitalis
könyök előtti (ante- + lat: cubitum, könyök)
anteflexio
1. előrehajlás és szögletképződés 2. Az uterus normális előrehajlását jelzi a corpus-cervix határán.
antemortem
halál előtt; vö: postmortem (ante + lat: mors, halál)
antenatalis
szinonima: praenatalis (ante + lat: natus, születés)
antepartum
szülés előtt; vö: intrapartum, postpartum (ante + lat: pario pp. partus, előre vinni)
antepositio
előrehelyezés
antepyreticus
lázas állapotot megelőzően (ante + gör: pyretos, láz)
anterior
1. Humán anatómia: a test frontalis felületét jelzi; gyakran az egyik struktúrának a helyzetét egy másikéval összehasonlítva jelöli, vagyis amelyik közelebb helyezkedik el a test frontalis síkjához. Szinonima: ventralis 2. embrió feji vége felé 3. időben, vagy térben valami előtt (lat.).
antero-
anterior (lat: anterior, előtte)
anterograd
1. előrefelé mozgás, normál mozgás irányába (pl. véráramlás, bél perisztaltika) 2. egy meghatározott időtől számítva előre; amnesia refenciapontjától számítva időben előrehaladva (lat: gradior, előre lépni)
anteroinferior
elől és alul
anterolateralis
előre és a középvonaltól kifelé
anteromedialis
előre és a középvonal irányába
anteromedian
középvonalban elől
anteroposterior
1. mind a frontalis, mind a hátsó síkban 2. röntgenfelvétel elvégzésének technikájában a sugárnyaláb útja a betegen át elölről hátra
anterosuperior
elöl és fent
antesystolia
A kamra időelőtti aktivációja, mely a preexcitáció kialakulásáért felelős a Wolff-Parkinson-White (WPW) és a Lown-Ganong-Levin (LGL) szindrómában.
anteversio
A test egyik szegmentumának előre fordulása, előredőlése, anélkül, hogy az illető megfordítaná a testét. (lat: ante-, előre + verto, fordul)
antevertált
előre hajlott, anteversio állapotában található
anthelix
szinonima: antihelix (anti + gör: helix, csavarvonal)
anthelminthicum
Olyan szer, amely a bélférgeket elpusztítja és kiűzi a szervezetből. (anti + gör: helmins, féreg)
anthelminthicus
féregellenes (gyógyszer)
anthraco-
szén-; latin carb-, carbo- jelentésnek megfelelő (gör: anthrax, anthrakos, szén)
anthracoid
carbunculusra, vagy cutan anthraxra emlékeztető
anthracosilicosis
Olyan pneumoconiosis, amelyben szén és szilícium szemcsék halmozódnak fel a tüdőben a belélegzett szénporból. A szilícium tartalom növeli a fibrosus csomók kialakulásának veszélyét. (anthraco + silicosis)
anthracosis
Pneumoconiosis, a szén felhalmozódása a tüdőben a belélegzett füstből, vagy szénporból. Szinonima: melanoderma, bányásztüdő (anthraco + gör: osis, állapot)
anthrax
Lépfene; a Bacillus anthracis okozta fertőzés, mely állatokról, vagy állati eredetű termékekről emberre, rendszerint hámsérüléseken át, ritkábban légutakon keresztül terjedve klinikailag a különböző szervekben és testüregekben (cutan, enteralis és pulmonalis forma) véres és serosus ömlenyeket, valamint általános elesettséget okoz. Szinonima: carbunculus (gör: anthrax, szén)
anthropophil
Embert kereső, vagy embert szerető, embert előnyben részesítő, különös tekintettel: (1) vérszopó arthropodákra, jelezvén, hogy az adott parazita emberi gazdaszervezetet keres, (2) dermatophyta gombákra, amelyek az emberi bőrön szeretnek növekedni. (anthropo- + gör: phileo, szeret)
anthropozoonosis
A természetben állatokon mutatkozó zoonosis, mely emberre terjed át (pl. veszettség, brucellosis) (anthropo + gör: zoon, állat + nosos, betegség)
anti-
Prefixum, melynek jelentése: szemben, ellen- (pl. antitoxin - egy adott toxin elleni immunanyag). (gör: anti-, szemben, ellen)
anti-HBc
antitest a HBcAg ellen
anti-HBs
hepatitis felületi antigén (HBsAg) elleni antitest
anti-hemagglutinin
Olyan anyag (beleértve az antitestet is), amely gátolja, illetve megelőzi a hemagglutinációt.
antiacid
szinonima: antacid (savlekötő)
antiadrenergicum
A szimpatikus vagy adrenerg idegrostok ellen ható, azok hatását antagonizáló. Ld. sympatholyticum
antiagglutinin
Specifikus antitest, amely az agglutinin hatását kioltja.
antianaemiás
Olyan tényezőt, vagy anyagot tartalmaz, amely kivédi, vagy gyógyítja az anaemiát.
antianaphylaxis
szinonima: deszenzitizáció
antiantibody
valamely antitest ellen ható másik antitest
antiantitoxin
Olyan antitest, amely egy antitoxin hatását gátolja.
antibacterialis
Meggátolja a baktériumok növekedését, elpusztítja a baktériumokat.
antibiosis 1.
Két szervezet olyan társulása, amely egyikükre végzetes, szemben a probiosissal. 2. Baktérium által termelt antibiotikum, amely gátolja egy másik szervezet növekedését, főleg a talajban élő mikrobák esetén találkozunk ezzel a jelenséggel. (anti + gör: bios, élet)
antibioticum
1. antibiosissal kapcsolatos 2. Olyan oldható anyag, amely pl. baktériumból ered és gátolja más mikroorganizmusok növekedését.
Találatok Magyarázat
széles spektrumú antibioticum Igen széles skálájú aktivitást fejt ki mind a Gram-pozitív, mind a Gram-negatív organizmusokkal szemben.
anticardiolipin antitest
A sejtmembránokban található cardiolipid - zsírsavak foszforilált poliszaccharid észtere - ellen termelődő antitest; rendszerint immun-mediált betegségekhez, szifiliszhez, strokehoz, hypercoagulációs állapotokhoz társulhat jelenléte.
anticholinerg
A parasympathicus, vagy más cholinerg idegrostokkal ellentétes hatású, antagonista (pl. atropin).
anticipatio
1. Rendszeresen visszatérő tünetek idő előtti, ismételt fellépése (pl. maláriás láz) 2. Valamely örökletes kórkép manifesztációjának progresszív időbeni előretolódása, esetleg egyre súlyosabb tünetek formájában a későbbi generációk folyamán.
anticlinalis
ellenkező irányba hajló, miként egy piramis két oldala (anti + gör: klino, hajolni)
anticonceptio
fogamzásgátlás
anticoncipiens
fogamzásgátló szer
antidepresszáns
1. depresszió ellen hat 2. ilyen hatással rendelkező gyógyszer
antidiuresis
vizelet térfogatának csökkentése
antidiureticum
Olyan gyógyszer, vagy hormon (pl. ADH), amely csökkenti a vizeletképződést a vesében.
antidotum
Olyan hatóanyag, amely képes semlegesíteni egy mérget, vagy annak hatását ellensúlyozza. (gör: antidotos, valami ellen adott)
Találatok Magyarázat
fiziológiai antidotum Olyan szervezetben megtalálható hatóanyag, amelynek hatása pontosan ellentétes a méregével.
kémiai antidotum Olyan anyag, amely a méreggel kapcsolódva azzal ártalmatlan vegyi anyagot képez.
mechanikai antidotum Olyan anyag, amely megakadályozza a méreg felszívódását a bélből.
antidrom
Normális iránnyal szemben mozgó, pl. az idegeken fordítva vezetődő impulzusok, szív vezetési rendszerében fordított irányú ingervezetés.
antiemeticum
1. Megakadályozza, vagy megszünteti a hányást. 2. Olyan hatóanyag, amely ezt a hatást létrehozza. (anti + gör: emetikos, hányás)
antifebrilis
szinonima: antipyreticus (anti + lat: febris, láz)
antifibrinolysin
szinonima: antiplasmin
antifibrinolyticum
Olyan anyag jelzője, amelyik csökkenti a fibrin szétesését, oldását (pl. aminokapronsav).
antifoszfolipid antitest
Olyan antitest, mely zsírsavak foszforilált poliszacharid észterei ellen termelődik (pl. lupus antikoaguláns, VDRL, antikardiolipin antitest). Autoimmun kórképekkel, hyperkoagulációs zavarral társulhat jelenléte.
Találatok Magyarázat
antifoszfolipid antitest szindróma Fokozott thrombosis hajlammal, recurrens abortusszal, thrombocytopeniával és neurológiai zavarokkal járó kórkép, melyre jellemző a kardiolipin, foszfatidil-szerin, és foszfatidil-etanolamin ellen termelt antitestek jelenléte.
antigén
Minden olyan anyag, amely - miután a megfelelő sejtekkel kapcsolatba jutott - immunválaszt idéz elő egy bizonyos látens idő után (napok, vagy hetek) és amely meghatározott módon képes az antitestekkel, vagy az immunsejtekkel reagálni in vivo és in vitro. A modern szóhasználattal szélesebb értelmezést nyert az antigén determináns, vagy determináns csoport egy molekulában, ez alatt egy jellegzetes kémiai csoportot értenek, amely a molekula antigén specificitását hordozza. Ld.: haptén. Szinonima: immunogén (antibody + gör: gen, készítő)
Találatok Magyarázat
vércsoport antigén Azon veleszületett antigénekre vonatkozó gyűjtőnév, amelyeket az erythrocyták felületén találunk, és amelyek meghatározzák a vércsoport hovatartozást reakcióba lépve specifikus antiszérumokkal. Az ABO- és a Lewis-vércsoportok antigénjei a nyálban és más testnedvben is fellelhetők.
capsularis antigén Csak bizonyos mikroorganizmusok tokjában találhatók (pl. pneumococcus különböző típusaiban specifikus poliszaccharidok).
carcinoembryonalis antigén (CEA) Az embrionális endodermalis epitheliumban található glikoprotein, amely a felnőttek sejtjeiben általában nincs jelen, kivéve néhány carcinomát. Így kimutatható a colon tumoros betegek szérumában is.
class I antigén (első osztályba tartozó antigének) Sejtmembránhoz kötött glikoproteinek, amelyeket a major histocompatibilitási komplex kódol.
class II antigén Sejt-membrán glikoproteinek, amelyeket a major histocompatibilitási komplex génjei kódolnak. Az antigének az antigén prezentáló sejtek (pl. macrophagok, B-lymphocyták és dendriticus sejtek) felszínén találhatók.
class III antigén Nem sejtmembrán molekulák, ezeket a major histocompatibilitási komplex S régiója kódolja. Ezek az antigének (pl. komplement proteinek) nem tartoznak a histocompatibilitást meghatározó antigénekhez.
keresztreagáló antigén (epitop) Közös antigén, amely két különböző molekulában, vagy organizmusban is jelen van.
komplett antigén Bármely antigén, amely antitestképződést idéz elő, amellyel in vivo és in vitro egyaránt reagál, ebben különbözik az inkomplett antigéntől (hapténtől)
delta antigén szinonima: hepatitis D vírus
flagellaris antigén Hőlabilis antigén, amely a baktériumok ostoraihoz tartozik, szemben a szomatikus antigénekkel. Ld. H-antigén
H-antigén 1. Mozgó baktériumok flagelláiban találhatók. 2. ABO-antigének vércsoportot meghatározó locusán kémiai prekurzor
hepatitis B core antigén (HBcAg) Dane particulum, amely a teljes vírus belsejében található antigén, de hepatitis B fertőzés esetén a májsejtek magja is tartalmazza.
hepatitis B e antigén (HBeAg) Olyan antigén, vagy antigének csoportja, amely a hepatitis B vírusfertőzéssel kapcsolatos, különbözik a HBs (surface, felületi) antigéntől és a core (HBcAg) antigéntől is. Jelenléte, kimutathatósága arra mutat, hogy a beteg potenciálisan fertőző.
hepatitis B surface antigén (HBsAg) (felületi antigén) A hepatitis B vírusnak kis, 20 nm-es kör alakú, vagy filamentosus alakú antigénje (a teljes vírus kb. 40 nm átmérőjű).
heterogén antigén Olyan antigén, amely filogenetikusan egymástól távol álló fajokban egyaránt kimutatható.
HLA-antigén (humán leukocyta csoport A antigén) Szoros kapcsolatban állnak azzal a 6. kromoszómán található génkomplexszel, amelyet major histocompatibilitási complex (MHC) néven ismerünk. Legalább négy kapcsolt locus és több sublocus által produkált gének terméke kapta a humán leukocyta csoport antigén elnevezést (A, B, C, D). Ezek az antigének nagy hatással vannak az allotranszplantációra, transzfúzióra és bizonyos betegségekkel is kapcsolatot mutatnak.
inkomplett antigén szinonima: haptén
Kveim- antigén Az emberi sarcoidosis szövetből (lépből) sóoldattal kivont antigén, amelyet a Kvein-tesztben alkalmaznak.
mumpsz bőrteszt antigén A megölt mumpsz vírus szuszpenzió, ezzel határozzák meg a mumpsz iránti érzékenységet, illetve régebbi mumpsszal történt expozíciót.
O-antigén 1. Gram-negatív bélbaktériumok szomatikus antigén-je; a sejtfal lipopoliszaccharidáinak külső része. Ld.: H-antigén 2. Ld.: ABO-vércsoport
oncofoetalis antigén Tumorhoz társult antigének összefoglaló elnevezése, amelyek a foetalis szövetekben megtalálhatók, de a normál felnőtt szövetekből hiányoznak. Ide soroljuk az α-foetoproteint és a carcinoembryonalis antigént.
szerv-, szövet-specifikus antigén Heterogén antigén, szerv- ill. specificitással (pl. a fajspecificitás mellett a vese tartalmaz olyan antigént is, amely más fajok veséjében is jelen van).
partialis antigén szinonima: haptén
prosztata specifikus antigén (PSA) Kallikrein proteáz, mely a normál seminalis váladékban jelen van, a prosztata epithel sejtjei termelik. A PSA emelkedett szintje a szérumban prosztata megnagyobbodással és prosztata carcinomával társultan fordul elő. Így alkalmas a prosztatarák korai felfedezésére. Mintegy 70%-ában az eseteknek az emelkedést rákos elváltozás okozza.
szenzitizált antigén Egy antigén specifikus antitesttel történő kapcsolódása során kialakuló komplex, mely kötődést követően az antigén érzékenyített a komplementek hatása iránt.
szomatikus antigén A baktérium sejtfalában elhelyezkedő antigén, szembeállítva a csillóban (flagellaris antigén), vagy a tokban (capsularis antigén) található antigénekkel.
faj-specifikus antigén A szöveteknek, vagy szöveti folyadékoknak olyan antigén komponensei, amelynek révén a különböző specieseket el lehet egymástól különíteni (pl. ló szérum albuminja immunológiailag különbözik az emberétől, a kutyáétól, a birkáétól).
T-antigén Tumor antigének, amelyek bizonyos DNS tumor vírusokhoz kapcsolódnak és ezeknek a vírusoknak replikációjához, transzformációjához társulnak. Ide tartoznak az adenovírusok, a papoavírusok.
tumor antigén 1. Azok az antigén-ek, amelyek gyakran társulnak tumorokkal, vagy amelyek az azonos eredetű daganatsejtekben találhatók (tumor specifikusak). 2. Tumor antigének, amelyek bizonyos DNS tumor vírusok replikációjával és transzformációjával kapcsolódnak (pl. adenovírusok, papoa vírusok). Szinonima: neoantigének; ld.: T-antigén
tumor-specifikus transzplantációs antigén (TSTA) Felületi antigének a DNS vírusok által transzformált sejtekből, amely a vírus mentes sejteknek az immunválaszát idézi elő, ha olyan állatokba transzplantálják, amelyeket a specifikus sejt-transzformáló vírussal immunizáltak.
antigenaemia
Antigén tartós jelenléte a keringő vérben (pl. HBsAg a beteg szérumában tartósan jelen lehet). (antigen + gör: haima, vér)
antigenitás
antigén reagáló képessége a specifikus ellenanyaggal; szinonima: immunogenitás
antiglobulin teszt
szinonima: Coombs-teszt
antihaemophiliás globulin A
VIII. véralvadási faktor, mely a haemophilia kezelésében használatos.
antihaemophiliás globulin B
IX. véralvadási faktor, mely a haemophilia kezelésében használatos.
antihaemorrhagiás
vérzéscsillapító (pl. K-vitamin); szinonima: haemostaticum
antihaemorrhoicum
aranyér kezelésére alkalmas szer
antihelix
a fülkagyló helixének hátsó részével durván párhuzamosan kiemelkedő porcos elülső szél, szinonima: anthelix
antihemolítikus
hemolízist kivédő anyag, hatás jelzője
antihemolizin
Olyan anyag (beleértve az antitestet is), amely megelőzi, vagy kivédi a hemolizin hatását.
antihisztamin
Olyan gyógyszer, amely a hisztamin különböző hatásait antagonizálja, allergiás tünetek kezelésére alkalmazzák.
antihormon
Olyan anyag, amely a szérumban található, és bizonyos hormonok hatását gátolni képes (pl. specifikus hormon ellenes antitestek).
antihumán globulin
Nyúl vagy más állatfaj széruma, melyet előzőleg tisztított humán globulinnal kezeltek IgG és komplement ellenes antitestek képződésének kiváltására; a direkt és indirekt Coombs-tesztben használják. Szinonima: Coombs-szérum
antihydroticum
szinonima: antiperspirans
antihypertensivum
hypertoniás betegeken vérnyomás csökkentésére alkalmas gyógyszer
antiinflammatoricum
A gyulladásos mediátorok képződését gátolja a szervezetben, de direkt úton a gyulladást kiváltó hatást nem befolyásolja (pl. aspirin, glükortikoidok).
antikoaguláns
1. alvadás gátló 2. olyan gyógyszer, amely alvadásgátló hatású (pl. warfarin)
Találatok Magyarázat
lupus antikoaguláns Antiphospholipid antitest, amely megnyújtja a partialis thromboplastin időt, ugyanakkor vénás és artériás thrombosisokkal jár együtt.
anticoagulans ld. antikoaguláns
antikodon
A kodonnal komplementer trinukleotid szekvencia, amelyet a tRNS molekulának egy ívében találunk. Például, ha a kodon A-G-C, ennek antikodonja U(vagy T)-C-G. A komplementer elv a Watson-Crick bázispárosításból következik, amely szerint A komplementer az U (vagy T)-vel és G komplementer a C-vel. Gyakran nodok-nak is nevezik (kodon fordítottja, komplementere).
antikomplement
Olyan anyag, amely a komplementtel kapcsolódva neutralizálja azt, illetve az antitesttel történő kötődését akadályozza.
antikonvulzáns
1. meggátolja epilepsziás görcs kialakulását, vagy a már meglévő görcsöt oldja 2. ilyen hatást kifejtő gyógyszer
antilithicum
kőképződést gátló, vagy a képződött kövek oldódását segítő hatóanyag (anti + gör: lithos, kő)
antilymphocyta globulin (ALG)
szinonima: antilymphocyta szérum (ALS)
antilymphocyta szérum (ALS)
Lymphocyták ellen termelt antiszérum, mely szerv transzplantációt követően a rejectio kivédésére használatos egyéb immunszuppresszív készítményekkel együttesen. Szinonima: antilymphocyta globulin
antimalaricum
malária elleni gyógyszer
antimer
szinomima: enantiomer
antimetabolit
Olyan anyag, amely verseng valamely metabolittal szemben annak kötőhelyéért, vagy antagonizálja a hatását (pl. ethionin antimetabolit-ja a methioninnak).
antimikrobiális
mikrobák elpusztítására alkalmas, növekedésüket, szaporodásukat, vagy patogén hatásukat gátolni képes
antimon (Sb)
(stibium) Fémes elem, atomszáma 51, atomsúlya: 121.757, vegyértéke 0,-3,+3,+5; ötvözetekben használják. Toxikus, izgatja a bőrt és a nyálkahártyákat. (gör: anti + monos, egyedül)
antimongoloid
Olyan állapot, amelyben a palpebra lateralis szöge alacsonyabb, mint a medialis része.
antimutagén
Olyan tényező, amely csökkenti a mutációk számát, vagy egy mutagén anyag hatását gyengíti.
antimycoticum
gombák növekedését ill. szaporodását gátló szer (anti + gör: mykés, gomba)
antineoplasticus
daganat fejlődését, érését, áttétek képződését megakadályozó
antinion
A szemöldökök közötti terület; a koponyán az inionnal szembeni pont. Ld.: glabella (anti + gör: inion, nyakszirt)
antinuclearis antitest (ANA)
ld. antitest
antioncogen
Tumor szuppresszor gén, amelynek feladata a sejtnövekedés kontrollja. Ha az ilyen gén inaktiválódik, a sejt proliferatioja a szabályozás alól kivonul, miként rákos daganatban. Szinonima: tumor szuppresszor gén
antiösztrogén
Bármely anyag, amely az ösztrogén biológiai hatását, ill. annak teljes kifejlődését a szövetekben képes megakadályozni.
antioxidáns
Olyan hatóanyag, mely gátolja a szervezetben zajló oxidatív folyamatokat (pl. aszkorbinsav, E-vitamin).
antiparasiticum
parazita pusztító gyógyszer
antipediculoticum
pediculosis (tetvesség) kezelésére alkalmas hatóanyag
antiperistalsis
ellenkező irányú perisztaltika
antiperistalticus
1. antiperistalsissal kapcsolatos 2. Olyan hatás, amely felfüggeszti, vagy megállítja a peristalsist.
antiperspiráns
1. Gátló hatást gyakorol a verejték szekrécióra. 2. Olyan szer, amely ilyen gátló hatást képes kifejteni (pl. alumínium-chlorid).
antiphlogisticum
1. Régi elnevezése a gyulladáscsökkentő anyagoknak. 2. Olyan hatóanyag, amely a gyulladást mérsékli. (anti + gör: phlogistos, kigyulladt)
antiplazmin
Olyan főként a plazmában, a lépben és a májban található anyag, amely gátolja, vagy megelőzi a plazmin hatását. Ld: antifibrinolízis
antiport
Két különböző molekula, vagy ion kapcsolt transzportja esetén játszik szerepet, amely egy membránon át történik, egymással szemben, közös karrier mechanizmus (antiporter) segítségével. Vö: symport, uniport (anti + lat: porto, vinni)
antiprothrombin
Olyan antikoaguláns (pl. heparin, dikumarin), amely gátolja, vagy megelőzi a prothrombinnak thrombinná való alakulását.
antipruriticum
Olyan szer, amely gátolja, vagy megszünteti a viszketést.
antipsychoticum
Olyan hatóanyagok, amelyek a pszichózis kezelésében hasznosak, képesek a gondolkodás zavarát mérsékelni (pl. chlorpromazin, haloperidol). Szinonima: neuroleptikum
antipyreticum
lázcsillapító készítmény (pl. paracetamol, aszpirin) (anti + gör: pyretos, láz)
antisecretoros
Szekréció gátló hatás, vagy bizonyos gyógyszerek, amelyek a gyomor sósav szekrécióját gátolják (pl. ranitidin, omeprazol).
antisepsis
Fertőzés megelőzés, vagy a fertőző ágens növekedésének megállítása. Ld. desinfectio (anti + gör: sepsis, rothadás)
antisepticus
1. antisepsissel kapcsolatos 2. Olyan hatóanyag, amely képes antisepsist kiváltani.
antispasmodicus
1. izomgörcsöket megelőző, vagy mérséklő hatású 2. Olyan hatóanyag, amely a görcsöket csillapítja.
antistreptokináz
Antitest, amely a streptokináz fibrint lebontó hatását gátolja, vagy megelőzi.
antistreptolizin
A Streptococcusokban található streptolizin nevű toxint közömbösítő antitest, melynek szérum koncentráció változásainak összehasonlítása fertőzés folyamán diagnosztikus és egyben prognosztikus értékű.
antiszérum
Egy, vagy néhány antigénnel szemben jelentős antitestet, illetve antitesteket tartalmazó szérum. Állati vérből állítják elő, előbb az állatot a megfelelő antigénnel oltották; esetleg olyan állatból, illetve személyből veszik a vért, amely átesett az illető antigénnel történő kontaktuson (betegségen).
antiszociális
Az egyén jogait állítja szembe a közösségével, illetve a közösség jogi normáival. Vö: aszociális
antitest
Immunglobulin molekula, amely specifikus aminosav szekvenciával rendelkezik. Emberen és állatokon is antigén beadásával lehet termelését kiváltani. A specifikus antigénnel kimutatható módon reagál. A megfelelő antigént és az antitestet egymásról nevezik el. Ugyanakkor úgy tudjuk, hogy az antitestek természetes úton is léteznek, anélkül, hogy antigén stimulus kellene keletkezésükhöz. 1. Széles értelemben antitestnek nevezünk minden olyan anyagot, amely antigén stimulus hatására keletkezve specifikus módon reagál az antigénnel. 2. A globulinok egyik osztálya (immonoglobulinok), amelyek az állati (emberi) szérumban, vagy testnedvekben jelen vannak antigén stimulust követően, vagy anélkül "természetesen". Különböző, genetikailag meghatározott determinánsok, Gm (amelyet az IgG H láncaiban találunk gheavy chain, nehéz lánch), Am (amelyet az IgA H láncaiban találunk) és Km (amelyet a K ))) típusú L láncokban találunk (light chain, könnyű lánc), régebben InV) határozzák meg az antigenitását az antitest molekulának. Az alosztályokat ábécé, vagy számok alapján jelöljük (pl. G3mb1, vagy G3m5). Az egyes osztályok azon képességük szerint különböznek, hogy a különböző szerológiai tesztekben hogyan reagálnak. Ld: immunoglobulin
Találatok Magyarázat
anti-basalis membrán antitest vese glomerularis membránja, mint antigén ellen termelődött antitest
antinuclearis antitest Olyan antitest, amely a sejtmagokkal szemben mutat affinitást. Kimutatható, ha sejt szubsztrátot teszünk ki a kérdéses szérum hatásának, majd antihumán globulin szérumot adunk hozzá. Nagy arányban pozitív olyan betegeken, akik szisztémás lupus erythematosusban, rheumatoid arthritisben és más kollagén betegségben szenvednek. De pozitivitás mutatkozhat a fenti betegek egészséges hozzátartozóiban és a normál populációban is mintegy 1%-os gyakorisággal.
blokkoló antitest 1. Bizonyos koncentrációban nem okoz precipitációt, ha specifikus antigénnel hozzuk össze, viszont ebben a kombinált helyzetben blokkolja a további antitestek aktivitását, ha a precipitáló koncentráció fölé visszük az antitest mennyiségét. 2. Az immunoglobulinok IgG osztálya, amely az atopia antigénjével kapcsolódik, de nem vált ki I. típusú azonnali allergiás reakciót; a kapcsolódó IgG blokkolja a rendelkezésre álló IgE osztályú antitest aktivitását.
komplement-kötő antitest Olyan antitest, amely a szenzitizáló antigénnel kapcsolódik, és a kötődése aktiválja a komplementet, majd ez a sejt lysisét idézi elő.
komplett antitest szinonima: agglutinin
keresztreakciót mutató antitest 1. Olyan antitest, mely csoport antigének iránt mutat specificitást, vagyis minden olyan antigénre reagál, amelynek azonos a funkcionális csoportja. 2. Olyan antigénekre reagál, amelyek közel azonos funkcionális csoporttal rendelkeznek, de kémiai struktúrájukat tekintve nem azonosak.
cytophil antitest szinonima: cytotrop antitest
cytotrop antitest Bizonyos sejtféleségek iránt mutat affinitást az antitest, specifikus affinitása az antitest termelését kiváltó antigénre nem vonatkozik a nehéz lánc Fc részének tulajdonsága következtében. Ld: heterocytotrop antitest, homocytotrop antitest. Szinonima: cytophil antitest
Donath-Landsteiner antitest Olyan IgG antitest, amely a paroxismalis hideg hemoglobinuriában mutatható ki. Az antitest bifázisos, a vörösvérsejtekkel 15 C0 alatt kapcsolódik, és a sejthártyához komplementet köt. Miután a testhőmérsékletre felmelegedett, az antitest lekapcsolódik a komplexről, de a terminális komplement komponens aktiválódik a sejthártyán, hemolízist okoz. Ld.: hemoglobinuria
heterocytotrop antitest Egy cytotrop antitest (főként az IgG osztályba tartozik), aktivitása hasonló, mint a homocytotrop antitest-é, de inkább idegen fajú sejtek iránt mutat affinitást és nem a saját, vagy szoros rokonságú faj sejtjei iránt.
homocytotrop antitest IgE osztályba sorolható antitest, amely saját sejtjei (főleg hízósejtjei), vagy közeli rokon faj sejtjei iránt mutat affinitást. Kötődve a specifikus sejtfelülethez, majd a vele kapcsolódó antigénhez, a sejtből az anaphylaxia kialakulásáért felelős mediátorok kiáramlását váltja ki.
inkomplett antitest 1. Szinonima: univalens antitest 2. Szinonima: szérum agglutinin
monoclonalis antitest Egy klón, illetve hibrid sejtek genetikailag homogén sejtpopulációja, azaz hibridoma által termelt antitest. A hibrid sejteket sejtvonallá tenyésztik, amelyek kémiailag és immunológiailag homogén antitestet produkálnak, amely valamely antigén ellen specifikusan hat. Ma az immunológiai kutatásnak és az orvosi diagnosztikának fő vonalát képezik.
természetes antitest Különböző személyek, illetve állatok szérumában jelenlévő olyan antitest, amelynek termelődésében nem specifikus antigénnel történt találkozás játszott szerepet, vagyis kimutatható antigén-inger nélkül képződik.
neutralizáló antitest Olyan antitest, amely fertőző kórokozóval reagálva (általában vírussal) elpusztítja azt, vagy gátolja a fertőzőképességét, virulenciáját.
univalens antitest Inkomplett antitest, amely ugyan lefedi az antigént, de a "rács-elmélet" szerint nincsen második receptora, hogy újabb antigénnel is kapcsolódhasson. Például az Rh+ vörösvérsejtek esetén az anti-Rh antitest kapcsolódhat a sejtekhez, de nem képes ezeket agglutinálni sóoldatban. Az agglutináció viszont azonnal megjelenik, mihelyt az antitesttel fedett sejteket átvisszük valamilyen proteint tartalmazó (pl. albumin) oldatba, ezért is szérum agglutininnek nevezzük. Szinonima: inkomplett antitest
antithermicus
szinonima: antipyreticus (anti + gör: thermé, hő)
antithrombin III
Olyan hatóanyag, mely a thrombin hatását, és ez által a véralvadást gátolja.
antithrombin III deficientia
Gyakori, örökletes (autoszomális domináns) véralvadási zavar. Az antithrombin III. hiánya a IIa, IXa, and Xa alvadási faktorok fokozott aktivációjához, és így recurrens thrombosisok kialakulásához vezet.
antitoxikus
valamely méreg hatását semlegesítő, antitoxinnal kapcsolatos
antitoxin
Olyan antitest, amelyet antigén jellegű méreg ellen termel a szervezet. Ez alapvetően biológiai toxikus anyag, mint a bakteriális exotoxinok, phytotoxinok és zootoxinok. Általában az antitoxin-okat emberből, vagy állatokból (rendszerint lovakból) nyerik, akiket, amelyeket a megfelelő toxinnal, illetve specifikus toxoiddal előkezeltek. Az antitoxin neutralizálja a specifikus toxin hatását. (anti + toxicon, méreg)
antitragus
A fül porcának vetülete a helix farkának elején, éppen a lobulus fölött és a tragus mögött, amelytől elválasztja az intertragalis bevágás. (gör: tragos, kecske)
antitreponemalis
szinonima: treponemicidalis
antitripszin
Olyan humán szérumban megtalálható glikoprotein, amely a tripszin hatását képes felfüggeszteni.
antitripszin deficientia
Az antitripszin hiánya autoszomális domináns öröklésmenetet mutató kórkép formájában jelentkezik; emphysema, ill. májcirrhosis kialakulásához vezet.
antitropicus
Hasonló, kétoldali szimmetrikus, de ellentétes oldalon lévő (miként a tükörképen); pl. a jobb hüvelykujj, szemben a bal hüvelykujjal.
antitussivum
köhögéscsillapító gyógyszer (pl. kodein) (anti + lat: tussis, köhögés)
antiviralis
1. vírusellenes 2. Olyan szer, amely gátolja a vírusok szaporodását, gyengíti, akadályozza hatásukat.
antivitamin
Olyan anyag, amely gátolja, hogy valamely vitamin kifejthesse a hatását. A legtöbb antivitamin hasonló vegyi szerkezetű, mint maga a hatásos vitamin és kompetitív antagonizmus által fejti ki hatását.
antra
antrum plurális alakja
antralis
antrummal kapcsolatos
antrectomia
1. antrum falának eltávolítása 2. az antrum (gyomor distalis szakaszának) eltávolítása (antrum + gör: ektomé, kimetszés)
antro-
antrum- (gör: antron, barlang)
antroduodenectomia
az antrum és a duodenum fekélyt tartalmazó részének műtéti eltávolítása
antronasalis
sinus maxillarisszal és a hozzá tartozó orrüregi területtel kapcsolatos
antropo-
ember(i)- (gör: anthropos, emberi lény)
antropocentrikus
Meggyőződés, mely szerint az ember a világegyetem központi tényezője. (anthropos + gör: kentron, központ)
antropoid
1. struktúráját és alakját tekintve emberre emlékeztető 2. emberszabású (majmok)
antropológia
Az a tudományág, amely az ember eredetével és fejlődésével foglalkozik, mind fizikai, mind szellemi, mind szociális vonatkozásában. (anthropo- + gör: logos, tanulmány)
antropometria
Az antropológia egyik ága, amely az emberi test összehasonlító mérésével foglalkozik. (anthropo + gör: metron, mérés)
antropometrikus
antropometriára vonatkozó
antropomorfizmus
Az ember alakját és minőségét a nem humán lényekkel összehasonlítva leíró tudományág. (anthropo + gör: morphé, alak)
antropophobia
interpersonalis, emberek között fennálló fóbia, másként szociális fóbia, patológiás félelem az emberektől, közösségtől
antroscop
Olyan optikai eszköz, amely bármilyen üreg megtekintésére alkalmas, különösen a Highmore-üreg antrumának vizsgálatára. (antro + gör: skopeo, megtekint)
antroscopia
bármilyen üreg (de főleg a Highmore üreg) megtekintése antroscoppal
antrostomia
antrumon állandó nyílás kiképzése (antro + gör: stoma, szájadék)
antrotomia
antrum falába történő műtéti bemetszés (antro + gör: tomé, bemetsz)
antrotympanicus
a mastoid antrummal és a tympanicus üreggel kapcsolatos
antrum
(gen. antri, pl. antra) közel zárt (főleg csontos falú) üreg Szinonima: antrum pylori (lat: antron, barlang)
Találatok Magyarázat
mastoid antrum Az os temporale processus petrosusában lévő üreg, mely hátrafelé a mastoid sejtekkel közlekedik, előre pedig az epitympanicus recessussal, vagyis a középfüllel.
antrum pylori A pylorus területének kezdeti, bejárati szakasza, amelyet időlegesen a perisztaltikus kontrakció ("praepyloricus sphincter") teljesen el tud zárni a gyomor többi területétől. A valódi pylorus csatornától időnként egy mélyedés választja el. Szinonima: antrum
anularis
gyűrű alakú (lat: anulus, gyűrű)
anuloplastica
nem záródó szívbillentyű-gyűrű műtéti rekonstrukciója (lat: anulus, gyűrű + gör: plastos, alakít)
anulorrhaphia
hernia gyűrű zárása suturával (lat: anulus, gyűrű + gör: rhaphé, varrás)
anulus
(pl. anuli) gyűrű, latin eredetű szó
Találatok Magyarázat
anulus abdominalis mély inguinalis gyűrű
anulus inguinalis profundus mély inguinalis gyűrű
anulus inguinalis superficialis felszínes inguinalis gyűrű
anulus umbilicalis köldökgyűrű
anuria
vizeletképződés hiánya
anus
(gen. ani, pl. ani) végbélnyílás (lat.)
Találatok Magyarázat
anus imperforatus végbélnyílás elzártsága fejlődési rendellenesség következtében; szinonima: analis atresia
anus praeternaturalis műtét során készített mesterséges végbélnyílás
anxietas
1. félelem és szorongás érzése, amelyet nyugtalanság, feszültség, tachycardia és dyspnoe kísér, de mindezt nem meghatározható, vagy a szorongás mértékével nem arányos nagyságú inger váltja ki. 2. Kísérletes pszichológia: Törekvés vagy motivált állapot, amelyet előzetes tanulás után neutrális történés is képes kiváltani. (lat: anxietas, szorongás)
Találatok Magyarázat
szeparációs anxietas Egy gyerek félelme, rettegése szülei, vagy számára jelentős más személy elvesztésétől.
anxiolyticum
A szorongás kezelésében bevált gyógyszerek, melyek olyan adagban képesek mérsékelni a szorongást, amelynél még nem lép fel túlzott sedatio (pl. diazepam). (anxietas + gör: lysis, oldás)
anyacsillag
Szin.: monaster
anyai felsőbbrendűségi komlexus
a terápiás folyamat rovására pszichoterapeuta célja az anyai szerep eljátszása
anyasejt
az osztódás során kettő vagy több leánysejtet képező sejt Szin.: metrocyta
anyasejttelep
a másodlagos (leánysejttelep) sejttelepet képező telep, ami az előző felszínén fejlődik ki, kisebb és különbözik jellegzetességeiben az anyateleptől
anyatömlő
az anyasejtelep belső, csírarétegéből kialakuló hólyagszerű tömlő, amiből több, féregtartalmú, másodlagos leánytömlő, ritkán harmadlagos tömlők fejlődnek ki leggyakrabban a májban, de más szervet is érinthet. Tünetei az érintett területen kialakuló daganatnak megfelelően alakulnak ki
aorta
(gen., pl. aortae) Főütőér, a szisztémás artériás rendszer főtörzse. A bal kamrából indul ki, a lumbalis csigolyáknál végződik, ahol is a jobb és bal arteria iliaca communisra oszlik. Az aorta részei: aorta ascendens (felszálló szár), arcus aortae (aorta ív) és aorta descendens (leszálló szár). Az aorta descendensnek a felső része az aorta thoracalis, a hasi része az aorta abdominalis. (gör: aeiró, felemelkedik)
aorta dissectio
Az aorta tunica mediájának szétválásával jellemezhető patológiás folyamat, mely aneurysma dissecans kialakulásához vezet. A lokalizációnak megfelelően több típusa ismert: I. típus - aorta ascendens, arcus aortae, és distalis aorta; II. típus - ascendendáló aorta; III. csoport - aorta descendens érintett.
aortalgia
Fájdalom, amelynek kiindulása az aortából feltételezhető, így lehet aorta aneurysmából, vagy más patológiás állapotból. (aorta + gör: algos, fájdalom)
aortectasia
aorta tágulata (aorta + gör: ektasis, nyúlás)
aortitis
aorta gyulladása
aortográfia
1. Az aorta és ágainak rtg-képe kontrasztanyagot tartalmazó injekcióval készítve. 2. Az aortának ultrahanggal, vagy mágneses rezonanciával készített képe. (aorta + gör: grapho, írni)
aortogram
aortográfia révén készített kép, vagy képsorozat
aortopathia
aortára terjedő betegség (aorta + gör: pathos, szenvedés)
aortoplastica
sebészi eljárás az aorta helyreállítására
aortorrhaphia
aortán végzett sutura (aorta + rhaphé, varrás)
aortosclerosis
aorta arteriosclerosisa
aortotomia
aortán történő műtéti bemetszés (aorta + gör: tomé, metszeni)
aparalyticus
bénulásmentes, bénulást nem okozó
apatheticus
apathiát mutató, indifferens
apathia
Közömbösség, a környezet iránti érdektelenség; gyakran első jele agyi betegségeknek. (gör: a-, fosztóképző + patheia, szenvedés)
apathismus
reakció lomhasága
apellosus
1. bőr nélküli 2. előbőr nélküli, körülmetélt (gör: a-, fosztóképző + lat: pellis, bőr)
aperiodicus
nem mutat periodicitást
aperistalsis
perisztaltika hiánya
apertognathia
Nyílt harapási deformitás; olyan malocclusio, amelyet időelőtti posterior occlusio és az anterior occlusio hiánya jellemez. (lat: apertus, nyitott + gör: gnathos, állkapocs)
apertura
(pl. aperturae) nyílás; szinonima: aditus (lat: aperio pp. apertus nyitni)
Találatok Magyarázat
apertura pelvis inferior medence alsó nyílása
apertura pelvis superior medence felső nyílása
apex
(gen. apicis; pl. apices) kúp, vagy piramis alakú struktúra csúcsa (lat: csúcsa valaminek)
Találatok Magyarázat
apex cordis szívcsúcs
apex pulmonis tüdőcsúcs
apexcardiográfia
A szív pulzálásának non-invazív leképzése az apex területén, amely gyakorlatilag a bal kamara csúcsát jelzi, és a kamrai nyomásgörbéhez hasonló ábrát képez.
apexificatio
A foggyökér kialakulásának indukálása, vagy a foggyökér csúcsának zárása kemény szöveti lerakódással.
aphagia
étkezésre való képtelenség (gör: a-, fosztóképző + phago, enni)
aphakia
szemlencse hiánya (gör: a-, fosztóképző + phakos, lencse)
aphalangia
Valamely ujj congenitalis hiánya; pontosabban egy, vagy több hosszú csont hiánya egy kéz-, vagy lábujjból.
aphasia
A domináns hemisphaerium sérülése következtében a beszéd, a kommunikáció, valamint az írás megértése és kivitelezése zavart szenved. Szinonima: alogia, dysphasia, dysphrasia, logagnosia, logamnesia, logasthenia (gör: beszédképtelenség)
Találatok Magyarázat
amnesticus aphasia szinonima: nominalis aphasia
anomiás aphasia szinonima: nominalis aphasia
asszociatív aphasia szinonima: vezetéses aphasia
ataxiás aphasia szinonima: motoros aphasia
auditoros aphasia A nyelv és beszéd hallásának, hallás általi megértésének hiánya jellemzi, beleértve a diktálás megértésének képtelenségét is, noha a beteg hallása rendben van. Spontán beszéd, olvasás és írás nem érintett.
Broca-féle aphasia szinonima: motoros aphasia
vezetéses aphasia Olyan aphasia, amelyben a beteg megérti a kimondott, vagy a leírt szót, tudatában van saját betegségének, tud beszélni is és írni is, azonban kihagy szavakat, vagy éppenséggel ismétli ezeket, gyakran a kifejezéseket egy másikkal helyettesíti (paraphasia). A szóismétlés képessége rendkívül megromlott. A felelős elváltozást a különböző nyelvi centrumokat összekapcsoló traktusok károsodásában kell keresnünk. Szinonima: asszociatív aphasia
expresszív aphasia szinonima: motoros aphasia
globalis aphasia Olyan típusú aphasia, amelyben a beszéd és kommunikáció minden formája súlyosan károsodott. Legjobb esetben a beteg néhány szót, vagy frázist ki tud fejezni, és meg képes érteni, de valójában sem írni, sem olvasni nem képes. Szinonima: kevert aphasia, totalis aphasia
impresszív aphasia szinonima: sensoros aphasia
zsargon aphasia szinonima: agrammatismus
kevert aphasia szinonima: globalis aphasia
motoros aphasia Olyan aphasia, amelyben a beszédkészségben, a szóformázásban észlelhető a károsodás, gyakran az egyéb módon (pl. írással, jelekkel) történő kommunikáció is kóros. A beteg tudatában van betegségének. Szinonima: ataxiás aphasia, Broca-féle aphasia, expresszív aphasia
nominalis aphasia Ezen formában az alapvető nehézség az emberek, a tárgyak megnevezése, ilyen esetben a nyelvi area különböző részein lehet az elváltozás. Szinonima: amnesticus aphasia, anomia, anomiás aphasia
receptiv aphasia szinonima: sensoros aphasia
sensoros aphasia A kimondott és leírt szavak megértésében jelentkezik a nehézség, amellyel erőtlen, artikulált, de paraphrasiás beszéd és írás társul. A szavak rosszul formáltak, helyettesítő szavak és neologismus a jellemző a beszédre. Ha súlyos formát ölt és a beszéd érthetetlenné válik, zsargon aphasia-ának is nevezik. A beteg gyakran nem is veszi észre állapotát. Szinonima: impresszív aphasia, receptiv aphasia
totalis aphasia szinonima: globalis aphasia
vizuális aphasia 1. szinonima: alexia 2. helytelenül használt szinonimaként az anomiára
aphasiás
aphasiával kapcsolatos, aphasiában szenvedő
aphasiologia
Az agy nyelvi területeinek elváltozása miatt kialakuló beszédzavarokkal foglalkozó tudományág.
aphemia
Elavult kifejezés a motoros aphasia azon alakjára, amelyben a beteg szóban nem képes gondolatokat visszaadni. (a-, fosztóképző + gör: phémé, hang)
apheresis
Bizonyos folyadékok, sejtes elemek kivonása a levett vérből, majd a vér visszajuttatása a donorba, vagy betegbe. Terápiás célból azért végzik, hogy a vérből veszélyes alkotórészeket eltávolítsanak, és azért is, hogy immunglobulint szerezzenek. (gör: aphairesis, kivonás)
aphonia
a hang elvesztése a larynx betegsége, vagy sérülése következtében (a-, fosztóképző + phoné, hang)
aphoniás
aphoniával kapcsolatos
aphrasia
beszédképtelenség, bármi is legyen az oka (gör: a-, fosztóképző + phrasis, beszélni)
aphrodisiacum
1. szexuális vágy növelése 2. Bármilyen hatóanyag, amely a nemi vágyat növeli.
aphtha
(pl. aphthae) 1. Egyes számban használva a nyálkahártyán lévő kis fekélyt jelenti. 2. Többes számban olyan stomatitis, amelyet fájdalmas szájfekélyek tünetei jellemeznek; etiológiája rendszerint ismeretlen. Felületükön szürkés exsudatum észlelhető, amelyet erythaemás udvar vesz körül, és egy-két hét alatt spontán gyógyul. Szinonima: aphthosus stomatitis, recurrens aphthosus fekély, ulcerativ stomatitis (gör: fekélyesedés)
Találatok Magyarázat
Bednar-féle aphtha Traumás fekélyek, amelyek a palatum közepén húzódó raphe két oldalán találhatók csecsemőkön.
herpetiformis aphtha Az oralis aphtha egyik variánsa, etiológiája ismeretlen, akár tucatszám mutatkozó fekélyek, átmérőjük 2-3 mm, csoportosan herpetiformis elrendeződésben mutatkoznak.
aphtha major Az aphtha súlyos alakja, amelyet szokatlanul sok, és nagy, mély és ismétlődő fekély jellemez. A gyógyulás akár 6 hetet is igénybe vehet, és hegesedéssel történik. Szinonima: Mikulicz aphtha, periadenitis mucosa necrotica recurrens.
Mikulicz aphtha szinonima: aphtha major
aphtha minor szinonima: aphtha
aphthoid
aphthára emlékeztető
aphthosis
Bármely állapot, amelyet aphtha jelenléte jellemez.
aphthosus
aphtára jellemző, vagy aphthosisra emlékeztető
apicalis
1. piramisszerű, vagy pontszerű struktúra hegyével kapcsolatos 2. egy struktúra apexéhez közeli, basalissal ellentétes
apicectomia
1. Az os temporaléban a processus petrosus levegőt tartalmazó sejtjeinek megnyitása és exenteratioja. 2. fogászati sebészetben elavult kifejezés az apicoectomiára (lat: apex, csúcs + gör: ektomé, kimetszés)
apices
apex plurálisa
apicitis
egy szervben, vagy struktúrában az apex gyulladása
apico-
apexre utaló előtag szóösszetételekben, csúcs, apicalis
apicoectomia
foggyökér műtéti eltávolítása; szinonima: gyökér-resectio (apico + gör: ektomé, kimetszés)
apicolysis
A tüdő csúcsának műtéti leválasztása a parietalis pleura összenövésről, mely következtében a tüdőcsúcsban lévő caverna collapsusa, gyógyulása jön létre. (apico + gör: lysis, feloldás)
apicotomia
apicalis struktúrába történő bemetszés (apico + gör: tomé, vágás)
apituitarismus
agyalapi mirigy működésének kiesésével járó kórkép
aplanaticus
aplanatismussal kapcsolatos, aplanaticus lencse (aberratio sphaerica lencsehibát korrigáló)
aplasia
1. valamely szerv, vagy szövet congenitalis fejlődési hiánya 2. A hematológiában: nem teljes, nem megfelelő kialakulása, vagy kiesése valamely regeneratív folyamatnak. (gör: a-, fosztóképző + plasis, képződés)
aplasticus
aplasiával jellemezhető, illetve defektív regenerációval mutatkozó (pl. anaemia)
apneumatosis
congenitalis pulmonalis atelectasis elavult megfelelője (gör: a-, fosztóképző + pneumato, gyulladás + -osis, állapot)
apneumia
tüdők congenitalis hiánya (gör: a-, fosztóképző + pneumon, tüdő)
apneusis
Kóros légzés, amelyre jellemző a teljes belégzés idején kialakuló légzési szünet. Az agytörzs középső, vagy caudalis híd szintjének elváltozása okozza. (gör: a-, fosztóképző + pneusis, légzés)
apnoe
a légzés átmeneti kimaradása (gör: apnoia, lélegezni akar)
Találatok Magyarázat
centralis apnoe A nyúltvelő depressziója, amelynek következtében a légzőmozgások gátlás alá kerülnek.
obstructiv apnoe, peripherialis apnoe A légutak elzáródása okozza az apnoét, vagy a légzési izmok működése elégtelen.
sleep apnoe Az alvás idején centrális, vagy perifériás ok miatti kialakuló apnoe, amely ismételten felébreszti a beteget, gyakori a napközbeni álmosság.
apnoés
apnoéra vonatkozó, vagy apnoéban szenvedő
apo-
Megváltoztatja a csatlakozó szó jelentését; szeparált alak, vagy származott alak.
apochromaticus lencse
Összetett lencse, mely mind a sphaericus, mind a chromaticus aberratiot korrigálja.
apocleisis
étellel szembeni aversio (gör: apo-, el- + kleisis, zárás]
apodalis
apodiával kapcsolatos
apodia
láb congenitalis hiánya (gör: a-, fosztóképző + pous, láb)
apoenzim
Egy enzim protein része, szembeállítva az enzim nem fehérje tartalmú részével (pl. koenzim, vagy prostheticus csoport).
apoferritin
A bélfalban lévő protein, amely a ferri-hidroxidfoszfáttal ferritinné kapcsolódik össze, amely a vasfelszívódás első stádiumát jelenti.
apokrin
Olyan mirigyszekréciót jelez, amelyben a mirigysejt apicalis része leválik, és a szekrétum részét képezi. (gör: apokrino, elkülönít)
apolaris
1. Pólusok nélküli; speciálisan neuroblastok, melyek még nem rendelkeznek idegnyúlványokkal. 2. Szinonima: hidrofób
apolipoprotein
A lipoprotein komplex protein komponense, normális része a chylomicronnak, a HDL-nek, az LDL-nek és a VLDL-nek emberi vérplazmában.
aponeurectomia
aponeurosis kivágása (aponeurosis + gör: ektomé, vágás)
aponeurorrhaphia
szinonima: fasciorrhaphia (aponeurosis + gör: rhaphé, varrat)
aponeurosis
(pl. aponeuroses) Fibrosus hüvely, vagy széles ín, amely az izomrostok tapadását szolgálja, a lapos izmok esetén ezek ebből erednek. Gyakran más izmok, vagy fascia segédtapadását szolgálja. (gör: apo-, valamiből + neuron, izom)
Találatok Magyarázat
epicranialis aponeurosis Aponeurosis, vagy közti ín, amely összeköti a frontalis és az occipitalis izmokat, és együttesen alakítják ki az epicraniumot. Szinonima: galea
aponeurositis
aponeurosis gyulladása
aponeuroticus
aponeurosisra vonatkozó
aponeurotomia
aponeurosisba történő bemetszés
apophysis
(pl. apophyses) Kinövés vagy kinyúlás, főként csontból. Csontos kinövés, amelynek nincsen önálló ossificatiós centruma. (gör: kinövés)
apophysitis
apophysis gyulladása
apoplasmia
vérplazma mennyiségének csökkenése
apoplecticus
apoplexiával kapcsolatos, apoplexiában szenvedő, vagy apoplexiára hajlamos
apoplexia
Klasszikus, de elavult kifejezés olyan belső szervi károsodásra, mely rendszerint hirtelen fellépő belső vérzés következtében alakul ki. (gör.)
Találatok Magyarázat
adrenalis apoplexia mellékvese vérzés
apoplexia cerebri agyvérzés
apoprotein
Polipeptid, vagy protein lánc, amely még nem kapcsolódott össze a prostheticus csoportjával, mert csak azzal együtt alkotja az aktív holoproteint.
apoptosis
Programozott sejthalál következtében egyes elszórtan elhelyezkedő sejtek pusztulása membránhoz kötött fragmentumokra történő szétesés formájában, amelyeket később más sejtek kebelezik be phagocytosis útján. (gör: apo, szét + ptosis, esés)
aporepresszor
szinonima: inaktív represszor
apostaxis
enyhe fokú vérzés, csepegő vérzés (gör: lefelé szivárog)
aposthia
praeputium congenitalis hiánya (gör: a-, fosztóképző + posthé, előbőr)
aposzóma
Citoplazmatikus zárvány, melyet maga a sejt állít elő. (gör: apo- + soma, test)
appalaesthesia
szinonima: pallanaesthesia (gör: a-, fosztóképző + pallo, remegni + aisthesis, érzés)
apparatus
1. speciális célokra alkalmas szerkezetek összessége 2. Olyan szerkezet, amelynek több része is van. 3. Mirigyek, vezetékek, erek, izmok vagy más anatómiai struktúrák csoportja, amely összességében valamely funkciót képes teljesíteni. (lat: szerkezet)
Találatok Magyarázat
Golgi-apparatus Ciszternák és hólyagocskák membránnal körülvett rendszere, amely a mag és a sejt szekretoros pólusa között helyezkedik el. A membránhoz kötött szekretoros proteinek feldolgozásához és intracellularis transzportjához kapcsolódik.
apparatus lacrimalis A könnymirigyből (glandula lacrimalis), a könnytóból (lacus lacrimalis), a könnyvezetékből (ductus lacrimalis), a könnyzacskóból (saccus lacrimalis) és a nasolacrimalis csatornából (ductus nasolacrimalis) áll.
appendectomia
appendix vermiformis (féregnyúlvány) műtéti eltávolítása; szinonima: appendicectomia (appendix + gör: ektomé, kimetszés)
appendicectomia
szinonima: appendectomia
appendicitis
féregnyúlvány gyulladás (appendix + gör: -itis, gyulladás)
appendico-
appendix, általában az appendix vermiformis
appendicocele
Az appendix vermiformis található a herniazsákban. (appendico- + gör: cele, sérv)
appendicolith
Calcifikálódott kő az appendixben, amely hasi röntgenvizsgálattal látható. (appendico- + gör: lithos, kő)
appendicolithiasis
kőképződés a féregnyúlványban
appendicolysis
az appendix összenövéseinek műtéti megoldása (appendico + gör: lysis, lazítás)
appendicostomia
A bél műtéti megnyitása a féregnyúlvány csúcsán, amely előzetesen a hasfalhoz kitapadt. (appendico + gör: stoma, száj)
appendicularis
1. appendix-szel kapcsolatos 2. A lábakkal kapcsolatos, szemben az axiálissal, amely kifejezés a törzzsel, a fejjel jelzi a kapcsolatot.
appendix
(gen. appendicis, pl. appendices) 1. Szinonima: függelék 2. specifikusan a féregnyúlvány (lat: appendo, függeni valamin)
Találatok Magyarázat
appendix epiploica (pl. appendices epiploicae) A peritoneumon függő kis zacskók, amelyeket zsírszövet tölt ki, és a vastagbél serosus hártyájáról csüggnek, a rectumot kivéve. Legkifejezettebbek a colon transversumon, illetve a sigmán a szabad tenia mentén.
appendix vermiformis Féregnyúlvány, amely a coecum vak végén indul és a hossza, kiterjedése változó.
apperceptio
1. A figyelmes felfogás végső állapota, amelyben valamit teljesen megértünk, felfogunk, és ez tudatunkban relatíve kiemelkedik. A pszichés tartalom teljes felfogása. 2. Valaki a saját személyiségének ideáját felismeri. (lat: ad-, hoz + percipio, felfogni)
apperceptiv
felfogásra képes, a felfogásra vonatkozó, vagy a felfogást illető
appetitus
Az ételre vonatkozó pszichés és fizikai vágy, de átvitt értelemben alkalmazzák folyadékra, szexualitásra vagy érzelemre is. Bármilyen vágy, amely fizikális, vagy mentális igény kielégítésére irányul.
applanatio
Tonometria: a cornea lelapulása nyomás hatására. Az intraocularis nyomás egyenesen arányos a külső nyomással és fordítva a lelapulás területével. (lat: ad-, -hoz + planum, sík)
applanometria
applanatiós tonometer alkalmazása
applicator
Vékony pálcika fából, hajlított fémből, vagy műanyagból, amelynek egyik végéhez vattacsomót, vagy egyéb anyagot rögzítünk, amely bármely felületre a szükséges hatóanyagot képes felvinni. (lat: applico, odatesz)
appozíció
1. két anyagot érintkezésbe hozni 2. két dolgot összeilleszteni, összerakni 3. törvégek összeillesztése 4. sejtfal vastagítása (lat: appono, valamihez illeszt)
approximatio
Sebészet: a varrat készítésekor a szöveti végek megfelelő közelítésbe hozása.
approximatív
megközelítő (lat: ad-, -hoz + proximus, legközelebbi)
apraxia
1. Az akaratlagos mozgás zavara, amelyben a gyakorlott, célszerű mozgások kivitelezése károsodik, noha a megértés, az izomerő, az érzékelés és a koordináció általában megtartott. Ez az eltérés szerzett agyi bántalomnak a következménye. 2. Pszichomotoros defektus, amelyben valamilyen tárgy megfelelő használata nem sikerül, bár a tárgyat a beteg meg tudja nevezni és ismertetni is képes annak célszerű alkalmazását. (gör: a-, fosztóképző + pratto, csinálni)
Találatok Magyarázat
beszéd fejlődési apraxia; developmental apraxia of speech (DAS) Súlyos artikulációs zavar gyerekkorban, amelyet többszörös és nem konzisztens hibák jellemeznek a phonémák akaratlagos egymásutániságában, de ennek nincsen köze a beszédben szereplő izmok gyengeségének, vagy spasticitásának (vagyis nem dysarthria). Szinonima: gyermekkori apraxia
idiokineticus apraxia, ideomotoros apraxia Az apraxia egyik formája, amelyben egyszerű tevékenységeket sem képes a beteg kivitelezni, mivel a kérgi központok közti kapcsolat, amely az akarat és a motoros kéreg összeköttetését jelenti, kiesett.
oralis apraxia Kérgi sensoromotoros károsodás folytán csökken az a képesség, hogy az oralis izomzat akaratlagos mozgásokat teljesítsen, különösen vonatkozik ez az egymásra következő mozgásokra. Gyakran beszéd apraxia-ként mutatkozik. Szinonima: oralis motoros apraxia
oralis motoros apraxia szinonima: oralis apraxia
beszéd apraxia szinonima: verbalis apraxia
verbalis apraxia Corticalis sensomotoros károsodását követő beszédzavar. A beszédben résztvevő izmok programozásának képessége károsodott, ezért az egymásután következő phonémák akaratlagosan nem vihetők ki. Gyakran társul motoros apraxia-val. Lásd: oralis apraxia; beszédfejlődési apraxia; szinonima: beszéd apraxia, verbalis dyspraxia
apraxiás
apraxiával kapcsolatos
aproctia
anus, vagy anusnyílás congenitalis hiánya (gör: a-, fosztóképző + proktos, anus)
apronectomia
hasfal kiterjedt és lelógó panniculus adiposusának (kötényhas) sebészi eltávolítása
aprosopia
Az arc egészének, vagy nagy részének congenitalis hiánya, amely gyakran más fejlődési rendellenességgel is társul. (gör: a-, fosztóképző + prosopon, arc)
apyreticus
lázmentes, normál testhőmérsékletű; szinonima: afebrilis
apyrexia
lázmentesség (a-, fosztóképző + pyrexis, láz)
aqua
(gen. és pl. aquae) H2O; víz (lat.)
Találatok Magyarázat
aqua chlorata klóros víz
aqua communis ivóvíz
aqua destillata desztillált víz
aquaeductus
(pl. aquaeductus) vízvezeték, csatorna (lat: aqua + ductus, vezeték)
Találatok Magyarázat
aquaeductus cerebralis Ependymával bélelt csatorna a mesencephalonban, mintegy 20 mm hosszú, a harmadik és negyedik agykamrát köti össze.
aquaeductus cochleae szinonima: ductus perilymphaticus
aquaphobia
beteges félelem a víztől (lat: aqua, víz, gör: phobos, félelem)
aqueosus
vizes, víztartalmú
Találatok Magyarázat
humor aqueosus Csarnokvíz; folyadék, mely a szemben az elülső és a hátsó csarnokot tölti ki. A processus ciliarisokban termelődik a hátsó csarnokban, majd a pupillán keresztül az elülső csarnokba jut, ahol a trabecularis hálózaton át az iridocornealis szöglet vénás hálózatában szívódik fel.
Ar
argon
arab-
gummi arabicum, hasonló gumiszerű anyagok (gör: Araps, arab)
arabin
Szénhidrát tartalmú mézga, mely D-arabinózra és hexózokra hidrolizál; természetes formájában (gummi arabicum) kalcium, kálium és magnézium ionokat is tartalmaz.
arabinosis
az arabinóz kóros metabolizmusa
arabinosuria
arabinóz kiválasztása a vizeletben
arabinóz (Ara)
Pentóz, melynek D-isomerje növényekben rendkívül elterjedt rendszerint komplex poliszaccharidok építőköveként; táptalajokban használatos. A D-arabinóz a D-ribóz epimerje.
arabinozid
Ribonukleozid, amelyben az arabinóz a cukor építőelem; bizonyos esetekben antibiotikus aktivitással rendelkezik.
arabitol
C5H12O5; 1,2,3,4,5-pentánpentol; az arabinóz redukciója során keletkező alkohol.
arachidonsav
CH3(CH2)3(CH2CH=CH)4(CH2)3COOH; 5,8,11,14-eikozatetraénsav; telítetlen zsírsav, mely a táplálkozás szempontjából esszenciálisnak tekintendő. A prosztaglandinok, thromboxánok, és leukotriének (összefoglalóan: eikozanoidok) biológiai prekurzora.
arachnáz
Pozitív kontroll plazma, amely az alvadási tesztben az alvadási végpont meghatározását szolgálja, főleg a lupus anticoagulans jelenlétének kimutatására szolgál. Olyan normál plazma, amely a barna remete pók mérgének kivonatát tartalmazza (Loxosceles reclusa), ugyanis e méreg imitálja a lupus anticoagulans jelenlétét az alvadási végpont teszt egyikében.
Arachnida
Az arthropodák egyik osztálya a Chelicerata altörzsben, ide tartoznak a pókok, skorpiók, kaszáspókok, atkák, valamint a kullancsok. (gör: arachné, pók)
arachno-
pók-
arachnodactylia
Olyan állapot, amelyben a kézujjak, de gyakran a lábujjak is túlságosan hosszúak és vékonyak. Jellegzetes a Marfan-szindrómára és egyéb kötőszöveti örökletes betegségekre. (gör: arachné, pók + daktylos, ujj)
arachnoidea, arachnoides
Pókhálóhártya; finom, fibrosus membrán, a központi idegrendszert befedő hártyák közül a középső. A külső felszíne szorosan követi a dura matert, de nem tapad hozzá, köztük csupán egy potenciális rés található (subduralis rés). A gerinccsapolás esetén a dura és az arachnoidea együtt kerülnek átszúrásra, mintha egyetlen réteget képeznének. Ld. leptomeninges. (gör: arachné, pók + eidos, hasonló)
arachnoiditis
Az arachnoidea gyulladása, gyakran egyidejűleg a subarachnoidealis térben is gyulladás észlelhető. Ld. leptomeningitis (arachnoidea + gör: -itis, gyulladás)
arachnophobia
beteges félelem a pókoktól (gör: arachne, pók + phobos, félelem)
arbor
(pl. arbores) anat: fához hasonlító, elágazó (lat: arbor, fa)
arborescens
szinonima: dendriformis
arborizatio
1. idegrostok, vagy erek végső elágazása 2. beszáradt kenet, vagy beszáradt cervixnyák elágazó alakzata, annak jeleként, hogy az ösztrogénnel szemben nincsen megfelelő progeszteron szint.
arbovírus
Az RNS vírusok nagy, heterogén csoportja. Mintegy 500 species tartozik ide, ízeltlábúakból, denevérekből és rágcsálókból izolálták ezeket a vírusokat. Az osztályozás szempontjából különböző vírusok azon epidemiológiai elképzelés alapján kerültek közös elnevezés alá, hogy az átvitelük a gerinces gazdáról vérszívó ízeltlábú vektorra (pl. szúnyog, kullancs, muslica stb.) történik. A vírus által előidézett betegség aránylag enyhe, szemben az egyéb csoportokba sorolt vírusokéval. A fertőzéseket néhány klinikai szindrómába lehet sorolni: nem differenciálható láz (szisztémás lázas betegség), hepatitis, haemorrhagiás láz és encephalitisek (ar-, arthropodák rövidítése + -bo, born, származó + vírus)
arch-, arche-, archi-, archo-
összetételi alak, jelentése primitív, ősi, első, fő, primitív, extrém. (gör: arché, eredet, kezdet)
arche
ld: arch-
archeokineticus
Az idegi motoros mechanizmus alacsony, primitív típusa, amit a ganglionaris idegrendszerben és a perifériás idegrendszerben találunk. Vö: neokineticus, paleokineticus (gör: archaios, ősi + kinetikos, mozgással kapcsolatos)
archetípus
1. Az a primitív szerkezeti terv, amelynek több módosulata is ismeretes. 2. A Jung-féle pszichológiában a kollektív tudattalan strukturális megnyilvánulása. Szinonima: imago (gör: arche, kezdeti + typto, kipusztít)
archi-
ld: arch-
arciformis
szinonima: arcuatus, ívelt
arctatio
szűkület, összehúzódás, strictura, vagy coarctatio (lat: arto, szűkít)
arcuatio
görbület, curvatura
arcuatus
Olyan alakot jelöl, amely ívelt, görbületes.
arcus
1. Ív, görbült vonal, vagy körív. 2. Anat: bármely olyan struktúra, amely boltozatosan ívelt, vagy hajlított. (lat: arcus, ív, boltozat))
Találatok Magyarázat
arcus abdominothoracalis Haranggörbe, amely a sternum alsó részétől és mindkét oldali bordaív széltől határvonalat képez a thoracalis és abdominalis izomzat anterolateralis szakasza között.
arcus aortae 1. Aortaív; az aorta ascendens és descendens közötti ívelt szakasz. Belőle ered a truncus brachiocephalicus, majd a bal arteria carotis communis és a bal arteria subclavia. 2. Az embrionális pharynxot körülvevő néhány pár artéria bármelyike a brachialis ívek közül a mesenchymában. Potenciálisan 6 ilyen pár létezik, de emlősökben az ötödik pár vagy hiányzik, vagy gyengén fejlett. Az első két pár csak akkor működik, amikor az embrió még igen fiatal. A harmadik pár a carotisok kialakításában vesz részt. A negyedik pár bal oldala az aorta falával olvad egybe, a hatodik párból képződik a kétoldali arteria pulmonalis.
arcus cornealis Egy átlátszatlan, szürke gyűrű a cornea perifériáján a sclerocorneális találkozásnál. Gyakori lelet időseken. Zsírszerű részecskék rakódnak le, vagy hyalinos degeneratio alakul ki a cornea területén. Szinonima: gerontoxon
arcus costae Bordaív, amelyet a thorax alsó nyílása képez a hetedik-tizedik álbordák porcos része között.
arcus dentalis Bonyolult görbült struktúra a természetes fogazat és a residualis foggerinc között.
arcus dentalis inferior Alveolaris alsó fogív; a mandibula processus alveolarisán lévő fogak íve. Tartalmazhatja a 10 tejfogat, vagy a 16 állandó fogat.
arcus dentalis superior Felső fogív; a kétoldali maxilla processus alveolarisában lévő fogak íve, akár a 10 tejfogat tartalmazza, akár a 16 maradandó fogat.
arcus mandibularis első posturalis ív a branchialis ívek között.
arcus palatoglossalis Annak a nyálkahártya áthajlásnak az egyik párja, amely a lágy szájpadtól a nyelv oldaláig húzódik. Tartalmazza a musculus palatoglossust és a fossa tonsillaris elülső szélét képezi. A szájüreget elhatárolja a toroknyílás szűkületétől.
arcus palatopharyngealis Nyálkahártya redőzet két oldalt, amely a lágy szájpad hátsó részéről ereszkedik a pharynx oldalfaláig. Befedi a musculus palatopharyngeust és a fossa tonsillaris hátsó szélét képezi. Ugyancsak elhatárolja a torok szűkületet az oropharynxtól.
arcus palmaris 1. Tenyérív; arcus palmaris profundus (mély tenyérív) - artériás ív, amely a hosszú flexor inak mögött fekszik és az arteria radialis mély palmaris ágaiból, illetve azok arteria ulnarissal való összeköttetéséből adódik. 2. Arcus palmaris superficialis, a kéz felületes artériás íve, amely az inak felett helyezkedik el, lényegében az arteria ulnaris teszi ki, amelynek összeköttetése van az arteria radialis felületi ágaival.
arcus plantaris 1. Az az arterialis ív, amelyet az arteria plantaris lateralis képez az arteria dorsalis pedisszel, keresztezve a metatarsalis csontok bázisát. 2. Egyike a hosszanti és a haránt csontos lábboltozatnak.
arcus pedis lábboltozat 1. Longitudinalis lábboltozat, a láb hosszanti boltozata, mely egyrészt a medialis hosszanti boltozatból áll, amelybe beleértjük a calcaneust, a talust, az os navicularét, a három cuneiformis csontot és a három medialis metatarsust. A lateralis hosszanti boltozatot pedig a calcaneus, az os cuboideum és a két oldalsó metatarsalis csont alkotja. 2. Harántboltozat, amely a metatarsalis csontok proximalis részeiből, a három cuneiformis csontból és az os cuboideumból áll.
arcus pubis Szeméremív; a symphysis teste és a szeméremcsontok ramus inferiorjai alkotják.
arcus superciliaris Szemöldökív; a glabellától lateral felé húzódik mindkét oldalon az orbita szélén.
arcus vertebralis A csigolyatest hátsó íve, amely bezárja a foramen vertebralét.
arcus zygomaticus Az os zygomaticum processus temporalisa által képezett ív, amely az os temporale processus zygomaticusával kapcsolódik.
area
(pl. areae) 1. terület, minden körülírt felület 2. artéria, vagy ideg által ellátott terület 3. Egy szervnek speciális funkcióval rendelkező része (pl. agy motoros areája). Ld: regio, spatium (lat: udvar)
Találatok Magyarázat
asszociációs area az agykéreg társításos areája; szinonima: asszociációs cortex
auditoros area az agykéreg hallási területe; szinonima: auditoros cortex
Broca-area szinonima: Broca-féle kérgi terület
area germinativa A blastoderma azon része, ahol az embrió kialakul.
Kiesselbach-area Az orr septum kapillárisokban gazdag területe (Kiesselbach plexus), melyből gyakori az orrvérzés kiindulása.
motoros area szinonima: motoros cortex
postcentralis area szinonima: gyrus postcentralis
Rolando-area szinonima: motoros cortex
sensoromotoros area az agykéreg praecentralis és postcentralis gyrusai
trigger area szinonima: kiváltó pont
vizuális area szinonima: látókéreg
areflexia
reflexek hiánya
Arenaviridae
RNS vírus család, ide tartozik a choriomeningitis vírusa, a Lassa vírus és a Tacaribe vírus komplex. (lat: arena, homok)
Arenavirus
Az Arenaviridae család egyik genusa, ide tartozik a lymphocytás choriomeningitis és több haemorrhagiás láz vírusa.
areola
(pl. areolae) 1. kisebb area 2. areolaris szövet egyik ürege, vagy hézaga 3. pigmentált, depigmentált, vagy erythaemás terület, amely papulát, pustulát, vagy bőrdaganatot körülvesz. Szinonima: halo (lat: area kicsinyítése)
Találatok Magyarázat
areola mammae Kör alakú pigmentált terület, amely a mellbimbót övezi, illetve a papilla mammaet körülveszi. Felülete apró kiemelkedésekkel egyenetlen, amelyek mögött az areolaris mirigyek találhatók. Szinonima: mellbimbó udvara
areola umbilici pigmentált gyűrű a köldök körül terhes nőkön
areolaris
areolával kapcsolatos
argasid
Argasidae család tagjainak közös elnevezése
Argasidae
Kullancs család; a lágy kullancsok tartoznak ide, ráncos kültakarójuk, ha vérrel teleszívják magukat, kisimul. Az argasid kullancsok, különösen az Ornithodoros faj, spirochaetákat hordoznak és átviszik emberre, emlősökre és madarakra, főként a Borellia genus spirochaetáit, ezáltal visszatérő lázat okoznak.
argentaffin
Azok a sejtek, vagy szöveti elemek, amelyek oldatból az ezüst ionokat redukálni képesek, ezáltal barnára, vagy feketére színeződnek. (lat: argentum, ezüst + affinitas)
argentaffinoma
szinonima: carcinoid tumor
argentophil
szinonima: argyrophil
argentum
(gen. argenti) Ag; ezüst (lat.)
argináz
Májenzim, amely az L-argininnek L-ornitinné és ureává történő hidrolízisét katalizálja. Az urea ciklus kulcsenzime.
arginin
2-amino-5-guanidino-pentánsav. Egyike azon aminosavaknak, amelyek a proteinek hidrolízisének termékeként állnak elő, különösen bőségesen tartalmazzák a bázikus proteinek, mint a hisztonok és a protaminok. Dibázikus aminosav.
arginino-szukcinilsav
Közti termék az L-citrullin L-argininné való átalakulásában az urea ciklusban.
argininosuccinicaciduria
Autoszomális recesszív betegség, amelyre jellemző az arginino-szukcinilsav nagy mértékű vizelettel történő ürítése, epilepsia, ataxia, mentális retardáció, májbetegség és törékeny haj. Valószínűleg azon enzim hiányának a következménye, amely az arginino-szukcinilsavat argininre és fumársavra hasítja.
argon (Ar)
Nemesgáz, atomszáma 18, atomsúlya 39,948. A száraz atmoszférában mintegy 0,94%-ban található. (gör: argos, lusta, inaktív, illetve a-, fosztóképző + ergon, munka)
argyria
Agyagszürke, vagy kékes elszíneződés a bőrön, vagy a mélyebb szövetekben, amelynek oka az ezüstlerakódás oldható ezüst-sók túlzott orvosi használatának következtében. Szinonima: argyrismus (gör: argyros, ezüst)
argyricus
argyriával kapcsolatos
argyrismus
ld: argyria
argyrophil
Olyan szöveti elem, amelyet ezüst ionnal impregnálni lehet, és ha külső redukáló anyagnak tesszük ki, láthatóvá válik. Szinonima: argentophil (gör: argyros, ezüst + philos, szeret)
arhigosis
hideg hőhatás érzékelésének hiánya (gör: a-, fosztóképző + rhigo, összetöredezik)
arhinia
veleszületett orrhiány; szinonima: arrhinia
ariboflavinosis
Gyakran ezt a kifejezést használják hyporiboflavinosis helyett.
aril
Szerves gyök, amely valamely aromás vegyületből keletkezik egy hidrogénatom eltávolítását követően.
aril-szulfatáz
Enzim, amely fenol-szulfátot hasít, ide tartozik a cerebrozid-szulfát is (fenol-szulfát + H2O ==> fenol + szulfát-anion) Egyes aril-szulfatáz-ok szulfáttal gátolhatók (II. típus), míg az I. típushoz tartozó enzimek nem. Szinonima: szulfatáz
armamentarium
Minden olyan terápiás eszköz, amely az egészségügyben a hivatás gyakorlásához szükséges. (lat: arzenál)
aromaticus
1. kellemes, fűszeres, élénk illat 2. A növényi gyógyszerek egyik csoportja, amelyek illatos és enyhén stimuláns tulajdonságúak. 3. Ld: ciklusos vegyületek (gör: aromatikos, aroma, fűszer, édes növény)
arrector
(pl. arrectores) Szinonima: erector (lat: emel)
arrest
1. leállítani, ellenőrizni, visszatartani 2. Leállítás, interferencia, ellenőrzés; pl. egy betegség szabályos lefolyását, tünetet, működés végrehajtását. 3. Valamely fejlődési folyamat gátlása, általában a fejlődés végső stádiumában, mely veleszületett rendellenességet okozhat. (francia: arester, leállít)
Találatok Magyarázat
cardiac arrest (CA) Szívmegállás; a szív elektromos és mechanikus működésének leállása. Előfordul, hogy szándékosan, terápiás okból kifolyólag (pl. szívműtét miatt) végzik.
sinus arrest A sinuscsomó működésének leállása, amely következtében a kamrák folytatják összehúzódásukat ectopiás pitvari, A-V junctionális vagy idioventricularis vezérlés alatt.
arrhenoblastoma
Ritka petefészek daganat, amelynek masculinisatio a következménye; a daganat gyakran tubulusokat és luteinizált sejteket tartalmaz. Szinonima: androblastoma, gynandroblastoma (gör: arrhén, férfi + blastos, csíra + oma, daganat)
arrhinencephalia
A rhinencephalon, vagy a lobus olfactorius congenitalis, egy- vagy kétoldali hiánya, gyakran a megfelelő külső szaglószerv fejlődési zavarával társul. (gör: a-, fosztóképző + rhis (rhin-), orr + enkephalos, agy)
arrhinia
orrnélküliség; szinonima: arhinia (gör: a-, fosztóképző + rhis, orr)
arrhythmia
A ritmus elvesztése; ritmus hiánya; speciálisan a szívverés ütemének szabálytalanságát jelenti. Vö: dysrhythmia (gör: a-, fosztóképző + rhythmos, ütem)
Találatok Magyarázat
arrhythmia absoluta pulzushullámok nagyságának és időközének teljes és tartós szabálytalansága; ld. pitvarfibrillatio
sinus arrhythmia A szívverés ciklusos változása, rendszerint normálisnak tekinthető és a légzőmozgásokkal kapcsolatos.
arrhythmiás
ritmus megszűnésével kapcsolatos
arrhythmogen
arrhythmia kiváltására képes (gör: a-, fosztóképző + rhythmos, ütem + gen, produkció)
arrhythmogen dysplasia
jobb kamrai cardiomyopathia, a jobb kamra izomszövetének zsíros elfajulása
arsenicalis
1. Olyan gyógyszer, illetve hatóanyag, amelynek hatása a benne lévő arzéntól függ. 2. Jelzi, hogy az adott készítmény arzént tartalmaz.
artefaktum
műtermék 1. szövettani mintában, vagy grafikai képben a használatos technika által előidézett eltérés. 2. Bőrelváltozás, amelyet a beteg magának okoz, vagy amelynek fenntartásában szerepet játszik. (lat: ars, mesterség + facio pp factum, csinált)
Találatok Magyarázat
radiographiás artefaktum Röntgenfelvételen lévő hiba, amelyet hő, fény, sérült ernyő, por, vagy a film nem megfelelő kezelése okozott.
arteri-
ld. arterio-
arteria
(gen. és pl. arteriae) Ütőér, verőér; relatíve nagyobb falvastagságú, izmos, pulzáló ér, amely a szívből a szövetek felé viszi a vért. Az arteria pulmonalis és az arteria umbilicalis kivételével az artériák piros, vagy oxigenizált vért szállítanak. Az egyes arteriákat részletesen ld. a Függelékben. (gör: arteria, légcső)
Találatok Magyarázat
collateralis arteria 1. Azt az arteria-t nevezik így, amelyik egy ideggel, vagy más struktúrával párhuzamosan fut. 2. Az az arteria, amellyel mellékágakon keresztül kapcsolat létesült.
arteria communicans Az az összekötő ág, amely révén két artéria összekapcsolódik.
arteria nutricia Különböző eredésű artériák, amelyek a csöves csontok velőüregét látják el. Szinonima: tápláló erek
arteria terminalis szinonima: végarteria
végarteria Olyan artéria, amelynek elégtelenek az anastomosisai, vagyis elzáródása esetén az általa ellátott szöveteket más ér nem képes vérrel ellátni. Szinonima: arteria terminalis
arteria cerebri media
az artéria carotis interna végső nagy ága, oldal felé megkerüli a halántéklebeny pólusát, majd hátulról a fissura cerebralis lateralis mélyén halad. három részre osztják: 1. sphenoidalis rész: (M1) perforáló ágai ellátják a capsula interna, thalamus, és striatum területét 2. insularis rész:ágai ellátják az insula és a szomszédos agykéreg területeket 3. corticalis vagy terminalis rész (utóbbi kettő együttesen M2): középső agykéreg terület nagy részét ellátó ágak
arteria colica media
az artéria mesenterica superiorból eredő, a haránt vastagbél területét ellátó, és a bal, illetve jobb oldali artéria colica-val anastomosist alkotó ér
arteria collateralis media
az artéria profunda brachii hátulsó végága, amia a többi artériával együtt a könyök ízület körüli érhálózat alkotásában vesz részt
arteria genus media
az artéria poplitealisból eredő, és térdízület tokját és a keresztszalagokat ellátó artéria Szin.: artéria articularis azygos
arteria meningea media
eredés: artéria maxillaris, ágai: ramus petrosa, tympani superior, frontalis és parietalis és a végső ágai az elülső ás középső koponyagödört látják el, anastomosis: összeköttetésben van az artéria occipitalis meningealis ágaival, a felszálló pharyngealis, ophtalmicus és lacrimalis, stylomastoidea, valamint a maxilllaris járulékos meningealis és mély temporalis ágaival
arteria rectalis media
az artéria ilaca-ból eredő, a végbél középső részét ellátó artéria, az alsó és felső rectalis artériával anastomosist alkot. Mivel a portalis érrendszer határa, ezért portoszisztémás, illetve portocavalis anastomosis is egyben
arteria sacralis mediana
a hasi aorta bifurcatio feletti szakaszából ered, az alsó ágyéki csigolyákat, keresztcsontot és farokcsontot látja el, összeköttetésben van a sacralis lateralis, rectalis superior és medius artériával
arteria suprarenalis media
az aortából eredő, mellékveséket ellátó artéria
arteria temporalis media
az artéria temporalis superficialisból eredő, és a musculus temporalist és fasciát ellátó artéria, összeköttetésben áll az artéria maxillaris ágaival
arterialis
egy, vagy több artériával kapcsolatos, vagy az artériás rendszerre vonatkozó
arteriectomia
artériának, vagy egy artéria résznek a kimetszése (arteria + gör: ektomé, kimetszés)
arterio-, arteri-
artériára utaló előtag szóösszetételekben (gör: arteria, légcső)
arteriocapillaris
mind az artériával, mind a kapillárisokkal kapcsolatos
arteriográfia
Az artériák láthatóvá tétele röntgennel történő felvétel készítésével, miután az artériába sugárfogó anyagot fecskendeztek be. (arterio + grapho, írni)
Találatok Magyarázat
bronchialis arteriográfia A bronchialis artériák szelektív ábrázolása az intercostalis artériába adott kontrasztanyag befecskendezésével.
arteriográfiás
arteriográfiával kapcsolatos
arteriogram
Egy artéria radiográfiás kimutatása kontrasztanyagot tartalmazó injekció után. (arterio + gör: gramma, valamit leírni)
arteriola
(pl. arteriolae) Kis verőér, amelynek a tunica mediájában mindössze egy, vagy két rétegben található simaizomsejt. Végarteria, amely a kapilláris hálózatban folytatódik. (lat: arteria kicsinyítése)
Találatok Magyarázat
afferens gromelularis arteriola A vese interlobularis arteriáinak kötege, amely a vért a glomerulusokba szállítja. Szinonima: vas afferens
efferens glomerularis arteriola Ez az ér a glomerularis kapilláris hálózatból a proximalis kanyarulatos csatornák ellátására szállítja a vért. Szinonima: vas efferens
arteriola macularis inferior Az arteria centralis retinae-ből ered, és a macula alsó részét látja el.
arteriola macularis superior Az arteria centralis retinae-ből ered, és a macula felső részét látja el.
arteriolaris
arteriolára vonatkozó, vagy az arteriolák összessége
arteriolith
kalciumtartalmú lerakódás az artéria falában, vagy a benne lévő thrombusban
arteriolitis
arteriolák falának gyulladása (lat: arteriola, kis arteria + gör: itis, gyulladás)
Találatok Magyarázat
necrotizáló arteriolitis Az arteriolák falának tunica mediájában necrosis lép fel; jellemző a malignus hypertensiora. Szinonima: arteriolonecrosis
arteriolo-
arteriolákra vonatkozó
arteriolonecrosis
szinonima: necrotizáló arteriolitis (lat: arteriola + gör: nekrosis, pusztulás)
arteriolonephrosclerosis
szinonima: arteriolaris nephrosclerosis
arteriolosclerosis
Olyan arteriosclerosis, amely különösen az arteriolákat érinti. Főleg hypertensióban fordul elő.
arterionephrosclerosis
szinonima: arterialis nephrosclerosis
arteriopathia
artériák bármely betegsége (arterio + gör: pathos, szenvedés)
Találatok Magyarázat
hypertensiv arteriopathia hypertensio okozta artériás degeneráció
arterioplastica
mindenféle műtét az artéria falának rekonstrukciója végett (arterio + gör: plastos, alakított)
arteriopressor
Olyan hatás, amely az artériákban fokozott nyomást okoz.
arteriorrhaphia
sutura végzése egy arterián
arteriorrhexis
artéria rupturája, szakadása (arterio + gör: rhexis, szakadás)
arteriosclerosis
Az artériák falának megkeményedése, mely típusai szerint lehet atherosclerosis, Mönckeberg-féle atherosclerosis és arteriolosclerosis. (arteri- + gör: sklérosis, keményedés)
Találatok Magyarázat
hypertensiv arteriosclerosis Az artéria falában az izom és az elasztikus szövetek progresszív szaporodása, amelynek kiváltója a hypertensio. Hosszan fennálló magasvérnyomás betegség esetén az elasztikus rostok koncentrikus rétegeket alkotnak az intimában, az izmokat kollagén rostok váltják fel, valamint a lerakodó hyalin megvastagítja az arteriolák intimáját. Hasonló elváltozások a korral is együtt járhatnak hypertensio nélkül is, és ekkor senilis arteriosclerosisnak nevezzük.
arteriosclerosis obliterans Az arteriosclerosis az artériák lumenének szűkületét, illetve elzáródását okozza.
senilis arteriosclerosis A hypertensiv arteriosclerosis-hoz hasonló folyamat, de nem magasvérnyomás betegség okozza, hanem az előrehaladott korral jár együtt.
arterioscleroticus
arteriosclerosissal kapcsolatos
arteriospasmus
valamely artéria, vagy artériák görcsös összehúzódása
arteriostenosis
Valamely artéria szűkülete, amely lehet időleges, ha érspasmus okozza, de ha arteriosclerosis váltja ki, akkor végleges.
arteriotomia
Az artérián ejtett sebészi bemetszés, így pl. embolus eltávolítása céljából.
arteriovenosus (A-V)
Mind az artériával, mind a vénával kapcsolatban álló, pl. arteriovenosus anastomosis.
arteritis
artéria gyulladása (arteria + gör: -itis, gyulladás)
Találatok Magyarázat
brachiocephalicus arteritis Óriássejtes arteritis, amely idős betegeken mutatkozik. A középnagy artériák gyulladása, leggyakrabban a fejen, nyakon, és a vállöv tájon jelentkezik. A vörösvérsejt süllyedés gyorsult.
arteritis obliterans szinonima: endarteritis obliterans
rheumaticus arteritis A rheumás lázzal kapcsolatos arteritis. A kis artériák adventitiájában, főleg a myocardiumban, Aschoff-csomók láthatók, és a lumen szűkületét, fibrosist idéznek elő.
Takayasu-arteritis Progresszív obliteráló arteritis, eredetét nem ismerjük, következményes fibrosis, lumen szűkület jellemzi. Az aortát és a fő ágait érinti. Gyakrabban fordul elő nőkön. Szinonima: pulseless disease
arteritis temporalis Szubakut granulomatosus arteritis, amelyben részt vesz az arteria carotis externa, ill. ennek temporalis ága. Idős betegeken észlelik, és konstitucionális tünetek is kísérik: súlyos fejfájás, hirtelen fellépő egyoldali vakság. Gyakran a panaszok megfelelnek a polymyalgia rheumatica tüneteinek. Szinonima: óriássejtes arteritis
arthr-
ld: arthro-
arthralgia
ízületi fájdalom, főként nem gyulladásos eredetű; szinonima: arthrodynia (gör: arthron, ízület + algos, fájdalom)
Találatok Magyarázat
polyarthralgia több ízületet érintő fájdalom
arthralgiás
arthralgiával kapcsolatos, vagy abban szenvedő
arthrectomia
ízület műtéti eltávolítása (gör: arthron, ízület + ektomé, kivágás)
arthritis
(pl. arthritides) ízületi gyulladás (gör: arthron, ízület + itis, gyulladás)
Találatok Magyarázat
atrophiás arthritis Elavult kifejezés olyan arthritis jellemzésére, amelyben nincsen új csontképződés. Ma általában rheumatoid arthritis-nek nevezzük.
arthritis deformans szinonima: rheumatoid arthritis
arthritis gonococcica arthritis Az ízületi üreg fertőződése Neisseria gonorrhoeae-vel. Jellegzetesen monoarticularis, de előfordulhat polyarticularis formája is.
hypertrophiás arthritis szinonima: osteoarthritis (arthrosis)
arthritis juvenile Gyerekkorban kezdődő krónikus arthritis, az esetek többségében pauciarticularis, vagyis csak kevés ízületet támad meg. E betegség néhány jellegzetessége: egyik alcsoportja inkább lányokat érint, az iritis előfordulása gyakori és rendszerint antinuclearis antitest is kimutatható. Egy másik alcsoportja inkább fiúknál fordul elő, gyakori a gerincre lokalizálódó forma, amely morbus Bechterew-re emlékeztet (spondylarthritis ankylopoetica). Egyes esetek valódi, gyerekkorban kezdődő rheumatoid arthritis-ek, rheuma faktor jelenlétével, az ízületekben destruktív deformáló elváltozásokkal. A pubertásban gyakran remisszió észlelhető. Ld: Still-betegség
Lyme-arthritis Lyme-kór ízületi megnyilvánulása
arthritis psoriatica Psoriasis társulása rheumatoid arthritissel, melyet gyakran különálló betegségnek tekintenek. Szeronegatív arthritis jellemzi, rheuma faktor pozitivitás nem észlelhető; leggyakrabban az ujjakat érinti.
rheumatoid arthritis Szisztémás (rendszer) betegség, amely nőkön gyakrabban mutatkozik. A legfontosabb klinikai megnyilvánulása az arthritis, mely számos ízületre terjedhet, de elsősorban a lábon és a kézen jelentkezik. Az ízületet alkotó lágyszöveteket is megbetegíti, a synovialis szövetről ráterjedve erodálja az ízfelszíni porcot. A betegség lefolyása változó, gyakran krónikus és progresszív, deformitásokat és torzulásokat okoz. Szinonima: arthritis deformans
arthritis suppurativa A synovialis hártya heveny gyulladása, az ízületi térben felgyülemlő gennyes váladékkal, mely bakteriális fertőzés következménye. Szinonima: arthritis purulenta, pyarthrosis.
arthritis urica köszvényes arthritis; ízület gyulladása köszvényben
arthro-, arth-
ízületi, ízület-, ízületet érintő; megfelel a latin articul-nak. (gör: arthron, ízület)
arthrocele
1. synovialis membrán herniatioja az ízületi tokon kívülre 2. ízület duzzanata
arthrocentesis
Folyadék leszívása az ízületből tűvel. (arthro- + gör: kentésis, punkció)
arthrochondritis
ízületi porc gyulladása (arthro- +gör: chondros, ízület + -itis, gyulladás)
arthroclasia
ankylosisban erőszakos adhesio-törés (arthro- + gör: klasis, törés)
arthrodesis
ízület műtéti úton történő rögzítése; szinonima: arterficialis ankylosis, syndesis (arthro- + gör: desis, összekapcsolás)
arthrodynia
szinonima: arthralgia (gör: arthros, ízület + odyné, fájdalom)
arthrodysplasia
veleszületett ízületi fejlődési defektus (arthro- + gör: dys, rossz + plasia, alakulás)
arthroendoscopia
szinonima: arthroscopia
arthrogram
ízületről készített röntgenfelvétel, melynél esetenként kontrasztanyagot fecskendeznek az ízületi tokba.
arthrographia
ízületbe történt kontrasztanyag befecskendezés után végzett radiographia (arthro- + gör: grapho, leír)
arthrogryphosis
Veleszületett végtaghiány, melyet az ízületek kontraktúrája kísér. (arthro- + gör: gryphosis, görbülés)
Találatok Magyarázat
arthrogryphosis multiplex congenita Az ízületek mozgáskorlátozottsága és kontrakturák jelenléte születéskor, mely rendszerint több ízületre terjed ki. E szindróma etiológiája valószínűleg sokrétű, a gerincvelőben, a vázizomzatban és a kötőszövetben egyaránt található eltérés.
arthrokinematika
mozgás tanulmányozása érintkező ízfelszínek között (arthro- + gör: kinema, mozgás)
arthrolysis
merev, ankylotizált ízületek mobilitásának helyreállítása
arthrometer
szinonima: goniometer
arthrometria
a mozgás mértékének megállapítása ízületekben (arthro- + gör: metron, mérés)
arthroophtalmopathia
Olyan betegség, amely az ízületeket és a szemet érinti. (arthro- + ophtalmo- + gör: pathos, bántalom)
arthropathia
Minden olyan betegség, amely az ízületeket érinti. (arthro- + gör: pathos, bántalom)
Találatok Magyarázat
arthropathia neuropathica idegellátási zavar következtében kialakuló súlyos ízületi bántalom; szinonima: neuropathiás ízület
tabeses arthropathia Olyan neuropathiás arthropathia, amely tabes dorsalis kapcsán jelenik meg. Ld: arthropathianeuropathica szinonima: Charcot-ízület
arthrophyta
Ízületi résben kialakuló csontosodás, csontos, szabálytalan alakú növedék.
arthroplastica
1. mesterséges ízület készítése ankylosis korrekciójára 2. Olyan műtét, amely igyekszik az adott ízület integritását és működőképességét helyreállítani.
Találatok Magyarázat
arthroplastica totalis Olyan műtét, amelynél az ízfelszíneket rendszerint fémmel, vagy nagy sűrűségű műanyaggal pótolják.
arthropneumoradiographia
Radiographiai vizsgálat, amelynél az ízületi résbe levegőt fecskendeznek be. (arthro- + pneumo- + radiographia)
Arthropoda
Az ízeltlábúak törzse, amelynek osztályai a következők: Crustacea (ide soroljuk a tengeri rákokat, a garnélarákokat, az édesvízi rákokat és a homárokat), Insecta (rovarok), Arachnida (pókok, skorpiók, atkák, kullancsok), Chilopoda (százlábúak), Diplopoda (ezerlábúak), Merostomata (patkórákok) és különféle egyéb kihalt, vagy kevésbé ismert csoportok. Az élővilág legnagyobb csoportosulása, az ismert élőlények 75%-a ízeltlábú, amelynek mintegy millió feletti fajtája ismert. (arthro- + gör: pous, láb)
arthropodiasis
a rovarok direkt hatása a gerincesekre, beleértve az acariasist (atka), az ezzel kapcsolatos allergiát, dermatosist, entomophobiát és a kontakt toxinok hatását.
arthropyosis
ízület gennyedése
arthrosclerosis
Valamely ízület merevedése, meszesedése, mely főleg időseken fordul elő.
arthroscop
ízületek vizsgálatára kifejlesztett endoszkóp
arthroscopia
ízületi üregek endoszkópos vizsgálata; szinonima: arthroendoscopia (arthro- + skopeo, szemlél)
arthrosis
ízület degeneratív elváltozása (arthro- + gör: -osis, állapot)
Találatok Magyarázat
polyarthrosis több ízületet érintő degeneratív elváltozás
arthrostomia
ízületi üregbe vezető időleges nyílás készítése (arthro- + gör:stoma, szájadék)
arthrosynovitis
ízületi membrán gyulladása
arthrotomia
ízület műtéti bemetszése, megnyitása (arthro- + gör: tomé, vágás)
arthroxesis
ízületből történő szöveteltávolítás éles kanállal, vagy más kaparó eszközzel (arthro- + gör: xesis, kikaparás)
articularis
ízülettel kapcsolatos, ízületi
articulatio
(pl. articulationes) 1. Szinonima: ízület 2. lazán összekötöz, amivel mozgást tesz két tag között lehetővé 3. tagolt, folyamatos beszéd és kiejtés 4. fogászatban: fogilleszkedés a fogsorok elmozdulásakor
Találatok Magyarázat
ízület latinul articulatio, minden, a szervezetben előforduló, csontok közötti találkozási, csatlakozási pont, ill. hely megnevezése.
articulatio atlantoaxialis mediana
forgó ízület a dens axis (fognyúlvány) és az atlas (fejgyám) arcus anterior és ligamanetum transversa által alkotott gyűrű között Szin.: Cruveilhier-féle ízület
articulatio mediocarpea
a proximalis és distalis kéztőcsontsor közötti ízület
articulator
Olyan mechanikai eszköz, amely a temporomandibularis ízület mozgását utánozza, fogsorminták készítésekor használatos.
artikulál
tagoltan, folyamatosan beszél (lat: articulo)
arytenoid
gégét alkotó porcok egyike ill. gégeizomzat egy részének neve
arytenoidectomia
Az arytenoid porc kimetszése, rendszerint kétoldali hangszalag bénulás esetén alkalmazzák a légzés javítására. (arytenoid + gör: ektomé, kimetszés)
arytenoiditis
arytenoid porc, vagy porchártyájának gyulladása
arytenoidopexia
az arytenoid porc, illetve izom műtéti fixálása (arytenoid + gör: pexis, fixálás)
arzén (As)
Fémes elem, atomszáma 33, atomsúlya 74,92159. Számos mérgező termékben van jelen, egyesek közülük az orvosi gyakorlatba is bevonultak. (lat: arsenicum, gör: arsenikon)
As
arzén
asbestosis
Pneumoconiosis, amelyet a levegőben szálló azbeszt rostok belégzése vált ki. Szövődménye lehet pleuralis mesothelioma, vagy bronchus carcinoma. Ferruginosus testek megjelenése jelzi hisztológiailag az asbestosis-t.
ascariasis
E betegséget Ascaris fajok, vagy hasonló nematodák okozzák. (gör: askaris, bélféreg + -iasis, állapot)
ascaricid
Ascaris nematodát elpusztító (szer) (ascarid- + lat: caedo, ölni)
ascites
peritonealis űrben jelentkező serosus folyadékgyülem; szinonima: hydroperitoneum (gör: askos, zsák + -ites)
Találatok Magyarázat
ascites chylosa A peritonealis űrben észlelhető tejszerű folyadékgyülem, amely szuszpendált zsírokat tartalmaz. A ductus thoracicus sérüléséből, vagy a cysterna chyli elzáródásának következtében megnyíló nyirokerekből származik e folyadék. Szinonima: chyloperitoneum
hemorrhagiás ascites véres, vagy vérrel festenyzett serosus folyadék, gyakori oka carcinoma metastasis a peritoneumon
Ascomycetes
A gombák egyik osztálya, amelyeket ascusok és ascosporák jelenléte jellemez. Az ilyen gombák két megkülönböztethető reproduktív fázissal rendelkeznek, egy szexuális és egy aszexuális fázissal. Ajellomyces capsulatum és Ajellomyces dermatitidis ennek a csoportnak a két patogén gombája. (gör: askos, zacskó + mykés, gomba)
asepsis
élő patogén mikroorganizmustól mentes állapot, környezet (gör: a- + sepsis, rothadás)
asepticus
asepsishez kapcsolódó, azzal jellemezhető, nem fertőző
Asp
aszparaginsav, vagy annak gyöki alakja
aspergilloma
1. Aspergillus okozta fertőzéses granuloma 2. bronchopulmonalis aspergillosis változata, az Aspergillus fumigatus labdaszerű tömege kolonizálja a tüdő már eddig is létezett üregét. (Aspergillus + -oma, tumor)
aspergillosis
Aspergillus jelenléte a szövetekben, emberi, vagy állati nyálkahártyákon és az általa okozott tünetegyüttes
asphyxia
Az oxigén és szén-dioxid légzéssel történő cseréjének zavara, mely kombinálódik hypercapniával, hypoxiával és anoxiával. (gör: a-, fosztóképző + sphyzo, dobog)
Találatok Magyarázat
asphyxia livida Az asphyxia újszülötteknél észlelt egyik formája, melynél a bőr cyanoticus, szapora szívverés észlelhető és a reflexek megtartottak.
lokális asphyxia A keringés helyi pangása, előfordul a lokális gangréna kialakulása, főként az ujjakon. A tünetek társulhatnak Raynaud kórral.
asphyxia neonatorum újszülötteken előforduló asphyxia
traumás asphyxia Olyan asphyxia, amely traumával áll kapcsolatban. A vénás nyomás hirtelen, elzáródás okozta emelkedése a vér extravasatioját okozza (pl. baleseteknél ún. crush-szindróma, vagy akasztottaknál).
aspiratio
1. gáznak, vagy folyadéknak a testüregekbőlszívással történő eltávolítása 2. belégzéskor a légutakba kerülő folyadék, idegen test, vagy hányadék 3. Műtéti technika a cataracta leszívására, amely csupán apró cornealis bemetszést, a lencse tokjának felhasítását, a lencse anyagának fragmentálását és tűvel történő eltávolítását igényli. (lat: aspiro, belélegezni)
Találatok Magyarázat
meconium aspiratio Intrauterin a magzat meconiummal szennyezett amnionfolyadékot aspirál.
aspirator Olyan szerkezet, amely folyadék, ill. gáz testüregekből történő leszívására alkalmas. Tartozik hozzá egy üreges tű, vagy trokár és kanül, egy vákuumrendszerrel összekötő cső, és fecskendő, vagy leszívó pumpa.
asplenia
lép hiánya
assay
1. teszt, vizsgálat 2. megvizsgálni, analizálni 3. mennyiségi és minőségi elemzése egy anyagnak tisztaságra, toxicitásra, ill. ilyen vizsgálatnak az eredménye (lat: exagium, mérés)
Találatok Magyarázat
competitive binding assay Olyan mérési módszer, amelyben a mérendő verseng egy jelzett liganddal. A ligandot ezután úgy mérik, illetve számítják, hogy az ismert standardban a kötött és a kötetlen arány miként alakul. Ld: enzyme linked immunosorbent assay, immunoassay, enzyme-multiplied immunoassay, radioimmunoassay technikák
complement binding assay immunkomplexek felderítésére szolgáló teszt
enzyme-linked immunosorbent assay (ELISA) Érzékeny módszer a specifikus fertőző betegségek szerológiai diagnosztizálására. In vitro assay, amelyben az enzim és annak szubsztrátuma szolgál indikátorként. Pozitív esetben e kettő kapcsolódása elszíneződést okoz, vagy egyéb módon könnyen felismerhető anyagot hoz létre. Az enzimet egy ismert immunoglobulinhoz (vagy antigénhez) kötik, pozitív esetben az antigén-antitest komplexnek a részeként reagál a hozzáadott szubsztrátjával.
immunoradiometric assay Olyan eljárás, amelyben ismeretlen antigén radioaktív jelzéssel ellátott antitesthez kapcsolódik. A következő lépésben a le nem kötött antitestet eltávolítják, így az antigén jelenléte egyenes arányban áll a mért radioaktivitással.
assimilatio
1. felépítő anyagcsere-folyamatok 2. átformálódás, hasonulás (lat: assimilo, hasonlít)
asszisztens
Segéd; olyan személy, aki az orvost segíti adminisztratív és rutin technikai munkájában.
Találatok Magyarázat
fogászati szakasszisztens Gyakorlott és tanult személy, aki fogorvos részére nyújt segítő tevékenységet, a hivatali munkától kezdve a laboratóriumi a szék melletti és radiológiai tevékenységig.
asszociáció
1. személyek, dolgok, eszmék társulása közös tényezők következtében 2. két eszmének, eseménynek, vagy pszichés jelenségnek tanulási , vagy tapasztalati úton történő társítása 3. statisztikai függés két, vagy több esemény, jellemző, vagy más változó között (lat: associo, társul)
Találatok Magyarázat
szabad asszociáció Szabad gondolattársítás, kísérleti pszichoanalitikus technika, amelyben a beteg verbalizálja a gondolatait, elképzeléseit. A konfliktusok a pszichoanalitikus elmélet szerint ilyen módszerrel szavakban kifejeződnek.
genetikai asszociáció Örökletes tulajdonságok populációban történő gyakori együttes megjelenése, amely véletlenszerűséggel nem magyarázható.
AST
aszpartát aminotranszferáz
astasia
izmok koordinációjának elveszítése miatti állóképtelenség (gör: a-, fosztóképző + stasis, állás)
astasiaabasia
Járásképteleség egy formája, melynél a lépés bizarr, a beteg ingadozik, majdnem elesik, de az utolsó pillanatban helyreáll egyensúlya. Szinonima: Blocq-betegség
asteatosis
csökkent, vagy megszűnt lipidszekréció a faggyúmirigyekben (gör: a-, fosztóképző + stear, zsír)
astereognosis
tárgyak térbeli formájának tapintással történő felismerésének kiesése; szinonima: tapintási agnosia (gör: a-, fosztóképző + stereos, szolid + gnosis, ismeret)
asterion
craniometriás pont a lamboid, az occipitomastoid és a parietomastoid varratok között
asterixis
Akaratlan, rángásos mozgás, mely főleg a kezekben jelentkezik. Metabolikus, vagy toxikus encephalopathiákban észleljük, pl. hepaticus encephalopathiában. Ide tartozik a flapping tremor, vagyis a tenyerek repkedő mozgatása. (gör: a-, fosztóképző + stérixis, fix helyzet)
asternia
sternum veleszületett hiánya (gör: a-, fosztóképző + sternon, mell)
asthenia
gyengeség, erőtlenség (gör: a-, fosztóképző + sthenos, erő)
astheniás
1. astheniával kapcsolatos 2. vékony, gyenge testi alkatú
asthenopia
A látási elfáradás szubjektív érzése, amely könnyezéssel, kellemetlen szem- és fejfájással jár együtt. A szem túlzott használatával lehet kapcsolatban. (gör: asthenia, gyengeség, + ops, szem)
Találatok Magyarázat
accomodativ asthenopia töréshiba és a ciliaris izmok túlzott kontrakciója váltja ki
muscularis asthenopia az extrinsic szemizmok egyensúlyának felborulása okozza
asthenospermia
A spermiumok mozgásának csökkenése, vagy hiánya, melyet gyakran látjuk infertilitásban. (gör: asthenia, gyengeség + sperma, mag)
asthma
rohamokban jelentkező nehézlégzés
Találatok Magyarázat
asthma bronchiale A légutak diffúz szűkületével jellemezhető állapot, mely spontán vagy kezelés hatására szűnhet. A simaizomzat különböző mértékű spasmusa, a nyálkahártya vizenyője, a submucosa krónikus gyulladása, valamint túlzott mértékű nyákszekréció figyelhető meg a bronchusok és bronchiolusok lumenében. Mindezeket az elváltozásokat lokális spasmogén és vasoaktív anyagok allergiás folyamat során történő felszabadulása okozza (pl. hisztamin, egyes leukotriének, illetve prosztaglandinok).
asthma cardiale asthmás roham a bal kamra elégtelensége miatt a tüdőben kialakuló pangás következtében
terhelés okozta asthma Hörgőszűkület, oedema és nyákszekréció, amelyet terhelés vált ki, különösen hideg, száraz körülmények között. A FEV1/FVC terhelés előtti értékének 10-15%-os csökkenése támasztja alá a diagnózist.
asthmaticus
asthmával kapcsolatos, vagy asthmában szenvedő
astigmatismus
1. A lencse, vagy más törőközeg a különböző meridiánban más és más törésmutatóval rendelkezik. 2. Egyenlőtlen görbület mutatkozik a különböző meridiánokban egyik, vagy több törési felületen (pl. corneán, a lencse elülső, vagy hátsó felszínén). Ennek következtében a fény nem egyetlen pontban fókuszálódik a retinán. Szinonima: astigmia (gör: a-, fosztóképző + stigma, pont)
Találatok Magyarázat
összetett hyperopiás astigmatismus valamennyi meridián hyperopiás, de nem egyforma mértékben
összetett myopiás astigmatismus valamennyi meridiánban myopiás a szem, de különböző fokban
astigmatismus corneale a cornea felületének görbülete nem egyenletes
hyperopiás astigmatismus az egyik meridián hyperopiás és a rá derékszögben lévőn nincsen törési hiba
irreguláris astigmatismus ugyanazon meridián különböző részei különböző fokú görbületet mutatnak
lenticularis astigmatismus a lencse refrakciós indexében, helyzetében, görbületében észlelhető valamilyen defektus
kevert astigmatismus Az astigmatismus e formájánál az egyik meridián hyperopiás, míg a másik, rá derékszögű myopiás.
regularis astigmatismus Valamennyi meridiánban a görbület teljes lefutásában egyenlő és a legnagyobb és legkisebb görbületek meridiánjai egymásra derékszögben állnak.
astigmia
szinonima: astigmatismus
astigmometria
az astigmatismus formájának és fokának a mérése
astomia
száj congenitalis hiánya
astragalectomia
astragalus (talus) műtéti eltávolítása (astragalus +gör: ektomé, kivágás)
astragalus
szinonima: talus
astroblast
Primitív sejt, amely astrocytává érik. (gör: astron, csillag + blastos, csira)
astroblastoma
Relatíve gyengén differenciált glioma, amelyet fiatal, éretlen, tumoros astroblast sejtek alkotnak rövid fibrillummal kis erekre tapadva, gyakori a radiális elrendezésük. (astro + gör: blastos, csira + oma, daganat)
astrocyta
Egyike az idegrendszer neuroglia sejtjeinek. Szinonima: astroglia, macroglia (gör: astron, csillag + kytos, üreg, sejt)
Találatok Magyarázat
fibrillaris astrocyta, fibrosus astrocyta Csillag alakú astrocyta, hosszú nyúlványokkal, főként az agy és gerincvelő fehérállományában láthatók. Cytoplasmájukban gliarostok kötegei találhatók. A legtöbb astrocytoma ezekből a sejtekből származik.
protoplasmás astrocyta Főként a szürkeállományban látható astrocyta, mely kevés fibrillumot és számos elágazó nyúlványt tartalmaz.
astrocytoma
Astrocytákból eredő glioma, mely ált. 20 évnél fiatalabb személyeken, gyakran a kisagy felszínén keletkezik. Felnőtteken gyorsan növekvő formája invazív és kiterjedő, ld: glioblastoma multiforme. (gör: astron, csillag + kytos, sejt + oma, tumor)
astroglia
szinonima: astrocyta (gör: astron, csillag + neuroglia)
ásvány
földkéregben található homogén szervetlen anyag
ásványolaj
kőolajból nyert folyékony szénhidrátok keveréke, gyógyszerészetben vivőanyagként, valamint bélrendszeri síkosító anyagként használják
ásványvíz
bizonyos sók nagyobb mennyiségét tartalmazó víz, ami gyógyító tulajdonsággal rendelkezik
asymbolia
Az aphasia egyik formája, amelyben a jelentősebb szimbólumokat és jeleket a beteg nem képes értelmezni. (gör: a-, fosztóképző + symbolon, külső jel)
asynclitismus
synclitismus, illetve parallelizmus hiánya a gyermek mutatkozó részének tengelye és a medence tengelye között szüléskor. (gör: a-, fosztóképző + syn-klino, összehajolni)
asyndesis
1. Ritkán használt elnevezés olyan szellemi károsodásra, amelyben a különböző eszméket, vagy gondolatokat a beteg nem képes koherens koncepcióba foglalni. 2. Schizophreniában szenvedők beszéd stílusa, melynél az összekötő gondolatok töredezettsége észlelhető. (gör: a-, fosztóképző + syn, együvé + desis, kapcsol)
asynechia
struktúra megszakadása (gör: a-, fosztóképző + synecheia, folyamatosság)
asynergia
A koordináció hiánya a különböző izmok között, amikor komplex mozgást kell végrehajtani. A komplex mozgást izolált mozdulatokkal hajtja végre a beteg. Rendszerint cerebellaris elváltozás áll a hátterében.
asystolia
szívkontrakció kimaradása, hiánya (gör: a-, fosztóképző + systolé, összehúzódik)
aszexuális
1. Olyan szaporodásra utal, amelyben nem szerepel a sejtmagok fúziója. 2. szexuális vágynak, vagy érdeklődésnek a hiánya (gör: a- fosztóképző + szexuális)
aszimmetrikus
1. szimmetria hiánya normálisan hasonló részek között 2. Az EEG aktivitás amplitúdójának és frekvenciájának jelentős különbsége, amelyet az agy két oldaláról regisztráltak ugyanolyan feltételek között.
aszimptomatikus
tünetmentes, tünetet nem produkáló
aszkorbát
aszkorbinsav sója, vagy észtere
Találatok Magyarázat
aszkorbát oxidáz Réztartalmú enzim, amely az L-aszkorbinsav oxidációját katalizálja O2 segítségével L-dehidroaszkorbinsavvá. Antitumor enzimként hasznosították.
aszkorbinsav
2,3-didehidro-L-threo-hexono-1,4-lakton. A skorbut prevenciójára alkalmas vitamin. Igen hatásos redukálószer, ezért antioxidánsként ételekben alkalmazzák. Szinonima: C-vitamin (gör: a- fosztóképző + lat: scorbutus, skorbut)
aszociális
nem szociális, társadalomtól elvonult, nem érdeklik a társadalmi szabályok, vagy szokások (pl. schizophren betegek, schizoid személyiségek) vö: antiszociális
aszparaginsav
Egyike azon aminosavaknak, amelyekből a fehérjék felépülnek. Szinonima: α-aminoszukcinilsav, α-amino-borostyánkősav
aszpartát
aszparaginsav sója, vagy észtere
Találatok Magyarázat
aszpartát aminotranszferáz (AST) Enzim, amely a reverzibilis amino-csoport átvitelt katalizálja glutaminsavról az oxálecetsavra, ezzel α-ketoglutársavat és L-aszparaginsavat képez. Diagnosztikailag fontos szérum enzim vírus hepatitisben és szívinfarktusban. Szinonima: glutamát-oxálacetát transzamináz (SGOT)
asztatin (At)
Mesterségesen előállított radioaktív elem, a halogén sorba tartozik. Atomszáma 85, atomsúlya 211. (gör: astatos, nem stabil)
asztroszféra
Sugár alakú mikrotubulus rendszer, mely az oszló sejt citocentrumából és centroszférájából indul ki. (gör: astron, csillag + sphaira, labda)
AT
adenin-timin hidrogén-kötéssel ellátott bázis pár a polinukleotid kettős hélixben
At
asztatin
ataranalgesia
intravénás érzéstelenítési eljárás gyógyszerkombináció adása révén. Gyermekgyógyászati- és szívsebészeti műtétek során alkalmazzák.
atavisztikus
atavizmussal kapcsolatos, ősi
atavizmus
Valamilyen jellemző, örökletes tulajdonság megjelenése, visszatérése, amelyről feltételezhető, hogy elődökben korábban jelen lehetett. (lat: atavus, távoli ős)
ataxia
Az izomaktivitás összehangoltságának elvesztése; a betegnél rángások, inkoordináció, az akaratlagos mozgások hatástalansága mutatkozik. Leginkább a cerebellumban, vagy a gerincvelő hátsó oszlopában lévő elváltozás következménye; a végtagokra, a fejre, a törzsre egyaránt kiterjedhet. Szinonima: inkoordináció (gör: a-, fosztóképző + taxis, rendelni)
Találatok Magyarázat
Friedreich-féle ataxia veleszületett spinalis ataxia
hereditaer cerebellaris ataxia A késői gyerekkorban, korai felnőttkorban megnyilvánuló betegség, ataxiás lépés, habozó és kirobbanó beszéd, nystagmus, néha neuritis optica jellemzi.
hereditaer spinalis ataxia A gerincvelő posterior és laterialis kötegének sclerosisa, gyerekkorban fordul elő, feltűnő az alsó végtagon, de kiterjed a felső végtagra, majd paralysis és contractura követi. Ld: spinocerebellaris ataxia; szinonima: Friedreich-féle ataxia
spinocerebellaris ataxia A leggyakoribb hereditaer ataxia, mely gyermekkorban kezdődik, végtag ataxia, nystagmus, kyphoscoliosis és pes cavus jellemzi. A gerincvelői hátsó kötegek elváltozása észlelhető.
ataxia teleangiectasia Lassan progrediáló multiszisztémás betegség ataxiával. Kezdetben a járás ataxiás, a conjunctivában és a bőrben teleangiectasiák láthatók. A későbbiekben athetosis, nystagmus, a légzőtraktusban rekurráló fertőzések jelentkeznek, amelynek a meglévő immundeficiencia adja magyarázatát. A betegek mintegy 70%-ában IgA hiány mutatható ki, amelyet a T-helper sejtek működésének csökkenése kísér.
ataxiás
ataxiával kapcsolatos, vagy ataxiában szenvedő
ataxiophemia
beszéddel kapcsolatos izmok inkoordinált működése (gör: a-, fosztóképző + taxis, rendel, + phémé, beszéd)
atelectasia
tüdő légtelensége (gör: atelés, nem teljes + ektasis, kiterjedés)
Találatok Magyarázat
passzív atelectasia Tüdőkollapszus, amely intrathoracalis térfoglaló folyamat, pneumothorax, hydrothorax stb. következménye.
primer atelectasia A tüdő képtelen expandálni születés után, miként a halva született gyerekeken látni, de élve születetteken is előfordulhat, akik a légzés beindulása előtt meghalnak.
szekunder atelectasia Tüdőcollapsus, mely bármely korban bekövetkezhet, de különösen gyakran újszülötteken, hyalinmembrán betegség következtében.
subsegmentalis atelectasia Az elzárt subsegmentalis bronchustól távol a tüdő egy része összeesik, mely a mellkas röntgenen vonalas árnyékot, ún. Fleischner-féle vonalakat ad.
atelia
szinonima: ateliosis
ateliosis
a test, vagy annak valamely részének elégtelen fejlődése, pl. infantilizmusban, törpeségben; szinonima: atelia (gör: atelés, inkomplett + osis, állapot)
athelia
mellbimbók congenitalis hiánya (gör: a-, fosztóképző + thélé, emlőbimbó)
athero-
pasztaszerű, lágy anyag (gör: athere, zabkása)
atheroembolus
Koleszterol embolus meszesedő anyaggal, vagy a nélkül, mely valamely ér atheromás lerakódásából származik.
atherogen
az atherogenesis folyamatát fokozó (hatás)
atherogenesis
atheroma képződés, az arteriosclerosis pathogenesisében játszik szerepet
atheroma
arteriák intimájában lévő sárgás lipidlerakódás (gör: athéré, zabkása + oma, tumor)
atheromatosus
atheromával kapcsolatos
atherosclerosis
Arteriosclerosis, amelyet szabálytalan eloszlásban jelentkező lipoid lerakódások jellemeznek az intimában a közepes nagyságú artériákban. Az ilyen lipid depositumok nyomán fibrosis és meszesedés jön létre. Az arteriosclerosis kialakulását súlyosbíthatja pl. magas vérnyomás, dohányzás, toxikus környezeti hatások. A kialakuló plakkok akadályozzák, sőt teljesen el is zárhatják a véráramlás útját.
atheroscleroticus
atherosclerosissal jellemezhető
athetoid
athetosisra emlékeztető
athetosis
Lassú, vonagló akaratlan flexiós, extensiós, pronatios, supinatios mozgás a karokban, az ujjakban, de előfordul a lábon is. Extrapyramidalis elváltozások okozzák. (gör: athetos, elhelyezkedés)
athetoticus
athetosissal kapcsolatos, azzal jellemezhető
athymia
1. kóros érzéketlenség, érzelemmentesség 2. thymus mirigy congenitalis hiánya, gyakori ilyenkor az immundeficiencia is. (gör: a-, fosztóképző + thymos, érzelem, thymus)
athyroidismus
Congenitalis pajzsmirigy hiány, vagy oly mértékű szuppressziója a pajzsmirigynek, hogy az nem képes hormontermelésre. Ld: hypothyroidismus
atka typhus
Szin.: tsutsugamushi betegség
ATL
adult (felnőttkori) T sejtes leukaemia, vagy adult (felnőttkori) T sejtes lymphoma
atlanto-, atlo-
az atlasra (a fejet támasztó csigolyára) vonatkozó (gör: Atlas a görög mitológiában szereplő Titán, aki vállaival tartotta az egeket.)
atlantoaxialis
az atlasra és az axisra, vagy az első két csigolya ízületére vonatkozó; szinonima: atloaxoidalis
atlas
Az első nyakcsigolya, amely az os occipitaléval ízesül. (gör: Atlas a görög mitológiában az a Titán, aki vállával támasztotta meg az eget.)
atlo-
ld. atlanto-
atloaxoidalis
szinonima: atlantoaxialis
atm
standard atmoszféra
atmo-
prefixum, amely gőzt, vagy párát jelent (gör: atmos, gőz, pára)
atmoszféra
1. egy adott testet körülvevő gáz, gáz médium 2. a légnyomás egysége. (gör: atmo + sphere, szféra)
Találatok Magyarázat
standard atmoszféra (atm) 1. átlagos tengerszinten az az atmoszférikus nyomás, amely egyenlő 1,013,250 dyn/cm2-rel, vagy 101,325 Pa-lal (N/m2 az SI rendszerben) 2. a barometrikus nyomásnak, a hőmérsékletnek és egyéb atmoszférikus változóknak a standardizált kifejezése a tengerszintre átszámított magasság függvényében.
atom
Egy elem régebbi elképzelés szerinti legkisebb része, amely neve szerint oszthatatlannak tekinthető. A radioaktivitás felfedezése igazolta a szubatomi részecskék, nevezetesen a proton, neutron és elektron létezését. Az első kettő az atom magjának tömegét teszi ki. Most már azt is tudjuk, hogy a szubatomi részecskék is tovább oszthatók hadronokra, leptonokra és quarkokra. (gör: atomos, oszthatatlan)
atónia
relaxáció, lazaság, tónus hiánya, petyhüdtség
atóniás
relaxálódott, tónus- és feszültségmentes
atopia
Genetikailag meghatározott hiperszenzitivitási állapot a környezeti allergének iránt. I. típusú allergiás reakció és betegségcsoport (pl. asthma, szénaláz és atopiás dermatitis), amelyet fokozott IgE antitest felszabadulás jellemez. (gör: atopia, idegenség)
atopiás
atopiával kapcsolatos, vagy atopiával jellemezhető (gör: atopos, helyen kívüli, idegen)
atopognosia, atopognosis
Érzékszervi figyelmetlenség, képtelenség, egy érzést megfelelő lokalizálására; rendszerint ellenoldali parietalis lebeny laesio esetén alakul ki. (gör: a-, fosztóképző + topos, hely + gnosis, ismeret)
atoxikus
nem toxikus
ATP
adenozin 5"-trifoszfát
ATPáz
adenozin trifoszfatáz
atresia
normálisan nyitott lumen elzáródása, illetve a lumen normális nyílásának hiánya (gör: a-, fosztóképző + trésis, nyílás)
Találatok Magyarázat
atresia ani congenitalis anus nyílás hiány, membrános septum jelenléte következtében (cloacalis membrán fennmaradása), vagy az analis csatorna teljes hiánya miatt. Szinonima: anus imperforatus, proctatresia
atresia aortae aortába vezető normális valvularis nyílás congenitalis hiánya
biliaris atresia A nagyobb epevezetékek elzáródása, cholestasissal és sárgasággal, amely csak a születést követő néhány nap múlva lesz észlelhető. Periportalis fibrosis, majd cirrhosis alakul ki a kis epeutak proliferatiojával, végül később utóbbiak is atretizálódnak. Vö: neonatalis hepatitis
tricuspidalis atresia tricuspidalis szájadék congenitalis hiánya
vaginalis atresia congenitalisan létrejött, vagy akár szerzett imperforatioja, esetleg elzáródása a vaginának, vagy a vagina falainak adhesioja; szinonima: colpatresia
atria
atrium többes száma (atrium, pitvar)
atrialis
atriummal kapcsolatos
atrichia
szőrzet congenitalis, vagy szerzett hiánya; szinonima: atrichosis (gör: a-, fosztóképző + thrix, szőrzet)
atrichosis
szinonima: atrichia
atrichosus
szőrzet nélküli
atrio-
atriummal kapcsolatos, atrialis (lat: atrium, előcsarnok)
atriomegalia
pitvarnagyobbodás (gör: atrio + megas, nagy)
atrioseptoplastica
pitvari septum műtéti korrekciója (atrio- + lat: septum, elválasztó + gör: plastos, alakított)
atrioseptostomia
két pitvar között közlekedés létesítése (atrio- +lat: septum, választó + gör: stoma, szájadék)
atrioventricularis
(A-V) mind az atriummal, mind a kamrával kapcsolatos, főként a normális orthograd véráramlás esetén
atrium, pl. atria
1. Olyan üreg, amely a passzázs útjában több más üreggel is kapcsolatban áll. 2. szívpitvar 3. A dobüreg része, amely közvetlenül a dobhártya mellett található. 4. A tüdőben a ductus alveolaris része, amelyből az alveolus zsák nyílik. (lat. előszoba)
Találatok Magyarázat
atrium, pl. atria cordis szívpitvar
atrophia
Szövetek, szervek, vagy akár az egész szervezet sorvadása a sejtek pusztulásának és felszívódásának, a gátolt sejtosztódásnak, csökkent sejttérfogatnak következtében. Az atrophia etiológiai tényezői között szerepelhetnek ischaemia, nyomás, malnutritio, csökkent működés, hormonális változások. (gör: a-, fosztóképző + trophé, táplálás)
Találatok Magyarázat
muscularis atrophia izomszövet sorvadása
peronealis muscularis atrophia Familiáris perifériás izomzavar, amelyre a végtagok distalis izmainak jelentős fokú sorvadása jellemző. A folyamat főleg a peroneus izomcsoportra terjed, amelynek "gólyaláb" a következménye. Szinonima: Charcot-Marie-Tooth betegség
Pick-féle atrophia az agykéreg körülírt atrophia-ja
Sudeck-féle atrophia Csontatrophia, mely főként a carpalis és tarsalis csontokat érinti; rendszerint traumát követően jelentkezik. Ld: causalgia, reflexes sympatheticus dystrophia
atrophia hepatis flava Akut fulmináns hepatitis, mely lehet vírusfertőzés vagy mérgezés következménye. A májparenchyma sejtjei gyorsan elpusztulnak, néha zsíros degeneráció figyelhető meg. Szinonima: Rokitansky-kór
infantilis spinalis muscularis atrophia Az 5q kromoszóma eltérése révén, autoszomális recesszív módon öröklődő betegség, melynél a gerincvelő elülső szarvának, ill. az agytörzsből eredő agyidegeknek a károsodása mutatható ki. A kórképet a betegség kezdetekor észlelt életkor alapján osztályozzuk.
juvenilis spinalis muscularis atrophia Lassan progrediáló, a proximalis izmokon megnyilvánuló gyengeség és sorvadás, amely gyerekkorban, rendszerint a 2-17 éves életkor között a gerincvelő elülső szarvában lévő motoros neuronok degenerációjával veszi kezdetét. Autoszomális recesszív módon öröklődik.
linearis atrophia s zinonima: striae cutis distensae
atrophoderma
bőrsorvadás; ld: anetoderma
atrophodermatosis
Bármilyen bőrelváltozás, amelynek fontos tünete a bőr sorvadása.
attack
Olyan elváltozás megjelenése, amely drámai, hirtelen kezdettel mutatkozik (pl. szívroham, pánikroham)
Találatok Magyarázat
drop attack Hirtelen rohamszerű összeesés állás vagy járás közben, minden figyelmeztető jel nélkül, mely során a beteg a tudatát nem veszti el, szédülés, vagy postictalis állapot nem észlelhető. A beteg rendszerint idős, EEG felvétele eltérés nélküli, a jelenség oka ismeretlen.
panic attack Hirtelen kezdetű rettegés, félelem, rémület, vagy fenyegető megsemmisülés érzése, amelyhez fokozott autonóm idegrendszeri aktivitás társul, depersonalizáció és derealizáció mellett.
transiens ischemic attack (TIA) Hirtelen, focalis idegműködés vesztés tökéletes rendeződéssel 24 órán belül. Ezt a képet a carotis, ill. a vertebrobasilaris arteriák rövid ideig tartó, nem megfelelő perfúziója idézi elő.
attenuatio
1. gyengítés 2. egy baktériumtörzs virulenciájának csökkentése 3. Valamely sugár energiájának mérséklődése abszorpció, szóródás, hullám divergencia vagy egyéb ok miatt, miközben a sugár egy közegen áthatol.
atticotomia
dobüreg műtéti megnyitása (gör: attic, dobüreg + tomé, bevágás)
atto-
(a) prefixum az SI rendszerben jelezve a quintilliomodrészt, 10-18 (Dán atten, tizennyolc)
attritio
1. dörzsöléssel, vagy súrlódással való koptatás 2. (fog)kopás (lat: attero, dörzsölni)
Au
aurum, arany
audio-
hallás- (lat: audio-, hallani)
audioanalgesia
zene, vagy hangok felhasználása fogászati, vagy sebészi eljárások során fájdalomcsillapításra
audiogram
a hallásélesség vizsgálata alkalmával készített vonalgörbe, a különböző frekvenciákon mért hallási küszöb ábrázolására (audio- + gör: gramma, rajzolás)
audiológia
A hallási zavarok tanulmányozása a hallási képesség elveszítésének mértékét lemérve, továbbá halláskárosodottak rehabilitációja.
audiológus
Olyan specialista, aki hallásvizsgálattal, hallássérült betegekkel foglalkozik.
audiométer
Elektronikus szerkezet a hallási küszöb megállapítására, mérve a tiszta hangtónusokat 128-8000 Hz frekvencián (decibelben regisztrálva) (audio- + gör: metron, mérés)
audiometria
hallásélesség vizsgálat
Találatok Magyarázat
auditory brainstem response audiometria (ABR) A hallási funkcióknak olyan elektrofiziológiai vizsgálata, amely méri a hallóideg által képezett válaszokat, valamint azokat, amelyek az agytörzsben keletkeznek ismételt hallási ingerek kapcsán. Szinonima: brainstem evoked response audiometria
brainstem evoked response audiometria szinonima: auditory brainstem evoked response audiometria
corticalis audiometria Azon potenciálok mérése, amelyek a hallórendszerben az agytörzs szintje felett képződnek.
electrodermalis audiometria Az elektrofiziológiás audiometria egyik alakja, amelyben a hallási küszöböt a bőrellenállás változásával mérik, mint a zajingerre kapott feltételes választ.
auditoros
hallási érzethez tartozó, vagy a hallásszervet illető (lat: audi, hallani)
aura, pl. aurae
1. Szubjektív tünetek, amelyek bevezetik a partialis epilepsziás görcsöket; gyakran jellemzi azt az agyi régiót, ahonnan a roham kiindul (pl. vizuális aura occipitalis lebenyre jellemzően, hallási aura a temporalis lebenyre utalva). 2. a migrén típusú fejfájást bevezető szubjektív tünetek (pl. fuvallat, szag, fényvillanás érzése)
auri-
összetett alak, fülre utal; ld: ot-, oto- (lat: auris, fül)
auricula
1. fülkagyló 2. fülcse (pitvarban)
Találatok Magyarázat
auricularis füllel, vagy fülcsével kapcsolatos
auriculare
(pl. auricularia) craniometriás pont a külső hallójárat nyílásának közepén (lat: auricularis, füllel kapcsolatos)
auriculotemporalis
füllel és a temporalis régióval kapcsolatos
auris
(pl. aures) fül (lat)
aurum
arany
auscultatio
Hallgatózás; a test különböző szerveiből származó hangok meghallgatása, mint diagnosztikai módszer, rendszerint sztetoszkóppal, fonendoszkóppal történik. (lat: ausculto, hallgatni valamire)
Találatok Magyarázat
direkt auscultatio Ebben az esetben a fület a test felszínére helyezi a vizsgáló orvos.
autisticus
autizmussal jellemezhető
autizmus
Kóros befelé fordulásra való hajlam, öntörvényűség, a beteg a külvilág realitását nem veszi figyelembe. (gör: autos, önmaga)
Találatok Magyarázat
infantilis autizmus A gyerekkor súlyos érzelmi zavara, amelyet a reciprok társas interakciók, a kommunikáció, a nyelvi kifejező képesség, a szociális fejlődéskárosodása jellemez. Szinonima: Kanner-szindróma
auto-, aut-
prefixumok, jelentése önmaga (gör: aut, önmaga)
autoagglutináció
1. nem specifikus összecsapzódása a sejteknek (baktérium, erythrocyta) fiziko-kémiai tényezők hatására 2. Vörösvérsejtek agglutinációja akkor, ha valakinek a szérumában antitest van jelen a saját vérsejtjeivel szemben.
autoagglutinin
agglutináló autoantitest
autoallergia
Megváltozott reakció, amelyben az antitestek (autoantitestek) az illető saját szövetei ellen képződnek, melyeknek inkább destruktív és nem protektív hatásuk van. Szinonima: autoimmunitás
autoantigén
Minden olyan antigén, amely a gazdaszervezetben önmagával szemben antitesttermelést provokál.
autoantitest
Olyan ellenanyag, amely az illető gazdaszervezet antigénjei ellen mutatkozik, és az azt kiváltó antigénnel reagál.
autochton
1. bennszülött, honos 2. helyben keletkező 3. Ahol található, onnan származik, pl. ha egy betegség a szervezet azon részén keletkezett, ahol észleljük. (auto- + gör: chthon, ország)
autoclasis, autoclasia
1. intrinsic okok miatti feldarabolódás 2. progresszív, immunológiai eredetű szöveti destrukció (auto- + gör: klasis, törés)
autocoid
Kémiai anyag, amely kihat a szintézisét végző sejtféleség közelében lévő egyéb sejtek tevékenységére, ezzel lokális hormon, illetve messenger szerepet tölti be. (gör: autos, saját +eidos, alak)
autocrin
Önmagát serkentő olyan molekula saját előállításával, amelynek egyben a receptorával is rendelkezik. (auto- + gör: krino, elválaszt)
autocytotoxin
cytotoxicus autoantitest
autodigestio
önemésztés szinonima: autolysis
autoecholalia
más személy, vagy saját mondásának beteges ismétlése (auto- + echolalia)
autoeroticus
autoerotizmussal kapcsolatos
autoerotizmus
1. masturbatio, önkielégítés 2. szexuális önimádat; ld: narcismus; vö: alloerotizmus (auto- + gör: erotikos, szerelemhez kapcsolódó)
autogamia
Az öntermékenyítés egyik alakja, amelyben a sejtmag szétválása a sejt oszlása nélkül megy végbe. Az így kialakult két pronucleus ismét egyesül és synkariont alkot. Más esetben a sejttest kettéoszlik, de a két leánysejt azonnal ismét egyesül. (auto- + gör: gamos, házasság)
autograft
Szövet, vagy szerv, amelyet új helyre ültetnek át ugyanazon személy testében. Szinonima: autolog graft, autotranszplantátum (auto- + A.S. graef)
autohemagglutináció
a vörösvérsejtek autoagglutinációja
autohemolysin
Olyan autoantitest, amely a vörösvértestek lysisét okozza ugyanazon ember szervezetében, ahol ez az ellenanyag termelődött.
autohemolysis
Egyes betegségekben megjelenő hemolysis, amely autohemolysin hatására következik be.
autoimmun
Az illető saját szövetéből eredő, saját szövetei ellen irányuló immunjelenségek (pl. autoimmun betegségekben)
autoimmunitás
Olyan állapot, amelyben a beteg saját szöveteit az immunrendszere károsítja (pl. autoimmun betegségekben)
autoimmunizáció
az autoimmunitás indukciója
autoimmunocytopenia
anaemia, thrombocytopenia és leukopenia, mint cytotoxicus immunreakciók eredménye
autoinfekció
1. Kórokozók, paraziták általi újrafertőződés, miután a beteg egyszer átesett már a fertőzéses cikluson. 2. A parazita petéjével történő direkt kontaktus okozta ismételt fertőzés, pl. ujjakkal átvitt féregpeték okozta ismételt fertőzés (analis-oralis út). Szinonima: autoreinfekció
autoinfusio
A végtagok , vagy más területek (pl. lép) vérét kötéssel, nyomással a szervezet létfontosságú részébe irányítják, ezzel a vérnyomást emelik, és a keringést stabilizálják. Gyors és nagyfokú vér, vagy más folyadék vesztés esetén alkalmazzák. Vö: autotransfusio
autoinoculatio
Másodlagos fertőzés, amely egy már a szervezetben jelenlévő fertőzéses gócból terjed át más szervekre.
autointoxicatio
A mérgezés az anyagcseréből származó salakanyag, bélből felszívódó mérgező anyagok révén történik, vagy pedig elhalt és fertőzött szövetekből (pl. gangréna) származik. Szinonima: endogén toxicosis
autoisolysin
Antitest, amely komplement jelenlétében a beteg szervezetében sejtlysist idéz elő. Az autoisolysin-t a saját szervezet állította elő, illetve azonos fajban is képes lyticus hatását kifejteni.
autokatalízis
Olyan vegyi reakció, amelyben egy, vagy több keletkező termék maga is gyorsítja a reakciót. Így tehát a folyamat lassan kezdődik, majd gyorsan nő a sebessége. Vö: láncreakció
autokeratoplastica
A cornea szövetének a beteg egyik szeméből a másikba való átültetése
autokinesia, autokinesis
akaratlagos mozgás (auto- + gör: kinesis, mozgás)
autokláv
Olyan készülék, amelyben gőznyomás alatt folyik a sterilizálás. (auto- + lat: clavis, kulcs)
autológ
1. természetesen és normális körülmények között a szövetek bizonyos típusában, vagy a szervezet specifikus struktúrájában megjelenő 2. Olyan sejtből származó daganat, amely közönségesen is az adott helyen található (pl. a nyelőcső felső részében található elszarusodó laphámsejtes carcinoma). 3. Transzplantáció: olyan beültetett graft, amelynél a donor és a recipiens ugyanazon személy. (auto- + gör: logos, viszony)
autolysatum
autolysisből származó anyagok keveréke
autolysin
Antitest, amely sejtek oldódását okozza azon személyben, akiben ez az antitest képződött.
autolysis
Különböző (főként elhalt, vagy degenerált) sejtek enzimatikus önemésztése a bennük lévő enzimek által;szinonima: autodigestio (auto- + gör: lysis, oldás)
automatismus
1. akarattól, vagy a központi beidegzéstől független, pl a szívverés 2. Epilepsziás roham, amely sztereotip pszichés, szenzoros, vagy motoros jelenségeket mutat, miközben a beteg öntudatlan. 3. Tudatos szándék nélküli, ismétlődő cselekvés, mely gyakran értelmetlen. (gör: automatos, önmozgó + in) Szinonima: telergia
autonom
önálló, független
autooxidáció
könnyen oxidálódó anyag direkt, enzimhatás nélküli reakciója a molekuláris oxigénnel normál hőmérsékleten
autophagia
1. saját testrész rágása, a Lesch-Nyhan szindróma egyik tünete 2. a szervezet anyagcsere egyensúlyának fenntartása, saját tartalékainak felélésével (auto- + gör: phago, enni)
autoplasztika
sérült testrész helyreállító műtéte a test más részéről vett szövettel
autopsia
Boncolás; a holttest szerveinek vizsgálata a halál okának feltárására, illetve annak megállapítására, hogy milyen patológiai elváltozások vannak jelen a szervekben. (gör: autopsia, saját szemeivel látni) Szinonima: necropsia
autoradiográfia
Szövettani metszet felületére felvitt fotóemulzió segítségével végzett eljárás, mely a szövetekben kimutatható radioaktivitás eloszlásának ábrázolására alkalmas. Szinonima: radioautográfia
autoregulatio
1. Egy szerv állandó vérellátásának automatikus biztosítása akkor is, ha az ellátó artériában a nyomás változik. 2. Általában valamennyi biológiai rendszerben találunk olyan szabályozó mechanizmust, amely egy adott változást képes nagyrészt, vagy teljes mértékben kompenzálni. Pl. a baroreceptor reflex a szisztémás vérnyomás autoregulációjának alapját képezi.
Találatok Magyarázat
heterometriás autoregulatio A szívizom kontrakciók erejének saját, intrinsic regulációja, amely során a kontrakciók ereje (a végdiastolés nyomás) a diastolés izomrost megnyúlás (a végdiastolés volumen) függvénye, amely független az afterloadtól (az aortában uralkodó nyomástól) és egyéb extrinsic befolyásoktól. Ld. Starling-féle törvény; Frank-Starling mechanizmus
homeometriás autoregulatio A szív kontrakciójának intrinsic szabályozása olyan behatásokra, amelyek nem változtatják a rosthosszat, vagyis a Frank-Starling mechanizmust. (Pl. Anrep-hatás, amely szerint az erő nő, ha az afterload (aortanyomás) emelkedik és a Bowditch-féle lépcső effektus, amely alapján az erő nő az emelkedő pulzusszám hatására és nem függ külső szabályozástól, pl. szimpatikus idegingerléstől, vagy noradrenalin kiáramlástól.)
autoreproductio
Egy gén, vírus, vagy általában egy nukleoprotein molekulának az a képessége hogy egy másik, vele azonos molekula szintézisét a sejtben található kisebb molekulákból elvégezze.
autosuggestio
1. Állandó ragaszkodás egy eszméhez, egy elképzeléshez, mely szellemi és testi működésbeli változásokat indít el. 2. Az agyban az előzetesen szerzett benyomásokat reprodukálni, hogy ez által új eszmék és cselekedetek valósuljanak meg.
autoszérum
Saját vérből előállított szérum, amelyet autoszeroterápia céljából alkalmaznak.
autoszóma
A szex kromoszómákon kívül minden más kromoszóma. Az autoszómák normálisan párosával vannak jelen a szomatikus sejtekben és egyesével az ivarsejtekben. (auto- + gör: soma, test)
autoszomális
autoszómával kapcsolatos
autotopagnosia
Saját testen való tájékozódási képesség elvesztése, amelyet a parietalis lebeny elváltozása okoz. Vö: somatotopagnosia (auto- + gör: topos, hely + a-, fosztóképző + gnosis)
autotransfusio
a beteg saját vérének levétele, majd visszaadása; vö: autoinfusio.
autotransplantatio
autograft beültetése
autotransplantatum
szinonima: autograft
autotroph
Olyan mikroorganizmus, amely csak szervetlen anyagot (pl. szén-dioxidot szénforrásként) képes saját táplálkozásában felhasználni. (auto- + gör: trophé, táplálás)
auxano-, auxo-, aux
megnövelni, pl. nagyságot, intenzitást, sebességet (gör: auxano, növelni)
auxanográfia
Auxanogramok alkalmazása a különböző feltételek tanulmányozására a baktériumok növekedésében.
auxanogram
Baktériumok lemeztenyészete, amelyben különböző feltételeket adnak meg, hogy ezek hatását vizsgálják a baktériumok növekedésére. (auxano- + gör: gramma, valamit leírni)
auxesis
nagyság-növekedés, főként hypertrophiára vonatkozik
auxiliaris
1. növekvő kapacitásban működő, kiegészítő 2. alárendeltként működik, másodlagos
auxo-
ld: auxano-
auxochrom
Egy festékmolekulában az a vegyi csoport, amelynek segítségével a festék reaktív csoportokhoz kapcsolódik a szövetekben. (auxo- + gör: chroma, szín)
auxotonicus
Olyan állapot jelölése, amelyben a kontraháló izom fokozott terhelésre megrövidül. Vö: isometriás (2), isotonicus (3)
auxotroph
Olyan mutáns mikroorganizmus, amely már igényel bizonyos tápanyagot, amelyet még az eredeti mikroorganizmus képes volt nélkülözni. (auxo- + gör: trophé, táplálás)
AV
arteriovenosus, atrioventricularis
avascularis
vér- és nyirokérmentes. Ez bizonyos porcszövet normális állapota, de lehet oka betegség is.
avascularizatio
1. Esmarch-féle leszorítással, vagy artéria kompresszióval történő vértelenítés 2. az erezettség elvesztése, pl. hegesedés révén
aVF, aVL, aVR
Végtagokról történő megnövelt EKG elvezetések: bal láb, bal kéz, jobb kéz az elvezetés helyei.
avian
madarakkal kapcsolatos (lat: avis, madár)
aviditás
a kötés erősségének mértéke multivalens antitest és multivalens antigén között; ld: affinitás
avirulens
nem virulens
avitaminosis
helyesebben hypovitaminosis
avoir-du-pois
Súlyrendszer, amelyben 16 uncia egy fonttal, azaz 453,59237 grammal egyenlő (fr: súllyal rendelkezni).
AVP
1. antiviralis protein 2. arginin-vazopresszin
avulsio
erőteljes szeparálás, vagy kiszakítás, vö: evulsio (lat: a- + vello, elszakít)
Találatok Magyarázat
avulsio nervi perifériás ideget megszakítani, műtétileg eltávolítani
AW
(atomic weight) atomtömeg
ax
axis, tengely
axanthopia
sárga színtévesztés
axenicus
Általában steril, tiszta tenyészetre utal (pl. protozoon tenyészet, amelyben nincsen baktérium jelen). De használják a csíramentes ("germ-free") állatok jelzésére is, amelyeket steril körülmények között hoztak világra és neveltek fel.
axialis
1. axissal kapcsolatos, tengelyben álló 2. a test középponti részében, a fejben és a törzsben lévő, szemben a végtagokkal 3. fogászat: a fogazat hossztengelyével kapcsolatos, vagy azzal párhuzamos
axifugalis
az axistól, vagy az axontól távolra terjedő, eső (lat: axis + fugio, elfutni)
axilla
(gen, pl. axillae) Hónalj; az a terület, amely a vállízület alatt van, elölről a m. pectoralis major, hátulról a m. latissimus dorsi, medialisan a m. serratus anterior és lateralisan a humerus határolja. Az axillának a felső nyílása a clavicula, a scapula és az első borda között található (canalis cervicoaxillaris), az alsó nyílását a fascia axillaris fedi. Ez tartalmazza az arteria és a vena axillarist, a plexus brachialis infraclavicularis részletét, az axillaris nyirokcsomókat és nyirokereket, valamint a kötőszövetet.
axillaris
axillával kapcsolatos, hónalji, hónaljhoz tartozó
axio-
tengely-, ld: axo- (lat: axis, tengely)
axioplazma
szinonima: axoplazma
axioversio
valamely fog hossztengelyének normálistól való eltérése
axipetalis
szinonima: centripetalis (lat: axis + peto, keres)
axis
(pl. axes) 1. tengely 2. Egyenes vonal, amely egy test azon két pólusát köti össze, amely körül a testet forgatni lehet. 3. gerincoszlop 4. második nyakcsigolya; szinonima: epistropheus, vertebra dentata
Találatok Magyarázat
axis basibregmaticus Az a vonal. amely az agyalaptól a koponyatetőig terjed.
axis basicranialis az agyalaptól a sphenoethmoidalis varratig húzott vonal
axis basifacialis a subnasalis pontból a sphenoethmoidalis varrat középpontjáig húzott vonal
axis biauricularis a két fül között húzott vonal
axis cephalocaudalis A test hossztengelye; az a képzeletbeli vonal, amely a középsíkban a koponya csúcsától a gáton át az alsó végtagok között fut le.
axis cerebrospinalis a központi idegrendszer, vagyis az agy és a gerincvelő elnevezése
axis facialis szinonima: axis basifacialis
axis opticus A szem elülső és hátsó pólusainak összekötő vonala, ez a látótengelytől általában mintegy 5 fokkal tér el.
axis pelvicus A medenceüreg tengelye, egy elméletileg alkotott görbült vonal, amely a medenceüreg minden síkjában annak középpontjában halad.
axis visualis Egyenes vonal, amely a látott tárgytól a pupilla középpontján át a sárga foltig húzódik. Szinonima: látótengely
axo-
axis, axon szóösszetételben (gör: axis, tengely)
axoaxonicus
szinaptikus kapcsolat két idegsejt axonja (tengelyfonala) között; ld: szinapszis
axodendriticus
egy axon és egy másik neuron dendritje közötti szinapszis; ld: szinapszis
axofugalis
szinonima: axifugalis (axo- + lat: fugio, menekül)
axolemma
az axon plazmamembránja (axo- + gör: lemma, héj)
axolysis
valamely ideg axonjának károsodása, feloldódása (axo- + gör: lysis, oldás)
axon
Az idegsejt nyúlványa, amely normális körülmények között idegimpulzusokat vezet el a sejttestből és a többi idegnyúlványból (dendritekből). Az axon általában szegmentekre osztott; az agyban és a gerincvelőben oligodendroglia sejtek, a perifériás idegekben pedig Schwann-sejtek által myelinhüvellyel ellátott idegnyúlvány. Az idegsejtek szinaptikusan továbbítják az ingerületet más idegsejtekre, vagy pedig effektor sejtekre (izomsejt, mirigysejt), mely az axon szinaptikus végződésein történhet. Szinonima: neurit (gör: axon, tengely)
axonalis
axonnal kapcsolatos
axoneme
1. kromoszóma tengelyén átmenő centrális fonál 2. Mikrotubulusok elrendeződése az eukarióta ciliumok és flagellák belsejében, amelyet kilenc páros mikrotubulus vesz körül kéveszerűen. (axo- + gör: néma, fonál)
axonográfia
az axonban végbemenő elektromos változások regisztrálása
axonotmesis
Egy ideg axonjának megszakadása, amelyet a perifériás szegmentum teljes degenerációja követ, de ugyanakkor az ideg támasztó szerkezete megmarad. Ilyen elváltozást eredményez az ideg megszúrása, tartós nyomása, zúzódása. Ld: neurapraxia, neurotmesis (axon + gör: tmesis, vágás)
axonreflex
idegrostok közötti reflexív
axopetalis
axon irányába terjedő (axo- + lat: peto, keres)
axoplazma
az axon neuroplazmája; szinonima: axioplazma
axoszomatikus
egy idegsejt sejtteste és másik axonja közötti szinaptikus kapcsolat
azbeszt
Hidrált, fibrosus szilikátokból készített termékek, melyeket amphibolokra és szerpentinekre osztunk. Oldhatatlan vegyületek, jó hőszigetelők, tűzre ellenállók, hőre nem változnak, nem korrodálnak. Részecskéinek belégzése asbestosist, tüdő- ill. mellhártyarákot okozhat. (gör: elolthatatlan, azon téves hiedelem alapján, hogy meggyújtva, illetve égetve nem lehet eloltani)
azeotrop
Két, vagy több folyadék keveréke, amelyet forralva nem változik az összetevők aránya sem a folyadék, sem a gőz fázisban.
azidotimidin (AZT)
ld: AZT
azo-
Prefixum, amely jelzi, hogy a molekulában =C-N=N-C= szerkezet található. Vö: diazo- (fr: azote, nitrogén)
azol
szinonima: pirrol
azoospermia
Élő spermatozoa nincsen jelen az ondóban károsodott spermatogenesis miatt. (gör: a-, fosztóképző + zoon, állat + sperma, mag)
azoprotein
Olyan módosult protein, amely a különböző aromás aminok diazónium származékával kezelve alakul ki. Antitestképzés végett állítják elő, az antitestek specificitásának igazolására.
azotaemia
szinonima: uraemia (azo- + gör: haima, vér)
azoturia
urea fokozott ürítése a vizeletben (azo- + gör: ouron, vizelet)
AZT
Azidotimidin rövidítése, timidin analóg, amely a HIV vírus replikációjának gátlását idézi elő in vitro, az AIDS kezelésére alkalmazzák.
azúr
Bázikus festékek egy csoportjának (pl. metil-tionin, fenotiazin) elnevezése, amelyeket biológiai festékként is alkalmaznak, főleg a vér és a sejtmagvak festésére.
azurezin
Az azúr A és a karbakril-rezin komplexe, indikátorként használják a gyomorban achlorhydria kimutatására.
azurophil
Azúr festékkel könnyen festődő, melyeket főleg hyperchromatin festésére és vörösbíbor granulumok kimutatására használnak egyes vérsejtekben. (azúr + gör: philos, szeret)
azygográfia
az azygos vénarendszer radiológiai kimutatása kontrasztanyag befecskendezésével
azygogram
radiográfiás kimutatása a vena azygos rendszernek kontrasztanyag befecskendezésével
azygos
1. páratlan 2. vena azygos (gör: a-, fosztóképző + zygon, járom)
Amennyiben nem találta meg a keresett kifejezést, jelezze a hiányt szerkesztőinknek:
A *-gal jelölt mezők kitöltése kötelező!

Orvosi szótár rovatunkban a gyakran használt latin-görög (kisebb részben angol) orvosi szavak, kifejezések szerepelnek. Magyar szavakat és kifejezéseket nem tárgyalunk
A helyesírást illetően: (csak néhány általános példa írásmódra: f=ph, i=y, k=c, ó=o, ú=u, , sz=s). A szavakat (különböző írásmódokat) érdemes megnézni beküldés előtt, az elütéseket, ha lehet, kérjük javítani.